Drug Information| Drug ID:   | NPD2858 |
| Drug Name:   | Ceftriaxone |
| Molecular Formula:   | C18H18N8O7S3 |
| Canonical SMILES:   | CO/N=C(/c1csc(=N)[nH]1)C(=N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)O)CSc1nc(=O)c(=O)[nH]n1C)O |
| Standard InCHI:   | "InChI=1S/C18H18N8O7S3/c1-25-18(22-12(28)13(29)23-25)36-4-6-3-34-15-9(14(30)26(15)10(6)16(31)32)21-11(27)8(24-33-2)7-5-35-17(19)20-7/h5,9,15H,3-4H2,1-2H3,(H2,19,20)(H,21,27)(H,23,29)(H,31,32)/b24-8-/t9-,15-/m1/s1" |
| Standard InCHIKey:   | VAAUVRVFOQPIGI-SPQHTLEESA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD2858Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC486882 |
| Remote Similarity | 0.6593 | NPC478434 |
| Remote Similarity | 0.5196 | NPC487962 |
| Remote Similarity | 0.505 | NPC483027 |
| Molecular Weight   | 554.05 |
| ALogP   | -1.2367 |
| MLogP   | 1.46 |
| XLogP   | 0.606 |
| HDA   | 13 |
| HBD   | 5 |
| Rotatable Bonds   | 12 |
| TPSA   | 285.34 |
| RO5 Violation   | 1 |