Drug Information| Drug ID:   | NPD7047 |
| Drug Name:   | Nalfurafine Hydrochloride |
| Molecular Formula:   | C28H32N2O5.ClH |
| Canonical SMILES:   | CN([C@@H]1CC[C@@]2([C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)CC2CC2)ccc1O)O)C(=O)/C=C/c1ccoc1.Cl |
| Standard InCHI:   | "InChI=1S/C28H32N2O5.ClH/c1-29(23(32)7-4-18-9-13-34-16-18)20-8-10-28(33)22-14-19-5-6-21(31)25-24(19)27(28,26(20)35-25)11-12-30(22)15-17-2-3-17;/h4-7,9,13,16-17,20,22,26,31,33H,2-3,8,10-12,14-15H2,1H3;1H/b7-4+;/t20-,22-,26+,27+,28-;/m1./s1" |
| Standard InCHIKey:   | DJSFYNINGIMKAG-FQJQBBMWSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD7047Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5914 | NPC611959 |
| Remote Similarity | 0.5104 | NPC254045 |
| Remote Similarity | 0.5104 | NPC201055 |
| Remote Similarity | 0.5104 | NPC265000 |
| Remote Similarity | 0.5104 | NPC64576 |
| Remote Similarity | 0.5104 | NPC151470 |
| Remote Similarity | 0.5104 | NPC603205 |
| Remote Similarity | 0.5104 | NPC603486 |
| Remote Similarity | 0.5104 | NPC611632 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 476.23 |
| ALogP   | -1.679 |
| MLogP   | 3.77 |
| XLogP   | 2.169 |
| HDA   | 4 |
| HBD   | 2 |
| Rotatable Bonds   | 9 |
| TPSA   | 86.38 |
| RO5 Violation   | 0 |