15 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
7 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC94943
Formula: C18H19NO
Ingredient ID: NPC94943
| Common Name | Siamenol |
| IUPAC Name | 6-methyl-3-(3-methylbut-2-enyl)-9H-carbazol-2-ol |
| Canonical SMILES | CC(=CCc1cc2c(cc1O)[nH]c1c2cc(C)cc1)C |
| Standard InCHI | InChI=1S/C18H19NO/c1-11(2)4-6-13-9-15-14-8-12(3)5-7-16(14)19-17(15)10-18(13)20/h4-5,7-10,19-20H,6H2,1-3H3 |
| Standard InCHIKey | BBPNJGRZPSCZBB-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 477436 ChEMBL ID: CHEMBL444482 |
| Plant-Ingredient Association Reference |
PMID: 10757740 Database: NPASS [NPC94943] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya siamensis | Murraya | Rutaceae |
 |
Ingredient ID: NPC47517
Formula: C27H44O4
Ingredient ID: NPC47517
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C[C@@H]1CC[C@@]2(OC1)OC1C([C@@H]2C)[C@@]2([C@@H](C1)C1CC[C@@H]3[C@](C1CC2)(C)C[C@H]([C@@H](C3)O)O)C |
| Standard InCHI | InChI=1S/C27H44O4/c1-15-7-10-27(30-14-15)16(2)24-23(31-27)12-20-18-6-5-17-11-21(28)22(29)13-26(17,4)19(18)8-9-25(20,24)3/h15-24,28-29H,5-14H2,1-4H3/t15-,16+,17+,18?,19?,20+,21-,22-,23?,24?,25+,26+,27-/m1/s1 |
| Standard InCHIKey | FWCXELAAYFYCSR-AIGCNLGPSA-N |
| Ingredient External Links |
PubChem CID: 10025825 |
| Plant-Ingredient Association Reference |
Database: TCMID [8456] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya siamensis | Murraya | Rutaceae |
|
| Hosta sieboldiana | Hosta | Asparagaceae |
 |
| Tribulus terrestris | Tribulus | Zygophyllaceae |
|
| Trigonella foenum-graecum | Trigonella | Fabaceae |
 |
Ingredient ID: NPC43787
Formula: C18H17NO
Ingredient ID: NPC43787
| Common Name | Grinimibine |
| IUPAC Name | 3,3,5-trimethyl-11H-pyrano[3,2-a]carbazole |
| Canonical SMILES | Cc1cc2c(c3c1OC(C)(C)C=C3)[nH]c1c2cccc1 |
| Standard InCHI | InChI=1S/C18H17NO/c1-11-10-14-12-6-4-5-7-15(12)19-16(14)13-8-9-18(2,3)20-17(11)13/h4-10,19H,1-3H3 |
| Standard InCHIKey | GAEQWKVGMHUUKO-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 96943 ChEMBL ID: CHEMBL1477760 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC43787] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya siamensis | Murraya | Rutaceae |
|
| Clausena vestita | Clausena | Rutaceae | |
| Clausena harmandiana | Clausena | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Panax ginseng | Panax | Araliaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae | |
| Murraya koenigii | Murraya | Rutaceae |
|
Ingredient ID: NPC302107
Formula: C9H6O4
Ingredient ID: NPC302107
| Common Name | 5,7-Dihydroxycoumarin |
| IUPAC Name | 5,7-dihydroxychromen-2-one |
| Canonical SMILES | Oc1cc(O)c2c(c1)oc(=O)cc2 |
| Standard InCHI | InChI=1S/C9H6O4/c10-5-3-7(11)6-1-2-9(12)13-8(6)4-5/h1-4,10-11H |
| Standard InCHIKey | KIQQFVJHWNCGAU-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5324654 ZINC ID: ZINC000006093474 ChEMBL ID: CHEMBL156000 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC302107] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Libanothamnus occultus | Libanothamnus | Asteraceae | |
| Hylotelephium telephium | Hylotelephium | Crassulaceae |
|
| Murraya siamensis | Murraya | Rutaceae |
|
| Carica pennata | Carica | Caricaceae | |
| Astragalus cibarius | Astragalus | Fabaceae |
|
| Veratrum dahuricum | Veratrum | Melanthiaceae | |
| Vernonia menthaefolia | Vernonia | Asteraceae | |
| Aconitum heterophylloides | Aconitum | Ranunculaceae | |
| Morus alba | Morus | Moraceae |
|
Ingredient ID: NPC296115
Formula: C16H16O5
Ingredient ID: NPC296115
| Common Name | n.a. |
| IUPAC Name | 2-[(8S)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl acetate |
| Canonical SMILES | CC(=O)OC([C@H]1Oc2c(C1)c1oc(=O)ccc1cc2)(C)C |
| Standard InCHI | InChI=1S/C16H16O5/c1-9(17)21-16(2,3)13-8-11-12(19-13)6-4-10-5-7-14(18)20-15(10)11/h4-7,13H,8H2,1-3H3/t13-/m0/s1 |
| Standard InCHIKey | IQTTZQQJJBEAIM-ZDUSSCGKSA-N |
| Ingredient External Links |
PubChem CID: 161409 ZINC ID: ZINC000005166472 |
| Plant-Ingredient Association Reference |
Database: TCMID [40231] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Torilis japonica | Torilis | Apiaceae |
|
| Cnidium monnieri | Cnidium | Apiaceae |
|
| Murraya siamensis | Murraya | Rutaceae |
|
| Angelica pubescens | Angelica | Apiaceae |
|
| Hansenia weberbaueriana | Hansenia | Apiaceae | |
| Hansenia forbesii | Hansenia | Apiaceae | |
| Aralia continentalis | Aralia | Araliaceae |
|
| Cnidium monieri | Cnidium | Apiaceae |
Ingredient ID: NPC276043
Formula: C19H20O7
Ingredient ID: NPC276043
| Common Name | n.a. |
| IUPAC Name | 2-[2-hydroxy-1-(4-methyl-5-oxooxolan-2-yl)propan-2-yl]-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-9-one |
| Canonical SMILES | O=C1OC(CC1C)CC(C1COc2c(O1)c1oc(=O)ccc1cc2)(O)C |
| Standard InCHI | InChI=1S/C19H20O7/c1-10-7-12(24-18(10)21)8-19(2,22)14-9-23-13-5-3-11-4-6-15(20)26-16(11)17(13)25-14/h3-6,10,12,14,22H,7-9H2,1-2H3 |
| Standard InCHIKey | OXBZEUQGKLXVSR-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 11473870 |
| Plant-Ingredient Association Reference |
Database: TCMID [15108] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya siamensis | Murraya | Rutaceae |
|
Ingredient ID: NPC247803
Formula: C14H11NO3
Ingredient ID: NPC247803
| Common Name | 2-Hydroxy-3-Formyl-7-Methoxycarbazole |
| IUPAC Name | 2-hydroxy-7-methoxy-9H-carbazole-3-carbaldehyde |
| Canonical SMILES | COc1ccc2c(c1)[nH]c1c2cc(c(c1)O)C=O |
| Standard InCHI | InChI=1S/C14H11NO3/c1-18-9-2-3-10-11-4-8(7-16)14(17)6-13(11)15-12(10)5-9/h2-7,15,17H,1H3 |
| Standard InCHIKey | JLWFCPLXNANORV-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 189687 ChEMBL ID: CHEMBL463264 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC247803] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya siamensis | Murraya | Rutaceae |
|
| Clausena vestita | Clausena | Rutaceae | |
| Clausena excavata | Clausena | Rutaceae |
|
| Tetradium ruticarpum | Tetradium | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC24615
Formula: C20H26O6
Ingredient ID: NPC24615
| Common Name | n.a. |
| IUPAC Name | [3-hydroxy-1-(7-methoxy-2-oxochromen-8-yl)-3-methylbutan-2-yl] 3-methylbutanoate |
| Canonical SMILES | COc1ccc2c(c1CC(C(O)(C)C)OC(=O)CC(C)C)oc(=O)cc2 |
| Standard InCHI | InChI=1S/C20H26O6/c1-12(2)10-18(22)25-16(20(3,4)23)11-14-15(24-5)8-6-13-7-9-17(21)26-19(13)14/h6-9,12,16,23H,10-11H2,1-5H3 |
| Standard InCHIKey | XAKVHDMPRFGESG-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 621354 |
| Plant-Ingredient Association Reference |
Database: TCMID [15113] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya exotica | Murraya | Rutaceae |
|
| Murraya siamensis | Murraya | Rutaceae |
|
| Clausena excavata | Clausena | Rutaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Murraya koenigii | Murraya | Rutaceae |
|
Ingredient ID: NPC241341
Formula: C20H24O4
Ingredient ID: NPC241341
| Common Name | 7-[(2E)-3,7-Dimethylocta-2,6-Dienoxy]-6-Methoxychromen-2-One |
| IUPAC Name | 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one |
| Canonical SMILES | COc1cc2ccc(=O)oc2cc1OC/C=C(/CCC=C(C)C)C |
| Standard InCHI | InChI=1S/C20H24O4/c1-14(2)6-5-7-15(3)10-11-23-19-13-17-16(12-18(19)22-4)8-9-20(21)24-17/h6,8-10,12-13H,5,7,11H2,1-4H3/b15-10+ |
| Standard InCHIKey | NLNMITFNBJXRRP-XNTDXEJSSA-N |
| Ingredient External Links |
PubChem CID: 5319406 ZINC ID: ZINC000015253754 ChEMBL ID: CHEMBL2346913 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC241341] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya siamensis | Murraya | Rutaceae |
|
| Artemisia scoparia | Artemisia | Asteraceae |
|
| Citrus trifoliata | Citrus | Rutaceae |
|
| Aegle marmelos | Aegle | Rutaceae |
|
| Rosa transmorrisonensis | Rosa | Rosaceae |
Ingredient ID: NPC205934
Formula: C23H25NO
Ingredient ID: NPC205934
| Common Name | Mahanimbine |
| IUPAC Name | 3,5-dimethyl-3-(4-methylpent-3-enyl)-11H-pyrano[3,2-a]carbazole |
| Canonical SMILES | CC(=CCCC1(C)C=Cc2c(O1)c(C)cc1c2[nH]c2c1cccc2)C |
| Standard InCHI | InChI=1S/C23H25NO/c1-15(2)8-7-12-23(4)13-11-18-21-19(14-16(3)22(18)25-23)17-9-5-6-10-20(17)24-21/h5-6,8-11,13-14,24H,7,12H2,1-4H3 |
| Standard InCHIKey | HTNVFUBCWIYPJN-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 167963 ChEMBL ID: CHEMBL495873 |
| Plant-Ingredient Association Reference |
PMID: 10757740 Database: NPASS [NPC205934] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya exotica | Murraya | Rutaceae |
|
| Murraya siamensis | Murraya | Rutaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Murraya euchrestifolia | Murraya | Rutaceae | |
| Murraya koenigii | Murraya | Rutaceae |
|
Ingredient ID: NPC190007
Formula: C23H27NO
Ingredient ID: NPC190007
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C/C(=CCc1c(O)c(C)cc2c1[nH]c1c2cccc1)/CCC=C(C)C |
| Standard InCHI | InChI=1S/C23H27NO/c1-15(2)8-7-9-16(3)12-13-19-22-20(14-17(4)23(19)25)18-10-5-6-11-21(18)24-22/h5-6,8,10-12,14,24-25H,7,9,13H2,1-4H3/b16-12+ |
| Standard InCHIKey | JSSIAXXILAGJKE-FOWTUZBSSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
PMID: 10757740 Database: NPASS [NPC190007] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya siamensis | Murraya | Rutaceae |
|
Ingredient ID: NPC187501
Formula: C14H11NO2
Ingredient ID: NPC187501
| Common Name | Murrayanine |
| IUPAC Name | 1-methoxy-9H-carbazole-3-carbaldehyde |
| Canonical SMILES | COc1cc(C=O)cc2c1[nH]c1c2cccc1 |
| Standard InCHI | InChI=1S/C14H11NO2/c1-17-13-7-9(8-16)6-11-10-4-2-3-5-12(10)15-14(11)13/h2-8,15H,1H3 |
| Standard InCHIKey | FWNZQNAJETXQPP-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 96942 ChEMBL ID: CHEMBL1689802 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC187501] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya siamensis | Murraya | Rutaceae |
|
| Clausena excavata | Clausena | Rutaceae |
|
| Clausena harmandiana | Clausena | Rutaceae |
|
| Clausena lansium | Clausena | Rutaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Murraya koenigii | Murraya | Rutaceae |
|
Ingredient ID: NPC178101
Formula: C11H12O3
Ingredient ID: NPC178101
| Common Name | n.a. |
| IUPAC Name | methyl (2R)-2-methyl-2,3-dihydro-1-benzofuran-7-carboxylate |
| Canonical SMILES | COC(=O)c1cccc2c1O[C@@H](C2)C |
| Standard InCHI | InChI=1S/C11H12O3/c1-7-6-8-4-3-5-9(10(8)14-7)11(12)13-2/h3-5,7H,6H2,1-2H3/t7-/m1/s1 |
| Standard InCHIKey | IDJNUGNMQBIGAJ-SSDOTTSWSA-N |
| Ingredient External Links |
PubChem CID: 92449358 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD190380] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya siamensis | Murraya | Rutaceae |
|
| Berberis koreana | Berberis | Berberidaceae |
|
Ingredient ID: NPC162803
Formula: C19H18O7
Ingredient ID: NPC162803
| Common Name | n.a. |
| IUPAC Name | 8-hydroxy-7-[[3-methyl-3-[(4-methylidene-5-oxooxolan-2-yl)methyl]oxiran-2-yl]methoxy]chromen-2-one |
| Canonical SMILES | O=c1ccc2c(o1)c(O)c(cc2)OCC1OC1(C)CC1CC(=C)C(=O)O1 |
| Standard InCHI | InChI=1S/C19H18O7/c1-10-7-12(24-18(10)22)8-19(2)14(26-19)9-23-13-5-3-11-4-6-15(20)25-17(11)16(13)21/h3-6,12,14,21H,1,7-9H2,2H3 |
| Standard InCHIKey | RYBFLVMGRQCAQI-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 10383752 |
| Plant-Ingredient Association Reference |
Database: TCMID [15106] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya siamensis | Murraya | Rutaceae |
|
Ingredient ID: NPC100576
Formula: C30H31NO7
Ingredient ID: NPC100576
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@H]1[C@@H](Oc2c1c1[nH]c3c(c1cc2OC)cc(c1c3C=CC(O1)(C)C)C)c1cc(OC)c(c(c1)OC)O |
| Standard InCHI | InChI=1S/C30H31NO7/c1-14-9-17-18-12-22(36-6)29-23(25(18)31-24(17)16-7-8-30(2,3)38-27(14)16)19(13-32)28(37-29)15-10-20(34-4)26(33)21(11-15)35-5/h7-12,19,28,31-33H,13H2,1-6H3/t19-,28+/m1/s1 |
| Standard InCHIKey | XEHPAUJBOXMPQU-GDJIYFAZSA-N |
| Ingredient External Links |
PubChem CID: 638195 |
| Plant-Ingredient Association Reference |
Database: TCMID [15110] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya kwangsiensis | Murraya | Rutaceae |
|
| Murraya siamensis | Murraya | Rutaceae |
|
| Clausena excavata | Clausena | Rutaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Murraya euchrestifolia | Murraya | Rutaceae | |
| Murraya koenigii | Murraya | Rutaceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC100576 | C30H31NO7 | 517.2100523 | -0.4456 | 3.88 | 2.78 | 2 | 3 | 102.4 | 5 | 6 | 38 | 0 | |
| NPC162803 | C19H18O7 | 358.1052529 | 0.3057 | 2.78 | 1.698 | 7 | 1 | 94.59 | 5 | 4 | 26 | 0 | |
| NPC178101 | C11H12O3 | 192.0786442 | -0.0796 | 2.34 | 2.972 | 3 | 0 | 35.53 | 2 | 2 | 14 | 0 | |
| NPC187501 | C14H11NO2 | Murrayanine | 225.08 | -0.6646 | 2.67 | 3.074 | 2 | 1 | 42.09 | 3 | 3 | 17 | 0 |
| NPC190007 | C23H27NO | 333.21 | 2.8709 | 3.77 | 6.308 | 1 | 2 | 36.02 | 10 | 3 | 25 | 1 | |
| NPC205934 | C23H25NO | Mahanimbine | 331.19 | 2.7573 | 3.77 | 6.132 | 1 | 1 | 25.02 | 7 | 4 | 25 | 1 |
| NPC241341 | C20H24O4 | 7-[(2E)-3,7-Dimethylocta-2,6-Dienoxy]-6-Methoxychromen-2-One | 328.17 | 2.8641 | 3.22 | 4.63 | 1 | 0 | 44.76 | 11 | 2 | 24 | 0 |
| NPC24615 | C20H26O6 | [3-hydroxy-1-(7-methoxy-2-oxochromen-8-yl)-3-methylbutan-2-yl] 3-methylbutanoate | 362.1729386 | 0.8806 | 3 | 3.664 | 4 | 1 | 82.06 | 8 | 2 | 26 | 0 |
| NPC247803 | C14H11NO3 | 2-Hydroxy-3-Formyl-7-Methoxycarbazole | 241.07 | -1.1249 | 2.56 | 2.329 | 2 | 2 | 62.32 | 4 | 3 | 18 | 0 |
| NPC276043 | C19H20O7 | 360.120903 | 0.2818 | 2.78 | 1.876 | 7 | 1 | 91.29 | 3 | 4 | 26 | 0 | |
| NPC296115 | C16H16O5 | 2-[(8S)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl acetate | 288.0997736 | 0.6408 | 2.67 | 2.833 | 3 | 0 | 61.83 | 3 | 3 | 21 | 0 |
| NPC302107 | C9H6O4 | 5,7-Dihydroxycoumarin | 178.03 | -0.6506 | 2.01 | 0.569 | 1 | 2 | 66.76 | 2 | 2 | 13 | 0 |
| NPC43787 | C18H17NO | Grinimibine | 263.13 | 1.1294 | 3.22 | 4.416 | 1 | 1 | 25.02 | 3 | 4 | 20 | 0 |
| NPC47517 | C27H44O4 | 432.3239599 | 0.1181 | 3.99 | 6.494 | 4 | 2 | 58.92 | 0 | 6 | 31 | 1 | |
| NPC94943 | C18H19NO | Siamenol | 265.15 | 1.6387 | 3.22 | 4.697 | 1 | 2 | 36.02 | 6 | 3 | 20 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
