Drug Information| Drug ID:   | NPD3291 |
| Drug Name:   | |
| Molecular Formula:   | C19H17N5O7S3 |
| Canonical SMILES:   | CO/N=C(/c1csc(=N)[nH]1)C(=N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)O)CSC(=O)c1ccco1)O |
| Standard InCHI:   | "InChI=1S/C19H17N5O7S3/c1-30-23-11(9-7-34-19(20)21-9)14(25)22-12-15(26)24-13(17(27)28)8(5-32-16(12)24)6-33-18(29)10-3-2-4-31-10/h2-4,7,12,16H,5-6H2,1H3,(H2,20,21)(H,22,25)(H,27,28)/b23-11-/t12-,16-/m1/s1" |
| Standard InCHIKey:   | ZBHXIWJRIFEVQY-IHMPYVIRSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD3291Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7531 | NPC478434 |
| Remote Similarity | 0.6263 | NPC486882 |
| Remote Similarity | 0.625 | NPC487961 |
| Remote Similarity | 0.587 | NPC487962 |
| Remote Similarity | 0.5714 | NPC483027 |
| Remote Similarity | 0.5446 | NPC485036 |
| Remote Similarity | 0.5222 | NPC487959 |
| TTD   | DNAP001590 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 6328657 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 523.03 |
| ALogP   | -0.2539 |
| MLogP   | 1.9 |
| XLogP   | 1.708 |
| HDA   | 9 |
| HBD   | 4 |
| Rotatable Bonds   | 12 |
| TPSA   | 253.78 |
| RO5 Violation   | 0 |