NPASS Compound

Natural Product: NPC6815

Natural Product ID	NPC6815
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	FBFCHVYQDYUGKU-NNTMNUMBSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1829521
PubChem CID	56670474
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000264] Organic acids and derivatives [CHEMONTID:0000265] Carboxylic acids and derivatives [CHEMONTID:0002995] Pentacarboxylic acids and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 81 85 0 0 0 0 0 0 0 0999 V2000 -4.2513 2.4219 -1.5652 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9015 1.9167 -1.8471 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3908 2.0360 -3.0129 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0963 1.2872 -0.8978 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7831 0.8231 -1.2718 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1848 0.2037 -0.0702 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.1214 1.2884 0.9617 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9434 1.0755 2.0115 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2477 0.6988 1.4030 C 0 0 2 0 0 0 0 0 0 0 0 0 2.1775 0.6832 -0.1398 C 0 0 2 0 0 0 0 0 0 0 0 0 1.1886 -0.4088 -0.3023 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2729 -1.2007 -1.5637 C 0 0 2 0 0 0 0 0 0 0 0 0 1.4402 -0.4261 -2.8250 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1411 -2.1880 -1.5858 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6880 -2.2531 -0.3634 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0414 -0.9742 0.3292 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4270 -0.7465 0.1540 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3031 -0.7365 1.2235 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8575 -0.9362 2.3817 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7606 -0.4997 1.0763 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8635 -3.0075 -0.6998 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1528 -4.2413 -0.1648 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3271 -4.7034 0.6565 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3870 -4.9992 -0.5381 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4566 -1.9796 -1.4391 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5108 -1.3174 0.7104 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3773 -0.8186 1.5973 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8912 -1.2116 3.0023 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8091 -1.1770 1.5228 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4326 0.2077 -0.5883 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2138 0.9406 -1.4662 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7764 2.0404 -1.8534 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4992 0.4718 -1.9361 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1628 -0.7011 -1.6368 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3374 -0.6486 -2.3462 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4193 0.4578 -3.0375 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3199 1.1507 -2.8056 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3531 1.6293 1.5216 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9284 2.8881 1.4215 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2433 3.7451 0.7623 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2064 3.2639 1.9997 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7964 4.5017 1.9038 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9995 4.4595 2.5874 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1104 3.2439 3.0657 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0797 2.5135 2.7428 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3616 2.9791 -0.6298 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5070 3.1627 -2.3797 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0292 1.6317 -1.6446 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9225 0.2482 -2.1624 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2388 1.8020 -1.4447 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2390 2.2271 0.4352 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0897 2.0715 2.5150 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5361 0.4114 2.7635 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1194 1.2416 1.7641 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9135 1.6547 -0.5523 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6881 -0.8001 -3.5827 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4214 -0.6272 -3.3569 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4248 0.6675 -2.7193 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4505 -2.0474 -2.5405 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5177 -3.2513 -1.7438 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1625 -2.9035 0.3694 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8949 -1.0956 1.4326 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9038 0.3483 0.3760 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2331 -0.3077 2.0419 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1745 -1.4174 0.5893 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7005 -5.5733 0.3491 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1284 -5.6708 -1.3670 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2214 -4.3076 -0.7763 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4935 -2.6793 -2.1332 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1070 -0.4302 3.7432 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5086 -2.1004 3.3363 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8589 -1.5827 2.9930 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1962 -1.6701 2.4668 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1303 -1.8280 0.7174 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4626 -0.2560 1.4535 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8031 -1.4708 -0.9808 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0878 -1.4184 -2.3318 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1195 2.1159 -3.2515 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4503 5.3984 1.4039 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7466 5.2218 2.7417 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9553 1.4826 3.0271 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 6 5 1 6 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 18 20 1 0 15 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 12 25 1 1 11 26 1 1 26 27 1 0 27 28 1 0 27 29 1 0 10 30 1 0 30 31 1 0 31 32 2 0 31 33 1 0 33 34 1 0 34 35 2 0 35 36 1 0 36 37 1 0 7 38 1 0 38 39 1 0 39 40 2 0 39 41 1 0 41 42 1 0 42 43 2 0 43 44 1 0 44 45 1 0 16 6 1 0 37 33 2 0 45 41 2 0 11 6 1 0 27 9 1 0 1 46 1 0 1 47 1 0 1 48 1 0 5 49 1 0 5 50 1 0 7 51 1 6 8 52 1 0 8 53 1 0 9 54 1 6 10 55 1 6 13 56 1 0 13 57 1 0 13 58 1 0 14 59 1 0 14 60 1 0 15 61 1 1 16 62 1 1 20 63 1 0 20 64 1 0 20 65 1 0 24 66 1 0 24 67 1 0 24 68 1 0 25 69 1 0 28 70 1 0 28 71 1 0 28 72 1 0 29 73 1 0 29 74 1 0 29 75 1 0 34 76 1 0 35 77 1 0 37 78 1 0 42 79 1 0 43 80 1 0 45 81 1 0 M END

Standard InCHIKey	FBFCHVYQDYUGKU-NNTMNUMBSA-N
Standard InCHI	InChI=1S/C31H36O14/c1-16(32)40-15-30-23(43-26(35)19-7-9-38-13-19)11-21-24(44-27(36)20-8-10-39-14-20)31(30,45-28(21,4)5)29(6,37)12-22(41-17(2)33)25(30)42-18(3)34/h7-10,13-14,21-25,37H,11-12,15H2,1-6H3/t21-,22+,23+,24-,25+,29+,30-,31+/m1/s1
SMILES	CC(=O)OC[C@@]12[C@H](C[C@@H]3[C@H]([C@@]2([C@](C)(C[C@@H]([C@@H]1OC(=O)C)OC(=O)C)O)OC3(C)C)OC(=O)c1ccoc1)OC(=O)c1ccoc1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	632.21	Volume:	601.285 ? Van der Waals volume.
Dense:	1.051	LogP:	1.922 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.237 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.582 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	29.0
TPSA:	187.24 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	1.0	Rings:	5.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.33	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.257	Fsp³:	0.581
MCE-18:	173.51 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.29	Fluc inhibitor:	0.014 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.046 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.06	Promiscuous compounds:	0.326

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.463	MDCK Permeability:	-4.956
Pgp-inhibitor:	0.987	Pgp-substrate:	0.723
PAMPA:	0.622 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.712	30% Bioavailability (F30%):	0.907
50% Bioavailability (F50%):	0.998

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.057	MRP1:	1.0
Plasma Protein Binding (PPB):	30.696%	Volume Distribution (VD):	-0.438
Fu:	67.008% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.808	BCRP inhibitor:	0.016
BSEP inhibitor:	0.987

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.215
CYP2C19-inhibitor:	0.002	CYP2C19-substrate:	0.02
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.507
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.057
CYP3A4-inhibitor:	0.036	CYP3A4-substrate:	0.018
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.999 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.691

Half-life (T1/2):

1.448

ADMET: Toxicity

hERG Blockers:	0.032	hERG Blockers (10um):	0.177
Human Hepatotoxicity (H-HT):	0.03	Drug-induced Liver Injury (DILI):	0.982
AMES Toxicity:	0.875	Rat Oral Acute Toxicity:	0.735
Maximum Recommended Daily Dose:	0.82	Skin Sensitization:	0.934
Carcinogencity:	0.969	Eye Corrosion:	0.0
Eye Irritation:	0.626	Respiratory Toxicity:	0.188
Drug-induced Neurotoxicity:	0.129	Ototoxicity:	0.177
Hematotoxicity:	0.052	Drug-induced Nephrotoxicity:	0.39
Genotoxicity:	0.93	RPMI-8226 Immunitoxicity:	0.083
A549 Cytotoxicity:	0.168	Hek293 Cytotoxicity:	0.425
BCF:	0.578 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.573 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.173 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.754 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO26437	Maytenus jelskii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[20146433]
NPO26437	Maytenus jelskii	Species	Celastraceae	Eukaryota	fruits	n.a.	n.a.	PMID[21856049]
NPO26437	Maytenus jelskii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[27541714]
NPO26437	Maytenus jelskii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO26437	Maytenus jelskii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	1
Ki	1
Imax	1
Ratio IC50	6
Activity	2

Activity Type	# Activity
Cell line	2
Individual protein	9

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	Inhibition	=	70.0	%	Open TG-GATES in vivo data: Hematology
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	Ki	=	510.0	nM	PubChem BioAssay data set
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	Imax	>	90.0	%	PMID[21856049]
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	Ratio IC50	=	2.72	n.a.	PMID[25442304]
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	Ratio IC50	=	4.37	n.a.	PMID[18247552]
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	Ratio IC50	=	14.63	n.a.	PMID[14987066]
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	Ratio IC50	=	3.58	n.a.	PMID[11495593]
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	Ratio IC50	=	18.85	n.a.	PMID[25647077]
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	Ratio IC50	=	65.64	n.a.	PMID[18161942]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT886	Cell line	NIH3T3	Mus musculus	Activity	=	91.98	%	PMID[26443549]
NPT886	Cell line	NIH3T3	Mus musculus	Activity	=	82.86	%	PMID[18955526]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC6815 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	14945
0.1-0.2	32958
0.2-0.3	1632
0.3-0.4	224
0.4-0.5	61
0.5-0.6	12
0.6-0.7	16
0.7-0.8	0
0.8-0.85	3
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8933	High Similarity	NPC294512
0.8514	High Similarity	NPC479041
0.8442	Intermediate Similarity	NPC176413
0.8378	Intermediate Similarity	NPC479048
0.8356	Intermediate Similarity	NPC479049
0.7531	Intermediate Similarity	NPC483885
0.7531	Intermediate Similarity	NPC479045
0.7333	Intermediate Similarity	NPC95265
0.6883	Remote Similarity	NPC97667
0.6824	Remote Similarity	NPC483868
0.6707	Remote Similarity	NPC56953
0.65	Remote Similarity	NPC294803
0.6456	Remote Similarity	NPC70716
0.631	Remote Similarity	NPC610134
0.6296	Remote Similarity	NPC481064
0.6296	Remote Similarity	NPC481062
0.6296	Remote Similarity	NPC481058
0.6296	Remote Similarity	NPC481060
0.6296	Remote Similarity	NPC479042
0.6296	Remote Similarity	NPC609309
0.6235	Remote Similarity	NPC10904
0.6235	Remote Similarity	NPC148896
0.6047	Remote Similarity	NPC180668
0.6024	Remote Similarity	NPC271460
0.5934	Remote Similarity	NPC471013
0.5802	Remote Similarity	NPC481061
0.5783	Remote Similarity	NPC147340
0.5682	Remote Similarity	NPC75600
0.5682	Remote Similarity	NPC483884
0.5357	Remote Similarity	NPC472570
0.5301	Remote Similarity	NPC171207
0.5294	Remote Similarity	NPC96903
0.5176	Remote Similarity	NPC11685
0.5176	Remote Similarity	NPC16912
0.5059	Remote Similarity	NPC481057
0.5059	Remote Similarity	NPC305403

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC6815 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3594
0.1-0.2	5494
0.2-0.3	61
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data