NPASS Compound

Natural Product: NPC219663

Natural Product ID	NPC219663
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	MUWPBWRABGOPKR-XIOIIYPLSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	101998410
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 145152 0 0 0 0 0 0 0 0999 V2000 7.6516 -1.5817 -3.2173 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8548 -1.8297 -2.3352 C 0 0 1 0 0 0 0 0 0 0 0 0 9.9519 -0.8841 -2.7841 C 0 0 1 0 0 0 0 0 0 0 0 0 10.8226 -0.4746 -1.6225 C 0 0 2 0 0 0 0 0 0 0 0 0 9.9403 0.1884 -0.5831 C 0 0 2 0 0 0 0 0 0 0 0 0 8.4768 -0.2106 -0.7376 C 0 0 1 0 0 0 0 0 0 0 0 0 8.4734 -1.5713 -1.0197 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8576 0.0552 0.4659 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9133 1.0058 0.4648 C 0 0 2 0 0 0 0 0 0 0 0 0 7.2475 2.2397 1.2833 C 0 0 2 0 0 0 0 0 0 0 0 0 6.6108 2.1865 2.6344 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1404 1.8790 2.5763 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3476 3.0601 3.1094 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9991 2.7921 3.0812 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7690 1.6519 1.2611 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5195 0.5152 0.8216 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8663 -0.0592 -0.1983 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0957 -1.2302 0.0724 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1987 -2.3193 -0.2690 C 0 0 2 0 0 0 0 0 0 0 0 0 4.6101 -3.6882 -0.1952 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2647 -3.6813 -0.8569 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2986 -4.1552 0.1470 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5808 -5.2080 0.8249 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0816 -3.5889 0.4613 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9949 -2.5777 -1.5696 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9557 -1.3498 -0.8335 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6846 -1.2814 -0.4328 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7846 -0.4499 -1.0306 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0975 -1.0097 -2.0834 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5669 -0.7136 -1.9853 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0464 -0.7534 -0.5328 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8177 -2.1279 -0.0820 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3448 0.3784 0.1082 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9009 0.6644 1.4482 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3849 0.8783 1.4085 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1401 -0.3378 0.8075 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.9229 -1.3919 1.8327 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5321 -0.4432 -0.5230 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3254 -1.1740 -1.5221 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6689 -0.5325 -1.5660 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2578 -0.0001 -0.5283 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5997 0.5987 -0.7114 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7669 2.0430 -0.5752 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0944 2.5314 -0.0686 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.7903 3.4359 -1.1243 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1076 1.5037 0.2560 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.4878 0.3638 0.9814 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.5040 -0.3179 0.0972 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.4224 -1.1016 -0.8856 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7969 -1.3826 0.8454 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4779 -1.1516 1.4772 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6150 -0.0669 0.7722 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8382 1.1094 1.6948 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4511 -0.6200 1.3241 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8972 1.1061 -0.8234 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9607 3.4547 1.0948 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8270 3.8116 1.4952 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0689 3.9472 1.7699 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1498 0.4595 -0.0354 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5634 1.9261 -0.3455 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8437 0.2254 1.2936 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4398 0.9854 2.3433 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4896 -4.6051 -0.7876 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1055 -2.2547 0.7995 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7484 3.4123 3.3153 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7679 3.3700 0.6246 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1204 1.5647 -0.7145 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7611 0.4301 -2.1334 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6762 -1.4969 -3.7944 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9851 -2.4924 -3.2660 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9369 -1.3567 -4.2675 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9906 -0.8006 -2.7703 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2112 -2.8802 -2.4029 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5209 0.0601 -3.2165 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3464 -1.3270 -1.1891 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3116 -0.1067 0.4216 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0967 0.4139 -1.5686 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8250 1.3823 -0.6007 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3422 2.3291 1.3349 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1494 1.4603 3.3213 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8844 1.0012 3.2289 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6001 3.9918 2.5368 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6718 3.1795 4.1744 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6939 2.5603 3.9843 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5074 -0.1230 1.7164 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9016 -1.3765 1.1356 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5847 -2.0603 -1.2337 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5270 -3.9578 0.9038 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3135 -4.5303 -1.6153 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7788 -3.5110 1.4301 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1609 -0.6184 -1.6941 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5139 0.1819 -1.6492 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1582 -0.6000 -3.1177 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0979 -2.1065 -2.2851 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0376 -1.5195 -2.6018 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8704 0.2438 -2.4166 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4161 -2.2968 0.9093 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7433 -2.7354 -0.3264 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0748 -2.6553 -0.7652 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7133 1.2778 -0.5141 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5274 1.7201 1.7252 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5590 0.0209 2.2624 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5088 1.6998 0.6404 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6882 1.1306 2.4100 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0521 -2.4251 1.5724 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9695 -1.3236 2.4068 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6522 -1.1807 2.6810 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5182 0.6349 -0.9229 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4296 -2.2826 -1.3138 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9244 -1.1608 -2.5539 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1672 -0.5336 -2.5704 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9260 0.3996 -1.7924 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9768 2.5935 -0.0265 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6572 2.5661 -1.5951 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8721 3.3881 -1.0586 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4175 3.1003 -2.1111 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4624 4.4964 -0.9915 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8427 1.9703 0.9789 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0912 0.7019 1.9320 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4075 -1.2911 -0.4779 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3895 -0.5898 -1.8718 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9714 -2.1127 -1.1013 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7565 -2.3218 0.1937 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5123 -1.7320 1.6569 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9707 -2.1356 1.4772 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6312 -0.9171 2.5497 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2750 1.9975 1.5301 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5238 0.6899 2.7131 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8864 1.3287 1.8903 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3524 -0.3644 1.0797 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5492 1.4786 -1.6459 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9285 4.3545 2.6953 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6334 2.0616 -0.1163 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0973 2.6200 0.1683 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4505 2.0263 -1.4464 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9378 0.4981 1.1238 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9122 -0.8627 1.5259 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6713 1.9489 2.2510 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3416 -5.4998 -0.3954 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6032 -2.5961 1.5838 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5273 3.9153 3.0338 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3543 3.5331 -0.1738 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6538 1.9770 -0.0146 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6398 0.3464 -1.7249 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5680 -1.0480 -3.8337 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 12 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 21 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 1 31 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 1 36 38 1 0 38 39 1 0 39 40 1 0 40 41 2 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 6 44 46 1 0 46 47 1 0 47 48 1 0 48 49 1 6 48 50 1 0 50 51 1 0 51 52 1 0 52 53 1 1 47 54 1 0 46 55 1 0 44 56 1 0 56 57 2 0 56 58 1 0 33 59 1 0 59 60 1 6 59 61 1 0 61 62 1 0 20 63 1 0 19 64 1 0 11 65 1 0 10 66 1 0 5 67 1 0 4 68 1 0 3 69 1 0 7 2 1 0 16 9 1 0 26 18 1 0 59 28 1 0 38 31 1 0 52 41 1 0 52 36 1 0 48 42 1 0 1 70 1 0 1 71 1 0 1 72 1 0 2 73 1 1 3 74 1 6 4 75 1 1 5 76 1 1 6 77 1 6 9 78 1 6 10 79 1 1 11 80 1 1 12 81 1 1 13 82 1 0 13 83 1 0 14 84 1 0 16 85 1 1 18 86 1 1 19 87 1 6 20 88 1 1 21 89 1 6 24 90 1 0 26 91 1 6 28 92 1 6 29 93 1 0 29 94 1 0 30 95 1 0 30 96 1 0 32 97 1 0 32 98 1 0 32 99 1 0 33100 1 6 34101 1 0 34102 1 0 35103 1 0 35104 1 0 37105 1 0 37106 1 0 37107 1 0 38108 1 6 39109 1 0 39110 1 0 40111 1 0 42112 1 6 43113 1 0 43114 1 0 45115 1 0 45116 1 0 45117 1 0 46118 1 1 47119 1 1 49120 1 0 49121 1 0 49122 1 0 50123 1 0 50124 1 0 51125 1 0 51126 1 0 53127 1 0 53128 1 0 53129 1 0 54130 1 0 55131 1 0 58132 1 0 60133 1 0 60134 1 0 60135 1 0 61136 1 0 61137 1 0 62138 1 0 63139 1 0 64140 1 0 65141 1 0 66142 1 0 67143 1 0 68144 1 0 69145 1 0 M END

Standard InCHIKey	MUWPBWRABGOPKR-XIOIIYPLSA-N
Standard InCHI	InChI=1S/C48H76O21/c1-19-26(51)28(53)32(57)39(64-19)68-34-29(54)27(52)22(17-49)65-40(34)69-35-31(56)30(55)33(38(60)61)67-41(35)66-25-11-12-44(3)23(46(25,5)18-50)10-13-48(7)24(44)9-8-20-21-16-45(4,42(62)63)37(59)36(58)43(21,2)14-15-47(20,48)6/h8,19,21-37,39-41,49-59H,9-18H2,1-7H3,(H,60,61)(H,62,63)/t19-,21-,22+,23+,24+,25-,26-,27-,28+,29-,30-,31-,32+,33-,34+,35+,36+,37-,39-,40-,41+,43+,44-,45-,46+,47+,48+/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@H]([C@H]([C@@H](CO)O[C@H]1O[C@@H]1[C@H]([C@@H]([C@@H](C(=O)O)O[C@H]1O[C@H]1CC[C@@]2(C)[C@@H](CC[C@]3(C)[C@@H]2CC=C2[C@@H]4C[C@@](C)([C@H]([C@H]([C@]4(C)CC[C@@]32C)O)O)C(=O)O)[C@@]1(C)CO)O)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	988.49	Volume:	946.997 ? Van der Waals volume.
Dense:	1.044	LogP:	0.138 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.219 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.831 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	46.0
TPSA:	352.51 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	13.0	Rings:	8.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.09	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.628	Fsp³:	0.917
MCE-18:	182.217 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.666	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.295	Promiscuous compounds:	0.161

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.293	MDCK Permeability:	-5.186
Pgp-inhibitor:	0.0	Pgp-substrate:	0.421
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.536
20% Bioavailability (F20%):	0.692	30% Bioavailability (F30%):	0.807
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.985
Plasma Protein Binding (PPB):	64.145%	Volume Distribution (VD):	-0.444
Fu:	21.953% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.885
OATP1B3 inhibitor:	0.444	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.009	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.001
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.159

Half-life (T1/2):

4.535

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.002
Human Hepatotoxicity (H-HT):	0.508	Drug-induced Liver Injury (DILI):	0.969
AMES Toxicity:	0.488	Rat Oral Acute Toxicity:	0.007
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.067	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.008
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.459	Drug-induced Nephrotoxicity:	0.995
Genotoxicity:	0.719	RPMI-8226 Immunitoxicity:	0.113
A549 Cytotoxicity:	0.37	Hek293 Cytotoxicity:	0.148
BCF:	0.523 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.212 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.615 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.593 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO25932	Delphinium barbeyi	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1021/jf00025a020]
NPO9446	Asterias rathbuni	Species	Asteriidae	Eukaryota	n.a.	n.a.	n.a.	PMID[11473430]
NPO13715	Bertya dimerostigma	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6243	Fomes fastuosus	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO5081	Amorphinopsis foetida	Species	Halichondriidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO25932	Delphinium barbeyi	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9446	Asterias rathbuni	Species	Asteriidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO25932	Delphinium barbeyi	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO8707.2	Pueraria montana var. thomsonii	Varieties	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO25932	Delphinium barbeyi	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8707.2	Pueraria montana var. thomsonii	Varieties	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO13715	Bertya dimerostigma	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO8707.2	Pueraria montana var. thomsonii	Varieties	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO25932	Delphinium barbeyi	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO5479	Astragalus wiedemannianus	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO9446	Asterias rathbuni	Species	Asteriidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO6243	Fomes fastuosus	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO5081	Amorphinopsis foetida	Species	Halichondriidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC219663 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23595
0.1-0.2	22471
0.2-0.3	2542
0.3-0.4	828
0.4-0.5	321
0.5-0.6	76
0.6-0.7	7
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7981	Intermediate Similarity	NPC236657
0.7788	Intermediate Similarity	NPC131469
0.7714	Intermediate Similarity	NPC95437
0.7642	Intermediate Similarity	NPC114692
0.7524	Intermediate Similarity	NPC118440
0.75	Intermediate Similarity	NPC120116
0.7232	Intermediate Similarity	NPC313110
0.6786	Remote Similarity	NPC218954
0.6726	Remote Similarity	NPC187618
0.6604	Remote Similarity	NPC12288
0.6481	Remote Similarity	NPC482748
0.6271	Remote Similarity	NPC471962
0.6126	Remote Similarity	NPC472949
0.6091	Remote Similarity	NPC25605
0.5913	Remote Similarity	NPC251768
0.5862	Remote Similarity	NPC162574
0.5806	Remote Similarity	NPC482736
0.5806	Remote Similarity	NPC482738
0.5804	Remote Similarity	NPC309780
0.5676	Remote Similarity	NPC164194
0.563	Remote Similarity	NPC302887
0.5625	Remote Similarity	NPC484061
0.5625	Remote Similarity	NPC484062
0.5593	Remote Similarity	NPC139044
0.5556	Remote Similarity	NPC114304
0.5556	Remote Similarity	NPC224121
0.5547	Remote Similarity	NPC82380
0.5547	Remote Similarity	NPC244296
0.5538	Remote Similarity	NPC258617
0.5537	Remote Similarity	NPC301449
0.5537	Remote Similarity	NPC601290
0.5526	Remote Similarity	NPC174679
0.5526	Remote Similarity	NPC279554
0.552	Remote Similarity	NPC151543
0.55	Remote Similarity	NPC64715
0.5496	Remote Similarity	NPC484059
0.5496	Remote Similarity	NPC484060
0.5431	Remote Similarity	NPC473884
0.541	Remote Similarity	NPC477075
0.541	Remote Similarity	NPC477076
0.5391	Remote Similarity	NPC59804
0.5378	Remote Similarity	NPC11551
0.5366	Remote Similarity	NPC160452
0.5366	Remote Similarity	NPC477077
0.5366	Remote Similarity	NPC477078
0.5333	Remote Similarity	NPC484063
0.5333	Remote Similarity	NPC484064
0.5328	Remote Similarity	NPC276093
0.5299	Remote Similarity	NPC488561
0.5299	Remote Similarity	NPC11577
0.5299	Remote Similarity	NPC482751
0.5299	Remote Similarity	NPC141600
0.5285	Remote Similarity	NPC477079
0.528	Remote Similarity	NPC480939
0.5278	Remote Similarity	NPC204407
0.5271	Remote Similarity	NPC471550
0.525	Remote Similarity	NPC148603
0.5231	Remote Similarity	NPC277212
0.5231	Remote Similarity	NPC30279
0.5231	Remote Similarity	NPC46823
0.5229	Remote Similarity	NPC57362
0.521	Remote Similarity	NPC192791
0.521	Remote Similarity	NPC482741
0.521	Remote Similarity	NPC482745
0.521	Remote Similarity	NPC482743
0.521	Remote Similarity	NPC146753
0.5207	Remote Similarity	NPC471383
0.5164	Remote Similarity	NPC257468
0.5161	Remote Similarity	NPC23275
0.5161	Remote Similarity	NPC482735
0.5152	Remote Similarity	NPC470518
0.513	Remote Similarity	NPC270667
0.5126	Remote Similarity	NPC475171
0.5126	Remote Similarity	NPC22956
0.5122	Remote Similarity	NPC486563
0.5116	Remote Similarity	NPC323341
0.5081	Remote Similarity	NPC114484
0.5079	Remote Similarity	NPC469947
0.5079	Remote Similarity	NPC480948
0.5078	Remote Similarity	NPC252657
0.5078	Remote Similarity	NPC88311
0.5075	Remote Similarity	NPC225791
0.5043	Remote Similarity	NPC136877
0.5041	Remote Similarity	NPC475504
0.5041	Remote Similarity	NPC123796
0.504	Remote Similarity	NPC486564
0.504	Remote Similarity	NPC482737
0.504	Remote Similarity	NPC323359
0.5039	Remote Similarity	NPC470915
0.5039	Remote Similarity	NPC480936

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC219663 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6794
0.1-0.2	2305
0.2-0.3	45
0.3-0.4	5
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data