Drug Information| Drug ID:   | NPD1959 |
| Drug Name:   | Cefixime |
| Molecular Formula:   | C16H15N5O7S2 |
| Canonical SMILES:   | OC(=N[C@H]1[C@H]2SCC(=C(N2C1=O)C(=O)O)C=C)/C(=NOCC(=O)O)/c1csc(=N)[nH]1 |
| Standard InCHI:   | "InChI=1S/C16H15N5O7S2/c1-2-6-4-29-14-10(13(25)21(14)11(6)15(26)27)19-12(24)9(20-28-3-8(22)23)7-5-30-16(17)18-7/h2,5,10,14H,1,3-4H2,(H2,17,18)(H,19,24)(H,22,23)(H,26,27)/b20-9-/t10-,14-/m1/s1" |
| Standard InCHIKey:   | OKBVVJOGVLARMR-QSWIMTSFSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD1959Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6875 | NPC478434 |
| Remote Similarity | 0.5851 | NPC485036 |
| Remote Similarity | 0.5714 | NPC486882 |
| Remote Similarity | 0.5618 | NPC487962 |
| Remote Similarity | 0.5281 | NPC483027 |
| TTD   | DAP000439 |
| DrugBank   | DB00671 |
| ChEMBL   | CHEMBL1541 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA164768821 |
| KEGG Drug   | D00258 |
| PubChem CID   | 5362065 |
| ChEBI   | 472657 |
| CAS Number   | 79350-37-1 |
| Molecular Weight   | 453.04 |
| ALogP   | -0.4149 |
| MLogP   | 1.68 |
| XLogP   | 0.969 |
| HDA   | 10 |
| HBD   | 5 |
| Rotatable Bonds   | 11 |
| TPSA   | 235.57 |
| RO5 Violation   | 0 |