NPASS Compound

Natural Product: NPC108112

Natural Product ID	NPC108112
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	YWTUZIXCNQDLDQ-LODRMGMJSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	21637700
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 146153 0 0 0 0 0 0 0 0999 V2000 5.6203 1.3694 3.9323 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4163 1.8194 2.4685 C 0 0 1 0 0 0 0 0 0 0 0 0 6.6824 1.5881 1.7432 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5803 0.5814 0.6527 C 0 0 2 0 0 0 0 0 0 0 0 0 5.5009 -0.4038 0.9495 C 0 0 2 0 0 0 0 0 0 0 0 0 4.2050 0.4193 1.0057 C 0 0 1 0 0 0 0 0 0 0 0 0 4.2680 1.2557 2.0501 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0275 1.0281 -0.2372 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9135 0.4975 -0.9301 C 0 0 2 0 0 0 0 0 0 0 0 0 3.3739 -0.1805 -2.2030 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4756 0.7464 -3.3802 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2471 1.5923 -3.4462 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1826 2.3470 -2.2792 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8803 1.5429 -1.1700 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6416 0.9554 -1.2882 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3166 1.4069 -0.3815 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3127 2.1573 -1.2022 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7126 2.1707 -0.7296 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1252 0.6956 -0.5326 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8196 0.0225 -1.8091 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3133 0.2676 0.6659 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8095 -0.9527 1.3402 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2720 -0.7782 1.7498 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1069 -0.4684 0.5252 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2653 -1.7164 -0.2871 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5791 0.7192 -0.2060 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4566 1.0909 -1.3426 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8091 0.4597 -1.2904 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3578 -0.0938 -0.2264 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7109 -0.6885 -0.3035 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.6158 0.2170 -1.1179 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0166 -0.4142 -1.2120 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8215 0.5672 -2.0724 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9143 -1.6842 -2.0212 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6281 -0.6017 0.1316 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6242 -0.4136 1.2019 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3053 -1.1234 0.9879 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.4845 -0.8244 2.2212 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0186 -0.9910 2.0646 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5115 -0.0784 1.0188 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5140 1.3334 1.5579 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5401 -2.6129 1.0316 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6927 -3.0224 1.2611 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4904 -3.4937 0.8190 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8253 0.2655 0.4180 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3032 -1.0567 -0.0814 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1919 0.4459 1.8135 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5518 1.6339 2.3909 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4618 -0.0745 -4.5329 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5686 -1.2750 -2.4830 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6136 -1.0260 2.1858 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7983 -0.0264 0.3562 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2723 0.2489 -0.9200 C 0 0 1 0 0 0 0 0 0 0 0 0 9.5486 1.0347 -0.7523 C 0 0 1 0 0 0 0 0 0 0 0 0 10.6825 0.1682 -0.2518 C 0 0 2 0 0 0 0 0 0 0 0 0 10.4360 -1.2919 -0.5796 C 0 0 1 0 0 0 0 0 0 0 0 0 9.6936 -1.3094 -1.8885 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3887 -0.9170 -1.6273 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5620 -2.0961 -0.5083 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7321 -3.1573 0.3548 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8238 -3.4479 1.1441 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9855 -3.9289 0.3282 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8822 0.3770 1.1151 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0844 0.8910 1.5742 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9821 1.1584 0.7061 O 0 0 0 0 0 0 0 0 0 0 0 0 12.3676 1.1382 2.9954 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9129 1.7193 -1.9237 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0407 2.8250 1.1396 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6464 2.2116 4.6293 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8418 0.6329 4.2345 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5754 0.8154 3.9704 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2018 2.9320 2.5867 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5072 1.3540 2.4666 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2798 1.1377 -0.2755 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3760 -1.1361 0.1281 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3766 -0.3222 1.1490 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4957 -0.2912 -0.2746 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3929 -0.6168 -1.9812 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4138 1.3070 -3.4280 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3139 2.2998 -4.2840 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3635 0.9349 -3.5709 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8583 2.2424 -0.3147 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2406 2.1819 0.2282 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9844 3.2225 -1.3262 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3337 1.7777 -2.2687 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3342 2.6645 -1.4779 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8235 2.6258 0.2819 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0490 0.7455 -2.6506 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3516 -0.8927 -2.0509 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7413 -0.1926 -1.9693 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4802 1.1085 1.4135 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7519 -1.8832 0.7939 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2692 -1.0801 2.3063 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4025 -0.0538 2.5578 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6029 -1.7726 2.1215 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4102 -2.4255 -0.2162 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1340 -2.3425 0.0845 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4969 -1.5672 -1.3534 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6726 1.5765 0.5445 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5649 2.2078 -1.3810 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0349 0.8308 -2.3393 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3742 0.4664 -2.2350 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6717 -1.6367 -0.9445 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2601 0.1338 -2.1897 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6591 1.2458 -0.7612 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3922 0.4782 -3.0949 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6715 1.6154 -1.7542 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8781 0.2707 -2.1238 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9275 -1.7908 -2.5374 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1497 -2.5945 -1.4128 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6780 -1.7170 -2.8505 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0797 -1.6017 0.1809 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4049 0.2030 0.2483 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9832 -0.7772 2.2091 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3735 0.6593 1.3919 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8170 0.1385 2.6308 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8039 -1.5767 3.0062 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5613 -0.6488 3.0432 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7552 -2.0457 1.9874 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5983 2.1119 0.7719 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4289 1.4872 2.1835 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6789 1.5074 2.2766 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6330 -4.4826 1.0396 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3080 -0.9528 -1.0010 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0822 -1.7978 -0.3357 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3585 -1.5853 0.6479 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9259 0.4715 1.7091 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4037 -0.3781 2.4890 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6295 1.5207 3.3518 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8957 0.3993 -5.2932 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7507 -1.0370 -2.9762 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9832 -1.8094 2.1570 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5206 0.9511 -1.3847 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3904 1.8322 0.0024 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5904 0.4729 -0.8054 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6992 -1.6591 0.1934 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6229 -2.3365 -2.3364 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1022 -0.5662 -2.6133 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4411 -3.8138 -0.6799 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6503 -3.5214 1.1194 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7323 -4.9991 0.4820 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1433 1.9125 3.0946 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4486 1.5085 3.4778 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7373 0.1944 3.4807 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1373 1.7121 -2.5428 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1755 3.1951 0.8044 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 6 19 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 6 24 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 32 34 1 0 32 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 1 37 42 1 6 42 43 2 0 42 44 1 0 21 45 1 0 45 46 1 6 45 47 1 0 47 48 1 0 11 49 1 0 10 50 1 0 5 51 1 0 4 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 56 59 1 0 59 60 1 0 60 61 2 0 60 62 1 0 55 63 1 0 63 64 1 0 64 65 2 0 64 66 1 0 54 67 1 0 3 68 1 0 7 2 1 0 14 9 1 0 45 16 1 0 58 53 1 0 26 19 1 0 40 29 1 0 40 24 1 0 37 30 1 0 1 69 1 0 1 70 1 0 1 71 1 0 2 72 1 1 3 73 1 1 4 74 1 6 5 75 1 6 6 76 1 1 9 77 1 1 10 78 1 1 11 79 1 1 12 80 1 0 12 81 1 0 14 82 1 1 16 83 1 1 17 84 1 0 17 85 1 0 18 86 1 0 18 87 1 0 20 88 1 0 20 89 1 0 20 90 1 0 21 91 1 1 22 92 1 0 22 93 1 0 23 94 1 0 23 95 1 0 25 96 1 0 25 97 1 0 25 98 1 0 26 99 1 1 27100 1 0 27101 1 0 28102 1 0 30103 1 6 31104 1 0 31105 1 0 33106 1 0 33107 1 0 33108 1 0 34109 1 0 34110 1 0 34111 1 0 35112 1 0 35113 1 0 36114 1 0 36115 1 0 38116 1 0 38117 1 0 39118 1 0 39119 1 0 41120 1 0 41121 1 0 41122 1 0 44123 1 0 46124 1 0 46125 1 0 46126 1 0 47127 1 0 47128 1 0 48129 1 0 49130 1 0 50131 1 0 51132 1 0 53133 1 6 54134 1 1 55135 1 6 56136 1 1 57137 1 0 57138 1 0 62139 1 0 62140 1 0 62141 1 0 66142 1 0 66143 1 0 66144 1 0 67145 1 0 68146 1 0 M END

Standard InCHIKey	YWTUZIXCNQDLDQ-LODRMGMJSA-N
Standard InCHI	InChI=1S/C50H78O18/c1-24-34(55)39(67-41-36(57)38(65-26(3)53)30(22-62-41)64-25(2)52)37(58)42(63-24)68-40-35(56)29(54)21-61-43(40)66-33-13-14-46(6)31(47(33,7)23-51)12-15-49(9)32(46)11-10-27-28-20-45(4,5)16-18-50(28,44(59)60)19-17-48(27,49)8/h10,24,28-43,51,54-58H,11-23H2,1-9H3,(H,59,60)/t24-,28-,29-,30+,31+,32+,33-,34-,35-,36+,37+,38-,39+,40+,41-,42-,43-,46-,47-,48+,49+,50-/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@H]([C@H](CO[C@H]1O[C@H]1CC[C@@]2(C)[C@@H](CC[C@]3(C)[C@@H]2CC=C2[C@@H]4CC(C)(C)CC[C@@]4(CC[C@@]32C)C(=O)O)[C@]1(C)CO)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H](CO1)OC(=O)C)OC(=O)C)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	966.52	Volume:	952.582 ? Van der Waals volume.
Dense:	1.015	LogP:	1.951 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.367 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.876 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	47.0
TPSA:	266.66 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	7.0	Rings:	8.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.094	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.416	Fsp³:	0.9
MCE-18:	172.421 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.985	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.007 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.179	Promiscuous compounds:	0.243

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.915	MDCK Permeability:	-5.196
Pgp-inhibitor:	0.0	Pgp-substrate:	0.006
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.024
20% Bioavailability (F20%):	0.083	30% Bioavailability (F30%):	0.821
50% Bioavailability (F50%):	0.996

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	0.935
Plasma Protein Binding (PPB):	74.16%	Volume Distribution (VD):	-0.586
Fu:	16.851% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.024

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.001	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.209	CYP3A4-substrate:	0.05
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.469
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.236

Half-life (T1/2):

3.043

ADMET: Toxicity

hERG Blockers:	0.008	hERG Blockers (10um):	0.015
Human Hepatotoxicity (H-HT):	0.723	Drug-induced Liver Injury (DILI):	0.958
AMES Toxicity:	0.644	Rat Oral Acute Toxicity:	0.037
Maximum Recommended Daily Dose:	0.018	Skin Sensitization:	0.999
Carcinogencity:	0.288	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.027
Drug-induced Neurotoxicity:	0.003	Ototoxicity:	0.985
Hematotoxicity:	0.621	Drug-induced Nephrotoxicity:	0.975
Genotoxicity:	0.662	RPMI-8226 Immunitoxicity:	0.097
A549 Cytotoxicity:	0.472	Hek293 Cytotoxicity:	0.314
BCF:	0.354 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.507 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.441 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.396 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO957	Sapindus mukorossi	Species	Sapindaceae	Eukaryota	Galls	n.a.	n.a.	PMID[16724837]
NPO957	Sapindus mukorossi	Species	Sapindaceae	Eukaryota	n.a.	gall	n.a.	PMID[17827775]
NPO957	Sapindus mukorossi	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO957	Sapindus mukorossi	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO957	Sapindus mukorossi	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO18854	Jamesonia scammaniae	Species	Pteridaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO957	Sapindus mukorossi	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO5621	Arisaema erubescens	Species	Araceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO957	Sapindus mukorossi	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO6496	Strongylosoma tambanum	Species	Paradoxosomatidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO18854	Jamesonia scammaniae	Species	Pteridaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO2814	Peperomia amplexicaulis	Species	Piperaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO1081	Parochetus communis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO5621	Arisaema erubescens	Species	Araceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO4690	Aphloia theiformis	Species	Aphloiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC108112 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20859
0.1-0.2	24917
0.2-0.3	2992
0.3-0.4	758
0.4-0.5	241
0.5-0.6	58
0.6-0.7	18
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7905	Intermediate Similarity	NPC276093
0.75	Intermediate Similarity	NPC133818
0.7383	Intermediate Similarity	NPC481082
0.7383	Intermediate Similarity	NPC164419
0.7339	Intermediate Similarity	NPC324875
0.7339	Intermediate Similarity	NPC292677
0.7282	Intermediate Similarity	NPC174679
0.7282	Intermediate Similarity	NPC279554
0.713	Intermediate Similarity	NPC219180
0.7043	Intermediate Similarity	NPC323341
0.6983	Remote Similarity	NPC251263
0.6952	Remote Similarity	NPC59804
0.686	Remote Similarity	NPC161717
0.6721	Remote Similarity	NPC471385
0.6699	Remote Similarity	NPC473538
0.6636	Remote Similarity	NPC56713
0.6555	Remote Similarity	NPC166422
0.6538	Remote Similarity	NPC284807
0.6422	Remote Similarity	NPC127056
0.6372	Remote Similarity	NPC139044
0.6372	Remote Similarity	NPC471383
0.6325	Remote Similarity	NPC475486
0.6311	Remote Similarity	NPC54636
0.6204	Remote Similarity	NPC270667
0.6091	Remote Similarity	NPC12288
0.6058	Remote Similarity	NPC28198
0.6058	Remote Similarity	NPC476123
0.6034	Remote Similarity	NPC475504
0.5913	Remote Similarity	NPC114304
0.5897	Remote Similarity	NPC257468
0.5882	Remote Similarity	NPC323359
0.5862	Remote Similarity	NPC104400
0.5862	Remote Similarity	NPC10320
0.5818	Remote Similarity	NPC475611
0.5804	Remote Similarity	NPC136877
0.5789	Remote Similarity	NPC488561
0.5738	Remote Similarity	NPC280941
0.5738	Remote Similarity	NPC235772
0.569	Remote Similarity	NPC469945
0.566	Remote Similarity	NPC204407
0.5614	Remote Similarity	NPC25605
0.5593	Remote Similarity	NPC180550
0.5593	Remote Similarity	NPC35405
0.5574	Remote Similarity	NPC488564
0.5573	Remote Similarity	NPC293330
0.5565	Remote Similarity	NPC476992
0.5556	Remote Similarity	NPC471384
0.553	Remote Similarity	NPC202828
0.553	Remote Similarity	NPC119592
0.55	Remote Similarity	NPC73829
0.5489	Remote Similarity	NPC298034
0.5489	Remote Similarity	NPC71065
0.5487	Remote Similarity	NPC164194
0.547	Remote Similarity	NPC80843
0.5463	Remote Similarity	NPC283849
0.5455	Remote Similarity	NPC100383
0.5455	Remote Similarity	NPC79718
0.5417	Remote Similarity	NPC91838
0.54	Remote Similarity	NPC120840
0.5385	Remote Similarity	NPC6377
0.5385	Remote Similarity	NPC208381
0.536	Remote Similarity	NPC62725
0.5354	Remote Similarity	NPC79643
0.5328	Remote Similarity	NPC119794
0.5323	Remote Similarity	NPC488209
0.5299	Remote Similarity	NPC114441
0.5299	Remote Similarity	NPC109079
0.528	Remote Similarity	NPC481078
0.5276	Remote Similarity	NPC475287
0.5271	Remote Similarity	NPC123199
0.5254	Remote Similarity	NPC472949
0.521	Remote Similarity	NPC22956
0.5182	Remote Similarity	NPC606107
0.5175	Remote Similarity	NPC191410
0.5152	Remote Similarity	NPC488211
0.5149	Remote Similarity	NPC41061
0.5149	Remote Similarity	NPC227551
0.5074	Remote Similarity	NPC236638
0.5074	Remote Similarity	NPC294453
0.5074	Remote Similarity	NPC305981
0.5072	Remote Similarity	NPC488212
0.5039	Remote Similarity	NPC76972
0.5039	Remote Similarity	NPC469782
0.5039	Remote Similarity	NPC204414
0.5036	Remote Similarity	NPC261506
0.5036	Remote Similarity	NPC4328

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC108112 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6365
0.1-0.2	2740
0.2-0.3	40
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data