NPASS Compound

Natural Product: NPC305238

Natural Product ID	NPC305238
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	QRVJUIRVDGCRAH-JSQXFSAFSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44567012
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 122128 0 0 0 0 0 0 0 0999 V2000 -6.6388 -0.6779 -0.4550 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0118 -1.7376 -1.3790 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.4121 -3.0592 -0.8306 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4157 -4.1504 -0.9982 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0055 -3.7903 -0.6685 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7730 -3.5484 0.7956 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3831 -3.1261 1.1256 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8317 -2.0496 0.2073 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.2190 -2.2958 -1.2019 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3507 -2.2787 -2.2079 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1147 -2.0151 -2.0400 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2303 -1.1831 -0.7857 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6039 -0.5962 -0.6252 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7315 -1.5061 -0.9657 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6799 0.5659 -1.6192 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9020 1.3745 -1.5413 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5647 1.5298 -0.2284 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9538 0.8665 0.9403 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0200 -0.0050 1.6246 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5945 1.8917 2.0385 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7273 0.0789 0.7106 C 0 0 2 0 0 0 0 0 0 0 0 0 1.4883 -0.9850 1.7710 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0138 -1.2909 1.6827 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3124 -1.9481 0.3538 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2874 -3.3487 0.4699 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9435 1.2182 -0.3131 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7812 2.2710 -0.1167 C 0 0 1 0 0 0 0 0 0 0 0 0 6.7295 2.0869 1.0495 C 0 0 1 0 0 0 0 0 0 0 0 0 8.0564 2.7179 0.6384 C 0 0 2 0 0 0 0 0 0 0 0 0 8.6234 1.8077 -0.4513 C 0 0 2 0 0 0 0 0 0 0 0 0 7.5461 1.6620 -1.4943 C 0 0 1 0 0 0 0 0 0 0 0 0 7.1615 0.2050 -1.6318 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4708 2.4976 -1.3078 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8550 0.5641 0.1738 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9372 2.8340 1.6859 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2899 2.8032 2.1676 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6325 -2.6279 -1.5347 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5685 -1.4867 -1.5625 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3212 -0.7564 -2.8993 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3648 -0.7628 0.7207 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1562 -0.7686 1.7437 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1218 0.4906 0.2364 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6837 1.6424 0.8029 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6598 2.6117 1.3528 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2635 4.0063 1.2355 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7328 3.8718 1.6364 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4402 3.0146 0.6370 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3994 3.7937 -0.2337 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2727 4.4746 0.6214 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5203 2.2930 -0.1217 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8185 3.3396 2.9316 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2092 4.4241 -0.0781 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4403 2.3993 2.7177 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1686 -4.9619 -1.0594 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2895 -4.8237 -1.9208 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3648 -6.2153 -0.4645 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7228 -0.5979 -0.5945 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3676 -0.9909 0.5749 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1135 0.2851 -0.6281 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5263 -1.5887 -2.3516 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6264 -2.9849 0.2773 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3719 -3.4133 -1.2718 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7765 -5.0551 -0.4781 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4218 -4.4283 -2.0943 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5098 -2.7810 1.1101 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0310 -4.4638 1.3591 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7254 -4.0108 1.0451 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3577 -2.8176 2.1893 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7368 -2.4668 -3.2122 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5228 -1.5417 -2.9319 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5406 -3.0519 -1.8794 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4433 -0.3033 -0.9684 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5435 -0.9765 -1.5548 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2625 -1.9163 -0.0810 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3923 -2.2885 -1.6741 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7899 1.2152 -1.3787 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5212 0.2090 -2.6448 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6508 0.9284 -2.2639 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6623 2.3677 -2.0335 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5903 2.6424 -0.0094 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6084 0.6069 2.3702 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6016 -0.8372 2.1802 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7849 -0.3412 0.8917 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1798 1.3853 2.9183 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5287 2.4221 2.2703 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8847 2.6412 1.6512 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8512 0.7654 0.7775 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6457 -0.5969 2.7977 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0059 -1.9276 1.5563 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4944 -0.2930 1.6748 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3364 -1.9099 2.5376 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1685 -4.0569 -0.2522 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2326 -3.7345 1.5100 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3553 -3.3201 0.2211 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2433 3.2397 0.0871 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9098 1.0330 1.2962 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8024 3.7112 0.1644 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5465 2.2492 -0.8476 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0076 1.9517 -2.4669 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1235 -0.3442 -1.8199 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5569 0.0526 -2.5528 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7266 -0.2328 -0.7314 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1968 0.7702 1.0731 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1729 3.7922 1.7871 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9992 3.0257 2.7904 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6872 -3.0706 -2.5903 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2549 -0.7404 -0.8077 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1812 -0.1084 -3.1369 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4051 -0.1489 -2.8592 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2550 -1.5437 -3.6945 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3275 1.3697 1.6633 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7240 2.6231 0.7777 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7428 4.6691 1.9447 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1622 4.8884 1.6158 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0296 2.2503 1.2156 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0051 3.0791 -0.8260 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8185 4.4938 -0.8424 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2860 5.4322 0.4086 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6716 3.5218 3.3575 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9322 5.3733 -0.0867 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8886 1.5395 2.9847 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8360 -6.9916 -0.8488 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 6 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 18 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 1 17 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 30 34 1 0 29 35 1 0 28 36 1 0 9 37 1 0 37 38 1 0 38 39 1 0 8 40 1 1 40 41 2 0 40 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 47 50 1 0 46 51 1 0 45 52 1 0 44 53 1 0 5 54 1 6 54 55 2 0 54 56 1 0 38 2 1 0 50 43 1 0 37 5 1 0 24 8 1 0 33 27 1 0 24 12 1 0 21 13 1 0 1 57 1 0 1 58 1 0 1 59 1 0 2 60 1 6 3 61 1 0 3 62 1 0 4 63 1 0 4 64 1 0 6 65 1 0 6 66 1 0 7 67 1 0 7 68 1 0 10 69 1 0 11 70 1 0 11 71 1 0 12 72 1 6 14 73 1 0 14 74 1 0 14 75 1 0 15 76 1 0 15 77 1 0 16 78 1 0 16 79 1 0 17 80 1 1 19 81 1 0 19 82 1 0 19 83 1 0 20 84 1 0 20 85 1 0 20 86 1 0 21 87 1 6 22 88 1 0 22 89 1 0 23 90 1 0 23 91 1 0 25 92 1 0 25 93 1 0 25 94 1 0 27 95 1 1 28 96 1 1 29 97 1 6 30 98 1 6 31 99 1 6 32100 1 0 32101 1 0 32102 1 0 34103 1 0 35104 1 0 36105 1 0 37106 1 6 38107 1 1 39108 1 0 39109 1 0 39110 1 0 43111 1 1 44112 1 6 45113 1 1 46114 1 1 47115 1 1 48116 1 0 48117 1 0 49118 1 0 51119 1 0 52120 1 0 53121 1 0 56122 1 0 M END

Standard InCHIKey	QRVJUIRVDGCRAH-JSQXFSAFSA-N
Standard InCHI	InChI=1S/C42H66O14/c1-19-10-15-41(36(50)51)16-17-42(37(52)56-35-33(49)31(47)29(45)23(18-43)54-35)22(27(41)20(19)2)8-9-25-39(6)13-12-26(38(4,5)24(39)11-14-40(25,42)7)55-34-32(48)30(46)28(44)21(3)53-34/h8,19-21,23-35,43-49H,9-18H2,1-7H3,(H,50,51)/t19-,20+,21-,23-,24+,25-,26+,27+,28+,29-,30+,31+,32-,33-,34+,35+,39+,40-,41+,42-/m1/s1
SMILES	C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@@]34C)O[C@H]3[C@@H]([C@H]([C@H]([C@@H](C)O3)O)O)O)[C@@H]2[C@H]1C)C(=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)C(=O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO26547	Uncaria tomentosa	Species	Rubiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[1919590]
NPO26547	Uncaria tomentosa	Species	Rubiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[2553871]
NPO26547	Uncaria tomentosa	Species	Rubiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO26547	Uncaria tomentosa	Species	Rubiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO26547	Uncaria tomentosa	Species	Rubiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO26547	Uncaria tomentosa	Species	Rubiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC305238 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	18743
0.1-0.2	25325
0.2-0.3	4121
0.3-0.4	1146
0.4-0.5	414
0.5-0.6	92
0.6-0.7	7
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC108748
0.9512	High Similarity	NPC473481
0.8791	High Similarity	NPC258885
0.7	Intermediate Similarity	NPC57362
0.6889	Remote Similarity	NPC274507
0.6701	Remote Similarity	NPC235841
0.6701	Remote Similarity	NPC297208
0.6495	Remote Similarity	NPC30397
0.6484	Remote Similarity	NPC484195
0.6277	Remote Similarity	NPC606107
0.6263	Remote Similarity	NPC211798
0.5963	Remote Similarity	NPC114484
0.5943	Remote Similarity	NPC124296
0.5922	Remote Similarity	NPC25605
0.5876	Remote Similarity	NPC177246
0.5816	Remote Similarity	NPC31839
0.578	Remote Similarity	NPC257468
0.567	Remote Similarity	NPC204407
0.5667	Remote Similarity	NPC485589
0.566	Remote Similarity	NPC157868
0.5631	Remote Similarity	NPC164194
0.5607	Remote Similarity	NPC161674
0.5607	Remote Similarity	NPC475171
0.5596	Remote Similarity	NPC40775
0.5596	Remote Similarity	NPC159309
0.5596	Remote Similarity	NPC180550
0.5596	Remote Similarity	NPC35405
0.5596	Remote Similarity	NPC86222
0.5566	Remote Similarity	NPC127056
0.5556	Remote Similarity	NPC192791
0.5556	Remote Similarity	NPC75417
0.5556	Remote Similarity	NPC112352
0.5545	Remote Similarity	NPC148417
0.5545	Remote Similarity	NPC128925
0.5534	Remote Similarity	NPC90856
0.5534	Remote Similarity	NPC214484
0.5472	Remote Similarity	NPC56713
0.5455	Remote Similarity	NPC251768
0.5455	Remote Similarity	NPC46665
0.5429	Remote Similarity	NPC48499
0.5421	Remote Similarity	NPC114441
0.5421	Remote Similarity	NPC109079
0.5405	Remote Similarity	NPC475591
0.5405	Remote Similarity	NPC236870
0.5398	Remote Similarity	NPC281148
0.5377	Remote Similarity	NPC12288
0.537	Remote Similarity	NPC472949
0.5364	Remote Similarity	NPC160415
0.5364	Remote Similarity	NPC114304
0.5351	Remote Similarity	NPC324875
0.5351	Remote Similarity	NPC292677
0.534	Remote Similarity	NPC209894
0.534	Remote Similarity	NPC607754
0.5327	Remote Similarity	NPC235405
0.5327	Remote Similarity	NPC475516
0.5321	Remote Similarity	NPC22956
0.5278	Remote Similarity	NPC249848
0.5278	Remote Similarity	NPC107966
0.5268	Remote Similarity	NPC68175
0.5268	Remote Similarity	NPC139044
0.5263	Remote Similarity	NPC485586
0.5263	Remote Similarity	NPC485588
0.5238	Remote Similarity	NPC204458
0.5234	Remote Similarity	NPC136877
0.5229	Remote Similarity	NPC473884
0.5229	Remote Similarity	NPC39211
0.5217	Remote Similarity	NPC323359
0.521	Remote Similarity	NPC151543
0.5203	Remote Similarity	NPC21691
0.5189	Remote Similarity	NPC270667
0.5189	Remote Similarity	NPC1046
0.5189	Remote Similarity	NPC78046
0.5182	Remote Similarity	NPC80843
0.5179	Remote Similarity	NPC164389
0.5179	Remote Similarity	NPC11551
0.5175	Remote Similarity	NPC79718
0.5175	Remote Similarity	NPC64715
0.5172	Remote Similarity	NPC488564
0.5149	Remote Similarity	NPC88744
0.5149	Remote Similarity	NPC283849
0.5138	Remote Similarity	NPC58448
0.5135	Remote Similarity	NPC223301
0.5135	Remote Similarity	NPC171544
0.5128	Remote Similarity	NPC187290
0.512	Remote Similarity	NPC258617
0.5096	Remote Similarity	NPC471967
0.5096	Remote Similarity	NPC256798
0.5091	Remote Similarity	NPC488561
0.5089	Remote Similarity	NPC30735
0.5089	Remote Similarity	NPC204392
0.5086	Remote Similarity	NPC301449
0.5086	Remote Similarity	NPC481079
0.5086	Remote Similarity	NPC601290
0.5085	Remote Similarity	NPC62725
0.5055	Remote Similarity	NPC274330
0.5052	Remote Similarity	NPC230151
0.5046	Remote Similarity	NPC174679
0.5046	Remote Similarity	NPC279554
0.5046	Remote Similarity	NPC59804
0.5045	Remote Similarity	NPC76497
0.5043	Remote Similarity	NPC480474
0.5043	Remote Similarity	NPC119794
0.5041	Remote Similarity	NPC471384

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC305238 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6102
0.1-0.2	2966
0.2-0.3	69
0.3-0.4	13
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data