Drug Information| Drug ID:   | NPD3333 |
| Drug Name:   | |
| Molecular Formula:   | C19H18N6O5S3 |
| Canonical SMILES:   | CO/N=C(/c1csc(=N)[nH]1)C(=NC1C(=O)N2[C@@H]1SCC(=C2C(=O)O)/C=Cc1scnc1C)O |
| Standard InCHI:   | "InChI=1S/C19H18N6O5S3/c1-8-11(33-7-21-8)4-3-9-5-31-17-13(16(27)25(17)14(9)18(28)29)23-15(26)12(24-30-2)10-6-32-19(20)22-10/h3-4,6-7,13,17H,5H2,1-2H3,(H2,20,22)(H,23,26)(H,28,29)/b4-3-,24-12-/t13?,17-/m1/s1" |
| Standard InCHIKey:   | KMIPKYQIOVAHOP-JZYNXJEQSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD3333Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6517 | NPC478434 |
| Remote Similarity | 0.566 | NPC486882 |
| Remote Similarity | 0.5408 | NPC487962 |
| Remote Similarity | 0.5189 | NPC485036 |
| Remote Similarity | 0.5102 | NPC483027 |
| Molecular Weight   | 506.05 |
| ALogP   | 0.9194 |
| MLogP   | 2.01 |
| XLogP   | 2.226 |
| HDA   | 9 |
| HBD   | 4 |
| Rotatable Bonds   | 11 |
| TPSA   | 239.4 |
| RO5 Violation   | 0 |