Drug Information| Drug ID:   | NPD20 |
| Drug Name:   | Cefmenoxime Hydrochloride |
| Molecular Formula:   | 2C16H17N9O5S3.ClH |
| Canonical SMILES:   | CO/N=C(/c1csc(=N)[nH]1)C(=N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)O)CSc1nnnn1C)O.CO/N=C(/c1csc(=N)[nH]1)C(=N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)O)CSc1nnnn1C)O.Cl |
| Standard InCHI:   | "InChI=1S/2C16H17N9O5S3.ClH/c2*1-24-16(20-22-23-24)33-4-6-3-31-13-9(12(27)25(13)10(6)14(28)29)19-11(26)8(21-30-2)7-5-32-15(17)18-7;/h2*5,9,13H,3-4H2,1-2H3,(H2,17,18)(H,19,26)(H,28,29);1H/b2*21-8-;/t2*9-,13-;/m11./s1" |
| Standard InCHIKey:   | MPTNDTIREFCQLK-UNVJPQNDSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD20Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7083 | NPC486882 |
| Intermediate Similarity | 0.7059 | NPC478434 |
| Remote Similarity | 0.5521 | NPC487962 |
| Remote Similarity | 0.5368 | NPC483027 |
| Remote Similarity | 0.5288 | NPC485036 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 511.05 |
| ALogP   | 0.1392 |
| MLogP   | 1.35 |
| XLogP   | 0.801 |
| HDA   | 12 |
| HBD   | 4 |
| Rotatable Bonds   | 12 |
| TPSA   | 267.17 |
| RO5 Violation   | 1 |