Drug Information| Drug ID:   | NPD1985 |
| Drug Name:   | Cefuroxime Sodium |
| Molecular Formula:   | C16H16N4O8S.Na |
| Canonical SMILES:   | CO/N=C(/c1ccco1)C(=N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)O)COC(=N)O)[O-].[Na+] |
| Standard InCHI:   | "InChI=1S/C16H16N4O8S.Na/c1-26-19-9(8-3-2-4-27-8)12(21)18-10-13(22)20-11(15(23)24)7(5-28-16(17)25)6-29-14(10)20;/h2-4,10,14H,5-6H2,1H3,(H2,17,25)(H,18,21)(H,23,24);/q;+1/p-1/b19-9-;/t10-,14-;/m1./s1" |
| Standard InCHIKey:   | URDOHUPGIOGTKV-JTBFTWTJSA-M |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD1985Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7436 | NPC487961 |
| Remote Similarity | 0.5281 | NPC483027 |
| Remote Similarity | 0.5116 | NPC487959 |
| Remote Similarity | 0.5056 | NPC487968 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 423.06 |
| ALogP   | -1.062 |
| MLogP   | 1.79 |
| XLogP   | 0.428 |
| HDA   | 9 |
| HBD   | 3 |
| Rotatable Bonds   | 12 |
| TPSA   | 206.37 |
| RO5 Violation   | 0 |