Drug Information| Drug ID:   | NPD1665 |
| Drug Name:   | Cefpodoxime |
| Molecular Formula:   | C15H17N5O6S2 |
| Canonical SMILES:   | CO/N=C(/c1csc(=N)[nH]1)C(=N[C@H]1[C@H]2SCC(=C(N2C1=O)C(=O)O)COC)O |
| Standard InCHI:   | "InChI=1S/C15H17N5O6S2/c1-25-3-6-4-27-13-9(12(22)20(13)10(6)14(23)24)18-11(21)8(19-26-2)7-5-28-15(16)17-7/h5,9,13H,3-4H2,1-2H3,(H2,16,17)(H,18,21)(H,23,24)/b19-8-/t9-,13-/m1/s1" |
| Standard InCHIKey:   | WYUSVOMTXWRGEK-HBWVYFAYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD1665Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.8971 | NPC478434 |
| Remote Similarity | 0.6818 | NPC486882 |
| Remote Similarity | 0.6667 | NPC483027 |
| Remote Similarity | 0.6625 | NPC487962 |
| Remote Similarity | 0.625 | NPC485036 |
| Remote Similarity | 0.5663 | NPC487961 |
| TTD   | DAP000457 |
| DrugBank   | DB01416 |
| ChEMBL   | CHEMBL1672 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA164746385 |
| KEGG Drug   | |
| PubChem CID   | 6335986 |
| ChEBI   | 3504 |
| CAS Number   | 80210-62-4 |
| Molecular Weight   | 427.06 |
| ALogP   | -0.6187 |
| MLogP   | 1.68 |
| XLogP   | 0.569 |
| HDA   | 9 |
| HBD   | 4 |
| Rotatable Bonds   | 11 |
| TPSA   | 207.5 |
| RO5 Violation   | 0 |