Drug Information| Drug ID:   | NPD1263 |
| Drug Name:   | Cefdinir |
| Molecular Formula:   | C14H13N5O5S2 |
| Canonical SMILES:   | OC(=N[C@H]1[C@H]2SCC(=C(N2C1=O)C(=O)O)C=C)/C(=NO)/c1csc(=N)[nH]1 |
| Standard InCHI:   | "InChI=1S/C14H13N5O5S2/c1-2-5-3-25-12-8(11(21)19(12)9(5)13(22)23)17-10(20)7(18-24)6-4-26-14(15)16-6/h2,4,8,12,24H,1,3H2,(H2,15,16)(H,17,20)(H,22,23)/b18-7-/t8-,12-/m1/s1" |
| Standard InCHIKey:   | RTXOFQZKPXMALH-GHXIOONMSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD1263Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.625 | NPC478434 |
| Remote Similarity | 0.5361 | NPC486882 |
| Remote Similarity | 0.5319 | NPC485036 |
| Remote Similarity | 0.5057 | NPC483027 |
| Remote Similarity | 0.5056 | NPC487962 |
| Molecular Weight   | 395.04 |
| ALogP   | 0.0645 |
| MLogP   | 1.68 |
| XLogP   | 1.421 |
| HDA   | 8 |
| HBD   | 5 |
| Rotatable Bonds   | 8 |
| TPSA   | 209.27 |
| RO5 Violation   | 0 |