NPASS Compound

Natural Product: NPC515009

Natural Product ID	NPC515009
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{S},6~{R})-4,5-dihydroxy-6-(hydroxymethyl)-2-[[(9~{S},13~{R},16~{S})-6-hydroxy-7,9,13-trimethyl-6-[(3~{R})-3-methyl-4-[(2~{R},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-butyl]-5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-en-16-yl]oxy]tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
IUPAC Name	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{S},6~{R})-4,5-dihydroxy-6-(hydroxymethyl)-2-[[(9~{S},13~{R},16~{S})-6-hydroxy-7,9,13-trimethyl-6-[(3~{R})-3-methyl-4-[(2~{R},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-butyl]-5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-en-16-yl]oxy]tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 137144 0 0 0 0 0 0 0 0999 V2000 5.1136 -1.6093 -0.7437 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1268 -0.6234 -0.1974 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9777 -1.4391 0.3467 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6928 -0.7862 1.6557 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4843 0.1120 1.4439 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1963 0.0414 -0.0287 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2086 0.3236 -0.4297 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8922 1.1995 0.5665 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2381 0.7563 0.9688 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9961 -0.1129 0.2963 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3403 -0.4488 0.8524 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0731 -1.4114 -0.0492 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4949 -0.8083 -1.2029 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8786 -0.8937 -1.4351 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.0573 -1.6458 -2.5647 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1580 -1.2544 -3.2719 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.4591 -2.3344 -4.2924 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7046 -3.5134 -3.6071 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8073 0.0529 -3.9647 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8901 0.4902 -4.7050 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3234 1.0609 -2.9382 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0240 1.4642 -3.2253 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4347 0.5052 -1.5464 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.7186 0.5887 -1.0020 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7489 1.3468 0.1784 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.1313 0.5918 1.2559 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2530 1.0110 1.8789 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.4646 0.1479 3.1264 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1592 2.4451 2.3862 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.4218 2.8801 2.7692 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6833 3.3380 1.2508 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3786 3.7181 1.5196 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6600 2.5123 -0.0327 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2865 3.3209 -1.1093 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0367 -2.5160 -0.3561 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1265 -1.9286 -1.4270 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4459 -0.6733 -0.9429 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5283 0.3336 -2.1045 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9742 -0.9320 -0.7508 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6399 -2.0455 0.1772 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8059 -2.4351 -0.0125 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7070 -1.3206 -0.4398 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9166 -1.3047 -1.9241 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8232 -0.1133 2.0564 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5574 0.2274 0.9225 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2151 1.5842 0.6866 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0318 0.2447 1.2486 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2863 1.1530 2.4040 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6749 1.2557 2.9097 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2177 -0.0706 3.3965 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6166 2.0114 2.0615 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9859 1.6780 0.8239 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8103 0.5903 0.7331 C 0 0 2 0 0 0 0 0 0 0 0 0 11.1732 1.1740 0.5551 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0144 0.1148 0.8504 C 0 0 2 0 0 0 0 0 0 0 0 0 13.4223 0.5561 1.1657 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2077 -0.5839 1.4532 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0193 -0.9186 -0.2547 C 0 0 1 0 0 0 0 0 0 0 0 0 12.7258 -2.0424 0.2280 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6182 -1.3584 -0.5205 C 0 0 2 0 0 0 0 0 0 0 0 0 10.5197 -2.0139 -1.7481 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6453 -0.1597 -0.5414 C 0 0 1 0 0 0 0 0 0 0 0 0 8.3895 -0.6627 -0.7641 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9980 -1.8025 -0.1456 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4803 -1.2433 -1.7431 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5925 -2.5806 -1.0352 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7958 0.0446 -1.0282 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2315 -2.5121 0.4823 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5060 -1.5860 2.4054 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7700 1.1140 1.7921 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6822 -0.3222 2.0745 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8763 0.7892 -0.5150 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1809 0.9023 -1.4033 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0231 2.2563 0.1810 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2911 1.3670 1.5073 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6455 1.1788 1.8934 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9327 0.4583 1.0475 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1844 -0.9928 1.8319 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9107 -1.8513 0.5192 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3022 -1.4511 -0.5789 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0292 -1.0529 -2.6226 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5307 -2.5152 -4.8884 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2895 -1.9940 -4.9208 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8997 -3.3361 -2.6552 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9814 -0.1654 -4.6613 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7228 0.1553 -4.2398 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9741 1.9433 -3.0196 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5742 0.8172 -3.8478 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7904 1.1204 -0.8849 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7265 1.7385 0.4139 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1931 0.9083 1.2983 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5058 0.2973 3.5076 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3755 -0.9159 2.8820 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8015 0.5026 3.9385 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4824 2.5554 3.2514 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4336 3.8098 3.0750 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3171 4.2296 1.1788 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1330 4.4973 0.9316 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6950 2.1485 -0.1982 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3004 3.3500 -1.1051 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5196 -3.4038 -0.8027 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5154 -2.7058 0.5828 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4348 -2.7166 -1.7743 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7982 -1.7247 -2.3074 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5337 1.3622 -1.7473 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4421 0.1721 -2.7114 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6687 0.1239 -2.8095 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6208 -1.2769 -1.7726 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9215 -1.8771 1.2234 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2430 -2.9472 -0.1405 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1256 -2.8848 0.9635 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9005 -3.2691 -0.7472 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4565 -2.1994 -2.4395 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4946 -0.4059 -2.4203 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9750 -1.3332 -2.2476 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9902 2.0550 1.5116 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5654 0.7476 0.3743 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5106 -0.7117 1.3854 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6401 0.8904 3.2978 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9548 2.2159 2.1849 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6303 1.8735 3.8958 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2231 0.0176 3.8315 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5663 -0.3239 4.3045 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1548 -0.8884 2.6879 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5596 2.2302 2.7156 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1878 3.0788 1.9964 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9863 0.0247 1.6391 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6093 -0.3977 1.7499 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4700 1.1929 2.0631 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9029 1.0726 0.3138 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7311 -1.1325 2.1274 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5282 -0.5615 -1.1763 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5436 -2.2137 -0.3287 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2661 -2.0109 0.2963 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3637 -2.9720 -1.5581 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9645 0.5403 -1.3656 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3526 -1.2588 -1.5493 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 16 19 1 0 19 20 1 0 19 21 1 0 21 22 1 0 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 12 35 1 0 35 36 1 0 36 37 1 0 37 38 1 6 37 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 6 4 44 1 0 44 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 49 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 55 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 60 62 1 0 62 63 1 0 45 2 1 0 62 53 1 0 42 3 1 0 42 6 1 0 39 7 1 0 37 10 1 0 23 14 1 0 33 25 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 0 3 68 1 0 4 69 1 0 5 70 1 0 5 71 1 0 6 72 1 0 7 73 1 0 8 74 1 0 8 75 1 0 9 76 1 0 11 77 1 0 11 78 1 0 12 79 1 1 14 80 1 1 16 81 1 1 17 82 1 0 17 83 1 0 18 84 1 0 19 85 1 6 20 86 1 0 21 87 1 1 22 88 1 0 23 89 1 1 25 90 1 1 27 91 1 6 28 92 1 0 28 93 1 0 28 94 1 0 29 95 1 1 30 96 1 0 31 97 1 6 32 98 1 0 33 99 1 6 34100 1 0 35101 1 0 35102 1 0 36103 1 0 36104 1 0 38105 1 0 38106 1 0 38107 1 0 39108 1 0 40109 1 0 40110 1 0 41111 1 0 41112 1 0 43113 1 0 43114 1 0 43115 1 0 46116 1 0 47117 1 0 47118 1 0 48119 1 0 48120 1 0 49121 1 1 50122 1 0 50123 1 0 50124 1 0 51125 1 0 51126 1 0 53127 1 1 55128 1 1 56129 1 0 56130 1 0 57131 1 0 58132 1 6 59133 1 0 60134 1 1 61135 1 0 62136 1 6 63137 1 0 M END

Standard InCHIKey	KNZSXKKCTOYLSV-WDZWPDENSA-N
Standard InCHI	InChI=1S/C45H74O18/c1-19(18-57-40-37(54)35(52)32(49)28(16-46)60-40)8-13-45(56)20(2)30-27(63-45)15-26-24-7-6-22-14-23(9-11-43(22,4)25(24)10-12-44(26,30)5)59-42-39(36(53)33(50)29(17-47)61-42)62-41-38(55)34(51)31(48)21(3)58-41/h6,19-21,23-42,46-56H,7-18H2,1-5H3/t19-,20?,21+,23+,24?,25?,26?,27?,28-,29-,30?,31+,32-,33-,34-,35+,36+,37-,38-,39-,40-,41+,42-,43+,44+,45?/m1/s1
SMILES	CC1C2C(CC3C4CC=C5C[C@@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O[C@@H]6O[C@@H](C)[C@H](O)[C@@H](O)[C@H]6O)CC[C@]5(C)C4CC[C@@]32C)OC1(O)CC[C@@H](C)CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	902.49	Volume:	874.012 ? Van der Waals volume.
Dense:	1.033	LogP:	0.527 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.473 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.872 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	42.0
TPSA:	287.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	11.0	Rings:	8.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.107	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.319	Fsp³:	0.956
MCE-18:	155.455 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.446	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.017 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.165	Promiscuous compounds:	0.016

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.39	MDCK Permeability:	-5.169
Pgp-inhibitor:	0.0	Pgp-substrate:	0.913
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.008
20% Bioavailability (F20%):	0.089	30% Bioavailability (F30%):	0.997
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.154
Plasma Protein Binding (PPB):	57.097%	Volume Distribution (VD):	-0.374
Fu:	28.336% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.001
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.004	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.909
HLM stability:	0.081 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.363

Half-life (T1/2):

3.636

ADMET: Toxicity

hERG Blockers:	0.031	hERG Blockers (10um):	0.07
Human Hepatotoxicity (H-HT):	0.586	Drug-induced Liver Injury (DILI):	0.768
AMES Toxicity:	0.878	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.009	Skin Sensitization:	1.0
Carcinogencity:	0.032	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.094	Drug-induced Nephrotoxicity:	0.413
Genotoxicity:	0.015	RPMI-8226 Immunitoxicity:	0.195
A549 Cytotoxicity:	0.712	Hek293 Cytotoxicity:	0.558
BCF:	1.624 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.637 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.016 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.169 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11599360]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	seed	n.a.	PMID[21381697]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[37120447]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	Fruit	n.a.	n.a.	Database[FooDB]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	Leaf	n.a.	n.a.	Database[FooDB]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	Plant	n.a.	n.a.	Database[FooDB]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	Seed	n.a.	n.a.	Database[FooDB]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.		Database[FooDB]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.		Database[Phenol-Explorer]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC515009 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23304
0.1-0.2	22438
0.2-0.3	2954
0.3-0.4	952
0.4-0.5	104
0.5-0.6	57
0.6-0.7	25
0.7-0.8	0
0.8-0.85	8
0.85-0.9	3
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC98696
0.8632	High Similarity	NPC73243
0.8632	High Similarity	NPC244086
0.8632	High Similarity	NPC84956
0.8454	Intermediate Similarity	NPC247037
0.8438	Intermediate Similarity	NPC102016
0.8438	Intermediate Similarity	NPC95051
0.82	Intermediate Similarity	NPC249265
0.8119	Intermediate Similarity	NPC23808
0.8119	Intermediate Similarity	NPC87998
0.802	Intermediate Similarity	NPC218571
0.802	Intermediate Similarity	NPC487615
0.7579	Intermediate Similarity	NPC485601
0.75	Intermediate Similarity	NPC291203
0.75	Intermediate Similarity	NPC217205
0.7172	Intermediate Similarity	NPC113044
0.7172	Intermediate Similarity	NPC283829
0.7172	Intermediate Similarity	NPC161676
0.703	Intermediate Similarity	NPC486388
0.701	Intermediate Similarity	NPC476538
0.701	Intermediate Similarity	NPC476539
0.697	Remote Similarity	NPC306991
0.6923	Remote Similarity	NPC475182
0.6832	Remote Similarity	NPC305423
0.6667	Remote Similarity	NPC485602
0.6606	Remote Similarity	NPC194207
0.6606	Remote Similarity	NPC22779
0.6422	Remote Similarity	NPC486386
0.6364	Remote Similarity	NPC309278
0.6346	Remote Similarity	NPC470748
0.6316	Remote Similarity	NPC232054
0.6306	Remote Similarity	NPC254255
0.6296	Remote Similarity	NPC480555
0.6296	Remote Similarity	NPC150372
0.6262	Remote Similarity	NPC477809
0.625	Remote Similarity	NPC485600
0.6228	Remote Similarity	NPC308140
0.6154	Remote Similarity	NPC94272
0.6078	Remote Similarity	NPC476540
0.6078	Remote Similarity	NPC476541
0.6075	Remote Similarity	NPC40440
0.6055	Remote Similarity	NPC300557
0.6019	Remote Similarity	NPC470433
0.6019	Remote Similarity	NPC46190
0.6019	Remote Similarity	NPC171073
0.6	Remote Similarity	NPC480553
0.5929	Remote Similarity	NPC475333
0.5929	Remote Similarity	NPC13193
0.5929	Remote Similarity	NPC224098
0.5929	Remote Similarity	NPC208383
0.5909	Remote Similarity	NPC6806
0.59	Remote Similarity	NPC181845
0.5888	Remote Similarity	NPC600116
0.5872	Remote Similarity	NPC602423
0.5826	Remote Similarity	NPC480554
0.5794	Remote Similarity	NPC141433
0.5776	Remote Similarity	NPC486383
0.575	Remote Similarity	NPC480556
0.5741	Remote Similarity	NPC14704
0.5714	Remote Similarity	NPC150057
0.5714	Remote Similarity	NPC147753
0.5702	Remote Similarity	NPC269297
0.5702	Remote Similarity	NPC222202
0.5676	Remote Similarity	NPC248746
0.5676	Remote Similarity	NPC122819
0.5619	Remote Similarity	NPC128123
0.5565	Remote Similarity	NPC470863
0.5556	Remote Similarity	NPC470432
0.5556	Remote Similarity	NPC230507
0.5534	Remote Similarity	NPC272015
0.5526	Remote Similarity	NPC98018
0.5526	Remote Similarity	NPC284104
0.5526	Remote Similarity	NPC103616
0.5495	Remote Similarity	NPC197231
0.5487	Remote Similarity	NPC42171
0.5463	Remote Similarity	NPC295980
0.5429	Remote Similarity	NPC477451
0.5417	Remote Similarity	NPC287885
0.5333	Remote Similarity	NPC84111
0.5333	Remote Similarity	NPC287483
0.5333	Remote Similarity	NPC470865
0.5323	Remote Similarity	NPC224314
0.5315	Remote Similarity	NPC485599
0.5294	Remote Similarity	NPC242748
0.5273	Remote Similarity	NPC15249
0.5273	Remote Similarity	NPC25455
0.5268	Remote Similarity	NPC19888
0.5238	Remote Similarity	NPC297348
0.5238	Remote Similarity	NPC249204
0.5238	Remote Similarity	NPC48339
0.5238	Remote Similarity	NPC141769
0.5238	Remote Similarity	NPC477547
0.5229	Remote Similarity	NPC600456
0.5192	Remote Similarity	NPC165439
0.5169	Remote Similarity	NPC475550
0.5159	Remote Similarity	NPC477808
0.5126	Remote Similarity	NPC470861
0.5102	Remote Similarity	NPC22140
0.5102	Remote Similarity	NPC243728
0.5102	Remote Similarity	NPC158088
0.5086	Remote Similarity	NPC124677
0.5085	Remote Similarity	NPC51520
0.5085	Remote Similarity	NPC303069

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC515009 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7541
0.1-0.2	1515
0.2-0.3	83
0.3-0.4	8
0.4-0.5	1
0.5-0.6	2
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5714	Remote Similarity	NPD8450	Suspended
0.5676	Remote Similarity	NPD8449	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data