NPASS Compound

Natural Product: NPC149072

Natural Product ID	NPC149072
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	ZYPUEOGJHLWGGM-AIZHKWPGSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	101103168
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 145152 0 0 0 0 0 0 0 0999 V2000 -1.5792 -2.6446 4.2136 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4212 -2.0424 2.8058 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7487 -0.7330 2.9667 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3783 0.3813 2.1866 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9121 -0.0964 0.8478 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3440 1.1010 0.0674 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6253 0.9103 -0.7159 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7421 0.7027 0.3133 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7561 1.8884 1.1921 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3683 -0.5869 0.9692 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3295 -1.3200 1.4938 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7795 -0.9494 1.4773 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0932 0.1392 0.5200 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.5053 0.0550 -0.0599 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8158 -1.1742 -0.7970 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3907 0.0471 1.2022 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8293 0.2537 0.8781 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0367 1.5196 0.1006 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.1866 1.5970 -1.1451 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.7442 0.7474 -2.2198 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2969 3.0468 -1.6065 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6839 3.2327 -1.8371 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7581 1.3611 -0.7559 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7559 1.7126 -1.8154 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3905 1.8056 -1.1124 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0572 0.5034 -0.4669 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7415 -0.4843 -1.5314 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7360 0.8662 -2.8880 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.3719 1.7369 -0.1329 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9851 -1.1049 1.0386 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7824 -2.0322 2.2008 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0558 -3.4953 1.8078 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8094 -0.7358 0.0533 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9394 -1.9062 -0.3114 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3529 -0.0764 -0.2935 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3684 -0.6882 -1.0358 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6717 -0.0442 -2.3359 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8899 -0.6475 -2.9639 C 0 0 2 0 0 0 0 0 0 0 0 0 3.2961 -1.9473 -2.3472 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2230 -1.9109 -0.8719 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3214 -2.4819 -0.0735 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3431 -1.7838 0.3973 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1139 -1.0734 -0.4632 C 0 0 1 0 0 0 0 0 0 0 0 0 6.2872 0.3685 -0.0701 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6577 0.9242 -0.3725 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7488 0.0612 0.2321 C 0 0 1 0 0 0 0 0 0 0 0 0 8.3521 -1.4097 0.1892 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2652 -2.0221 1.5554 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1625 -1.7021 2.2918 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3561 -1.7020 -0.6769 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9027 0.3259 -0.5028 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9108 0.9162 0.2145 C 0 0 1 0 0 0 0 0 0 0 0 0 12.0586 -0.0730 0.3248 C 0 0 1 0 0 0 0 0 0 0 0 0 13.2974 0.5884 0.8928 C 0 0 1 0 0 0 0 0 0 0 0 0 13.6331 1.8666 0.1732 C 0 0 2 0 0 0 0 0 0 0 0 0 12.5675 2.1114 -0.8782 C 0 0 2 0 0 0 0 0 0 0 0 0 12.8175 3.4644 -1.4875 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3213 2.1420 -0.2549 O 0 0 0 0 0 0 0 0 0 0 0 0 14.8614 1.8253 -0.4787 O 0 0 0 0 0 0 0 0 0 0 0 0 13.1583 0.7824 2.2647 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7313 -1.1260 1.1772 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7317 2.2089 0.1086 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3545 1.2301 -0.6192 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5799 -0.7995 -0.3317 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3810 -2.9158 -2.9021 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9393 0.2691 -3.0926 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6069 -0.2252 -3.2550 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1227 -3.6183 4.0715 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6078 -2.8618 4.6541 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2273 -1.9950 4.8158 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8018 -2.8034 2.2691 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3058 -0.8427 2.5756 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6125 -0.4385 4.0358 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6547 1.1953 2.0442 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2215 0.7566 2.7681 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3547 2.0041 0.7200 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5783 1.3784 -0.7247 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7702 1.8225 -1.3103 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4576 0.0039 -1.3322 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3151 1.6880 2.2004 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7428 2.3388 1.4227 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2046 2.7546 0.7101 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1509 -2.2883 2.0010 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3940 -1.8681 1.3236 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0011 -0.6878 2.5579 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2204 1.0623 1.1768 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1124 -2.0321 -0.5773 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8102 -1.6198 -0.4798 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9351 -1.0790 -1.8992 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0657 0.8428 1.9015 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2911 -0.9339 1.7200 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3510 0.4093 1.8667 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3335 -0.6019 0.4137 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6793 2.3607 0.7631 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0985 0.6291 -3.1023 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6541 1.2951 -2.6179 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1740 -0.2262 -1.8723 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8610 3.1220 -2.6439 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8888 3.7666 -0.9011 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0631 3.8869 -1.2093 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5695 2.1354 0.0592 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9528 2.7270 -2.1736 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4574 2.6702 -0.4510 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6878 2.0950 -1.9369 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2034 0.0832 -2.3516 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0316 -1.2802 -1.2190 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5633 -0.9677 -2.0414 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5867 1.3312 -3.7282 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7930 2.3377 0.5612 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9117 -1.7927 0.1250 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4949 -1.7838 3.0229 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5005 -3.5128 0.7825 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0901 -4.0620 1.6856 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6215 -4.0378 2.5636 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0354 -1.7396 -1.2540 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8918 1.0543 -2.2394 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6366 -0.9039 -4.0482 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2615 -2.3005 -2.7811 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3472 -2.7183 -0.6711 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6410 -3.4262 -0.6264 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8200 -2.9654 0.8530 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6635 -1.1007 -1.4714 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1632 0.5043 1.0479 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7667 0.9510 -1.4763 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8292 0.3705 1.2923 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2785 -1.9064 -0.2596 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4444 -3.1114 1.4538 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1647 -1.6412 2.1243 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3240 -0.9087 2.8962 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5521 1.0572 1.2721 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2569 -0.5095 -0.6747 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1407 -0.1160 0.7438 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6336 2.6771 0.9196 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6105 1.2924 -1.6057 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7139 3.9679 -1.0392 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9672 4.1681 -1.3500 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9608 3.3096 -2.5820 H 0 0 0 0 0 0 0 0 0 0 0 0 14.8146 1.3704 -1.3555 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7626 0.2181 2.7999 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4955 -1.4508 1.6940 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0379 2.8633 -0.5678 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7571 1.7501 -1.3801 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3292 -3.6881 -2.3089 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6056 -0.0644 -3.7444 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6952 -1.1247 -3.6927 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 1 8 10 1 0 10 11 2 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 6 14 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 6 19 21 1 0 21 22 1 0 19 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 6 24 28 1 0 18 29 1 0 10 30 1 0 30 31 1 0 31 32 1 0 5 33 1 6 33 34 2 0 33 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 47 50 1 0 46 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 56 58 1 0 55 59 1 0 54 60 1 0 53 61 1 0 45 62 1 0 44 63 1 0 40 64 1 0 39 65 1 0 38 66 1 0 37 67 1 0 31 2 1 0 64 36 1 0 30 5 1 0 50 43 1 0 58 52 1 0 26 8 1 0 26 13 1 0 23 14 1 0 1 68 1 0 1 69 1 0 1 70 1 0 2 71 1 6 3 72 1 0 3 73 1 0 4 74 1 0 4 75 1 0 6 76 1 0 6 77 1 0 7 78 1 0 7 79 1 0 9 80 1 0 9 81 1 0 9 82 1 0 11 83 1 0 12 84 1 0 12 85 1 0 13 86 1 1 15 87 1 0 15 88 1 0 15 89 1 0 16 90 1 0 16 91 1 0 17 92 1 0 17 93 1 0 18 94 1 1 20 95 1 0 20 96 1 0 20 97 1 0 21 98 1 0 21 99 1 0 22100 1 0 23101 1 1 24102 1 6 25103 1 0 25104 1 0 27105 1 0 27106 1 0 27107 1 0 28108 1 0 29109 1 0 30110 1 6 31111 1 1 32112 1 0 32113 1 0 32114 1 0 36115 1 6 37116 1 1 38117 1 6 39118 1 1 40119 1 6 41120 1 0 41121 1 0 43122 1 6 44123 1 1 45124 1 6 46125 1 1 47126 1 6 48127 1 0 48128 1 0 49129 1 0 52130 1 1 53131 1 6 54132 1 1 55133 1 1 56134 1 6 57135 1 0 57136 1 0 57137 1 0 59138 1 0 60139 1 0 61140 1 0 62141 1 0 63142 1 0 65143 1 0 66144 1 0 67145 1 0 M END

Standard InCHIKey	ZYPUEOGJHLWGGM-AIZHKWPGSA-N
Standard InCHI	InChI=1S/C48H78O19/c1-20-10-13-48(15-14-46(6)23(29(48)21(20)2)8-9-27-44(4)12-11-28(52)45(5,19-50)39(44)24(51)16-47(27,46)7)43(61)67-42-36(59)33(56)31(54)26(65-42)18-62-40-37(60)34(57)38(25(17-49)64-40)66-41-35(58)32(55)30(53)22(3)63-41/h8,20-22,24-42,49-60H,9-19H2,1-7H3/t20-,21+,22+,24-,25-,26-,27-,28+,29+,30+,31-,32-,33+,34-,35-,36-,37-,38-,39-,40-,41+,42+,44-,45-,46-,47-,48+/m1/s1
SMILES	C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H]([C@@](C)(CO)[C@@H]5[C@@H](C[C@@]34C)O)O)[C@@H]2[C@H]1C)C(=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)O)O)O1)O)O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO11144	Centella asiatica	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[ 17560738]
NPO11144	Centella asiatica	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1007/s11816-015-0350-y]
NPO11144	Centella asiatica	Species	Apiaceae	Eukaryota	n.a.	aerial part	n.a.	PMID[17520525]
NPO11144	Centella asiatica	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22966846]
NPO11144	Centella asiatica	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO11144	Centella asiatica	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO11144	Centella asiatica	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[MetaboLights]
NPO11144	Centella asiatica	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO11144	Centella asiatica	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO11144	Centella asiatica	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO11144	Centella asiatica	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC149072 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22348
0.1-0.2	23065
0.2-0.3	3474
0.3-0.4	759
0.4-0.5	153
0.5-0.6	47
0.6-0.7	7
0.7-0.8	0
0.8-0.85	0
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8854	High Similarity	NPC601659
0.8542	High Similarity	NPC101744
0.7921	Intermediate Similarity	NPC134835
0.717	Intermediate Similarity	NPC73318
0.6952	Remote Similarity	NPC102439
0.6698	Remote Similarity	NPC104071
0.6273	Remote Similarity	NPC148417
0.614	Remote Similarity	NPC241909
0.6	Remote Similarity	NPC295823
0.6	Remote Similarity	NPC174720
0.6	Remote Similarity	NPC475467
0.5932	Remote Similarity	NPC76972
0.5932	Remote Similarity	NPC469782
0.5932	Remote Similarity	NPC204414
0.5882	Remote Similarity	NPC192600
0.5818	Remote Similarity	NPC1876
0.5798	Remote Similarity	NPC60557
0.5798	Remote Similarity	NPC67857
0.5785	Remote Similarity	NPC155410
0.5784	Remote Similarity	NPC306746
0.5738	Remote Similarity	NPC100639
0.5702	Remote Similarity	NPC165204
0.5673	Remote Similarity	NPC110139
0.5673	Remote Similarity	NPC108709
0.5664	Remote Similarity	NPC137414
0.5656	Remote Similarity	NPC135904
0.5648	Remote Similarity	NPC29069
0.561	Remote Similarity	NPC475160
0.561	Remote Similarity	NPC473714
0.5596	Remote Similarity	NPC179434
0.5565	Remote Similarity	NPC488560
0.5517	Remote Similarity	NPC469822
0.5469	Remote Similarity	NPC65105
0.5433	Remote Similarity	NPC110633
0.5426	Remote Similarity	NPC202828
0.5426	Remote Similarity	NPC119592
0.5391	Remote Similarity	NPC258617
0.5385	Remote Similarity	NPC298034
0.5385	Remote Similarity	NPC71065
0.5354	Remote Similarity	NPC476068
0.5349	Remote Similarity	NPC43550
0.5308	Remote Similarity	NPC136768
0.5308	Remote Similarity	NPC236638
0.5308	Remote Similarity	NPC294453
0.5308	Remote Similarity	NPC305981
0.5276	Remote Similarity	NPC481080
0.5267	Remote Similarity	NPC261506
0.5267	Remote Similarity	NPC4328
0.521	Remote Similarity	NPC469821
0.5164	Remote Similarity	NPC473826
0.5154	Remote Similarity	NPC41061
0.5154	Remote Similarity	NPC227551
0.5149	Remote Similarity	NPC250247
0.5086	Remote Similarity	NPC473343
0.5044	Remote Similarity	NPC48499
0.5043	Remote Similarity	NPC473373
0.5039	Remote Similarity	NPC475209
0.5038	Remote Similarity	NPC475514

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC149072 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7477
0.1-0.2	1623
0.2-0.3	43
0.3-0.4	7
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data