14 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
6 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC39837
Formula: C20H34O2
Ingredient ID: NPC39837
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=C1CC[C@H]2[C@@](C[C@@H]3[C@@H]1CC[C@@]3(C)O)(C)CC[C@]2(O)C(C)C |
| Standard InCHI | InChI=1S/C20H34O2/c1-13(2)20(22)11-10-18(4)12-16-15(8-9-19(16,5)21)14(3)6-7-17(18)20/h13,15-17,21-22H,3,6-12H2,1-2,4-5H3/t15-,16-,17+,18+,19-,20+/m1/s1 |
| Standard InCHIKey | HAIFQAQHAROQLN-JWLCQNFESA-N |
| Ingredient External Links |
PubChem CID: 5317434 ZINC ID: ZINC000033831291 |
| Plant-Ingredient Association Reference |
Database: TCMID [8033] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Hypoestes serpens | Hypoestes | Acanthaceae |
 |
Ingredient ID: NPC32298
Formula: C15H10O2
Ingredient ID: NPC32298
| Common Name | Flavone |
| IUPAC Name | 2-phenylchromen-4-one |
| Canonical SMILES | O=c1cc(oc2c1cccc2)c1ccccc1 |
| Standard InCHI | InChI=1S/C15H10O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H |
| Standard InCHIKey | VHBFFQKBGNRLFZ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 10680 ChEMBL ID: CHEMBL275638 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD33417] Database: NPASS [NPC32298] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Carpobrotus edulis | Carpobrotus | Aizoaceae |
 |
| Asplenium normale | Asplenium | Aspleniaceae | |
| Centrolobium tomentosum | Centrolobium | Fabaceae | |
| Psilostrophe cooperi | Psilostrophe | Asteraceae | |
| Trifolium alexandrinum | Trifolium | Fabaceae |
 |
| Sideritis tragoriganum | Sideritis | Lamiaceae | |
| Solanum jamaicense | Solanum | Solanaceae | |
| Lippia carviodora | Lippia | Verbenaceae |
|
| Ceratophyllum submersum | Ceratophyllum | Ceratophyllaceae | |
| Brucea javanica | Brucea | Simaroubaceae |
|
| Myrica nana | Myrica | Myricaceae | |
| Chamaemelum nobile | Chamaemelum | Asteraceae |
 |
| Dracocephalum kotschyi | Dracocephalum | Lamiaceae |
|
| Ginkgo semen | Ginkgo | Ginkgoaceae | |
| Schkuhria multiflora | Schkuhria | Asteraceae | |
| Anthocleista grandiflora | Anthocleista | Gentianaceae |
|
| Helleborus caucasicus | Helleborus | Ranunculaceae | |
| Lespedeza homoloba | Lespedeza | Fabaceae |
|
| Lolium perenne | Lolium | Poaceae |
|
| Hypoestes serpens | Hypoestes | Acanthaceae |
|
| Primula farinosa | Primula | Primulaceae | |
| Phoenix dactylifera | Phoenix | Arecaceae |
|
| Oroxylum indicum | Oroxylum | Bignoniaceae |
|
| Hippophae fructus | Hippophae | Elaeagnaceae | |
| Chrysanthemum morifolium | Chrysanthemum | Asteraceae |
|
| Desmodium styracifolium | Desmodium | Fabaceae |
|
| Swertia hickinii | Swertia | Gentianaceae | |
| Castanea crenata | Castanea | Fagaceae |
 |
| Commelina communis | Commelina | Commelinaceae |
|
Ingredient ID: NPC254225
Formula: C20H30O2
Ingredient ID: NPC254225
| Common Name | n.a. |
| IUPAC Name | (3aR,5Z,9E,12aS)-3a,6-dimethyl-1-propan-2-yl-4,7,8,11,12,12a-hexahydro-3H-cyclopenta[11]annulene-10-carboxylic acid |
| Canonical SMILES | C/C/1=C/C[C@]2(C)CC=C([C@H]2CC/C(=CCC1)/C(=O)O)C(C)C |
| Standard InCHI | InChI=1S/C20H30O2/c1-14(2)17-11-13-20(4)12-10-15(3)6-5-7-16(19(21)22)8-9-18(17)20/h7,10-11,14,18H,5-6,8-9,12-13H2,1-4H3,(H,21,22)/b15-10-,16-7+/t18-,20-/m1/s1 |
| Standard InCHIKey | YQRHFPSCUBKRIZ-XXGZKNCUSA-N |
| Ingredient External Links |
PubChem CID: 101229719 |
| Plant-Ingredient Association Reference |
Database: TCMID [6548] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Hypoestes serpens | Hypoestes | Acanthaceae |
|
Ingredient ID: NPC241060
Formula: C21H26O4
Ingredient ID: NPC241060
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COC(=O)C1=CC[C@@H]2C(=CC(=O)[C@@]2(CC2=C(C(=O)C[C@H]12)C)C)C(C)C |
| Standard InCHI | InChI=1S/C21H26O4/c1-11(2)14-9-19(23)21(4)10-16-12(3)18(22)8-15(16)13(20(24)25-5)6-7-17(14)21/h6,9,11,15,17H,7-8,10H2,1-5H3/b13-6+/t15-,17-,21-/m1/s1 |
| Standard InCHIKey | IKRSVGORANVKEE-GFJBOOSXSA-N |
| Ingredient External Links |
PubChem CID: 10450072 |
| Plant-Ingredient Association Reference |
Database: TCMID [19746] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Hypoestes serpens | Hypoestes | Acanthaceae |
|
Ingredient ID: NPC233282
Formula: C14H12O3
Ingredient ID: NPC233282
| Common Name | Benzyl Salicylate |
| IUPAC Name | benzyl 2-hydroxybenzoate |
| Canonical SMILES | O=C(c1ccccc1O)OCc1ccccc1 |
| Standard InCHI | InChI=1S/C14H12O3/c15-13-9-5-4-8-12(13)14(16)17-10-11-6-2-1-3-7-11/h1-9,15H,10H2 |
| Standard InCHIKey | ZCTQGTTXIYCGGC-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 8363 ChEMBL ID: CHEMBL460124 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD15882] Database: NPASS [NPC233282] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Chamaemelum nobile | Chamaemelum | Asteraceae |
|
| Schkuhria multiflora | Schkuhria | Asteraceae | |
| Anthocleista grandiflora | Anthocleista | Gentianaceae |
|
| Helleborus caucasicus | Helleborus | Ranunculaceae | |
| Lespedeza homoloba | Lespedeza | Fabaceae |
|
| Lolium perenne | Lolium | Poaceae |
|
| Hypoestes serpens | Hypoestes | Acanthaceae |
|
| Primula farinosa | Primula | Primulaceae |
Ingredient ID: NPC22783
Formula: C15H10O3
Ingredient ID: NPC22783
| Common Name | 2-(4-Hydroxyphenyl)Chromen-4-One |
| IUPAC Name | 2-(4-hydroxyphenyl)chromen-4-one |
| Canonical SMILES | Oc1ccc(cc1)c1cc(=O)c2c(o1)cccc2 |
| Standard InCHI | InChI=1S/C15H10O3/c16-11-7-5-10(6-8-11)15-9-13(17)12-3-1-2-4-14(12)18-15/h1-9,16H |
| Standard InCHIKey | SHGLJXBLXNNCTE-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 229016 ZINC ID: ZINC000000057679 ChEMBL ID: CHEMBL327209 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC22783] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Chamaemelum nobile | Chamaemelum | Asteraceae |
|
| Schkuhria multiflora | Schkuhria | Asteraceae | |
| Anthocleista grandiflora | Anthocleista | Gentianaceae |
|
| Helleborus caucasicus | Helleborus | Ranunculaceae | |
| Lespedeza homoloba | Lespedeza | Fabaceae |
|
| Lolium perenne | Lolium | Poaceae |
|
| Hypoestes serpens | Hypoestes | Acanthaceae |
|
| Primula farinosa | Primula | Primulaceae |
Ingredient ID: NPC197425
Formula: C15H10O3
Ingredient ID: NPC197425
| Common Name | 5-Hydroxyflavone |
| IUPAC Name | 5-hydroxy-2-phenylchromen-4-one |
| Canonical SMILES | Oc1cccc2c1c(=O)cc(o2)c1ccccc1 |
| Standard InCHI | InChI=1S/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
| Standard InCHIKey | IYBLVRRCNVHZQJ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 68112 ZINC ID: ZINC000000057676 ChEMBL ID: CHEMBL16807 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC197425] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Chamaemelum nobile | Chamaemelum | Asteraceae |
|
| Schkuhria multiflora | Schkuhria | Asteraceae | |
| Anthocleista grandiflora | Anthocleista | Gentianaceae |
|
| Helleborus caucasicus | Helleborus | Ranunculaceae | |
| Lespedeza homoloba | Lespedeza | Fabaceae |
|
| Lolium perenne | Lolium | Poaceae |
|
| Hypoestes serpens | Hypoestes | Acanthaceae |
|
| Primula farinosa | Primula | Primulaceae |
Ingredient ID: NPC193805
Formula: C15H10O3
Ingredient ID: NPC193805
| Common Name | n.a. |
| IUPAC Name | 2-(2-hydroxyphenyl)chromen-4-one |
| Canonical SMILES | Oc1ccccc1c1cc(=O)c2c(o1)cccc2 |
| Standard InCHI | InChI=1S/C15H10O3/c16-12-7-3-1-5-10(12)15-9-13(17)11-6-2-4-8-14(11)18-15/h1-9,16H |
| Standard InCHIKey | ZZLQHXCRRMUGQJ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 161860 ZINC ID: ZINC000000038938 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC193805] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Chamaemelum nobile | Chamaemelum | Asteraceae |
|
| Schkuhria multiflora | Schkuhria | Asteraceae | |
| Anthocleista grandiflora | Anthocleista | Gentianaceae |
|
| Helleborus caucasicus | Helleborus | Ranunculaceae | |
| Lespedeza homoloba | Lespedeza | Fabaceae |
|
| Lolium perenne | Lolium | Poaceae |
|
| Hypoestes serpens | Hypoestes | Acanthaceae |
|
| Primula farinosa | Primula | Primulaceae |
Ingredient ID: NPC144394
Formula: C33H40O19
Ingredient ID: NPC144394
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | Oc1ccc(cc1)c1oc2cc(O)cc(c2c(=O)c1O[C@H]1O[C@@H](CO[C@H]2O[C@@H](C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O[C@H]1O[C@@H](C)[C@@H]([C@H]([C@@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C33H40O19/c1-10-19(37)23(41)25(43)31(47-10)46-9-17-21(39)29(51-32-26(44)24(42)20(38)11(2)48-32)27(45)33(50-17)52-30-22(40)18-15(36)7-14(35)8-16(18)49-28(30)12-3-5-13(34)6-4-12/h3-8,10-11,17,19-21,23-27,29,31-39,41-45H,9H2,1-2H3/t10-,11-,17-,19-,20-,21-,23+,24+,25-,26-,27-,29+,31-,32+,33+/m0/s1 |
| Standard InCHIKey | UGFONMRRLRPYJP-XKDUTNGDSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD223909] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Chamaemelum nobile | Chamaemelum | Asteraceae |
|
| Schkuhria multiflora | Schkuhria | Asteraceae | |
| Anthocleista grandiflora | Anthocleista | Gentianaceae |
|
| Helleborus caucasicus | Helleborus | Ranunculaceae | |
| Lespedeza homoloba | Lespedeza | Fabaceae |
|
| Lolium perenne | Lolium | Poaceae |
|
| Hypoestes serpens | Hypoestes | Acanthaceae |
|
| Primula farinosa | Primula | Primulaceae |
Ingredient ID: NPC128216
Formula: C15H10O4
Ingredient ID: NPC128216
| Common Name | 3,5-Dihydroxy-2-Phenylchromen-4-One |
| IUPAC Name | 3,5-dihydroxy-2-phenylchromen-4-one |
| Canonical SMILES | Oc1cccc2c1c(=O)c(c(o2)c1ccccc1)O |
| Standard InCHI | InChI=1S/C15H10O4/c16-10-7-4-8-11-12(10)13(17)14(18)15(19-11)9-5-2-1-3-6-9/h1-8,16,18H |
| Standard InCHIKey | QHYWQIVTVQAKQF-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5393151 ChEMBL ID: CHEMBL239276 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD60655] Database: NPASS [NPC128216] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Chamaemelum nobile | Chamaemelum | Asteraceae |
|
| Schkuhria multiflora | Schkuhria | Asteraceae | |
| Anthocleista grandiflora | Anthocleista | Gentianaceae |
|
| Helleborus caucasicus | Helleborus | Ranunculaceae | |
| Lespedeza homoloba | Lespedeza | Fabaceae |
|
| Lolium perenne | Lolium | Poaceae |
|
| Hypoestes serpens | Hypoestes | Acanthaceae |
|
| Primula farinosa | Primula | Primulaceae |
Ingredient ID: NPC12323
Formula: C33H40O19
Ingredient ID: NPC12323
| Common Name | n.a. |
| IUPAC Name | 3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| Canonical SMILES | Oc1ccc(cc1)c1oc2cc(O)cc(c2c(=O)c1O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)[C@H]([C@@H]([C@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O)O |
| Standard InCHI | InChI=1S/C33H40O19/c1-10-19(37)23(41)26(44)31(47-10)46-9-17-21(39)25(43)30(52-32-27(45)24(42)20(38)11(2)48-32)33(50-17)51-29-22(40)18-15(36)7-14(35)8-16(18)49-28(29)12-3-5-13(34)6-4-12/h3-8,10-11,17,19-21,23-27,30-39,41-45H,9H2,1-2H3/t10-,11-,17+,19-,20-,21+,23+,24+,25-,26+,27+,30+,31+,32-,33-/m0/s1 |
| Standard InCHIKey | WRXVPTMENPZUIZ-QEZWUOJGSA-N |
| Ingredient External Links |
PubChem CID: 11592917 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD111776] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Centaurea solstitialis | Centaurea | Asteraceae |
|
| Xanthorrhoea resinosa | Xanthorrhoea | Asphodelaceae |
|
| Ocimum pilosum | Ocimum | Lamiaceae |
|
| Rhododendron ungerni | Rhododendron | Ericaceae | |
| Lagochilus leiacanthus | Lagochilus | Lamiaceae | |
| Strychnos tricalysioides | Strychnos | Loganiaceae | |
| Piptostigma fugax | Piptostigma | Annonaceae | |
| Onobrychis cyri | Onobrychis | Fabaceae | |
| Chara ceratophylla | Chara | Characeae | |
| Cosmos diversifolius | Cosmos | Asteraceae | |
| Trichodesma incanum | Trichodesma | Boraginaceae | |
| Acnistus breviflorus | Acnistus | Solanaceae | |
| Rhododendron mucronatum | Rhododendron | Ericaceae |
|
| Onobrychis viciifolia | Onobrychis | Fabaceae |
|
| Oxalis purpurea | Oxalis | Oxalidaceae |
|
| Chamaemelum nobile | Chamaemelum | Asteraceae |
|
| Inga velutina | Inga | Fabaceae |
|
| Curcuma caesia | Curcuma | Zingiberaceae |
|
| Glinus lotoides | Glinus | Molluginaceae |
|
| Albizia inundata | Albizia | Fabaceae |
|
| Schkuhria multiflora | Schkuhria | Asteraceae | |
| Tipuana tipu | Tipuana | Fabaceae | |
| Cathormion altissimum | Cathormion | Fabaceae | |
| Urochloa decumbens | Urochloa | Poaceae | |
| Anthocleista grandiflora | Anthocleista | Gentianaceae |
|
| Helleborus caucasicus | Helleborus | Ranunculaceae | |
| Lespedeza homoloba | Lespedeza | Fabaceae |
|
| Lolium perenne | Lolium | Poaceae |
|
| Hypoestes serpens | Hypoestes | Acanthaceae |
|
| Primula farinosa | Primula | Primulaceae | |
| Erythrophleum couminga | Erythrophleum | Fabaceae |
|
| Erythrina pallida | Erythrina | Fabaceae | |
| Garrya elliptica | Garrya | Garryaceae | |
| Nassauvia cumingii | Nassauvia | Asteraceae | |
| Eucalyptus australiana | Eucalyptus | Myrtaceae | |
| Phelline lucida | Phelline | Phellinaceae | |
| Lactuca serriola | Lactuca | Asteraceae |
|
| Artocarpus altilis | Artocarpus | Moraceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
| Cryptocarya oblata | Cryptocarya | Lauraceae | |
| Solenopsis punctaticeps | Solenopsis | Campanulaceae |
Ingredient ID: NPC121560
Formula: C21H20O9
Ingredient ID: NPC121560
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2cccc(c2O)c2cc(=O)c3c(o2)cccc3)[C@@H]([C@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C21H20O9/c22-9-16-18(25)19(26)20(27)21(30-16)29-14-7-3-5-11(17(14)24)15-8-12(23)10-4-1-2-6-13(10)28-15/h1-8,16,18-22,24-27H,9H2/t16-,18+,19+,20-,21-/m1/s1 |
| Standard InCHIKey | IUTJBONMKIDSBU-OBJCFNGXSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD221783] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Chamaemelum nobile | Chamaemelum | Asteraceae |
|
| Schkuhria multiflora | Schkuhria | Asteraceae | |
| Anthocleista grandiflora | Anthocleista | Gentianaceae |
|
| Helleborus caucasicus | Helleborus | Ranunculaceae | |
| Lespedeza homoloba | Lespedeza | Fabaceae |
|
| Lolium perenne | Lolium | Poaceae |
|
| Hypoestes serpens | Hypoestes | Acanthaceae |
|
| Primula farinosa | Primula | Primulaceae |
Ingredient ID: NPC118343
Formula: C14H12O2
Ingredient ID: NPC118343
| Common Name | Benzyl Benzoate |
| IUPAC Name | benzyl benzoate |
| Canonical SMILES | O=C(c1ccccc1)OCc1ccccc1 |
| Standard InCHI | InChI=1S/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
| Standard InCHIKey | SESFRYSPDFLNCH-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 2345 ZINC ID: ZINC000000001021 ChEMBL ID: CHEMBL1239 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC118343] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Liquidambar orientalis | Liquidambar | Altingiaceae |
|
| Piper attenuatum | Piper | Piperaceae |
|
| Styrax benzoin | Styrax | Styracaceae |
|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Murraya exotica | Murraya | Rutaceae |
|
| Artemisia jacutica | Artemisia | Asteraceae | |
| Styrax tonkinensis | Styrax | Styracaceae |
|
| Sinapis semen | Sinapis | Brassicaceae | |
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Bersama abyssinica | Bersama | Melianthaceae |
|
| Uvaria acuminata | Uvaria | Annonaceae |
|
| Lonicera japonica | Lonicera | Caprifoliaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Chamaemelum nobile | Chamaemelum | Asteraceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Aconitum sajanense | Aconitum | Ranunculaceae | |
| Schkuhria multiflora | Schkuhria | Asteraceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Strychnos triplinervia | Strychnos | Loganiaceae |
|
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Leonurus japonicus | Leonurus | Lamiaceae |
|
| Solidago decurrens | Solidago | Asteraceae | |
| Anthocleista grandiflora | Anthocleista | Gentianaceae |
|
| Hansenia weberbaueriana | Hansenia | Apiaceae | |
| Helleborus caucasicus | Helleborus | Ranunculaceae | |
| Lespedeza homoloba | Lespedeza | Fabaceae |
|
| Lolium perenne | Lolium | Poaceae |
|
| Hypoestes serpens | Hypoestes | Acanthaceae |
|
| Primula farinosa | Primula | Primulaceae | |
| Cynomorium songaricum | Cynomorium | Cynomoriaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Rheedia acuminata | Rheedia | Clusiaceae |
|
| Acacia aulacocarpa | Acacia | Fabaceae | |
| Aspidosperma subincanum | Aspidosperma | Apocynaceae |
|
| Syzygium aromaticum | Syzygium | Myrtaceae |
|
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
| Hypericum perforatum | Hypericum | Hypericaceae |
|
| Cassia jahnii | Cassia | Fabaceae | |
| Ardisia neriifolia | Ardisia | Primulaceae | |
| Psiadia dentata | Psiadia | Asteraceae | |
| Peritassa compta | Peritassa | Celastraceae | |
| Eupatorium argentinum | Eupatorium | Asteraceae | |
| Cryptocarya aschersoniana | Cryptocarya | Lauraceae | |
| Myroxylon pereirae | Myroxylon | Fabaceae | |
| Juniperus brevifolia | Juniperus | Cupressaceae | |
| Avrainvillea rawsonii | Avrainvillea | Udoteaceae | |
| Guatteria boliviana | Guatteria | Annonaceae | |
| Damnacanthus major | Damnacanthus | Rubiaceae | |
| Cinnamomum aromaticum | Cinnamomum | Lauraceae |
|
| Anemone flaccida | Anemone | Ranunculaceae |
|
| Stauntonia hexaphylla | Stauntonia | Lardizabalaceae |
|
| Rubus sanctus | Rubus | Rosaceae |
|
| Rosa multiflora | Rosa | Rosaceae |
|
Ingredient ID: NPC101899
Formula: C15H10O4
Ingredient ID: NPC101899
| Common Name | n.a. |
| IUPAC Name | 5,8-dihydroxy-2-phenylchromen-4-one |
| Canonical SMILES | Oc1ccc(c2c1oc(cc2=O)c1ccccc1)O |
| Standard InCHI | InChI=1S/C15H10O4/c16-10-6-7-11(17)15-14(10)12(18)8-13(19-15)9-4-2-1-3-5-9/h1-8,16-17H |
| Standard InCHIKey | KYLWJAUHHPTDDH-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 11055 ZINC ID: ZINC000000898960 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Chamaemelum nobile | Chamaemelum | Asteraceae |
|
| Saposhnikovia divaricata | Saposhnikovia | Apiaceae |
|
| Schkuhria multiflora | Schkuhria | Asteraceae | |
| Anthocleista grandiflora | Anthocleista | Gentianaceae |
|
| Helleborus caucasicus | Helleborus | Ranunculaceae | |
| Lespedeza homoloba | Lespedeza | Fabaceae |
|
| Lolium perenne | Lolium | Poaceae |
|
| Hypoestes serpens | Hypoestes | Acanthaceae |
|
| Primula farinosa | Primula | Primulaceae |
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC101899 | C15H10O4 | 5,8-dihydroxy-2-phenylchromen-4-one | 254.0579088 | -1.4242 | 2.67 | 3.163 | 1 | 2 | 66.76 | 1 | 3 | 19 | 0 |
| NPC118343 | C14H12O2 | Benzyl Benzoate | 212.08 | -0.0795 | 2.78 | 5.895 | 2 | 0 | 26.3 | 4 | 2 | 16 | 1 |
| NPC121560 | C21H20O9 | 416.1107322 | -3.1711 | 2.78 | 1.633 | 6 | 5 | 145.91 | 4 | 4 | 30 | 0 | |
| NPC12323 | C33H40O19 | 3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one | 740.2163791 | -6.9256 | 3 | -1.488 | 15 | 11 | 304.21 | 8 | 6 | 52 | 2 |
| NPC128216 | C15H10O4 | 3,5-Dihydroxy-2-Phenylchromen-4-One | 254.06 | -1.4203 | 2.67 | 4.474 | 2 | 2 | 66.76 | 3 | 3 | 19 | 0 |
| NPC144394 | C33H40O19 | 740.2163791 | -6.9256 | 3 | -1.917 | 15 | 11 | 304.21 | 8 | 6 | 52 | 2 | |
| NPC193805 | C15H10O3 | 238.0629942 | -0.9639 | 2.78 | 3.915 | 1 | 1 | 46.53 | 2 | 3 | 18 | 0 | |
| NPC197425 | C15H10O3 | 5-Hydroxyflavone | 238.06 | -0.9639 | 2.78 | 4.126 | 1 | 1 | 46.53 | 2 | 3 | 18 | 0 |
| NPC22783 | C15H10O3 | 2-(4-Hydroxyphenyl)Chromen-4-One | 238.06 | -0.9639 | 2.78 | 3.704 | 1 | 1 | 46.53 | 2 | 3 | 18 | 0 |
| NPC233282 | C14H12O3 | Benzyl Salicylate | 228.08 | -0.5398 | 2.67 | 5.493 | 2 | 1 | 46.53 | 5 | 2 | 17 | 1 |
| NPC241060 | C21H26O4 | 342.1831093 | 1.7766 | 3.33 | 1.197 | 4 | 0 | 60.44 | 3 | 3 | 25 | 0 | |
| NPC254225 | C20H30O2 | (3aR,5Z,9E,12aS)-3a,6-dimethyl-1-propan-2-yl-4,7,8,11,12,12a-hexahydro-3H-cyclopenta[11]annulene-10-carboxylic acid | 302.2245802 | 3.2114 | 3.44 | 6.257 | 2 | 1 | 37.3 | 2 | 2 | 22 | 1 |
| NPC32298 | C15H10O2 | Flavone | 222.07 | -0.5036 | 2.89 | 5.3 | 1 | 0 | 26.3 | 1 | 3 | 17 | 1 |
| NPC39837 | C20H34O2 | 306.2558803 | 1.3998 | 3.44 | 4.132 | 2 | 2 | 40.46 | 1 | 3 | 22 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
