NPASS Compound

Natural Product: NPC174237

Natural Product ID	NPC174237
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	HIZNXZVTIKIPSM-JWTROTHCSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	6325606
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 145152 0 0 0 0 0 0 0 0999 V2000 -8.5452 2.1079 -2.5397 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6680 1.3424 -1.8698 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8672 1.4688 -2.8332 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0719 2.0431 -0.5992 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6404 0.9862 0.3137 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5401 0.0189 0.7666 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.7011 0.7623 1.7414 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2895 0.3174 1.8822 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5629 0.1639 0.5830 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.1288 1.4921 0.0558 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4143 -0.5743 -0.4065 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8555 -1.2911 -1.3815 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3835 -1.4273 -1.5839 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6245 -0.7818 -0.4967 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.1676 -1.2003 -0.3744 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1050 -2.6175 0.0908 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5415 -1.0525 -1.7305 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0662 -1.2075 -1.7306 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3189 -0.4707 -0.6596 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0864 -0.0104 0.4980 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8135 1.5053 0.6837 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5396 -0.1913 0.5230 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.1121 -0.4517 1.9238 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5911 -0.2552 1.9586 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3612 -0.7870 0.8015 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9925 -2.1433 1.1030 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5216 -0.6097 1.7478 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1047 0.0730 2.7261 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4087 -1.9903 1.9340 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7740 -1.2746 -0.3183 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9914 -0.7757 -0.7704 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9720 -0.5006 0.3477 C 0 0 1 0 0 0 0 0 0 0 0 0 4.2485 -0.0119 -0.3032 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7926 -1.2033 -1.0791 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7315 -1.4696 -2.1579 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1786 -2.6602 -2.9659 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2397 -2.9708 -3.9393 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5392 -1.7850 -1.5628 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0250 -0.9655 -1.6343 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1586 0.5108 0.5718 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4794 1.8082 0.2029 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1032 2.8559 1.1950 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0088 4.0515 1.0342 C 0 0 2 0 0 0 0 0 0 0 0 0 7.4445 3.6590 1.2099 C 0 0 1 0 0 0 0 0 0 0 0 0 7.7070 2.2475 0.7396 C 0 0 1 0 0 0 0 0 0 0 0 0 7.9094 1.2960 1.8764 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3718 0.0548 1.5505 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6036 -0.0035 0.9361 C 0 0 1 0 0 0 0 0 0 0 0 0 10.5743 -0.7802 1.8450 C 0 0 1 0 0 0 0 0 0 0 0 0 11.9334 -0.6173 1.2332 C 0 0 2 0 0 0 0 0 0 0 0 0 11.8545 -0.4334 -0.2676 C 0 0 1 0 0 0 0 0 0 0 0 0 10.6341 -1.0535 -0.8613 C 0 0 1 0 0 0 0 0 0 0 0 0 10.7711 -2.5567 -1.0284 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7043 -3.0618 -1.7633 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4629 -0.7890 -0.2043 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9683 0.9275 -0.6282 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8059 -1.6494 1.5617 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5888 -0.2194 3.1266 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8065 1.8507 -0.2137 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1965 4.5539 0.4291 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6804 5.0458 1.9801 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7833 3.2788 0.9027 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5414 0.4751 1.2103 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7712 -2.5798 -1.7264 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8948 -0.5841 -0.3921 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.4085 -0.1080 -1.7211 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3101 -1.0467 1.5112 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0184 -1.2236 2.7139 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2898 -1.8019 0.9235 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9315 2.7763 -3.3087 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7581 1.4216 -2.9124 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0556 2.7189 -1.7275 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3228 2.4687 -2.7524 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5805 0.6316 -2.6780 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4531 1.3458 -3.8572 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8689 2.8081 -0.7882 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1688 2.5439 -0.2177 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4211 0.4475 -0.2593 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0795 1.4173 1.2383 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7853 1.8654 1.6120 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1572 0.6147 2.7745 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2658 -0.5808 2.5315 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7751 1.1118 2.5033 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1373 1.4900 -1.0541 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8493 2.3142 0.3393 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1599 1.8478 0.4647 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4339 -1.8577 -2.1245 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1832 -0.8861 -2.5581 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1183 -2.4789 -1.8189 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5275 0.3157 -0.7776 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5558 -2.7936 1.0642 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6639 -3.2359 -0.6438 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0973 -3.0562 0.1097 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9698 -1.7066 -2.4910 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7753 0.0010 -2.0688 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7315 -0.8901 -2.7677 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1480 0.4103 -1.1988 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0716 1.6773 1.3042 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7118 1.9970 1.1412 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6784 1.9818 -0.3091 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0244 0.8000 0.2504 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6233 0.3291 2.5690 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7605 -1.4187 2.3368 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9623 -0.7979 2.8782 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7854 0.8176 2.1800 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1155 -2.0851 1.1759 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6866 -2.5218 2.1132 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8244 -2.8831 0.2950 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1994 -2.3794 2.6414 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8726 0.1723 -1.3288 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1715 -1.4578 0.9143 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9338 0.7174 -1.1085 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7973 -2.0637 -0.3822 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6786 -0.5972 -2.8441 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2683 -3.5477 -2.2990 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1938 -2.5177 -3.4023 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1931 -3.9205 -4.1684 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6980 -1.4877 -1.1143 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8866 2.0370 -0.7310 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0430 2.5054 2.2461 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8476 4.4509 0.0029 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7726 3.8021 2.2723 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7039 2.2915 0.2047 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6062 1.8212 2.5943 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9786 1.1345 2.4850 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0931 0.9575 0.7654 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2738 -1.8323 1.9177 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4058 0.3190 1.6472 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7460 -0.9360 -0.7009 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5284 -0.6402 -1.9014 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8237 -3.0691 -0.0582 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7099 -2.7397 -1.6019 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8639 -3.9618 -2.1067 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7381 1.3402 -0.1787 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7443 -1.3743 1.4462 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7456 -0.4082 3.5964 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1320 4.2058 -0.5167 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1850 5.8490 1.7243 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6090 4.1888 1.2360 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2137 0.7637 1.8558 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0147 -2.7918 -2.2996 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1366 -1.7087 -0.4075 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3316 -0.7089 -2.0125 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6911 -0.3828 -2.5505 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6019 -2.7006 1.2970 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 6 9 11 1 0 11 12 2 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 1 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 20 27 1 0 27 28 2 0 27 29 1 0 19 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 35 38 1 0 34 39 1 0 33 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 52 55 1 0 51 56 1 0 50 57 1 0 49 58 1 0 45 59 1 0 44 60 1 0 43 61 1 0 42 62 1 0 32 63 1 0 18 64 1 0 11 65 1 0 65 66 1 0 6 67 1 1 67 68 2 0 67 69 1 0 66 2 1 0 65 6 1 0 25 9 1 0 38 31 1 0 59 41 1 0 25 14 1 0 55 48 1 0 22 15 1 0 1 70 1 0 1 71 1 0 1 72 1 0 3 73 1 0 3 74 1 0 3 75 1 0 4 76 1 0 4 77 1 0 5 78 1 0 5 79 1 0 7 80 1 0 7 81 1 0 8 82 1 0 8 83 1 0 10 84 1 0 10 85 1 0 10 86 1 0 12 87 1 0 13 88 1 0 13 89 1 0 14 90 1 6 16 91 1 0 16 92 1 0 16 93 1 0 17 94 1 0 17 95 1 0 18 96 1 6 19 97 1 6 21 98 1 0 21 99 1 0 21100 1 0 22101 1 6 23102 1 0 23103 1 0 24104 1 0 24105 1 0 26106 1 0 26107 1 0 26108 1 0 29109 1 0 31110 1 6 32111 1 1 33112 1 6 34113 1 1 35114 1 6 36115 1 0 36116 1 0 37117 1 0 39118 1 0 41119 1 6 42120 1 1 43121 1 6 44122 1 1 45123 1 6 46124 1 0 46125 1 0 48126 1 6 49127 1 1 50128 1 1 51129 1 6 52130 1 6 53131 1 0 53132 1 0 54133 1 0 56134 1 0 57135 1 0 58136 1 0 60137 1 0 61138 1 0 62139 1 0 63140 1 0 64141 1 0 65142 1 1 66143 1 0 66144 1 0 69145 1 0 M END

Standard InCHIKey	HIZNXZVTIKIPSM-JWTROTHCSA-N
Standard InCHI	InChI=1S/C48H76O21/c1-43(2)11-13-48(42(62)63)14-12-45(4)20(21(48)15-43)7-8-26-44(3)16-22(51)37(47(6,41(60)61)27(44)9-10-46(26,45)5)69-40-35(59)36(30(54)24(18-50)66-40)68-39-34(58)32(56)29(53)25(67-39)19-64-38-33(57)31(55)28(52)23(17-49)65-38/h7,21-40,49-59H,8-19H2,1-6H3,(H,60,61)(H,62,63)/t21-,22-,23+,24+,25+,26+,27+,28+,29+,30+,31-,32-,33+,34+,35+,36-,37-,38+,39-,40-,44+,45+,46+,47?,48-/m0/s1
SMILES	CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H]([C@@H](C(C)([C@@H]5CC[C@@]34C)C(=O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)O3)O)O)O)O)O)[C@@H]2C1)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	988.49	Volume:	946.997 ? Van der Waals volume.
Dense:	1.044	LogP:	-0.347 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.081 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.282 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	46.0
TPSA:	352.51 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	13.0	Rings:	8.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.085	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.478	Fsp³:	0.917
MCE-18:	179.457 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.717	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.017 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.211	Promiscuous compounds:	0.145

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.482	MDCK Permeability:	-5.082
Pgp-inhibitor:	0.0	Pgp-substrate:	0.02
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.359
20% Bioavailability (F20%):	0.01	30% Bioavailability (F30%):	0.748
50% Bioavailability (F50%):	0.879

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.704
Plasma Protein Binding (PPB):	70.641%	Volume Distribution (VD):	-0.521
Fu:	19.542% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.271

Half-life (T1/2):

3.907

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.675	Drug-induced Liver Injury (DILI):	0.956
AMES Toxicity:	0.892	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.068	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.83	Drug-induced Nephrotoxicity:	0.998
Genotoxicity:	0.283	RPMI-8226 Immunitoxicity:	0.073
A549 Cytotoxicity:	0.428	Hek293 Cytotoxicity:	0.057
BCF:	0.493 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.28 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.797 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.75 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1042/BA20020118]
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1556/abot.45.2003.3-4.15]
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[15019787]
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22029392]
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[23517479]
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[37685099]
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota	Latex Exudate	n.a.	n.a.	Database[FooDB]
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota	Seed	n.a.	n.a.	Database[FooDB]
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota	n.a.	n.a.		Database[FooDB]
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO9498	Papaver somniferum	Species	Papaveraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC174237 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22824
0.1-0.2	22510
0.2-0.3	3228
0.3-0.4	985
0.4-0.5	230
0.5-0.6	59
0.6-0.7	20
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.71	Intermediate Similarity	NPC270667
0.6961	Remote Similarity	NPC136877
0.6638	Remote Similarity	NPC219180
0.6422	Remote Similarity	NPC114304
0.641	Remote Similarity	NPC323341
0.6364	Remote Similarity	NPC180550
0.6364	Remote Similarity	NPC35405
0.6356	Remote Similarity	NPC166422
0.6293	Remote Similarity	NPC476992
0.6283	Remote Similarity	NPC276093
0.6228	Remote Similarity	NPC324875
0.6228	Remote Similarity	NPC292677
0.6216	Remote Similarity	NPC473383
0.62	Remote Similarity	NPC204407
0.6195	Remote Similarity	NPC119794
0.6161	Remote Similarity	NPC139044
0.6139	Remote Similarity	NPC606107
0.6116	Remote Similarity	NPC54636
0.6106	Remote Similarity	NPC257468
0.6	Remote Similarity	NPC471385
0.6	Remote Similarity	NPC161717
0.5965	Remote Similarity	NPC609763
0.5963	Remote Similarity	NPC59804
0.5948	Remote Similarity	NPC323359
0.5909	Remote Similarity	NPC127056
0.5897	Remote Similarity	NPC488564
0.5868	Remote Similarity	NPC133818
0.5856	Remote Similarity	NPC472949
0.5833	Remote Similarity	NPC164194
0.582	Remote Similarity	NPC251263
0.5789	Remote Similarity	NPC104400
0.5789	Remote Similarity	NPC10320
0.5776	Remote Similarity	NPC79718
0.5766	Remote Similarity	NPC109079
0.5701	Remote Similarity	NPC284807
0.5625	Remote Similarity	NPC480424
0.5603	Remote Similarity	NPC471383
0.5586	Remote Similarity	NPC12288
0.5583	Remote Similarity	NPC475486
0.5575	Remote Similarity	NPC488561
0.5575	Remote Similarity	NPC488516
0.5556	Remote Similarity	NPC481082
0.5556	Remote Similarity	NPC164419
0.5537	Remote Similarity	NPC62725
0.5536	Remote Similarity	NPC25605
0.5524	Remote Similarity	NPC28198
0.5524	Remote Similarity	NPC476123
0.552	Remote Similarity	NPC191827
0.5421	Remote Similarity	NPC31839
0.5413	Remote Similarity	NPC475633
0.541	Remote Similarity	NPC75287
0.5398	Remote Similarity	NPC174679
0.5398	Remote Similarity	NPC279554
0.5391	Remote Similarity	NPC22956
0.5377	Remote Similarity	NPC283849
0.5372	Remote Similarity	NPC488209
0.536	Remote Similarity	NPC471384
0.5351	Remote Similarity	NPC114441
0.5351	Remote Similarity	NPC150400
0.5344	Remote Similarity	NPC135849
0.5308	Remote Similarity	NPC484942
0.5304	Remote Similarity	NPC6377
0.5304	Remote Similarity	NPC208381
0.5294	Remote Similarity	NPC73829
0.5263	Remote Similarity	NPC56713
0.5259	Remote Similarity	NPC80843
0.5254	Remote Similarity	NPC473459
0.525	Remote Similarity	NPC488515
0.5242	Remote Similarity	NPC288205
0.5242	Remote Similarity	NPC51465
0.5229	Remote Similarity	NPC100383
0.521	Remote Similarity	NPC473405
0.5135	Remote Similarity	NPC209894
0.5111	Remote Similarity	NPC478823
0.5111	Remote Similarity	NPC51564
0.5111	Remote Similarity	NPC478824
0.5077	Remote Similarity	NPC487505
0.504	Remote Similarity	NPC280941
0.504	Remote Similarity	NPC235772
0.5036	Remote Similarity	NPC478825

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC174237 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6889
0.1-0.2	2193
0.2-0.3	62
0.3-0.4	6
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data