NPASS Compound

Natural Product: NPC247791

Natural Product ID	NPC247791
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	QSKFJIQOEAWAJW-VPTYWWQVSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 176184 0 0 0 0 0 0 0 0999 V2000 11.0926 2.1686 2.3572 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4332 1.3522 1.2405 C 0 0 2 0 0 0 0 0 0 0 0 0 10.7894 -0.1060 1.5124 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2649 -1.0296 0.4820 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8445 -1.1635 0.2964 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2962 -2.2383 0.6883 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9651 -0.2315 -0.2875 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6286 -0.5342 -0.4347 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6446 0.2436 0.4568 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4564 0.4371 -0.4009 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1089 0.4544 0.1787 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6512 1.9057 0.2180 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1682 2.0372 0.3202 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2979 1.0888 0.1833 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2129 1.2992 0.3127 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6773 0.2581 1.2906 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4260 -0.0691 2.1438 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5164 -0.9447 1.3473 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7001 -0.3085 -0.0627 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.2089 -1.0876 -0.9573 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1411 -0.4649 -0.4873 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2291 -0.5363 -1.9694 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6077 -0.2094 -2.5231 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6216 -0.6186 -1.4953 C 0 0 2 0 0 0 0 0 0 0 0 0 4.5622 -2.0232 -1.0496 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0556 -0.2792 -1.8334 C 0 0 2 0 0 0 0 0 0 0 0 0 6.6250 -1.0219 -2.9138 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9711 -1.8473 -3.5208 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0324 -0.8219 -3.3429 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6363 0.6244 2.1938 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6338 -0.3433 2.2233 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9365 0.2113 1.8546 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0500 -0.2096 2.7602 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9459 -1.6695 3.2826 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5675 -2.1032 3.2954 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2009 -3.1697 4.2767 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8852 -3.6304 4.0042 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7011 -0.9943 3.4575 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7175 -2.4877 2.4297 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0906 -2.1275 2.5634 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.9981 -3.2410 2.4922 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.8149 -3.5210 1.2579 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.8069 -2.5142 0.2047 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.3814 -1.7902 0.3196 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3446 -2.7892 0.0102 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3182 -1.2104 1.4973 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7033 -1.5053 0.3034 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9618 -0.6856 -0.7425 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.4624 0.6228 -0.2316 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.2637 1.4851 -1.1262 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.0450 0.7221 -2.1661 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.1298 -0.3955 -2.6256 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.5602 -1.0506 -3.8792 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.0677 -1.2726 -1.5264 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.3967 1.5114 -3.2498 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.2377 2.1489 -0.3476 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.4265 1.3808 0.3398 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5581 -4.7866 0.7138 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9445 -3.1450 3.5653 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8587 0.6152 3.9302 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1322 -0.0055 0.5061 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9719 0.8112 -0.1531 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2484 0.6305 -1.5797 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.4143 1.5318 -2.0233 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0623 2.9811 -1.5961 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.5208 2.9980 -0.2078 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2642 4.3398 0.3948 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3527 2.1817 -0.1574 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2266 3.7578 -1.7530 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5903 1.4848 -3.3700 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4256 -0.6177 -2.0914 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0655 1.7945 -0.0664 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3956 1.4761 0.0012 O 0 0 0 0 0 0 0 0 0 0 0 0 13.1777 1.9229 -1.0294 C 0 0 2 0 0 0 0 0 0 0 0 0 13.5850 0.7635 -1.9305 C 0 0 2 0 0 0 0 0 0 0 0 0 15.0744 0.5930 -1.8128 C 0 0 1 0 0 0 0 0 0 0 0 0 15.4849 0.6521 -0.3652 C 0 0 2 0 0 0 0 0 0 0 0 0 15.1651 2.0341 0.1883 C 0 0 2 0 0 0 0 0 0 0 0 0 14.6980 1.9343 1.6189 C 0 0 0 0 0 0 0 0 0 0 0 0 15.7147 1.3369 2.3830 O 0 0 0 0 0 0 0 0 0 0 0 0 14.2601 2.6447 -0.6254 O 0 0 0 0 0 0 0 0 0 0 0 0 16.8766 0.4082 -0.2639 O 0 0 0 0 0 0 0 0 0 0 0 0 15.4166 -0.6606 -2.3454 O 0 0 0 0 0 0 0 0 0 0 0 0 13.2421 1.0631 -3.2600 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6139 1.4861 3.0485 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7973 2.9163 1.9146 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2917 2.6707 2.9265 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3740 1.5027 1.1971 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4139 -0.4212 2.5158 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8919 -0.1700 1.5445 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7167 -2.0423 0.6969 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7891 -0.7713 -0.5191 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4597 -1.5977 -0.1029 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1261 1.2140 0.6792 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4468 -0.3006 1.4138 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6229 1.4073 -0.9838 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1794 0.1251 1.2544 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1244 2.4033 1.1388 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9865 2.5053 -0.6345 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7474 3.0435 0.5358 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4027 2.3459 0.6770 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6162 1.2558 -0.6894 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0012 -0.6459 0.7697 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6986 -0.5921 3.0501 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0123 0.9262 2.4014 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0638 -1.9343 1.2521 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4644 -1.0481 1.8560 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2813 -1.4727 -1.8973 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5274 -2.0692 -0.4726 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0516 -0.4975 -1.3050 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3705 -1.5136 -0.0566 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0908 -1.5984 -2.3313 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4424 0.0627 -2.4417 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6676 0.8843 -2.6491 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7675 -0.6664 -3.5118 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7190 -2.5600 -1.5863 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5693 -2.2176 0.0354 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4500 -2.6430 -1.4218 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1281 0.8350 -1.9472 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1337 -0.0857 -4.1748 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5943 -0.3979 -2.4975 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4761 -1.7642 -3.7419 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3331 -1.1952 1.5120 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9976 1.3573 1.9267 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9932 0.0382 2.4229 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5144 -1.5516 4.1946 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2271 -2.4805 2.2521 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8715 -4.0329 4.2545 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1452 -2.8015 5.3234 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0021 -4.1321 3.1355 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1962 -1.5073 3.5049 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4180 -4.2083 2.6784 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9182 -3.6036 1.5886 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6784 -2.8799 -0.8254 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4873 -1.0434 -0.5242 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3418 -2.3064 0.1442 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3952 -3.1216 -1.0789 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4129 -3.7064 0.6235 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2130 -0.6316 -1.5455 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1771 0.3254 0.6321 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6397 2.2663 -1.6347 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.9503 0.3041 -1.6551 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1235 0.0603 -2.7813 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8601 -0.8079 -4.7259 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6517 -2.1475 -3.7975 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.5542 -0.6602 -4.2145 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.5705 2.4300 -2.9769 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3241 3.1021 -0.6365 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4382 1.2585 1.3246 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2278 -5.4059 1.0704 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4410 -2.2973 3.4509 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4474 0.0244 4.5927 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8309 1.1258 0.5066 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3643 1.1417 -2.1586 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2936 1.2165 -1.4222 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3271 3.3484 -2.3121 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3109 2.5064 0.4574 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6056 4.3152 1.4573 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7700 5.1387 -0.1488 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1396 4.4675 0.4320 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6693 3.4927 -2.6198 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3207 0.8406 -3.6369 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6202 -1.2192 -1.9472 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5373 1.3439 -0.9395 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9432 2.8882 -0.1422 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5083 2.5848 -1.6572 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0559 -0.1566 -1.6751 H 0 0 0 0 0 0 0 0 0 0 0 0 15.5853 1.4101 -2.3922 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9209 -0.1286 0.1979 H 0 0 0 0 0 0 0 0 0 0 0 0 16.1286 2.6144 0.1608 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4675 2.9097 2.0702 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7763 1.2982 1.7071 H 0 0 0 0 0 0 0 0 0 0 0 0 15.2781 0.9790 3.1809 H 0 0 0 0 0 0 0 0 0 0 0 0 17.2852 1.2681 0.0473 H 0 0 0 0 0 0 0 0 0 0 0 0 16.2488 -0.5295 -2.8817 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0962 1.1841 -3.7546 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 6 19 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 1 24 26 1 0 26 27 1 0 27 28 2 0 27 29 1 0 16 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 35 38 1 0 34 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 44 46 1 0 43 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 52 54 1 0 51 55 1 0 50 56 1 0 49 57 1 0 42 58 1 0 41 59 1 0 33 60 1 0 32 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 66 68 1 0 65 69 1 0 64 70 1 0 63 71 1 0 2 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 78 81 1 0 77 82 1 0 76 83 1 0 75 84 1 0 26 8 1 0 38 31 1 0 46 40 1 0 54 48 1 0 68 62 1 0 81 74 1 0 24 10 1 0 21 11 1 0 19 14 1 0 1 85 1 0 1 86 1 0 1 87 1 0 2 88 1 6 3 89 1 0 3 90 1 0 4 91 1 0 4 92 1 0 8 93 1 1 9 94 1 0 9 95 1 0 10 96 1 6 11 97 1 1 12 98 1 0 12 99 1 0 13100 1 0 15101 1 0 15102 1 0 16103 1 6 17104 1 0 17105 1 0 18106 1 0 18107 1 0 20108 1 0 20109 1 0 20110 1 0 21111 1 1 22112 1 0 22113 1 0 23114 1 0 23115 1 0 25116 1 0 25117 1 0 25118 1 0 26119 1 6 29120 1 0 29121 1 0 29122 1 0 31123 1 6 32124 1 6 33125 1 6 34126 1 1 35127 1 6 36128 1 0 36129 1 0 37130 1 0 40131 1 1 41132 1 1 42133 1 1 43134 1 6 44135 1 6 45136 1 0 45137 1 0 45138 1 0 48139 1 6 49140 1 1 50141 1 6 51142 1 1 52143 1 6 53144 1 0 53145 1 0 53146 1 0 55147 1 0 56148 1 0 57149 1 0 58150 1 0 59151 1 0 60152 1 0 62153 1 1 63154 1 6 64155 1 1 65156 1 6 66157 1 1 67158 1 0 67159 1 0 67160 1 0 69161 1 0 70162 1 0 71163 1 0 72164 1 0 72165 1 0 74166 1 6 75167 1 1 76168 1 6 77169 1 1 78170 1 1 79171 1 0 79172 1 0 80173 1 0 82174 1 0 83175 1 0 84176 1 0 M END

Standard InCHIKey	QSKFJIQOEAWAJW-VPTYWWQVSA-N
Standard InCHI	InChI=1S/C57H92O27/c1-21(20-74-51-43(69)41(67)38(64)32(18-58)80-51)8-11-34(61)79-31-17-30-28-10-9-26-16-27(12-14-56(26,6)29(28)13-15-57(30,7)35(31)22(2)60)78-55-50(84-53-45(71)40(66)37(63)24(4)76-53)47(73)49(33(19-59)81-55)83-54-46(72)42(68)48(25(5)77-54)82-52-44(70)39(65)36(62)23(3)75-52/h9,21,23-25,27-33,35-55,58-59,62-73H,8,10-20H2,1-7H3/t21-,23+,24+,25+,27-,28+,29+,30-,31+,32+,33+,35-,36+,37+,38+,39-,40-,41-,42+,43+,44+,45+,46+,47-,48+,49+,50+,51+,52-,53-,54-,55+,56+,57-/m1/s1
SMILES	C[C@H](CCC(=O)O[C@H]1C[C@@H]2[C@H]3CC=C4C[C@@H](CC[C@]4(C)[C@H]3CC[C@@]2(C)[C@@H]1C(=O)C)O[C@@H]1[C@H]([C@@H]([C@H]([C@H](CO)O1)O[C@@H]1[C@H]([C@@H]([C@H]([C@H](C)O1)O[C@@H]1[C@H]([C@@H]([C@H]([C@H](C)O1)O)O)O)O)O)O)O[C@@H]1[C@H]([C@@H]([C@H]([C@H](C)O1)O)O)O)CO[C@@H]1[C@H]([C@@H]([C@H]([C@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1208.58	Volume:	1146.846 ? Van der Waals volume.
Dense:	1.054	LogP:	0.472 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.154 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.936 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	19.0	Rigid Bonds:	52.0
TPSA:	418.89 ? Topological Polar Surface Area.	H-Bond Acceptor:	27.0
H-Bond Donor:	14.0	Rings:	9.0
Heavy Atoms:	27.0

MedChem Properties

QED Drug-Likeness Score:	0.047	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.176	Fsp³:	0.93
MCE-18:	185.455 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.855	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.354	Promiscuous compounds:	0.183

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.233	MDCK Permeability:	-4.755
Pgp-inhibitor:	0.0	Pgp-substrate:	0.964
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.079
20% Bioavailability (F20%):	0.001	30% Bioavailability (F30%):	0.979
50% Bioavailability (F50%):	0.901

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.023
Plasma Protein Binding (PPB):	47.224%	Volume Distribution (VD):	-0.355
Fu:	33.665% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.01

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.988
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.998
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-1.067

Half-life (T1/2):

4.133

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.011
Human Hepatotoxicity (H-HT):	0.515	Drug-induced Liver Injury (DILI):	0.987
AMES Toxicity:	0.594	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.006	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.136	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.004	RPMI-8226 Immunitoxicity:	0.493
A549 Cytotoxicity:	0.464	Hek293 Cytotoxicity:	0.089
BCF:	1.039 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.509 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.224 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.241 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO20097	Thermobifida alba	Species	Nocardiopsaceae	Bacteria	n.a.	n.a.	n.a.	PMID[11430001]
NPO9419	Enterobacter cloacae	Species	Enterobacteriaceae	Bacteria	n.a.	n.a.	n.a.	PMID[25427277]
NPO24359	Streptomyces cacaoi	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	PMID[27642865]
NPO26245	Styracaster caroli	Species	Porcellanasteridae	Eukaryota	n.a.	n.a.	n.a.	PMID[8145229]
NPO13147	Euphorbia cyparissias	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9419	Enterobacter cloacae	Species	Enterobacteriaceae	Bacteria	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20097	Thermobifida alba	Species	Nocardiopsaceae	Bacteria	n.a.	n.a.	n.a.	Database[COCONUT]
NPO26245	Styracaster caroli	Species	Porcellanasteridae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8559	Calophyllum venulosum	Species	Calophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO11319	Laurencia hybrida	Species	Rhodomelaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO24359	Streptomyces cacaoi	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9419	Enterobacter cloacae	Species	Enterobacteriaceae	Bacteria	n.a.	n.a.	n.a.	Database[UNPD]
NPO19605	Tara spinosa	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13147	Euphorbia cyparissias	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO26245	Styracaster caroli	Species	Porcellanasteridae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO24359	Streptomyces cacaoi	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	Database[UNPD]
NPO20097	Thermobifida alba	Species	Nocardiopsaceae	Bacteria	n.a.	n.a.	n.a.	Database[UNPD]
NPO8460	Pedicularis torta	Species	Orobanchaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO11181	Juniperus bermudiana	Species	Cupressaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO6962	Cetraria delisei	Species	Parmeliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO11319	Laurencia hybrida	Species	Rhodomelaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO8559	Calophyllum venulosum	Species	Calophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO10024	Tylecodon wallichii	Species	Crassulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO6054	Sinularia brongersmai	Species	Alcyoniidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC247791 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21510
0.1-0.2	24069
0.2-0.3	3058
0.3-0.4	1019
0.4-0.5	124
0.5-0.6	36
0.6-0.7	30
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9375	High Similarity	NPC475182
0.8037	Intermediate Similarity	NPC23808
0.8037	Intermediate Similarity	NPC87998
0.789	Intermediate Similarity	NPC308140
0.75	Intermediate Similarity	NPC247037
0.7477	Intermediate Similarity	NPC73243
0.7477	Intermediate Similarity	NPC244086
0.7477	Intermediate Similarity	NPC84956
0.7207	Intermediate Similarity	NPC194207
0.7207	Intermediate Similarity	NPC22779
0.7182	Intermediate Similarity	NPC269297
0.7182	Intermediate Similarity	NPC222202
0.7143	Intermediate Similarity	NPC249265
0.6909	Remote Similarity	NPC480555
0.6909	Remote Similarity	NPC150372
0.6897	Remote Similarity	NPC232054
0.6792	Remote Similarity	NPC94272
0.6667	Remote Similarity	NPC224314
0.6636	Remote Similarity	NPC470433
0.6636	Remote Similarity	NPC46190
0.6636	Remote Similarity	NPC171073
0.6609	Remote Similarity	NPC254255
0.6579	Remote Similarity	NPC486386
0.6545	Remote Similarity	NPC98696
0.6522	Remote Similarity	NPC475333
0.6522	Remote Similarity	NPC224098
0.6522	Remote Similarity	NPC208383
0.6441	Remote Similarity	NPC480553
0.6404	Remote Similarity	NPC102016
0.6404	Remote Similarity	NPC95051
0.6283	Remote Similarity	NPC248746
0.6271	Remote Similarity	NPC480554
0.6239	Remote Similarity	NPC32361
0.6182	Remote Similarity	NPC306991
0.6179	Remote Similarity	NPC480556
0.6154	Remote Similarity	NPC165439
0.6134	Remote Similarity	NPC218571
0.6134	Remote Similarity	NPC487615
0.6106	Remote Similarity	NPC486388
0.6102	Remote Similarity	NPC309278
0.6087	Remote Similarity	NPC42171
0.6048	Remote Similarity	NPC248202
0.6	Remote Similarity	NPC122819
0.5966	Remote Similarity	NPC13193
0.5952	Remote Similarity	NPC477808
0.5948	Remote Similarity	NPC6806
0.5929	Remote Similarity	NPC113044
0.5929	Remote Similarity	NPC283829
0.5929	Remote Similarity	NPC161676
0.5862	Remote Similarity	NPC477809
0.5854	Remote Similarity	NPC287885
0.5812	Remote Similarity	NPC300557
0.5812	Remote Similarity	NPC124677
0.5789	Remote Similarity	NPC470748
0.5776	Remote Similarity	NPC265275
0.5752	Remote Similarity	NPC470432
0.5752	Remote Similarity	NPC230507
0.5652	Remote Similarity	NPC305423
0.5641	Remote Similarity	NPC602423
0.5397	Remote Similarity	NPC477811
0.5345	Remote Similarity	NPC6295
0.5321	Remote Similarity	NPC486114
0.5312	Remote Similarity	NPC486390
0.5246	Remote Similarity	NPC150057
0.5246	Remote Similarity	NPC147753
0.5242	Remote Similarity	NPC475550
0.5225	Remote Similarity	NPC181845
0.5214	Remote Similarity	NPC15249
0.5214	Remote Similarity	NPC25455
0.5197	Remote Similarity	NPC486384
0.5167	Remote Similarity	NPC40440
0.5164	Remote Similarity	NPC182900
0.5159	Remote Similarity	NPC63609
0.5128	Remote Similarity	NPC295980
0.5126	Remote Similarity	NPC14704
0.5126	Remote Similarity	NPC600116
0.5086	Remote Similarity	NPC19400
0.5041	Remote Similarity	NPC48886
0.5041	Remote Similarity	NPC94881

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC247791 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7332
0.1-0.2	1716
0.2-0.3	87
0.3-0.4	11
0.4-0.5	2
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6	Remote Similarity	NPD8449	Approved
0.5246	Remote Similarity	NPD8450	Suspended

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data