Drug Information| Drug ID:   | NPD985 |
| Drug Name:   | Ceftizoxime |
| Molecular Formula:   | C13H13N5O5S2 |
| Canonical SMILES:   | CO/N=C(/c1csc(=N)[nH]1)C(=N[C@H]1[C@H]2SCC=C(N2C1=O)C(=O)O)O |
| Standard InCHI:   | "InChI=1S/C13H13N5O5S2/c1-23-17-7(5-4-25-13(14)15-5)9(19)16-8-10(20)18-6(12(21)22)2-3-24-11(8)18/h2,4,8,11H,3H2,1H3,(H2,14,15)(H,16,19)(H,21,22)/b17-7-/t8-,11-/m1/s1" |
| Standard InCHIKey:   | NNULBSISHYWZJU-LLKWHZGFSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD985Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7067 | NPC478434 |
| Remote Similarity | 0.6296 | NPC487962 |
| Remote Similarity | 0.5638 | NPC486882 |
| Remote Similarity | 0.5435 | NPC485036 |
| Remote Similarity | 0.5176 | NPC483027 |
| Molecular Weight   | 383.04 |
| ALogP   | -0.3829 |
| MLogP   | 1.57 |
| XLogP   | 1.236 |
| HDA   | 8 |
| HBD   | 4 |
| Rotatable Bonds   | 8 |
| TPSA   | 198.27 |
| RO5 Violation   | 0 |