22 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
9 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC94355
Formula: C18H24N2O3
Ingredient ID: NPC94355
| Common Name | n.a. |
| IUPAC Name | (E)-4-hydroxy-2-methyl-N-[4-[[(E)-3-phenylprop-2-enoyl]amino]butyl]but-2-enamide |
| Canonical SMILES | OC/C=C(/C(=NCCCCN=C(/C=C/c1ccccc1)O)O)C |
| Standard InCHI | InChI=1S/C18H24N2O3/c1-15(11-14-21)18(23)20-13-6-5-12-19-17(22)10-9-16-7-3-2-4-8-16/h2-4,7-11,21H,5-6,12-14H2,1H3,(H,19,22)(H,20,23)/b10-9+,15-11+ |
| Standard InCHIKey | VRQBQHFFHBFLQO-LVICEBGESA-N |
| Ingredient External Links |
PubChem CID: 10980024 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD83718] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pinus yunnanensis | Pinus | Pinaceae | |
| Salvia trijuga | Salvia | Lamiaceae |
 |
| Erophaca baetica subsp. baetica | Erophaca | Fabaceae | |
| Duguetia chrysocarpa | Duguetia | Annonaceae | |
| Senecio asper | Senecio | Asteraceae | |
| Sechium edule | Sechium | Cucurbitaceae |
 |
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Aglaia dasyclada | Aglaia | Meliaceae | |
| Pyrola media | Pyrola | Ericaceae | |
| Phaseolus coccineus | Phaseolus | Fabaceae |
 |
Ingredient ID: NPC93342
Formula: C39H38O22
Ingredient ID: NPC93342
| Common Name | n.a. |
| IUPAC Name | 3-oxo-3-[[(3S,4S,6S)-3,4,5-trihydroxy-6-[7-hydroxy-3-[(2S,5R)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-5-yl]oxyoxan-2-yl]methoxy]propanoic acid |
| Canonical SMILES | O=C(C=Cc1ccc(cc1)O)OCC1O[C@@H](Oc2cc3c(cc(cc3[o+]c2c2cc(O)c(c(c2)O)O)O)O[C@@H]2OC(COC(=O)CC(=O)O)[C@H]([C@@H](C2O)O)O)C(C([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C39H38O22/c40-17-4-1-15(2-5-17)3-6-28(46)55-13-25-31(49)34(52)36(54)39(61-25)59-24-11-19-22(57-37(24)16-7-20(42)30(48)21(43)8-16)9-18(41)10-23(19)58-38-35(53)33(51)32(50)26(60-38)14-56-29(47)12-27(44)45/h1-11,25-26,31-36,38-39,49-54H,12-14H2,(H5-,40,41,42,43,44,45,46,48)/p+1/t25?,26?,31-,32+,33-,34?,35?,36?,38+,39+/m0/s1 |
| Standard InCHIKey | LXITVYYZHYMDFB-DCRFRZNTSA-O |
| Ingredient External Links |
PubChem CID: 57003757 |
| Plant-Ingredient Association Reference |
Database: TCMID [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Gynostemma pentaphyllum | Gynostemma | Cucurbitaceae |
|
| Hordeum vulgare | Hordeum | Poaceae |
|
| Beta vulgaris | Beta | Chenopodiaceae |
|
| Apium graveolens | Apium | Apiaceae |
|
| Commelina communis | Commelina | Commelinaceae |
|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC90336
Formula: C29H28O9
Ingredient ID: NPC90336
| Common Name | 1-O-Formylaglafoline |
| IUPAC Name | methyl (1R,2R,3S,3aR,8bS)-1-formyloxy-8b-hydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
| Canonical SMILES | O=CO[C@@H]1[C@H](C(=O)OC)[C@H]([C@]2([C@]1(O)c1c(OC)cc(cc1O2)OC)c1ccc(cc1)OC)c1ccccc1 |
| Standard InCHI | InChI=1S/C29H28O9/c1-33-19-12-10-18(11-13-19)29-24(17-8-6-5-7-9-17)23(27(31)36-4)26(37-16-30)28(29,32)25-21(35-3)14-20(34-2)15-22(25)38-29/h5-16,23-24,26,32H,1-4H3/t23-,24-,26-,28+,29+/m1/s1 |
| Standard InCHIKey | HMAGEEKSMOZIOP-IDAMAFBJSA-N |
| Ingredient External Links |
PubChem CID: 10839697 ChEMBL ID: CHEMBL558707 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD99103] Database: NPASS [NPC90336] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pinus yunnanensis | Pinus | Pinaceae | |
| Erophaca baetica subsp. baetica | Erophaca | Fabaceae | |
| Duguetia chrysocarpa | Duguetia | Annonaceae | |
| Senecio asper | Senecio | Asteraceae | |
| Sechium edule | Sechium | Cucurbitaceae |
|
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Aglaia perviridis | Aglaia | Meliaceae |
|
| Aglaia dasyclada | Aglaia | Meliaceae | |
| Pyrola media | Pyrola | Ericaceae | |
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC73844
Formula: C49H86N2O17
Ingredient ID: NPC73844
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CCC(=O)O[C@H]1[C@@H](C)O[C@@H](C[C@]1(C)OC(=O)C)O[C@@H]1[C@@H](C)C(=O)O[C@H](CC)C(C)(C)[C@H](O)[C@@H](C(=O)[C@H](C[C@@]([C@H]([C@@H]1C)O[C@H]1O[C@H](C)C[C@@H]([C@@H]1O)N(C)C)(C)O[C@H]1O[C@H](C)[C@H]([C@@H](C1)N(C)C)O)C)O |
| Standard InCHI | InChI=1S/C49H86N2O17/c1-18-33-47(10,11)42(58)40(57)37(54)24(3)22-48(12,68-35-21-32(51(16)17)38(55)28(7)61-35)43(66-46-39(56)31(50(14)15)20-25(4)60-46)26(5)41(27(6)45(59)63-33)65-36-23-49(13,67-30(9)52)44(29(8)62-36)64-34(53)19-2/h24-29,31-33,35-36,38-44,46,55-58H,18-23H2,1-17H3/t24-,25+,26+,27+,28+,29+,31-,32+,33+,35+,36+,38+,39-,40+,41-,42+,43-,44-,46+,48+,49-/m0/s1 |
| Standard InCHIKey | ZTJIVRKEBWZBTM-HXIRPGALSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD66117] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC73422
Formula: C28H28O8
Ingredient ID: NPC73422
| Common Name | Aglafolin |
| IUPAC Name | methyl (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
| Canonical SMILES | COc1ccc(cc1)[C@]12Oc3c([C@]2(O)[C@@H]([C@@H]([C@H]1c1ccccc1)C(=O)OC)O)c(OC)cc(c3)OC |
| Standard InCHI | InChI=1S/C28H28O8/c1-32-18-12-10-17(11-13-18)28-23(16-8-6-5-7-9-16)22(26(30)35-4)25(29)27(28,31)24-20(34-3)14-19(33-2)15-21(24)36-28/h5-15,22-23,25,29,31H,1-4H3/t22-,23-,25-,27+,28+/m1/s1 |
| Standard InCHIKey | VFTGDXPPYSWBSO-GWNOIRNCSA-N |
| Ingredient External Links |
PubChem CID: 393601 ZINC ID: ZINC000005922875 ChEMBL ID: CHEMBL394528 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC73422] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pinus yunnanensis | Pinus | Pinaceae | |
| Erophaca baetica subsp. baetica | Erophaca | Fabaceae | |
| Duguetia chrysocarpa | Duguetia | Annonaceae | |
| Senecio asper | Senecio | Asteraceae | |
| Sechium edule | Sechium | Cucurbitaceae |
|
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Aglaia odorata | Aglaia | Meliaceae |
|
| Aglaia rubiginosa | Aglaia | Meliaceae | |
| Aglaia perviridis | Aglaia | Meliaceae |
|
| Aglaia dasyclada | Aglaia | Meliaceae | |
| Pyrola media | Pyrola | Ericaceae | |
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC69127
Formula: C28H28O9
Ingredient ID: NPC69127
| Common Name | n.a. |
| IUPAC Name | methyl (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-3a-(3-hydroxy-4-methoxyphenyl)-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
| Canonical SMILES | COc1cc(OC)c2c(c1)O[C@@]1([C@@]2(O)[C@H](O)[C@@H]([C@H]1c1ccccc1)C(=O)OC)c1ccc(c(c1)O)OC |
| Standard InCHI | InChI=1S/C28H28O9/c1-33-17-13-20(35-3)24-21(14-17)37-28(16-10-11-19(34-2)18(29)12-16)23(15-8-6-5-7-9-15)22(26(31)36-4)25(30)27(24,28)32/h5-14,22-23,25,29-30,32H,1-4H3/t22-,23-,25-,27+,28+/m1/s1 |
| Standard InCHIKey | MKTMWKCGQTXSNC-GWNOIRNCSA-N |
| Ingredient External Links |
PubChem CID: 10815498 ZINC ID: ZINC000014687595 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pinus yunnanensis | Pinus | Pinaceae | |
| Duguetia chrysocarpa | Duguetia | Annonaceae | |
| Sechium edule | Sechium | Cucurbitaceae |
|
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC62392
Formula: C18H26N2O3
Ingredient ID: NPC62392
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OCC[C@@H](C(=NCCCCN=C(/C=C/c1ccccc1)O)O)C |
| Standard InCHI | InChI=1S/C18H26N2O3/c1-15(11-14-21)18(23)20-13-6-5-12-19-17(22)10-9-16-7-3-2-4-8-16/h2-4,7-10,15,21H,5-6,11-14H2,1H3,(H,19,22)(H,20,23)/b10-9+/t15-/m0/s1 |
| Standard InCHIKey | AZFOWFPALBQOTD-FEAKQIBJSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD137080] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pinus yunnanensis | Pinus | Pinaceae | |
| Duguetia chrysocarpa | Duguetia | Annonaceae | |
| Sechium edule | Sechium | Cucurbitaceae |
|
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC3343
Formula: C3H4O4
Ingredient ID: NPC3343
| Common Name | Malonic Acid |
| IUPAC Name | propanedioic acid |
| Canonical SMILES | OC(=O)CC(=O)O |
| Standard InCHI | InChI=1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7) |
| Standard InCHIKey | OFOBLEOULBTSOW-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 867;23511544 ChEMBL ID: CHEMBL7942 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC3343] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Angelica gigas | Angelica | Apiaceae |
|
| Coleostephus myconis | Coleostephus | Asteraceae |
|
| Gynostemma pentaphyllum | Gynostemma | Cucurbitaceae |
|
| Angelica sinensis | Angelica | Apiaceae |
|
| Synotis alata | Synotis | Asteraceae | |
| Hordeum vulgare | Hordeum | Poaceae |
|
| Beta vulgaris | Beta | Chenopodiaceae |
|
| Apium graveolens | Apium | Apiaceae |
|
| Panax ginseng | Panax | Araliaceae |
|
| Angelica acutiloba | Angelica | Apiaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Dahlia pinnata | Dahlia | Asteraceae |
|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC295219
Formula: C17H24N2O3
Ingredient ID: NPC295219
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@@H](C(=NCCCCN=C(/C=C/c1ccccc1)O)O)C |
| Standard InCHI | InChI=1S/C17H24N2O3/c1-14(13-20)17(22)19-12-6-5-11-18-16(21)10-9-15-7-3-2-4-8-15/h2-4,7-10,14,20H,5-6,11-13H2,1H3,(H,18,21)(H,19,22)/b10-9+/t14-/m0/s1 |
| Standard InCHIKey | YDWIIBRQNZACSH-HBWSCVEGSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD60156] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pinus yunnanensis | Pinus | Pinaceae | |
| Duguetia chrysocarpa | Duguetia | Annonaceae | |
| Sechium edule | Sechium | Cucurbitaceae |
|
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC281034
Formula: C29H28O10
Ingredient ID: NPC281034
| Common Name | n.a. |
| IUPAC Name | methyl (1R,2R,3S,3aR,8bS)-1-formyloxy-8b-hydroxy-3a-(3-hydroxy-4-methoxyphenyl)-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
| Canonical SMILES | O=CO[C@@H]1[C@H](C(=O)OC)[C@H]([C@]2([C@]1(O)c1c(OC)cc(cc1O2)OC)c1ccc(c(c1)O)OC)c1ccccc1 |
| Standard InCHI | InChI=1S/C29H28O10/c1-34-18-13-21(36-3)25-22(14-18)39-29(17-10-11-20(35-2)19(31)12-17)24(16-8-6-5-7-9-16)23(27(32)37-4)26(38-15-30)28(25,29)33/h5-15,23-24,26,31,33H,1-4H3/t23-,24-,26-,28+,29+/m1/s1 |
| Standard InCHIKey | XPXOKOTZMIKMIQ-IDAMAFBJSA-N |
| Ingredient External Links |
PubChem CID: 10650033 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD42596] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pinus yunnanensis | Pinus | Pinaceae | |
| Duguetia chrysocarpa | Duguetia | Annonaceae | |
| Sechium edule | Sechium | Cucurbitaceae |
|
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC263955
Formula: C29H26O10
Ingredient ID: NPC263955
| Common Name | Methyl 1-Formyloxy-4'-Demethoxy-3',4'-Methylenedioxyrocaglate |
| IUPAC Name | methyl (1R,2R,3S,3aR,8bS)-3a-(1,3-benzodioxol-5-yl)-1-formyloxy-8b-hydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
| Canonical SMILES | O=CO[C@@H]1[C@H](C(=O)OC)[C@H]([C@]2([C@]1(O)c1c(OC)cc(cc1O2)OC)c1ccc2c(c1)OCO2)c1ccccc1 |
| Standard InCHI | InChI=1S/C29H26O10/c1-33-18-12-21(34-2)25-22(13-18)39-29(17-9-10-19-20(11-17)38-15-37-19)24(16-7-5-4-6-8-16)23(27(31)35-3)26(36-14-30)28(25,29)32/h4-14,23-24,26,32H,15H2,1-3H3/t23-,24-,26-,28+,29+/m1/s1 |
| Standard InCHIKey | XKYRDXZNJADCQR-IDAMAFBJSA-N |
| Ingredient External Links |
PubChem CID: 10721063 ChEMBL ID: CHEMBL2331811 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD132112] Database: NPASS [NPC263955] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pinus yunnanensis | Pinus | Pinaceae | |
| Duguetia chrysocarpa | Duguetia | Annonaceae | |
| Sechium edule | Sechium | Cucurbitaceae |
|
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Aglaia perviridis | Aglaia | Meliaceae |
|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC256606
Formula: C15H20O5
Ingredient ID: NPC256606
| Common Name | n.a. |
| IUPAC Name | (2E,4E)-5-[(1R,5R,8S)-8-hydroxy-1,5-dimethyl-3-oxo-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid |
| Canonical SMILES | OC(=O)/C=C(/C=C/[C@]1(O)[C@@]2(C)CO[C@]1(C)CC(=O)C2)C |
| Standard InCHI | InChI=1S/C15H20O5/c1-10(6-12(17)18)4-5-15(19)13(2)7-11(16)8-14(15,3)20-9-13/h4-6,19H,7-9H2,1-3H3,(H,17,18)/b5-4+,10-6+/t13-,14-,15+/m1/s1 |
| Standard InCHIKey | IZGYIFFQBZWOLJ-UWXFGITNSA-N |
| Ingredient External Links |
PubChem CID: 14525182 |
| Plant-Ingredient Association Reference |
Database: TCMID [17031] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC23593
Formula: C28H26O9
Ingredient ID: NPC23593
| Common Name | Methyl (1R,2R,3S,3Ar,8Bs)-3A-(1,3-Benzodioxol-5-Yl)-1,8B-Dihydroxy-6,8-Dimethoxy-3-Phenyl-2,3-Dihydro-1H-Cyclopenta[B][1]Benzofuran-2-Carboxylate |
| IUPAC Name | methyl (1R,2R,3S,3aR,8bS)-3a-(1,3-benzodioxol-5-yl)-1,8b-dihydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
| Canonical SMILES | COC(=O)[C@@H]1[C@@H](c2ccccc2)[C@]2([C@]([C@@H]1O)(O)c1c(O2)cc(cc1OC)OC)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C28H26O9/c1-32-17-12-20(33-2)24-21(13-17)37-28(16-9-10-18-19(11-16)36-14-35-18)23(15-7-5-4-6-8-15)22(26(30)34-3)25(29)27(24,28)31/h4-13,22-23,25,29,31H,14H2,1-3H3/t22-,23-,25-,27+,28+/m1/s1 |
| Standard InCHIKey | SAGBWAVFZFVBBQ-GWNOIRNCSA-N |
| Ingredient External Links |
PubChem CID: 390507 ZINC ID: ZINC000005838849 ChEMBL ID: CHEMBL1986494 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC23593] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pinus yunnanensis | Pinus | Pinaceae | |
| Erophaca baetica subsp. baetica | Erophaca | Fabaceae | |
| Duguetia chrysocarpa | Duguetia | Annonaceae | |
| Senecio asper | Senecio | Asteraceae | |
| Sechium edule | Sechium | Cucurbitaceae |
|
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Aglaia perviridis | Aglaia | Meliaceae |
|
| Aglaia dasyclada | Aglaia | Meliaceae | |
| Pyrola media | Pyrola | Ericaceae | |
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC207824
Formula: C18H21NO3
Ingredient ID: NPC207824
| Common Name | Norarmepavine |
| IUPAC Name | 4-[[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]phenol |
| Canonical SMILES | COc1cc2[C@@H](NCCc2cc1OC)Cc1ccc(cc1)O |
| Standard InCHI | InChI=1S/C18H21NO3/c1-21-17-10-13-7-8-19-16(15(13)11-18(17)22-2)9-12-3-5-14(20)6-4-12/h3-6,10-11,16,19-20H,7-9H2,1-2H3/t16-/m0/s1 |
| Standard InCHIKey | NKBBUUNAVOMVER-INIZCTEOSA-N |
| Ingredient External Links |
PubChem CID: 6999736 ZINC ID: ZINC000024717722 ChEMBL ID: CHEMBL453038 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC207824] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pisum sativum | Pisum | Fabaceae |
|
| Albizia julibrissin | Albizia | Fabaceae |
|
| Cheilanthes mysurensis | Cheilanthes | Pteridaceae | |
| Myristica argentea | Myristica | Myristicaceae |
|
| Lonchocarpus urucu | Lonchocarpus | Fabaceae | |
| Portulaca oleracea | Portulaca | Portulacaceae |
|
| Artemisia arbuscula | Artemisia | Asteraceae |
|
| Mimosa pudica | Mimosa | Fabaceae |
|
| Aconitum fauriei | Aconitum | Ranunculaceae | |
| Citrus reshni | Citrus | Rutaceae |
|
| Dacrycarpus imbricatus | Dacrycarpus | Podocarpaceae | |
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC189730
Formula: C26H24O7
Ingredient ID: NPC189730
| Common Name | 4'-Demethoxy-3',4'-Methylenedioxyrocaglaol |
| IUPAC Name | (1R,3S,3aR,8bS)-3a-(1,3-benzodioxol-5-yl)-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
| Canonical SMILES | COc1cc2O[C@@]3([C@@](c2c(c1)OC)(O)[C@@H](C[C@H]3c1ccccc1)O)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C26H24O7/c1-29-17-11-21(30-2)24-22(12-17)33-26(16-8-9-19-20(10-16)32-14-31-19)18(13-23(27)25(24,26)28)15-6-4-3-5-7-15/h3-12,18,23,27-28H,13-14H2,1-2H3/t18-,23+,25+,26-/m0/s1 |
| Standard InCHIKey | ZPHNJERYFDKEMS-LHVBDCGNSA-N |
| Ingredient External Links |
PubChem CID: 10623340 ChEMBL ID: CHEMBL2332223 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD21925] Database: NPASS [NPC189730] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pinus yunnanensis | Pinus | Pinaceae | |
| Duguetia chrysocarpa | Duguetia | Annonaceae | |
| Sechium edule | Sechium | Cucurbitaceae |
|
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Aglaia perviridis | Aglaia | Meliaceae |
|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC184607
Formula: C26H26O6
Ingredient ID: NPC184607
| Common Name | Rocaglaol |
| IUPAC Name | (1R,3S,3aR,8bS)-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
| Canonical SMILES | COc1ccc(cc1)[C@]12Oc3c([C@]2(O)[C@@H](C[C@H]1c1ccccc1)O)c(OC)cc(c3)OC |
| Standard InCHI | InChI=1S/C26H26O6/c1-29-18-11-9-17(10-12-18)26-20(16-7-5-4-6-8-16)15-23(27)25(26,28)24-21(31-3)13-19(30-2)14-22(24)32-26/h4-14,20,23,27-28H,15H2,1-3H3/t20-,23+,25+,26-/m0/s1 |
| Standard InCHIKey | RRVZOJQBRVGMMK-HCBGRYSISA-N |
| Ingredient External Links |
PubChem CID: 393602 ChEMBL ID: CHEMBL468454 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD24520] Database: NPASS [NPC184607] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pinus yunnanensis | Pinus | Pinaceae | |
| Erophaca baetica subsp. baetica | Erophaca | Fabaceae | |
| Duguetia chrysocarpa | Duguetia | Annonaceae | |
| Senecio asper | Senecio | Asteraceae | |
| Sechium edule | Sechium | Cucurbitaceae |
|
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Aglaia odorata | Aglaia | Meliaceae |
|
| Aglaia perviridis | Aglaia | Meliaceae |
|
| Aglaia laxiflora | Aglaia | Meliaceae |
|
| Aglaia dasyclada | Aglaia | Meliaceae | |
| Pyrola media | Pyrola | Ericaceae | |
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC169207
Formula: C8H11NO3
Ingredient ID: NPC169207
| Common Name | Norepinephrine |
| IUPAC Name | 4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol |
| Canonical SMILES | NC[C@@H](c1ccc(c(c1)O)O)O |
| Standard InCHI | InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2/t8-/m0/s1 |
| Standard InCHIKey | SFLSHLFXELFNJZ-QMMMGPOBSA-N |
| Ingredient External Links |
PubChem CID: 439260 ChEMBL ID: CHEMBL1437 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC169207] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pisum sativum | Pisum | Fabaceae |
|
| Albizia julibrissin | Albizia | Fabaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Portulaca oleracea | Portulaca | Portulacaceae |
|
| Mimosa pudica | Mimosa | Fabaceae |
|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC167667
Formula: C29H30O9
Ingredient ID: NPC167667
| Common Name | n.a. |
| IUPAC Name | methyl (1R,2R,3S,3aR,8bS)-3a-(3,4-dimethoxyphenyl)-1,8b-dihydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
| Canonical SMILES | COc1cc(OC)c2c(c1)O[C@@]1([C@@]2(O)[C@H](O)[C@@H]([C@H]1c1ccccc1)C(=O)OC)c1ccc(c(c1)OC)OC |
| Standard InCHI | InChI=1S/C29H30O9/c1-33-18-14-21(36-4)25-22(15-18)38-29(17-11-12-19(34-2)20(13-17)35-3)24(16-9-7-6-8-10-16)23(27(31)37-5)26(30)28(25,29)32/h6-15,23-24,26,30,32H,1-5H3/t23-,24-,26-,28+,29+/m1/s1 |
| Standard InCHIKey | OWHOEKLNSDNYTQ-IDAMAFBJSA-N |
| Ingredient External Links |
PubChem CID: 10720804 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD79517] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pinus yunnanensis | Pinus | Pinaceae | |
| Duguetia chrysocarpa | Duguetia | Annonaceae | |
| Sechium edule | Sechium | Cucurbitaceae |
|
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC164843
Formula: C35H36N2O9
Ingredient ID: NPC164843
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1c2OCOc2cc2c1[C@]1(O)C(=O)[C@@H]([C@H]([C@@]1(O2)c1ccc(cc1)OC)c1ccccc1)C(=O)N1CCC[C@@H]1N=C(C(C)C)O |
| Standard InCHI | InChI=1S/C35H36N2O9/c1-19(2)32(39)36-25-11-8-16-37(25)33(40)26-27(20-9-6-5-7-10-20)35(21-12-14-22(42-3)15-13-21)34(41,31(26)38)28-23(46-35)17-24-29(30(28)43-4)45-18-44-24/h5-7,9-10,12-15,17,19,25-27,41H,8,11,16,18H2,1-4H3,(H,36,39)/t25-,26-,27-,34+,35+/m1/s1 |
| Standard InCHIKey | BJIDEXYWQKFHOB-QPRNYPETSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD67667] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pinus yunnanensis | Pinus | Pinaceae | |
| Duguetia chrysocarpa | Duguetia | Annonaceae | |
| Sechium edule | Sechium | Cucurbitaceae |
|
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC154012
Formula: C47H84N2O16
Ingredient ID: NPC154012
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CCC(=O)O[C@H]1[C@H](C)O[C@@H](C[C@]1(C)O)O[C@@H]1[C@H](C)C(=O)O[C@@H](CC)C(C)(C)[C@H](O)[C@H](C(=O)[C@@H](C[C@]([C@@H]([C@@H]1C)O[C@H]1O[C@@H](C)C[C@H]([C@@H]1O)N(C)C)(C)O[C@H]1O[C@H](C)[C@@H]([C@H](C1)N(C)C)O)C)O |
| Standard InCHI | InChI=1S/C47H84N2O16/c1-17-31-45(9,10)40(55)38(54)35(51)23(3)21-47(12,65-33-20-30(49(15)16)36(52)27(7)59-33)41(64-44-37(53)29(48(13)14)19-24(4)58-44)25(5)39(26(6)43(56)61-31)63-34-22-46(11,57)42(28(8)60-34)62-32(50)18-2/h23-31,33-34,36-42,44,52-55,57H,17-22H2,1-16H3/t23-,24+,25-,26+,27-,28+,29-,30+,31+,33-,34-,36+,37+,38+,39+,40-,41-,42+,44-,46+,47+/m1/s1 |
| Standard InCHIKey | YMCXDRDWSJHHGE-NPLAKZGISA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD75988] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC137967
Formula: C48H84N2O17
Ingredient ID: NPC137967
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC[C@@H]1OC(=O)[C@@H](C)[C@@H](O[C@H]2O[C@@H](C)[C@H]([C@](C2)(C)OC(=O)C)OC(=O)C)[C@@H](C)[C@@H](O[C@H]2O[C@H](C)C[C@H]([C@H]2O)N(C)C)[C@@](C[C@H](C(=O)[C@@H]([C@H](C1(C)C)O)O)C)(C)O[C@@H]1O[C@@H](C)[C@H]([C@H](C1)N(C)C)O |
| Standard InCHI | InChI=1S/C48H84N2O17/c1-18-33-46(10,11)41(57)39(56)36(53)23(2)21-47(12,67-34-20-32(50(16)17)37(54)27(6)60-34)42(65-45-38(55)31(49(14)15)19-24(3)59-45)25(4)40(26(5)44(58)63-33)64-35-22-48(13,66-30(9)52)43(28(7)61-35)62-29(8)51/h23-28,31-35,37-43,45,54-57H,18-22H2,1-17H3/t23-,24-,25-,26+,27+,28+,31-,32+,33+,34+,35-,37-,38-,39+,40+,41-,42-,43-,45-,47+,48-/m1/s1 |
| Standard InCHIKey | VFMCQWHSZUWDKN-MGLQBNBWSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD164453] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
Ingredient ID: NPC136275
Formula: C30H28O10
Ingredient ID: NPC136275
| Common Name | n.a. |
| IUPAC Name | methyl (1R,2R,3S,3aR,8bS)-1-acetyloxy-3a-(1,3-benzodioxol-5-yl)-8b-hydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
| Canonical SMILES | COC(=O)[C@@H]1[C@@H](c2ccccc2)[C@]2([C@]([C@@H]1OC(=O)C)(O)c1c(O2)cc(cc1OC)OC)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C30H28O10/c1-16(31)39-27-24(28(32)36-4)25(17-8-6-5-7-9-17)30(18-10-11-20-21(12-18)38-15-37-20)29(27,33)26-22(35-3)13-19(34-2)14-23(26)40-30/h5-14,24-25,27,33H,15H2,1-4H3/t24-,25-,27-,29+,30+/m1/s1 |
| Standard InCHIKey | LKTVHWYLAFQHAX-KKPOPCGDSA-N |
| Ingredient External Links |
PubChem CID: 10697870 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD85860] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pinus yunnanensis | Pinus | Pinaceae | |
| Duguetia chrysocarpa | Duguetia | Annonaceae | |
| Sechium edule | Sechium | Cucurbitaceae |
|
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Phaseolus coccineus | Phaseolus | Fabaceae |
|
