NPASS Compound

Natural Product: NPC545481

Natural Product ID	NPC545481
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Pseudoprotogracillin
IUPAC Name	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{R},6~{R})-5-hydroxy-6-(hydroxymethyl)-4-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-2-[[(1~{S},2~{S},4~{S},8~{S},9~{S},12~{S},13~{R},16~{S})-7,9,13-trimethyl-6-[(3~{R})-3-methyl-4-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-butyl]-5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosa-6,18-dien-16-yl]oxy]tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 155163 0 0 0 0 0 0 0 0999 V2000 6.1677 2.1567 0.7841 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9490 0.7180 0.9883 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4022 -0.0276 1.9487 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2385 0.3085 3.0833 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4300 1.1457 2.9224 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5507 0.6539 2.0708 C 0 0 1 0 0 0 0 0 0 0 0 0 10.0759 -0.6885 2.6327 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3426 0.4746 0.6358 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4983 0.0186 0.0090 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5802 0.8493 0.0408 C 0 0 2 0 0 0 0 0 0 0 0 0 11.8741 1.3696 -1.2323 O 0 0 0 0 0 0 0 0 0 0 0 0 12.6085 0.5474 -2.0356 C 0 0 2 0 0 0 0 0 0 0 0 0 11.9511 -0.7503 -2.3781 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8347 -1.4602 -3.2053 O 0 0 0 0 0 0 0 0 0 0 0 0 14.0027 0.2854 -1.5347 C 0 0 1 0 0 0 0 0 0 0 0 0 14.9982 0.8240 -2.3299 O 0 0 0 0 0 0 0 0 0 0 0 0 14.0776 0.8334 -0.1249 C 0 0 2 0 0 0 0 0 0 0 0 0 15.1919 0.2585 0.5265 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8402 0.2807 0.5945 C 0 0 1 0 0 0 0 0 0 0 0 0 13.0397 0.5820 1.9406 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9543 -1.3692 1.7708 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0717 -1.4343 0.7119 C 0 0 1 0 0 0 0 0 0 0 0 0 3.6183 -1.5954 1.1968 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9122 -0.9300 0.0684 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4697 -0.6764 0.2308 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6821 -2.0130 0.2143 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7669 -1.6159 0.3816 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2388 -0.4929 -0.0757 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7181 -0.1740 0.1424 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2587 0.1795 -1.1960 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5663 0.6942 -1.1795 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4832 -0.1525 -1.7100 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0711 0.4649 -2.8303 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9274 -0.4040 -3.4846 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.1444 0.3982 -3.9036 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0780 -0.3748 -4.5774 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3339 -1.6235 -2.7776 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4540 -2.6555 -3.1009 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3829 -1.5248 -1.2487 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.7222 -1.6277 -0.8789 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0210 -2.8373 -0.2920 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.8525 -3.5321 -1.1205 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1765 -3.2634 -1.1429 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.4146 -2.1451 -2.1688 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9906 -2.5875 -3.4227 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8272 -2.8491 0.1366 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.1861 -3.9330 0.9331 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9513 -1.9431 0.9645 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.7835 -0.7044 0.3909 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6082 -2.6384 1.0761 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.7872 -3.8897 1.7180 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6983 -0.3310 -0.7545 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1342 -0.3629 0.4986 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3756 0.8308 1.2030 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1922 1.5888 1.2334 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3360 2.9005 1.5624 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2372 3.7472 0.3122 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6808 3.1342 2.2136 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6979 4.3698 2.8857 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8400 2.0422 3.2595 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.0316 2.2656 3.9327 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9471 0.6715 2.5669 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3093 0.4102 2.5010 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4525 1.0850 -2.0467 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0564 0.6153 -2.2207 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4172 0.4893 -0.8189 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5389 1.8801 -0.2186 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9750 0.0448 -0.9920 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8264 1.2364 -1.3496 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3094 0.9578 -1.3645 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6859 0.3800 -0.0274 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3534 1.3286 1.0639 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1037 -0.0916 0.0352 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6867 2.7944 1.5917 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2224 2.4631 0.6472 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6811 2.5421 -0.1658 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6232 0.8206 3.9126 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5817 -0.6179 3.6548 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2400 2.2470 2.7462 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8889 1.1995 3.9775 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4123 1.3494 2.2673 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4307 -0.4802 3.6450 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8014 -1.1583 1.9753 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1851 -1.3737 2.7269 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0928 1.4114 0.0751 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5758 -0.3244 0.4141 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3269 1.7780 0.6313 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7399 1.0979 -3.0095 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7241 -1.3981 -1.5325 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0693 -0.5164 -3.0107 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2567 -2.2079 -2.7320 H 0 0 0 0 0 0 0 0 0 0 0 0 14.2289 -0.8184 -1.4692 H 0 0 0 0 0 0 0 0 0 0 0 0 15.5318 1.4535 -1.7694 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1138 1.9210 -0.0701 H 0 0 0 0 0 0 0 0 0 0 0 0 15.9045 0.9380 0.6649 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9085 -0.8298 0.4717 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9600 -0.2354 2.4718 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2823 -2.2164 -0.0226 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5347 -0.9488 2.1021 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3411 -2.6349 1.3497 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0759 -1.4580 -0.8933 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1418 -0.2148 1.1729 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9542 -2.6492 1.0447 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7953 -2.5212 -0.7442 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3999 -2.3094 0.8986 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2181 -1.0778 0.5221 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7502 0.5910 0.9133 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3685 -0.8135 -1.7388 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1251 -1.1484 -1.9638 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4069 -0.6450 -4.4611 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8293 1.2846 -4.5308 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6146 0.8296 -2.9992 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5723 -1.0505 -5.0845 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3308 -1.9842 -3.1055 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4221 -3.2951 -2.3458 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8962 -2.4488 -0.8636 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1028 -3.4822 -0.1817 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7626 -4.1337 -1.6070 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9477 -1.2107 -1.8694 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5174 -2.0161 -2.2096 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6405 -2.2337 -4.0996 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7354 -2.2333 -0.1216 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8561 -4.5224 0.5214 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3356 -1.8439 2.0067 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9335 -0.2754 0.5099 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9786 -2.0639 1.7566 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8502 -4.6228 1.0547 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3019 0.6015 -0.9136 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0569 1.4192 0.5628 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5111 3.2718 2.2323 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1738 3.8472 0.0233 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7797 3.2912 -0.5377 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6934 4.7526 0.4718 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4547 3.1408 1.4484 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1384 5.0391 2.3081 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0200 2.0723 3.9927 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6893 2.7974 3.4039 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4141 -0.0920 3.1801 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5619 0.0572 3.4040 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5314 2.1190 -1.6442 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9444 1.0929 -3.0619 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0621 -0.4082 -2.6317 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4407 1.3212 -2.7964 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5903 2.0557 0.1468 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1663 2.0172 0.6236 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3589 2.6930 -0.9419 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9993 -0.6713 -1.8581 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5671 1.4521 -2.4329 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5925 2.1546 -0.8181 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5325 0.2645 -2.2038 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8281 1.9018 -1.5278 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0122 1.1969 1.9686 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5231 2.3658 0.7109 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2967 1.3258 1.4075 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5616 -0.1079 -0.9720 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 12 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 3 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 34 37 1 0 37 38 1 0 37 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 43 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 48 50 1 0 50 51 1 0 39 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 56 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 60 62 1 0 62 63 1 0 30 64 1 0 64 65 1 0 65 66 1 0 66 67 1 1 66 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 1 1 71 73 1 0 73 2 1 0 19 10 1 0 73 22 1 0 71 24 1 0 68 25 1 0 66 28 1 0 52 32 1 0 62 54 1 0 50 41 1 0 1 74 1 0 1 75 1 0 1 76 1 0 4 77 1 0 4 78 1 0 5 79 1 0 5 80 1 0 6 81 1 6 7 82 1 0 7 83 1 0 7 84 1 0 8 85 1 0 8 86 1 0 10 87 1 1 12 88 1 6 13 89 1 0 13 90 1 0 14 91 1 0 15 92 1 1 16 93 1 0 17 94 1 6 18 95 1 0 19 96 1 1 20 97 1 0 22 98 1 6 23 99 1 0 23100 1 0 24101 1 6 25102 1 1 26103 1 0 26104 1 0 27105 1 0 29106 1 0 29107 1 0 30108 1 6 32109 1 6 34110 1 6 35111 1 0 35112 1 0 36113 1 0 37114 1 6 38115 1 0 39116 1 1 41117 1 1 43118 1 6 44119 1 0 44120 1 0 45121 1 0 46122 1 6 47123 1 0 48124 1 1 49125 1 0 50126 1 1 51127 1 0 52128 1 1 54129 1 6 56130 1 1 57131 1 0 57132 1 0 57133 1 0 58134 1 6 59135 1 0 60136 1 1 61137 1 0 62138 1 1 63139 1 0 64140 1 0 64141 1 0 65142 1 0 65143 1 0 67144 1 0 67145 1 0 67146 1 0 68147 1 6 69148 1 0 69149 1 0 70150 1 0 70151 1 0 72152 1 0 72153 1 0 72154 1 0 73155 1 6 M END

Standard InCHIKey	JNZLXJWNXMGDGS-CRPAHPMISA-N
Standard InCHI	InChI=1S/C51H82O22/c1-20(19-65-46-41(62)39(60)35(56)30(16-52)69-46)6-9-28-21(2)33-29(68-28)15-27-25-8-7-23-14-24(10-12-50(23,4)26(25)11-13-51(27,33)5)67-49-45(73-47-42(63)38(59)34(55)22(3)66-47)44(37(58)32(18-54)71-49)72-48-43(64)40(61)36(57)31(17-53)70-48/h7,20,22,24-27,29-49,52-64H,6,8-19H2,1-5H3/t20-,22+,24+,25-,26+,27+,29+,30-,31-,32-,33+,34+,35-,36-,37-,38-,39+,40+,41-,42-,43-,44+,45-,46-,47+,48+,49-,50+,51+/m1/s1
SMILES	CC1=C(CC[C@@H](C)CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H]2C[C@H]3[C@@H]4CC=C5C[C@@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@H]6O[C@@H]6O[C@@H](C)[C@H](O)[C@@H](O)[C@H]6O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@@H]12

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1046.53	Volume:	1001.756 ? Van der Waals volume.
Dense:	1.045	LogP:	1.018 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.014 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.245 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	48.0
TPSA:	346.06 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	13.0	Rings:	9.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.078	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.726	Fsp³:	0.922
MCE-18:	171.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.706	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.26	Promiscuous compounds:	0.108

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.882	MDCK Permeability:	-5.017
Pgp-inhibitor:	0.0	Pgp-substrate:	0.827
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.013
20% Bioavailability (F20%):	0.004	30% Bioavailability (F30%):	0.997
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.001
Plasma Protein Binding (PPB):	57.458%	Volume Distribution (VD):	-0.338
Fu:	29.029% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.057
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.997	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.988
HLM stability:	0.367 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.254

Half-life (T1/2):

3.472

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.008
Human Hepatotoxicity (H-HT):	0.551	Drug-induced Liver Injury (DILI):	0.938
AMES Toxicity:	0.957	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.016	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.418	Drug-induced Nephrotoxicity:	0.907
Genotoxicity:	0.003	RPMI-8226 Immunitoxicity:	0.172
A549 Cytotoxicity:	0.853	Hek293 Cytotoxicity:	0.4
BCF:	1.637 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.537 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.868 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.136 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO4863	Dioscorea futschauensis	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO4863	Dioscorea futschauensis	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO4863	Dioscorea futschauensis	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO4863	Dioscorea futschauensis	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO4863	Dioscorea futschauensis	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO4863	Dioscorea futschauensis	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC545481 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23354
0.1-0.2	22820
0.2-0.3	2836
0.3-0.4	647
0.4-0.5	113
0.5-0.6	50
0.6-0.7	20
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.785	Intermediate Similarity	NPC308140
0.7596	Intermediate Similarity	NPC102016
0.7596	Intermediate Similarity	NPC95051
0.7383	Intermediate Similarity	NPC309278
0.7248	Intermediate Similarity	NPC218571
0.7248	Intermediate Similarity	NPC487615
0.7075	Intermediate Similarity	NPC300557
0.7009	Intermediate Similarity	NPC208832
0.6887	Remote Similarity	NPC602423
0.6545	Remote Similarity	NPC150057
0.6545	Remote Similarity	NPC475182
0.6545	Remote Similarity	NPC147753
0.6346	Remote Similarity	NPC128123
0.6339	Remote Similarity	NPC73243
0.6339	Remote Similarity	NPC244086
0.6339	Remote Similarity	NPC84956
0.633	Remote Similarity	NPC98696
0.6228	Remote Similarity	NPC247037
0.6207	Remote Similarity	NPC92710
0.6121	Remote Similarity	NPC194207
0.6121	Remote Similarity	NPC22779
0.6095	Remote Similarity	NPC486118
0.6068	Remote Similarity	NPC249265
0.6018	Remote Similarity	NPC48886
0.6018	Remote Similarity	NPC94881
0.6017	Remote Similarity	NPC23808
0.6017	Remote Similarity	NPC87998
0.6	Remote Similarity	NPC475357
0.5868	Remote Similarity	NPC232054
0.5833	Remote Similarity	NPC477811
0.5826	Remote Similarity	NPC480555
0.5826	Remote Similarity	NPC150372
0.5818	Remote Similarity	NPC94272
0.5812	Remote Similarity	NPC486386
0.576	Remote Similarity	NPC477808
0.5752	Remote Similarity	NPC486388
0.5714	Remote Similarity	NPC113044
0.5714	Remote Similarity	NPC283829
0.5714	Remote Similarity	NPC161676
0.5714	Remote Similarity	NPC254255
0.5676	Remote Similarity	NPC306991
0.5603	Remote Similarity	NPC6806
0.5574	Remote Similarity	NPC480553
0.5565	Remote Similarity	NPC470433
0.5565	Remote Similarity	NPC46190
0.5565	Remote Similarity	NPC171073
0.55	Remote Similarity	NPC475333
0.55	Remote Similarity	NPC224098
0.55	Remote Similarity	NPC208383
0.5476	Remote Similarity	NPC248202
0.5462	Remote Similarity	NPC148965
0.5439	Remote Similarity	NPC305423
0.5439	Remote Similarity	NPC14704
0.5421	Remote Similarity	NPC181845
0.541	Remote Similarity	NPC480554
0.5403	Remote Similarity	NPC31896
0.5398	Remote Similarity	NPC470432
0.5398	Remote Similarity	NPC230507
0.5354	Remote Similarity	NPC480556
0.5289	Remote Similarity	NPC269297
0.5289	Remote Similarity	NPC222202
0.5254	Remote Similarity	NPC248746
0.5227	Remote Similarity	NPC263359
0.5214	Remote Similarity	NPC485596
0.5203	Remote Similarity	NPC197003
0.5179	Remote Similarity	NPC206003
0.5179	Remote Similarity	NPC473610
0.5128	Remote Similarity	NPC475351
0.5126	Remote Similarity	NPC122819
0.5126	Remote Similarity	NPC477809
0.5122	Remote Similarity	NPC13193
0.5115	Remote Similarity	NPC210569
0.5085	Remote Similarity	NPC40440
0.5083	Remote Similarity	NPC42171
0.5079	Remote Similarity	NPC256983
0.5046	Remote Similarity	NPC165439
0.5043	Remote Similarity	NPC470748
0.5043	Remote Similarity	NPC295980

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC545481 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7467
0.1-0.2	1598
0.2-0.3	76
0.3-0.4	7
0.4-0.5	0
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6545	Remote Similarity	NPD8450	Suspended
0.5126	Remote Similarity	NPD8449	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data