Drug Information| Drug ID:   | NPD2023 |
| Drug Name:   | Cefotaxime Sodium |
| Molecular Formula:   | C16H17N5O7S2.Na |
| Canonical SMILES:   | CO/N=C(/c1csc(=N)[nH]1)C(=N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)O)COC(=O)C)[O-].[Na+] |
| Standard InCHI:   | "InChI=1S/C16H17N5O7S2.Na/c1-6(22)28-3-7-4-29-14-10(13(24)21(14)11(7)15(25)26)19-12(23)9(20-27-2)8-5-30-16(17)18-8;/h5,10,14H,3-4H2,1-2H3,(H2,17,18)(H,19,23)(H,25,26);/q;+1/p-1/b20-9-;/t10-,14-;/m1./s1" |
| Standard InCHIKey:   | AZZMGZXNTDTSME-JUZDKLSSSA-M |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD2023Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 454.05 |
| ALogP   | -1.3259 |
| MLogP   | 1.68 |
| XLogP   | 0.79 |
| HDA   | 10 |
| HBD   | 3 |
| Rotatable Bonds   | 12 |
| TPSA   | 227.4 |
| RO5 Violation   | 0 |