Drug Information| Drug ID:   | NPD1963 |
| Drug Name:   | |
| Molecular Formula:   | C16H15N7O5S4 |
| Canonical SMILES:   | CO/N=C(/c1csc(=N)[nH]1)C(=N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)O)CSc1cnns1)[O-] |
| Standard InCHI:   | "InChI=1S/C16H15N7O5S4/c1-28-21-9(7-5-31-16(17)19-7)12(24)20-10-13(25)23-11(15(26)27)6(4-30-14(10)23)3-29-8-2-18-22-32-8/h2,5,10,14H,3-4H2,1H3,(H2,17,19)(H,20,24)(H,26,27)/p-1/b21-9-/t10-,14-/m1/s1" |
| Standard InCHIKey:   | CXHKZHZLDMQGFF-ZSDSSEDPSA-M |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD1963Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DNAP001512 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 23663965 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 511.99 |
| ALogP   | -0.0635 |
| MLogP   | 1.46 |
| XLogP   | 1.373 |
| HDA   | 10 |
| HBD   | 3 |
| Rotatable Bonds   | 11 |
| TPSA   | 280.42 |
| RO5 Violation   | 0 |