Natural Product: NPC487961| Natural Product ID | NPC487961 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| JFPVXVDWJQMJEE-IZRZKJBUSA-N |
| IUPAC Name | n.a. |
| Synonyms | |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | n.a. |
| PubChem CID |
5479529 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | JFPVXVDWJQMJEE-IZRZKJBUSA-N |
| Standard InCHI | InChI=1S/C16H16N4O8S/c1-26-19-9(8-3-2-4-27-8)12(21)18-10-13(22)20-11(15(23)24)7(5-28-16(17)25)6-29-14(10)20/h2-4,10,14H,5-6H2,1H3,(H2,17,25)(H,18,21)(H,23,24)/b19-9-/t10-,14-/m1/s1 |
| SMILES | CO/N=C(/c1ccco1)C(=N[C@@H]1C(=O)N2C(=C(COC(=N)O)CS[C@H]12)C(=O)O)O |
  Calculated Properties| Molecular Weight:   | 424.07 | Volume:   | 371.349 Van der Waals volume.
|
| Dense:   | 1.142 | LogP:   | 0.524 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 0.965 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -2.202 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 8.0 | Rigid Bonds:   | 19.0 |
| TPSA:   | 178.24 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 12.0 |
| H-Bond Donor:   | 4.0 | Rings:   | 3.0 |
| Heavy Atoms:   | 13.0 |
| QED Drug-Likeness Score:   | 0.212 | GASA:   | 1.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 4.355 | Fsp3:   | 0.312 |
| MCE-18:   | 65.714 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Rejected |
| Pfizer Rule:   | Rejected | GSK Rule:   | Accepted |
| Golden Triangle Rule:   | Rejected | BMS Rule:   | 1 |
| Chelating Alert:   | 0 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.413 | Fluc inhibitor:   | 0.014 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.097 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.115 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.056 | Promiscuous compounds:   | 0.234 |
| Caco-2 Permeability:   | -6.206 | MDCK Permeability:   | -5.433 |
| Pgp-inhibitor:   | 0.85 | Pgp-substrate:   | 0.962 |
| PAMPA:   |
0.843 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.953 |
| 20% Bioavailability (F20%):   | 0.997 | 30% Bioavailability (F30%):   | 0.998 |
| 50% Bioavailability (F50%):   | 0.996 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.0 | MRP1:   | 0.161 |
| Plasma Protein Binding (PPB):   | 43.271% | Volume Distribution (VD):   | -0.669 |
| Fu: |
51.72% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.568 |
| OATP1B3 inhibitor:   | 0.993 | BCRP inhibitor:   | 0.003 |
| BSEP inhibitor:   | 0.683 |
| CYP1A2-inhibitor:   | 0.0 | CYP1A2-substrate:   | 0.0 |
| CYP2C19-inhibitor:   | 0.0 | CYP2C19-substrate:   | 0.0 |
| CYP2C9-inhibitor:   | 0.992 | CYP2C9-substrate:   | 0.0 |
| CYP2D6-inhibitor:   | 0.006 | CYP2D6-substrate:   | 0.0 |
| CYP3A4-inhibitor:   | 0.017 | CYP3A4-substrate:   | 0.0 |
| CYP2B6-substrate:   | 0.0 | CYP2C8-inhibitor:   | 0.011 |
| HLM stability:   |
0.004 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 1.203 | Half-life (T1/2):   | 1.604 |
| hERG Blockers:   | 0.013 | hERG Blockers (10um):   | 0.01 |
| Human Hepatotoxicity (H-HT):   | 0.996 | Drug-induced Liver Injury (DILI):   | 1.0 |
| AMES Toxicity:   | 0.346 | Rat Oral Acute Toxicity:   | 0.093 |
| Maximum Recommended Daily Dose:   | 0.001 | Skin Sensitization:   | 1.0 |
| Carcinogencity:   | 0.606 | Eye Corrosion:   | 0.0 |
| Eye Irritation:   | 0.363 | Respiratory Toxicity:   | 0.306 |
| Drug-induced Neurotoxicity:   | 0.0 | Ototoxicity:   | 0.895 |
| Hematotoxicity:   | 0.616 | Drug-induced Nephrotoxicity:   | 0.998 |
| Genotoxicity:   | 1.0 | RPMI-8226 Immunitoxicity:   | 0.005 |
| A549 Cytotoxicity:   | 0.001 | Hek293 Cytotoxicity:   | 0.004 |
| BCF:   |
0.318 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
2.767 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
4.175 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
3.645 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO40573 | Chryseobacterium indologenes 597 | Strain | n.a. | Bacteria | n.a. | n.a. | n.a. |
PMID[19651915] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT1237 | Individual protein | Oligopeptide transporter small intestine isoform | Homo sapiens | Ki | = | 26000000.0 | nM | PMID[15974593] |
| NPT1037 | Individual protein | Solute carrier family 15 member 2 | Homo sapiens | Ki | = | 12600000.0 | nM | PMID[21741846] |
| NPT1037 | Individual protein | Solute carrier family 15 member 2 | Homo sapiens | Ki | = | 12589254.12 | nM | PMID[21741846] |
| NPT1241 | Individual protein | Oligopeptide transporter, kidney isoform | Rattus norvegicus | Ki | > | 3000.0 | nM | PMID[15567297] |
| NPT1237 | Individual protein | Oligopeptide transporter small intestine isoform | Homo sapiens | Ki | > | 5000000.0 | nM | PMID[15567297] |
| NPT1241 | Individual protein | Oligopeptide transporter, kidney isoform | Rattus norvegicus | Ki | = | 12600000.0 | nM | PMID[15567297] |
| NPT1237 | Individual protein | Oligopeptide transporter small intestine isoform | Homo sapiens | Ki | = | 26000000.0 | nM | PMID[15567297] |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT243 | Individual protein | Dopamine D2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT217 | Individual protein | Adenosine A2a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1788 | Individual protein | Alpha-1a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1464 | Individual protein | Phosphodiesterase 4D | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1410 | Individual protein | GABA receptor alpha-1 subunit | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT272 | Individual protein | Kappa opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1647 | Individual protein | Vasopressin V2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT271 | Individual protein | Delta opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT252 | Individual protein | Histamine H2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT216 | Individual protein | Adenosine A1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1163 | Individual protein | Glutamate (NMDA) receptor subunit zeta 1 | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT264 | Individual protein | Muscarinic acetylcholine receptor M3 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT267 | Individual protein | Neuropeptide Y receptor type 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2879 | Individual protein | Equilibrative nucleoside transporter 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT230 | Individual protein | Bradykinin B2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT239 | Individual protein | Cholecystokinin A receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT251 | Individual protein | Histamine H1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT247 | Individual protein | Endothelin receptor ET-A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT303 | Individual protein | Vasopressin V1a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5575 | Individual protein | Gil1 | Citrobacter gillenii | Ratio | = | 0.4 | n.a. | PMID[17242148] |
| NPT26363 | Single protein | Penicillin-binding protein 2x | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.004 | ug.mL-1 | PMID[19237649] |
| NPT26363 | Single protein | Penicillin-binding protein 2x | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.003 | ug.mL-1 | PMID[19237649] |
| NPT26363 | Single protein | Penicillin-binding protein 2x | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.02 | ug.mL-1 | PMID[19237649] |
| NPT26363 | Single protein | Penicillin-binding protein 2x | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.014 | ug.mL-1 | PMID[19237649] |
| NPT26363 | Single protein | Penicillin-binding protein 2x | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.00004 | ug.mL-1 | PMID[19237649] |
| NPT26363 | Single protein | Penicillin-binding protein 2x | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.002 | ug.mL-1 | PMID[19237649] |
| NPT26363 | Single protein | Penicillin-binding protein 2x | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.006 | ug.mL-1 | PMID[19237649] |
| NPT14749 | Single protein | Penicillin-binding protein 2B | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.038 | ug.mL-1 | PMID[19237649] |
| NPT14749 | Single protein | Penicillin-binding protein 2B | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.0005 | ug.mL-1 | PMID[19237649] |
| NPT14749 | Single protein | Penicillin-binding protein 2B | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 2.646 | ug.mL-1 | PMID[19237649] |
| NPT14749 | Single protein | Penicillin-binding protein 2B | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.472 | ug.mL-1 | PMID[19237649] |
| NPT14749 | Single protein | Penicillin-binding protein 2B | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.023 | ug.mL-1 | PMID[19237649] |
| NPT14749 | Single protein | Penicillin-binding protein 2B | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 14.74 | ug.mL-1 | PMID[19237649] |
| NPT14749 | Single protein | Penicillin-binding protein 2B | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 1.656 | ug.mL-1 | PMID[19237649] |
| NPT14749 | Single protein | Penicillin-binding protein 2B | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.171 | ug.mL-1 | PMID[19237649] |
| NPT14749 | Single protein | Penicillin-binding protein 2B | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 1.164 | ug.mL-1 | PMID[19237649] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | AC50 | > | 300000.0 | nM | PMID[37468498] |
| NPT5301 | Individual protein | Motilin receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT987 | Individual protein | Histamine H3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 3.14 | % | DOI[10.6019/CHEMBL4495564] |
| NPT4358 | Individual protein | Type-1 angiotensin II receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT29430 | Single protein | Neuronal acetylcholine receptor protein alpha-4 subunit | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT4729 | Individual protein | Cholecystokinin B receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT98 | Individual protein | HERG | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT99 | Individual protein | Peroxisome proliferator-activated receptor gamma | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | AC50 | = | 3900.0 | nM | PMID[37468498] |
| NPT14748 | Single protein | Penicillin-binding protein 1A | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.004 | ug.mL-1 | PMID[19237649] |
| NPT14748 | Single protein | Penicillin-binding protein 1A | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.001 | ug.mL-1 | PMID[19237649] |
| NPT14748 | Single protein | Penicillin-binding protein 1A | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.006 | ug.mL-1 | PMID[19237649] |
| NPT14748 | Single protein | Penicillin-binding protein 1A | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.008 | ug.mL-1 | PMID[19237649] |
| NPT14748 | Single protein | Penicillin-binding protein 1A | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.002 | ug.mL-1 | PMID[19237649] |
| NPT14748 | Single protein | Penicillin-binding protein 1A | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.01 | ug.mL-1 | PMID[19237649] |
| NPT14748 | Single protein | Penicillin-binding protein 1A | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.164 | ug.mL-1 | PMID[19237649] |
| NPT14802 | Single protein | Extended spectrum beta-lactamase CTX-M-71 | Klebsiella pneumoniae | Ratio | = | 0.1 | n.a. | PMID[19620330] |
| NPT28814 | Single protein | Ghrelin receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT92 | Individual protein | Serotonin 1a (5-HT1a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT29454 | Single protein | Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 | Homo sapiens | Inhibition | = | -10.74 | % | PMID[38318365] |
| NPT5104 | Individual protein | Phosphodiesterase 3A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5975 | Individual protein | Cyclooxygenase-1 | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5577 | Individual protein | Beta-lactamase | Bacillus clausii | Activity | = | 2.0 | n.a. | PMID[17846134] |
| NPT6272 | Individual protein | PER-2 beta-lactamase | Citrobacter freundii | Activity | = | 45.0 | % | PMID[17438050] |
| NPT18177 | Single protein | Catechol 2,3-dioxygenase | Stenotrophomonas maltophilia | Activity | = | 4.0 | U/min | PMID[20385866] |
| NPT18177 | Single protein | Catechol 2,3-dioxygenase | Stenotrophomonas maltophilia | Activity | = | 39.0 | U/min | PMID[20385866] |
| NPT18177 | Single protein | Catechol 2,3-dioxygenase | Stenotrophomonas maltophilia | Activity | = | 41.0 | U/min | PMID[20385866] |
| NPT18177 | Single protein | Catechol 2,3-dioxygenase | Stenotrophomonas maltophilia | Activity | = | 5.0 | U/min | PMID[20385866] |
| NPT18177 | Single protein | Catechol 2,3-dioxygenase | Stenotrophomonas maltophilia | Activity | = | 0.0 | U/min | PMID[20385866] |
| NPT18177 | Single protein | Catechol 2,3-dioxygenase | Stenotrophomonas maltophilia | Activity | = | 6.0 | U/min | PMID[20385866] |
| NPT18177 | Single protein | Catechol 2,3-dioxygenase | Stenotrophomonas maltophilia | Activity | = | 50.0 | U/min | PMID[20385866] |
| NPT18177 | Single protein | Catechol 2,3-dioxygenase | Stenotrophomonas maltophilia | Activity | = | 45.0 | U/min | PMID[20385866] |
| NPT18177 | Single protein | Catechol 2,3-dioxygenase | Stenotrophomonas maltophilia | Activity | = | 8.0 | U/min | PMID[20385866] |
| NPT14803 | Single protein | Beta-lactamase AH27 CTX-M-15 | Klebsiella pneumoniae | Ratio | = | 0.25 | n.a. | PMID[19620330] |
| NPT543 | Individual protein | Pregnane X receptor | Homo sapiens | AC50 | = | 6100.0 | nM | PMID[37468498] |
| NPT425 | Individual protein | Serotonin 3a (5-HT3a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT543 | Individual protein | Pregnane X receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30151 | Single protein | Melanocortin receptor 3 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT543 | Individual protein | Pregnane X receptor | Homo sapiens | AC50 | = | 12999.9 | nM | PMID[37468498] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT857 | Cell line | LLC-PK1 | Sus scrofa | Ratio | = | 2.0 | n.a. | PMID[24397738] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.06 | ug.mL-1 | PMID[10230635] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.25 | ug.mL-1 | PMID[10230635] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 32.0 | ug.mL-1 | PMID[10230635] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 16.0 | ug.mL-1 | PMID[10230635] |
| NPT2916 | Organism | Klebsiella | Klebsiella | MIC | = | 3.71 | ug.mL-1 | PMID[3572964] |
| NPT2921 | Organism | Pseudomonas | Pseudomonas | MIC | > | 100.0 | ug.mL-1 | PMID[3572964] |
| NPT14695 | Organism | Neisseria perflava | Neisseria perflava | MIC | = | 0.39 | ug.mL-1 | PMID[3572964] |
| NPT174 | Organism | Streptococcus | Streptococcus | MIC | = | 15.14 | ug.mL-1 | PMID[3572964] |
| NPT6381 | Organism | Sarcina | Sarcina | MIC | = | 0.39 | ug.mL-1 | PMID[3572964] |
| NPT2916 | Organism | Klebsiella | Klebsiella | MBC | = | 4.68 | ug ml-1 | PMID[3572964] |
| NPT2921 | Organism | Pseudomonas | Pseudomonas | MBC | > | 100.0 | ug ml-1 | PMID[3572964] |
| NPT14695 | Organism | Neisseria perflava | Neisseria perflava | MBC | = | 0.78 | ug ml-1 | PMID[3572964] |
| NPT174 | Organism | Streptococcus | Streptococcus | MBC | = | 59.46 | ug ml-1 | PMID[3572964] |
| NPT6381 | Organism | Sarcina | Sarcina | MBC | = | 0.55 | ug ml-1 | PMID[3572964] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | ED50 | > | 90.0 | mg.kg-1 | PMID[3572964] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | = | 1.56 | ug.mL-1 | PMID[3572964] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | = | 256.0 | ug.mL-1 | PMID[17116662] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | <= | 0.016 | ug.mL-1 | PMID[17116666] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[17116666] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.125 | ug.mL-1 | PMID[17116666] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.5 | ug.mL-1 | PMID[17116666] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.25 | ug.mL-1 | PMID[17116666] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 2.0 | ug.mL-1 | PMID[17116666] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 16.0 | ug.mL-1 | PMID[17116666] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 1.0 | ug.mL-1 | PMID[17116681] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 8.0 | ug.mL-1 | PMID[17116681] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 0.5 | ug.mL-1 | PMID[17116681] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 256.0 | ug.mL-1 | PMID[17116681] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 1.0 | ug.mL-1 | PMID[17116681] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 0.5 | ug.mL-1 | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 1.0 | ug.mL-1 | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.25 | ug.mL-1 | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 1.0 | ug.mL-1 | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.5 | ug.mL-1 | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 2.0 | ug.mL-1 | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 4.0 | ug.mL-1 | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | <= | 0.12 | ug.mL-1 | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 2.0 | ug.mL-1 | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 0.0 | % | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 100.0 | % | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 2.0 | % | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 98.0 | % | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 4.0 | ug.mL-1 | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 8.0 | ug.mL-1 | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | >= | 2.0 | ug.mL-1 | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | >= | 0.12 | ug.mL-1 | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | >= | 0.5 | ug.mL-1 | PMID[17470649] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.5 | ug.mL-1 | PMID[17606681] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | <= | 0.12 | ug.mL-1 | PMID[17606689] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | >= | 4.0 | ug.mL-1 | PMID[17606689] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | <= | 0.12 | ug.mL-1 | PMID[17606689] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.5 | ug.mL-1 | PMID[17606689] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | > | 4.0 | ug.mL-1 | PMID[17606689] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | <= | 0.12 | ug.mL-1 | PMID[17606689] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 4.0 | ug.mL-1 | PMID[17606689] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | > | 4.0 | ug.mL-1 | PMID[17606689] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | = | 48.0 | ug.mL-1 | PMID[17638702] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | > | 256.0 | ug.mL-1 | PMID[17638702] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 1.0 | ug.mL-1 | PMID[17698631] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 2.0 | ug.mL-1 | PMID[17698631] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 64.0 | ug.mL-1 | PMID[17698631] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 2.0 | ug.mL-1 | PMID[17698631] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 16.0 | ug.mL-1 | PMID[17698631] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 128.0 | ug.mL-1 | PMID[17698631] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 97.7 | % | PMID[17698631] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 66.3 | % | PMID[17698631] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 1.4 | % | PMID[17698631] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 1.2 | % | PMID[17698631] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 21.4 | % | PMID[17698631] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 94.6 | % | PMID[17698631] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 78.2 | % | PMID[17908940] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 99.9 | % | PMID[17908940] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 74.0 | % | PMID[17908940] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 0.0 | % | PMID[17908940] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 18.7 | % | PMID[17908940] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 12.7 | % | PMID[17908940] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 99.2 | % | PMID[17908940] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | <= | 0.5 | ug.mL-1 | PMID[17908940] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 8.0 | ug.mL-1 | PMID[17908940] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 8.0 | ug.mL-1 | PMID[17908940] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | <= | 0.5 | ug.mL-1 | PMID[17908940] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 4.0 | ug.mL-1 | PMID[17908940] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 16.0 | ug.mL-1 | PMID[17908940] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 1.0 | ug.mL-1 | PMID[17908940] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 2.0 | ug.mL-1 | PMID[17908940] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 97.6 | % | PMID[17908940] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 96.3 | % | PMID[17908940] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 98.0 | % | PMID[17908940] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 0.3 | % | PMID[17908940] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 0.7 | % | PMID[17908940] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 0.2 | % | PMID[17908940] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC | > | 16.0 | ug.mL-1 | PMID[18025117] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 13.3 | ug.mL-1 | PMID[19884366] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 2.0 | ug.mL-1 | PMID[19884366] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 8.0 | ug.mL-1 | PMID[19884366] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 8.0 | ug.mL-1 | PMID[19884366] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 16.0 | ug.mL-1 | PMID[19884366] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 32.0 | ug.mL-1 | PMID[19884366] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 9.3 | ug.mL-1 | PMID[19884366] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 6.0 | ug.mL-1 | PMID[19884366] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 11.4 | ug.mL-1 | PMID[19884366] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 2.0 | ug.mL-1 | PMID[19884366] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 32.0 | ug.mL-1 | PMID[19884366] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 6.5 | ug.mL-1 | PMID[19884366] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 4.0 | ug.mL-1 | PMID[19884366] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 8.0 | ug.mL-1 | PMID[19884366] |
| NPT1190 | Organism | Salmonella enterica | Salmonella enterica | MIC | > | 32.0 | ug.mL-1 | PMID[19901088] |
| NPT2895 | Organism | Providencia stuartii | Providencia stuartii | MIC | = | 1024.0 | ug.mL-1 | PMID[19901092] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.25 | ug.mL-1 | PMID[18160523] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.12 | ug.mL-1 | PMID[18160523] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 2.0 | ug.mL-1 | PMID[18160523] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 32.0 | ug.mL-1 | PMID[18160523] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 8.0 | ug.mL-1 | PMID[18160523] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | > | 32.0 | ug.mL-1 | PMID[18160523] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 16.0 | ug.mL-1 | PMID[18160523] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 4.0 | ug.mL-1 | PMID[18160523] |
| NPT4805 | Organism | Rhodococcus equi | Rhodococcus equi | MIC50 | = | 8.0 | ug.mL-1 | PMID[18227183] |
| NPT4805 | Organism | Rhodococcus equi | Rhodococcus equi | MIC90 | = | 16.0 | ug.mL-1 | PMID[18227183] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.5 | ug.mL-1 | PMID[18347113] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 2.0 | ug.mL-1 | PMID[18347113] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.03 | ug.mL-1 | PMID[18362189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 0.12 | ug.mL-1 | PMID[18362189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.25 | ug.mL-1 | PMID[18362189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.5 | ug.mL-1 | PMID[18362189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 0.5 | ug.mL-1 | PMID[18362189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 2.0 | ug.mL-1 | PMID[18362189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 4.0 | ug.mL-1 | PMID[18362189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 4.0 | ug.mL-1 | PMID[18362189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 8.0 | ug.mL-1 | PMID[18362189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 16.0 | ug.mL-1 | PMID[18362189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | > | 0.016 | ug.mL-1 | PMID[18362189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.016 | ug.mL-1 | PMID[18362189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[18362189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | > | 1.0 | ug.mL-1 | PMID[18362189] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.5 | ug.mL-1 | PMID[20086141] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 4.0 | ug.mL-1 | PMID[20086141] |
| NPT3988 | Organism | Corynebacterium minutissimum | Corynebacterium minutissimum | MIC | = | 0.25 | ug.mL-1 | PMID[18227183] |
| NPT4805 | Organism | Rhodococcus equi | Rhodococcus equi | MIC | = | 0.25 | ug.mL-1 | PMID[18227183] |
| NPT3988 | Organism | Corynebacterium minutissimum | Corynebacterium minutissimum | MIC50 | = | 0.5 | ug.mL-1 | PMID[18227183] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 1.0 | ug.mL-1 | PMID[18955529] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 8.0 | ug.mL-1 | PMID[18955529] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 20.0 | % | PMID[18955529] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 2.0 | ug.mL-1 | PMID[18955529] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 19.0 | % | PMID[18955529] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 4.0 | ug.mL-1 | PMID[18955529] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 16.0 | ug.mL-1 | PMID[18955529] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 48.8 | % | PMID[18955529] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 45.4 | % | PMID[18955529] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 99.3 | % | PMID[20439616] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 5.5 | % | PMID[20439616] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 83.8 | % | PMID[20439616] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 1.0 | ug.mL-1 | PMID[20439616] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | <= | 0.015 | ug.mL-1 | PMID[20439616] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 94.5 | % | PMID[20439616] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 1.3 | % | PMID[20439616] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 0.5 | ug.mL-1 | PMID[20439616] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 1.0 | ug.mL-1 | PMID[20439616] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 99.3 | % | PMID[20439616] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 0.1 | % | PMID[20439616] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 91.4 | % | PMID[20439616] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 0.0 | % | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.25 | ug.mL-1 | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 4.0 | ug.mL-1 | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 8.0 | ug.mL-1 | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 8.0 | ug.mL-1 | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 16.0 | ug.mL-1 | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 16.0 | ug.mL-1 | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 26.8 | % | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 55.3 | % | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | >= | 32.0 | ug.mL-1 | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 31.6 | % | PMID[18725443] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC | > | 512.0 | ug.mL-1 | PMID[18765691] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | = | 4.0 | ug.mL-1 | PMID[18519732] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 2.0 | % | PMID[18443122] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 17.0 | % | PMID[18443122] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 1.0 | ug.mL-1 | PMID[18443122] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | > | 4.0 | ug.mL-1 | PMID[18443122] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | > | 4.0 | ug.mL-1 | PMID[18443122] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.5 | ug.mL-1 | PMID[18443122] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 2.0 | ug.mL-1 | PMID[18443122] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 4.0 | ug.mL-1 | PMID[18443122] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.016 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.125 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 2.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 4.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 1.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 16.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.5 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 8.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.25 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 64.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 32.0 | ug.mL-1 | PMID[19307366] |
| NPT5768 | Organism | Acinetobacter pittii | Acinetobacter pittii | MIC | = | 16.0 | ug.mL-1 | PMID[19029333] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.03 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.25 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 4.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 0.125 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 4.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 16.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 8.0 | ug.mL-1 | PMID[19307366] |
| NPT5768 | Organism | Acinetobacter pittii | Acinetobacter pittii | MIC | = | 24.0 | ug.mL-1 | PMID[19029333] |
| NPT5768 | Organism | Acinetobacter pittii | Acinetobacter pittii | MIC | = | 32.0 | ug.mL-1 | PMID[19029333] |
| NPT5768 | Organism | Acinetobacter pittii | Acinetobacter pittii | MIC | = | 48.0 | ug.mL-1 | PMID[19029333] |
| NPT5768 | Organism | Acinetobacter pittii | Acinetobacter pittii | MIC | = | 64.0 | ug.mL-1 | PMID[19029333] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 8.0 | ug.mL-1 | PMID[19237649] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 4.0 | ug.mL-1 | PMID[19237649] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 16.0 | ug.mL-1 | PMID[19237649] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 2.0 | ug.mL-1 | PMID[19237649] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.125 | ug.mL-1 | PMID[19237649] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.25 | ug.mL-1 | PMID[19237649] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[19237649] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC | = | 4.0 | ug.mL-1 | PMID[19258263] |
| NPT4074 | Tissue | Serum | Homo sapiens | Activity | = | 30.0 | % | PMID[19223616] |
| NPT2910 | Organism | Campylobacter jejuni | Campylobacter jejuni | MIC | = | 128.0 | ug.mL-1 | PMID[19506058] |
| NPT2910 | Organism | Campylobacter jejuni | Campylobacter jejuni | MIC | = | 64.0 | ug.mL-1 | PMID[19506058] |
| NPT2910 | Organism | Campylobacter jejuni | Campylobacter jejuni | MIC | = | 256.0 | ug.mL-1 | PMID[19506058] |
| NPT2910 | Organism | Campylobacter jejuni | Campylobacter jejuni | MIC50 | = | 128.0 | ug.mL-1 | PMID[19506058] |
| NPT2910 | Organism | Campylobacter jejuni | Campylobacter jejuni | MIC90 | = | 128.0 | ug.mL-1 | PMID[19506058] |
| NPT2910 | Organism | Campylobacter jejuni | Campylobacter jejuni | MIC | = | 1.0 | ug.mL-1 | PMID[19506058] |
| NPT2910 | Organism | Campylobacter jejuni | Campylobacter jejuni | MIC | = | 32.0 | ug.mL-1 | PMID[19506058] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 36.1 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 2.0 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 4.0 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 4.0 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 8.0 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | <= | 1.0 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | <= | 1.0 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | <= | 1.0 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | > | 8.0 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | > | 2.0 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 100.0 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 9.6 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 95.2 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 47.5 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 0.0 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 91.4 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 96.4 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 96.8 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 20.7 | % | PMID[20308374] |
| NPT4276 | Organism | Yersinia enterocolitica | Yersinia enterocolitica | MIC | = | 0.75 | ug.mL-1 | PMID[20547799] |
| NPT4276 | Organism | Yersinia enterocolitica | Yersinia enterocolitica | MIC | = | 0.5 | ug.mL-1 | PMID[20547799] |
| NPT729 | Organism | Micrococcus luteus | Micrococcus luteus | MIC | = | 0.98 | ug.mL-1 | PMID[22100136] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.5 | ug.mL-1 | PMID[22444877] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.5 | ug.mL-1 | PMID[22731783] |
| NPT729 | Organism | Micrococcus luteus | Micrococcus luteus | MIC | = | 0.98 | ug.mL-1 | PMID[23543889] |
| NPT729 | Organism | Micrococcus luteus | Micrococcus luteus | MIC | = | 0.49 | ug.mL-1 | PMID[23710121] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.5 | ug.mL-1 | PMID[24953950] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 0.18 | % | DOI[10.6019/CHEMBL4495565] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 20000.0 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 19952.62 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC | = | 0.06 | ug.mL-1 | PMID[10230635] |
| NPT1246 | Organism | Salmonella | Salmonella | MIC | = | 3.12 | ug.mL-1 | PMID[3572964] |
| NPT3496 | Organism | Enterobacter | Enterobacter | MIC | = | 7.01 | ug.mL-1 | PMID[3572964] |
| NPT1246 | Organism | Salmonella | Salmonella | MBC | = | 6.7 | ug ml-1 | PMID[3572964] |
| NPT3496 | Organism | Enterobacter | Enterobacter | MBC | = | 25.0 | ug ml-1 | PMID[3572964] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | ED50 | = | 9.0 | mg.kg-1 | PMID[3572964] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 12.5 | ug.mL-1 | PMID[3572964] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC | = | 0.0313 | ug.mL-1 | PMID[17060524] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 2.0 | ug.mL-1 | PMID[17242148] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | > | 512.0 | ug.mL-1 | PMID[17420213] |
| NPT14707 | Organism | Bacillus clausii | Bacillus clausii | MIC | = | 128000.0 | ug.mL-1 | PMID[17846134] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | = | 16000.0 | ug.mL-1 | PMID[17846134] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | = | 8000.0 | ug.mL-1 | PMID[17846134] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | Activity | = | 46.9 | % | PMID[17452479] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | Activity | = | 21.9 | % | PMID[17452479] |
| NPT1252 | Organism | Streptococcus sp. 'group A' | Streptococcus sp. 'group A' | MIC | <= | 0.12 | ug.mL-1 | PMID[17606689] |
| NPT1252 | Organism | Streptococcus sp. 'group A' | Streptococcus sp. 'group A' | MIC50 | <= | 0.12 | ug.mL-1 | PMID[17606689] |
| NPT1252 | Organism | Streptococcus sp. 'group A' | Streptococcus sp. 'group A' | MIC90 | <= | 0.12 | ug.mL-1 | PMID[17606689] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 1024.0 | ug.mL-1 | PMID[19901092] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 512.0 | ug.mL-1 | PMID[19917750] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | MIC50 | > | 32.0 | ug.mL-1 | PMID[18227183] |
| NPT5306 | Organism | Corynebacterium amycolatum | Corynebacterium amycolatum | MIC90 | = | 2.0 | ug.mL-1 | PMID[18227183] |
| NPT5305 | Organism | Corynebacterium jeikeium | Corynebacterium jeikeium | MIC90 | > | 32.0 | ug.mL-1 | PMID[18227183] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC90 | = | 0.25 | ug.mL-1 | PMID[18227183] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | MIC90 | > | 32.0 | ug.mL-1 | PMID[18227183] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 2.0 | ug.mL-1 | PMID[18316518] |
| NPT1252 | Organism | Streptococcus sp. 'group A' | Streptococcus sp. 'group A' | MIC50 | = | 0.016 | ug.mL-1 | PMID[18362189] |
| NPT1252 | Organism | Streptococcus sp. 'group A' | Streptococcus sp. 'group A' | MIC90 | = | 0.016 | ug.mL-1 | PMID[18362189] |
| NPT1252 | Organism | Streptococcus sp. 'group A' | Streptococcus sp. 'group A' | MIC90 | = | 0.03 | ug.mL-1 | PMID[18362189] |
| NPT1252 | Organism | Streptococcus sp. 'group A' | Streptococcus sp. 'group A' | MIC | = | 0.016 | ug.mL-1 | PMID[18362189] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 64.0 | ug.mL-1 | PMID[18362192] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | > | 64.0 | ug.mL-1 | PMID[18362192] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | >= | 64.0 | ug.mL-1 | PMID[18426899] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 1.0 | ug.mL-1 | PMID[18268083] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.25 | ug.mL-1 | PMID[18268083] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 4.0 | ug.mL-1 | PMID[18268083] |
| NPT5306 | Organism | Corynebacterium amycolatum | Corynebacterium amycolatum | MIC | = | 0.125 | ug.mL-1 | PMID[18227183] |
| NPT5305 | Organism | Corynebacterium jeikeium | Corynebacterium jeikeium | MIC | = | 2.0 | ug.mL-1 | PMID[18227183] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.06 | ug.mL-1 | PMID[18227183] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | MIC | = | 4.0 | ug.mL-1 | PMID[18227183] |
| NPT5306 | Organism | Corynebacterium amycolatum | Corynebacterium amycolatum | MIC50 | = | 0.5 | ug.mL-1 | PMID[18227183] |
| NPT5305 | Organism | Corynebacterium jeikeium | Corynebacterium jeikeium | MIC50 | > | 32.0 | ug.mL-1 | PMID[18227183] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC50 | = | 0.125 | ug.mL-1 | PMID[18227183] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.5 | ug.mL-1 | PMID[20308380] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 64.0 | ug.mL-1 | PMID[20308380] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC90 | <= | 0.015 | ug.mL-1 | PMID[20439616] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC50 | <= | 0.015 | ug.mL-1 | PMID[20439616] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | = | 2.0 | ug.mL-1 | PMID[18765691] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | > | 512.0 | ug.mL-1 | PMID[18765691] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | >= | 64.0 | ug.mL-1 | PMID[20516281] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 16.0 | ug.mL-1 | PMID[20516281] |
| NPT6599 | Organism | Pectobacterium atrosepticum | Pectobacterium atrosepticum | MIC | = | 0.5 | ug.mL-1 | PMID[18443127] |
| NPT4066 | Organism | Streptococcus mitis | Streptococcus mitis | MIC | <= | 0.12 | ug.mL-1 | PMID[18443122] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | MIC90 | <= | 0.12 | ug.mL-1 | PMID[18443122] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | MIC50 | <= | 0.12 | ug.mL-1 | PMID[18443122] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | MIC | <= | 0.12 | ug.mL-1 | PMID[18443122] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC90 | = | 0.25 | ug.mL-1 | PMID[18443122] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC50 | <= | 0.12 | ug.mL-1 | PMID[18443122] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC | <= | 0.12 | ug.mL-1 | PMID[18443122] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | > | 256.0 | ug.mL-1 | PMID[19104021] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 256.0 | ug.mL-1 | PMID[19104021] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.125 | ug.mL-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.25 | ug.mL-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.5 | ug.mL-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC90 | = | 0.25 | ug.mL-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MBC | > | 8.0 | ug ml-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MBC | = | 8.0 | ug ml-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MBC | = | 2.0 | ug ml-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MBC | = | 4.0 | ug ml-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MBC90 | > | 8.0 | ug ml-1 | PMID[19075048] |
| NPT4077 | Organism | Escherichia coli DH5[alpha] | Escherichia coli DH5[alpha] | MIC | = | 0.25 | ug.mL-1 | PMID[19075050] |
| NPT4077 | Organism | Escherichia coli DH5[alpha] | Escherichia coli DH5[alpha] | MIC | <= | 0.125 | ug.mL-1 | PMID[19075050] |
| NPT4077 | Organism | Escherichia coli DH5[alpha] | Escherichia coli DH5[alpha] | MIC | = | 128.0 | ug.mL-1 | PMID[19075050] |
| NPT4077 | Organism | Escherichia coli DH5[alpha] | Escherichia coli DH5[alpha] | MIC | = | 64.0 | ug.mL-1 | PMID[19075050] |
| NPT5751 | Organism | Burkholderia cenocepacia | Burkholderia cenocepacia | MIC | = | 16.0 | ug.mL-1 | PMID[19075063] |
| NPT5751 | Organism | Burkholderia cenocepacia | Burkholderia cenocepacia | MIC | = | 512.0 | ug.mL-1 | PMID[19075063] |
| NPT5751 | Organism | Burkholderia cenocepacia | Burkholderia cenocepacia | MIC | = | 32.0 | ug.mL-1 | PMID[19075063] |
| NPT4077 | Organism | Escherichia coli DH5[alpha] | Escherichia coli DH5[alpha] | MIC | = | 1.5 | ug.mL-1 | PMID[19029333] |
| NPT4077 | Organism | Escherichia coli DH5[alpha] | Escherichia coli DH5[alpha] | MIC | = | 4.0 | ug.mL-1 | PMID[19029333] |
| NPT4077 | Organism | Escherichia coli DH5[alpha] | Escherichia coli DH5[alpha] | MIC | = | 32.0 | ug.mL-1 | PMID[19029333] |
| NPT4077 | Organism | Escherichia coli DH5[alpha] | Escherichia coli DH5[alpha] | MIC | = | 48.0 | ug.mL-1 | PMID[19029333] |
| NPT4077 | Organism | Escherichia coli DH5[alpha] | Escherichia coli DH5[alpha] | MIC | = | 64.0 | ug.mL-1 | PMID[19029333] |
| NPT4077 | Organism | Escherichia coli DH5[alpha] | Escherichia coli DH5[alpha] | MIC | = | 96.0 | ug.mL-1 | PMID[19029333] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | = | 128.0 | ug.mL-1 | PMID[19414578] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | = | 64.0 | ug.mL-1 | PMID[19414578] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | > | 256.0 | ug.mL-1 | PMID[19414578] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | = | 6.0 | ug.mL-1 | PMID[19414578] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 256.0 | ug.mL-1 | PMID[19770275] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | > | 256.0 | ug.mL-1 | PMID[20547808] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | = | 2.0 | ug.mL-1 | PMID[19620330] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | = | 256.0 | ug.mL-1 | PMID[19620330] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 512.0 | ug.mL-1 | PMID[19620330] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | IZ | = | 21.1 | mm | PMID[20713661] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | IZ | = | 24.4 | mm | PMID[20713661] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | MIC | = | 2.87 | ug.mL-1 | PMID[20713661] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | MIC | = | 1.44 | ug.mL-1 | PMID[20713661] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | FC | > | 2.0 | n.a. | PMID[20713661] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | FC | = | 2.0 | n.a. | PMID[20643901] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | MIC | = | 2.87 | ug.mL-1 | PMID[20643901] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | MIC | = | 1.44 | ug.mL-1 | PMID[20643901] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | IZ | = | 21.3 | mm | PMID[20643901] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | IZ | = | 24.8 | mm | PMID[20643901] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | = | 15.63 | ug.mL-1 | PMID[22100136] |
| NPT5781 | Organism | Bacillus cereus ATCC 10876 | Bacillus cereus ATCC 10876 | MIC | = | 31.25 | ug.mL-1 | PMID[23543889] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | = | 15.63 | ug.mL-1 | PMID[23543889] |
| NPT5781 | Organism | Bacillus cereus ATCC 10876 | Bacillus cereus ATCC 10876 | MIC | = | 62.5 | ug.mL-1 | PMID[23710121] |
| NPT2709 | Organism | Bacillus subtilis subsp. subtilis str. 168 | Bacillus subtilis subsp. subtilis str. 168 | Ratio | = | 0.306 | n.a. | PMID[23539337] |
| NPT2709 | Organism | Bacillus subtilis subsp. subtilis str. 168 | Bacillus subtilis subsp. subtilis str. 168 | MIC | = | 20000.0 | nM | PMID[23539337] |
| NPT29392 | Protein complex | Gamma-aminobutyric acid receptor subunit alpha-1/alpha-2/beta-2/gamma-2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 8.192 | ug.mL-1 | PMID[34865870] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 1.0 | ug.mL-1 | PMID[10230635] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.0 | ug.mL-1 | PMID[10230635] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.2 | ug.mL-1 | PMID[3572964] |
| NPT775 | Organism | Proteus | Proteus | MIC | = | 1.97 | ug.mL-1 | PMID[3572964] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MBC | = | 4.42 | ug ml-1 | PMID[3572964] |
| NPT775 | Organism | Proteus | Proteus | MBC | = | 3.9 | ug ml-1 | PMID[3572964] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | ED50 | = | 4.8 | mg.kg-1 | PMID[3572964] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[17116662] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[17116662] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[17220412] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[17220412] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1024.0 | ug.mL-1 | PMID[17220412] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 16.0 | ug.mL-1 | PMID[17220412] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[17242148] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[17242148] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[17353248] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1.0 | ug.mL-1 | PMID[17353248] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | > | 16.0 | ug.mL-1 | PMID[17371815] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | > | 16.0 | ug.mL-1 | PMID[17371815] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 100.0 | % | PMID[17371815] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[17371815] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 256.0 | ug.mL-1 | PMID[17371815] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[17420213] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[17420213] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2000.0 | ug.mL-1 | PMID[17846134] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 500.0 | ug.mL-1 | PMID[17846134] |
| NPT5308 | Organism | Streptococcus sp. group B | Streptococcus sp. group B | MIC | <= | 0.12 | ug.mL-1 | PMID[17606689] |
| NPT5308 | Organism | Streptococcus sp. group B | Streptococcus sp. group B | MIC50 | <= | 0.12 | ug.mL-1 | PMID[17606689] |
| NPT5308 | Organism | Streptococcus sp. group B | Streptococcus sp. group B | MIC90 | <= | 0.12 | ug.mL-1 | PMID[17606689] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 512.0 | ug.mL-1 | PMID[17664321] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 128.0 | ug.mL-1 | PMID[17664321] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1.0 | ug.mL-1 | PMID[17664321] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[17709463] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[17709463] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | > | 512.0 | ug.mL-1 | PMID[19884378] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[19884378] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 128.0 | ug.mL-1 | PMID[19884378] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[19884378] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[19901088] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 16.0 | ug.mL-1 | PMID[19901088] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[19901088] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 16.0 | ug.mL-1 | PMID[19901091] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.5 | ug.mL-1 | PMID[19901091] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 1024.0 | ug.mL-1 | PMID[19901092] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 512.0 | ug.mL-1 | PMID[19901092] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1024.0 | ug.mL-1 | PMID[19901092] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[19901092] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 512.0 | ug.mL-1 | PMID[19917750] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[19917750] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[19917750] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | >= | 512.0 | ug.mL-1 | PMID[20065056] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[20065056] |
| NPT4067 | Organism | Corynebacterium pseudodiphtheriticum | Corynebacterium pseudodiphtheriticum | MIC90 | = | 0.125 | ug.mL-1 | PMID[18227183] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[18316518] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[18316518] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[18362187] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 64.0 | ug.mL-1 | PMID[18362187] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 128.0 | ug.mL-1 | PMID[18362187] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[18362192] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[18362192] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | >= | 64.0 | ug.mL-1 | PMID[18426899] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 16.0 | ug.mL-1 | PMID[18426899] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[18443114] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 64.0 | ug.mL-1 | PMID[18443114] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 128.0 | ug.mL-1 | PMID[18443114] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | >= | 256.0 | ug.mL-1 | PMID[18443114] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC | = | 2048.0 | ug.mL-1 | PMID[18086856] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC | = | 1024.0 | ug.mL-1 | PMID[18086856] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | Ratio | = | 2.4 | n.a. | PMID[18086856] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[18268083] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.5 | ug.mL-1 | PMID[18268083] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[18268083] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[18268083] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[18160517] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[18160517] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[18160517] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 128.0 | ug.mL-1 | PMID[18160517] |
| NPT4067 | Organism | Corynebacterium pseudodiphtheriticum | Corynebacterium pseudodiphtheriticum | MIC | <= | 0.03 | ug.mL-1 | PMID[18227183] |
| NPT4067 | Organism | Corynebacterium pseudodiphtheriticum | Corynebacterium pseudodiphtheriticum | MIC50 | = | 0.06 | ug.mL-1 | PMID[18227183] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.5 | ug.mL-1 | PMID[20308380] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 256.0 | ug.mL-1 | PMID[20308380] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 1.0 | ug.mL-1 | PMID[20211890] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC90 | = | 1.0 | ug.mL-1 | PMID[20211890] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 16.0 | ug.mL-1 | PMID[19001117] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1.0 | ug.mL-1 | PMID[19001117] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC | > | 1024.0 | ug.mL-1 | PMID[20385866] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC | = | 32.0 | ug.mL-1 | PMID[20385866] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC | = | 64.0 | ug.mL-1 | PMID[20385866] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[18765691] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 512.0 | ug.mL-1 | PMID[18765691] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 256.0 | ug.mL-1 | PMID[18443127] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[18443127] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[18443121] |
| NPT5308 | Organism | Streptococcus sp. group B | Streptococcus sp. group B | MIC | = | 0.06 | ug.mL-1 | PMID[18541727] |
| NPT5308 | Organism | Streptococcus sp. group B | Streptococcus sp. group B | MIC | = | 0.03 | ug.mL-1 | PMID[18541727] |
| NPT5308 | Organism | Streptococcus sp. group B | Streptococcus sp. group B | MIC | = | 0.25 | ug.mL-1 | PMID[18541727] |
| NPT5308 | Organism | Streptococcus sp. group B | Streptococcus sp. group B | MIC | = | 0.12 | ug.mL-1 | PMID[18541727] |
| NPT5308 | Organism | Streptococcus sp. group B | Streptococcus sp. group B | MIC | = | 0.5 | ug.mL-1 | PMID[18541727] |
| NPT4401 | Organism | Streptococcus oralis | Streptococcus oralis | MIC | <= | 0.12 | ug.mL-1 | PMID[18443122] |
| NPT5315 | Organism | Streptococcus intermedius | Streptococcus intermedius | MIC | <= | 0.12 | ug.mL-1 | PMID[18443122] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 256.0 | ug.mL-1 | PMID[19104021] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[19104021] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.0 | ug.mL-1 | PMID[19075048] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | <= | 0.125 | ug.mL-1 | PMID[19075050] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 16.0 | ug.mL-1 | PMID[19075063] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[19075063] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[19258263] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[19380596] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[19380596] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | FC | = | 16.0 | n.a. | PMID[19289525] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | FC | = | 128.0 | n.a. | PMID[19289525] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | FC | = | 4.0 | n.a. | PMID[19289525] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | EC50 | = | 0.27 | ug.mL-1 | PMID[19289525] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 0.26 | mg/L | PMID[19289525] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 200.0 | mg/L | PMID[19289525] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.0 | ug.mL-1 | PMID[19223616] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | FC | > | 2.0 | n.a. | PMID[19223616] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | FC | = | 2.0 | n.a. | PMID[19223616] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 256.0 | ug.mL-1 | PMID[19414578] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 96.0 | ug.mL-1 | PMID[19414578] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC | = | 2048.0 | ug.mL-1 | PMID[19414581] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[19770275] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 256.0 | ug.mL-1 | PMID[19770275] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[19651915] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[19651915] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 256.0 | ug.mL-1 | PMID[20547808] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 64.0 | ug.mL-1 | PMID[20547808] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 128.0 | ug.mL-1 | PMID[20547808] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[20547808] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 512.0 | ug.mL-1 | PMID[19470510] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[19470510] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[19620330] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 512.0 | ug.mL-1 | PMID[19620330] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 512.0 | ug.mL-1 | PMID[19620330] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[19001114] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 256.0 | ug.mL-1 | PMID[19001114] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[19001114] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 128.0 | ug.mL-1 | PMID[19001114] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 96.0 | ug.mL-1 | PMID[19001114] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 256.0 | ug.mL-1 | PMID[19001114] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[19001114] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 256.0 | ug.mL-1 | PMID[20498317] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[20498317] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 64.0 | ug.mL-1 | PMID[21041509] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 128.0 | ug.mL-1 | PMID[21041509] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[21041509] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 0.0 | % | PMID[20733038] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 1.1 | % | PMID[20733038] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 128.0 | ug.mL-1 | PMID[20733047] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 512.0 | ug.mL-1 | PMID[20733047] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 256.0 | ug.mL-1 | PMID[20733047] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1.0 | ug.mL-1 | PMID[20733047] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 512.0 | ug.mL-1 | PMID[20733047] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[20733047] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 0.49 | ug.mL-1 | PMID[22100136] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 0.98 | ug.mL-1 | PMID[22100136] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Ratio | = | 16.0 | n.a. | PMID[22483632] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Ratio | = | 8.0 | n.a. | PMID[22483632] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1.56 | ug.mL-1 | PMID[22483632] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 0.49 | ug.mL-1 | PMID[23543889] |
| NPT3145 | Organism | Bacillus subtilis subsp. spizizenii ATCC 6633 | Bacillus subtilis subsp. spizizenii ATCC 6633 | MIC | = | 0.49 | ug.mL-1 | PMID[23710121] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 1.95 | ug.mL-1 | PMID[23710121] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 0.49 | ug.mL-1 | PMID[23710121] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 500.0 | ug.mL-1 | PMID[26186150] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.0 | ug.mL-1 | PMID[28992569] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 128.0 | ug.mL-1 | PMID[28992569] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 8.0 | ug.mL-1 | PMID[28992569] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 1.0 | ug.mL-1 | PMID[28992569] |
| NPT4025 | Organism | Staphylococcus hominis | Staphylococcus hominis | MIC | = | 8.0 | ug.mL-1 | PMID[28992569] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | MIC | = | 32.0 | ug.mL-1 | PMID[28992569] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | MIC | = | 0.5 | ug.mL-1 | PMID[28992569] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC | > | 128.0 | ug.mL-1 | PMID[28992569] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 32.0 | ug.mL-1 | PMID[30503946] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 1024.0 | ug.mL-1 | PMID[30503946] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 256.0 | ug.mL-1 | PMID[30503946] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 16.0 | ug.mL-1 | PMID[30503946] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 512.0 | ug.mL-1 | PMID[30503946] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 64.0 | ug.mL-1 | PMID[30503946] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 8.0 | ug.mL-1 | PMID[30503946] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.0 | ug.mL-1 | PMID[30503946] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 70.0 | % | PMID[30503946] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 98.0 | ug.mL-1 | PMID[32971428] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1.024 | ug.mL-1 | PMID[34865870] |
| NPT2 | Others | Unspecified | n.a. | MIC | = | 10.64 | ug.mL-1 | PMID[3572964] |
| NPT2 | Others | Unspecified | n.a. | MIC | = | 1.11 | ug.mL-1 | PMID[3572964] |
| NPT2917 | Organism | Serratia | Serratia | MIC | = | 12.4 | ug.mL-1 | PMID[3572964] |
| NPT23986 | Organism | Alcaligenes | Alcaligenes | MIC | = | 50.0 | ug.mL-1 | PMID[3572964] |
| NPT1238 | Organism | Staphylococcus | Staphylococcus | MIC | = | 1.06 | ug.mL-1 | PMID[3572964] |
| NPT1238 | Organism | Staphylococcus | Staphylococcus | MIC | = | 10.51 | ug.mL-1 | PMID[3572964] |
| NPT3598 | Organism | Bacillus | Bacillus | MIC | = | 35.36 | ug.mL-1 | PMID[3572964] |
| NPT2917 | Organism | Serratia | Serratia | MBC | = | 28.02 | ug ml-1 | PMID[3572964] |
| NPT23986 | Organism | Alcaligenes | Alcaligenes | MBC | = | 100.0 | ug ml-1 | PMID[3572964] |
| NPT1238 | Organism | Staphylococcus | Staphylococcus | MBC | = | 1.67 | ug ml-1 | PMID[3572964] |
| NPT1238 | Organism | Staphylococcus | Staphylococcus | MBC | = | 17.68 | ug ml-1 | PMID[3572964] |
| NPT3598 | Organism | Bacillus | Bacillus | MBC | = | 35.36 | ug ml-1 | PMID[3572964] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 0.08 | /mM/s | PMID[17420213] |
| NPT2 | Others | Unspecified | n.a. | FC | = | 100.0 | n.a. | PMID[17846134] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC | <= | 0.12 | ug.mL-1 | PMID[17606689] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC50 | <= | 0.12 | ug.mL-1 | PMID[17606689] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC90 | = | 2.0 | ug.mL-1 | PMID[17606689] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 4.0 | n.a. | PMID[17709463] |
| NPT1121 | Organism | Moraxella catarrhalis | Moraxella catarrhalis | MIC50 | = | 1.0 | ug.mL-1 | PMID[17908940] |
| NPT1121 | Organism | Moraxella catarrhalis | Moraxella catarrhalis | MIC90 | = | 2.0 | ug.mL-1 | PMID[17908940] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | > | 256.0 | ug.mL-1 | PMID[19884362] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 300.0 | n.a. | PMID[19884378] |
| NPT1209 | Organism | Pseudomonas fluorescens | Pseudomonas fluorescens | MIC | > | 256.0 | ug.mL-1 | PMID[19901091] |
| NPT4843 | Organism | Corynebacterium striatum | Corynebacterium striatum | MIC90 | = | 2.0 | ug.mL-1 | PMID[18227183] |
| NPT5744 | Organism | Corynebacterium urealyticum | Corynebacterium urealyticum | MIC90 | > | 32.0 | ug.mL-1 | PMID[18227183] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 0.005 | % | PMID[18212108] |
| NPT4843 | Organism | Corynebacterium striatum | Corynebacterium striatum | MIC | = | 0.125 | ug.mL-1 | PMID[18227183] |
| NPT5744 | Organism | Corynebacterium urealyticum | Corynebacterium urealyticum | MIC | = | 4.0 | ug.mL-1 | PMID[18227183] |
| NPT3987 | Organism | Corynebacterium xerosis | Corynebacterium xerosis | MIC | = | 0.125 | ug.mL-1 | PMID[18227183] |
| NPT4843 | Organism | Corynebacterium striatum | Corynebacterium striatum | MIC50 | = | 1.0 | ug.mL-1 | PMID[18227183] |
| NPT5744 | Organism | Corynebacterium urealyticum | Corynebacterium urealyticum | MIC50 | > | 32.0 | ug.mL-1 | PMID[18227183] |
| NPT3987 | Organism | Corynebacterium xerosis | Corynebacterium xerosis | MIC50 | = | 2.0 | ug.mL-1 | PMID[18227183] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 1522.0 | U/mg | PMID[20385866] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 5.0 | U/mg | PMID[20385866] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 6.0 | U/mg | PMID[20385866] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 3.0 | U/mg | PMID[20385866] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 1735.0 | U/mg | PMID[20385866] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 1615.0 | U/mg | PMID[20385866] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 18.0 | U/mg | PMID[20385866] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 1453.0 | U/mg | PMID[20385866] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 12.0 | U/mg | PMID[20385866] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 882.0 | U/mg | PMID[20385866] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | > | 128.0 | ug.mL-1 | PMID[18443121] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | = | 32.0 | ug.mL-1 | PMID[18443121] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC | <= | 0.12 | ug.mL-1 | PMID[18443122] |
| NPT5314 | Organism | Streptococcus constellatus | Streptococcus constellatus | MIC | <= | 0.12 | ug.mL-1 | PMID[18443122] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.923 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.032 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.028 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.038 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.075 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.016 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.024 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.008 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.198 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.002 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.01 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.011 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.009 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.004 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.048 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.023 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.047 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.021 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.071 | ug.mL-1 | PMID[19237649] |
| NPT2 | Others | Unspecified | n.a. | Activity | < | 0.01 | % | PMID[19380596] |
| NPT4815 | Organism | Neisseria meningitidis | Neisseria meningitidis | MIC | < | 0.016 | ug.mL-1 | PMID[19188396] |
| NPT4815 | Organism | Neisseria meningitidis | Neisseria meningitidis | MIC50 | = | 0.047 | ug.mL-1 | PMID[19188396] |
| NPT4815 | Organism | Neisseria meningitidis | Neisseria meningitidis | MIC90 | = | 0.094 | ug.mL-1 | PMID[19188396] |
| NPT4815 | Organism | Neisseria meningitidis | Neisseria meningitidis | Activity | = | 99.0 | % | PMID[19188396] |
| NPT4815 | Organism | Neisseria meningitidis | Neisseria meningitidis | Activity | = | 1.0 | % | PMID[19188396] |
| NPT4815 | Organism | Neisseria meningitidis | Neisseria meningitidis | Activity | = | 0.0 | % | PMID[19188396] |
| NPT4806 | Organism | Campylobacter coli | Campylobacter coli | MIC | = | 64.0 | ug.mL-1 | PMID[19506058] |
| NPT6330 | Organism | Chryseobacterium indologenes | Chryseobacterium indologenes | MIC | >= | 64.0 | ug.mL-1 | PMID[19651915] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | > | 256.0 | ug.mL-1 | PMID[20547808] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | = | 32.0 | ug.mL-1 | PMID[20547808] |
| NPT4806 | Organism | Campylobacter coli | Campylobacter coli | MIC50 | = | 128.0 | ug.mL-1 | PMID[19506058] |
| NPT4806 | Organism | Campylobacter coli | Campylobacter coli | MIC90 | = | 256.0 | ug.mL-1 | PMID[19506058] |
| NPT1277 | Organism | Staphylococcus epidermidis ATCC 12228 | Staphylococcus epidermidis ATCC 12228 | MIC | = | 0.24 | ug.mL-1 | PMID[22100136] |
| NPT314 | Organism | Bacillus cereus | Bacillus cereus | MIC | = | 31.25 | ug.mL-1 | PMID[22100136] |
| NPT1277 | Organism | Staphylococcus epidermidis ATCC 12228 | Staphylococcus epidermidis ATCC 12228 | MIC | = | 0.24 | ug.mL-1 | PMID[23543889] |
| NPT1277 | Organism | Staphylococcus epidermidis ATCC 12228 | Staphylococcus epidermidis ATCC 12228 | MIC | = | 0.24 | ug.mL-1 | PMID[23710121] |
| NPT1238 | Organism | Staphylococcus | Staphylococcus | MIC | = | 600.0 | ug.mL-1 | PMID[26186150] |
| NPT1843 | Organism | Aeromonas hydrophila | Aeromonas hydrophila | MIC | = | 500.0 | ug.mL-1 | PMID[26186150] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MIC | > | 128.0 | ug.mL-1 | PMID[28992569] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT32 | Organism | Mus musculus | Mus musculus | Survival | = | 91.4 | % | PMID[17145792] |
| NPT32 | Organism | Mus musculus | Mus musculus | Survival | = | 5.0 | % | PMID[17145792] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Activity | = | 1.0 | % | PMID[20022146] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| n.a. | n.a. | permeability | = | 0.6 | 10^-6 cm/s | PMID[36996715] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC487961 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC487961 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| 1.0 | High Similarity | NPD1986 | Phase 4 |
| 0.7436 | Intermediate Similarity | NPD1985 | Approved |
| 0.7436 | Intermediate Similarity | NPD1987 | Approved |
| 0.625 | Remote Similarity | NPD3291 | Phase 2 |
| 0.6235 | Remote Similarity | NPD3958 | Phase 4 |
| 0.5663 | Remote Similarity | NPD1665 | Phase 4 |
| 0.561 | Remote Similarity | NPD1979 | Phase 4 |
| 0.5465 | Remote Similarity | NPD2025 | Phase 4 |
| 0.5349 | Remote Similarity | NPD2020 | Phase 4 |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
