Drug Information| Drug ID:   | NPD2020 |
| Drug Name:   | Cefoxitin |
| Molecular Formula:   | C16H17N3O7S2 |
| Canonical SMILES:   | CO[C@@]1(N=C(Cc2cccs2)O)C(=O)N2[C@@H]1SCC(=C2C(=O)O)COC(=N)O |
| Standard InCHI:   | "InChI=1S/C16H17N3O7S2/c1-25-16(18-10(20)5-9-3-2-4-27-9)13(23)19-11(12(21)22)8(6-26-15(17)24)7-28-14(16)19/h2-4,14H,5-7H2,1H3,(H2,17,24)(H,18,20)(H,21,22)/t14-,16+/m1/s1" |
| Standard InCHIKey:   | WZOZEZRFJCJXNZ-ZBFHGGJFSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD2020Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC487968 |
| Remote Similarity | 0.5625 | NPC60344 |
| Remote Similarity | 0.5366 | NPC487959 |
| Remote Similarity | 0.5349 | NPC487961 |
| Molecular Weight   | 427.05 |
| ALogP   | 0.678 |
| MLogP   | 1.9 |
| XLogP   | 0.679 |
| HDA   | 10 |
| HBD   | 4 |
| Rotatable Bonds   | 12 |
| TPSA   | 206.28 |
| RO5 Violation   | 0 |