NPASS drugs

Drug Information

Drug ID:	NPD1979
Drug Name:	Cephalothin
Molecular Formula:	C16H16N2O6S2
Canonical SMILES:	CC(=O)OCC1=C(C(=O)O)N2[C@H](SC1)[C@@H](C2=O)N=C(Cc1cccs1)O
Standard InCHI:	"InChI=1S/C16H16N2O6S2/c1-8(19)24-6-9-7-26-15-12(14(21)18(15)13(9)16(22)23)17-11(20)5-10-3-2-4-25-10/h2-4,12,15H,5-7H2,1H3,(H,17,20)(H,22,23)/t12-,15-/m1/s1"
Standard InCHIKey:	XIURVHNZVLADCM-IUODEOHRSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD1979

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	94523
0.1-0.2	115872
0.2-0.3	1296
0.3-0.4	24
0.4-0.5	11
0.5-0.6	11
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC487959
Remote Similarity	0.6104	NPC481259
Remote Similarity	0.6053	NPC609559
Remote Similarity	0.5977	NPC487963
Remote Similarity	0.5802	NPC487960
Remote Similarity	0.5616	NPC157603
Remote Similarity	0.561	NPC487961
Remote Similarity	0.5541	NPC64758
Remote Similarity	0.5529	NPC143325
Remote Similarity	0.5366	NPC487968
Remote Similarity	0.5325	NPC270750
Remote Similarity	0.5325	NPC165659
Remote Similarity	0.5301	NPC478434
Remote Similarity	0.5185	NPC609567

Drug Structure

NPD1979 OpenBabel08211701392D 28 30 0 0 1 0 0 0 0 0999 V2000 3.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2548 0.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2561 0.7100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5136 -0.3082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9319 -0.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8978 -0.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6730 -1.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 -1.7071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.3301 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3801 -2.1554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7321 2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4641 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6749 -0.8529 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 1.8660 -1.5000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -3.3461 -1.8966 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 3.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 8 1 0 0 0 0 2 3 1 0 0 0 0 2 4 2 0 0 0 0 3 10 2 0 0 0 0 4 25 1 0 0 0 0 5 10 1 0 0 0 0 5 11 1 0 0 0 0 6 9 1 0 0 0 0 6 24 1 0 0 0 0 7 9 1 0 0 0 0 7 26 1 0 0 0 0 8 19 2 0 0 0 0 8 24 1 0 0 0 0 9 13 2 0 0 0 0 10 25 1 0 0 0 0 11 17 2 3 0 0 0 11 20 1 0 0 0 0 12 14 1 0 0 0 0 12 15 1 0 0 0 0 12 17 1 6 0 0 0 13 16 1 0 0 0 0 13 18 1 0 0 0 0 14 18 1 0 0 0 0 14 21 2 0 0 0 0 15 18 1 0 0 0 0 15 26 1 6 0 0 0 16 22 2 0 0 0 0 16 23 1 0 0 0 0 20 27 1 0 0 0 0 23 28 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000155
DrugBank	DB00456
ChEMBL	CHEMBL617
IUPHAR/BPS	8798
PharmaGKB	PA448886
KEGG Drug
PubChem CID	6024
ChEBI	124991
CAS Number	153-61-7

Drug Properties

Molecular Weight	396.04
ALogP	0.0023
MLogP	2.12
XLogP	0.385
HDA	8
HBD	2
Rotatable Bonds	10
TPSA	170.04
RO5 Violation	0