Drug Information| Drug ID:   | NPD2065 |
| Drug Name:   | E-1101 |
| Molecular Formula:   | C16H18N6O7S2 |
| Canonical SMILES:   | O/N=C(/c1csc(=N)[nH]1)C(=N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)O)COC(=O)N(C)C)O |
| Standard InCHI:   | "InChI=1S/C16H18N6O7S2/c1-21(2)16(27)29-3-6-4-30-13-9(12(24)22(13)10(6)14(25)26)19-11(23)8(20-28)7-5-31-15(17)18-7/h5,9,13,28H,3-4H2,1-2H3,(H2,17,18)(H,19,23)(H,25,26)/b20-8-/t9-,13-/m1/s1" |
| Standard InCHIKey:   | YVTOGZOMDXRYTD-DQBBSJBJSA-N |
| Max Developmental Stage:   | Discontinued |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD2065Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.75 | NPC478434 |
| Remote Similarity | 0.6145 | NPC483027 |
| Remote Similarity | 0.5354 | NPC486882 |
| Remote Similarity | 0.5312 | NPC485036 |
| Remote Similarity | 0.5059 | NPC487959 |
| Molecular Weight   | 470.07 |
| ALogP   | -0.5108 |
| MLogP   | 1.57 |
| XLogP   | 0.406 |
| HDA   | 11 |
| HBD   | 5 |
| Rotatable Bonds   | 13 |
| TPSA   | 238.81 |
| RO5 Violation   | 1 |