NPASS Compound

Natural Product: NPC16598

Natural Product ID	NPC16598
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	GTNPYMJJYMUXBT-XTZLTXSXSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001701] Furostanes and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 151159 0 0 0 0 0 0 0 0999 V2000 9.9405 -1.2408 -3.2433 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0011 -0.6135 -1.8611 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7232 -0.9747 -1.1485 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5074 -0.4653 -1.8714 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2664 -0.8522 -1.1518 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2925 -1.5777 -1.6658 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2893 -2.1205 -3.0440 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2201 -1.7496 -0.6825 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8482 -1.2434 0.6182 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8136 -0.4306 1.3259 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5440 -0.7561 0.5799 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4491 0.2304 0.7416 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7980 0.0500 2.0886 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6812 0.1351 2.0664 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3994 0.5935 1.0677 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8711 0.6196 1.1835 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5524 0.7981 -0.1391 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8077 1.8632 -0.9074 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4937 1.2544 -1.3456 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6396 1.0569 -0.1409 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0055 2.3887 0.2212 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4200 -0.0087 -0.3368 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9489 -0.1008 -1.7185 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9785 -1.2406 -1.7361 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1001 -0.7597 -0.8511 C 0 0 2 0 0 0 0 0 0 0 0 0 3.5518 0.5816 -1.3001 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8843 1.0434 -0.0001 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6963 0.0942 -0.6174 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5863 -0.6210 0.3473 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.0015 -0.1229 0.1476 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.0468 1.3810 -0.1001 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2836 1.6289 -1.3911 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8547 3.0684 -1.4880 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8158 3.4031 -0.6238 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3256 0.7055 -1.6737 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4036 1.6941 -0.2648 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8812 2.5929 0.6706 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.4625 3.8274 0.0369 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.8278 4.0937 0.5977 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.7385 2.9321 0.2689 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.9813 1.6587 0.5036 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9125 1.9207 1.3574 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.8366 2.9535 1.1242 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.3561 5.2943 0.1379 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6653 4.9421 0.3596 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7357 -0.3667 1.3214 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6130 -1.9931 0.1595 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2837 -2.7537 1.2448 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4109 -3.6525 1.6584 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7331 -4.5816 0.5383 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5628 -4.9132 -0.3126 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2249 -4.5593 0.2199 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5848 -5.7053 0.9988 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1124 -3.4327 0.9602 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6987 -4.4146 -1.6289 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3975 -5.7140 1.0226 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1518 -4.3114 2.8589 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9639 -0.5025 0.1615 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1360 0.8752 -1.9702 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1939 1.5305 -0.7501 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2790 1.1609 0.0006 C 0 0 1 0 0 0 0 0 0 0 0 0 12.1114 2.3763 0.3812 C 0 0 1 0 0 0 0 0 0 0 0 0 12.6153 2.2310 1.8005 C 0 0 2 0 0 0 0 0 0 0 0 0 13.0625 0.8159 2.0750 C 0 0 1 0 0 0 0 0 0 0 0 0 11.9680 -0.1277 1.6854 C 0 0 1 0 0 0 0 0 0 0 0 0 11.5350 -0.9931 2.8563 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6401 -1.7015 3.3368 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8613 0.5691 1.2160 O 0 0 0 0 0 0 0 0 0 0 0 0 14.2412 0.5778 1.3718 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5742 2.5083 2.6805 O 0 0 0 0 0 0 0 0 0 0 0 0 13.1345 2.5161 -0.5342 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9130 -1.6558 -3.5448 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6506 -0.4823 -3.9999 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1931 -2.0622 -3.3021 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8206 -1.0710 -1.2601 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7546 -0.6199 -0.0878 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7071 -2.0942 -1.0993 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5392 -0.8787 -2.8955 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5606 0.6462 -1.9956 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5143 -2.9311 -3.1567 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0803 -1.2962 -3.7770 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2383 -2.5748 -3.3340 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8507 -2.7705 -0.5785 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2094 -2.0642 1.2537 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6562 -0.7993 2.3810 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9868 0.6476 1.3250 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1686 -1.7593 0.7748 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8006 1.2896 0.7128 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0773 -0.9226 2.5426 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1529 0.8300 2.8168 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1963 -0.2124 2.9528 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2873 -0.2848 1.6653 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1685 1.4801 1.8368 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4381 -0.1465 -0.7271 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3336 2.1704 -1.8331 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7182 2.7346 -0.2644 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0443 1.9033 -2.0987 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7178 0.2628 -1.8167 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8425 2.6542 -0.4439 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7659 3.1778 0.0533 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2426 2.4529 1.3027 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0353 -1.0065 -0.0961 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3182 0.8152 -2.1736 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1233 -0.4651 -2.3652 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4966 -2.1250 -1.3152 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2870 -1.3881 -2.7724 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5532 0.8955 -1.0250 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8692 1.4070 -1.0122 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5341 0.5743 -2.4303 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0554 -0.7128 -1.0994 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2968 -0.3404 1.3860 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4531 -0.6456 -0.6981 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6447 1.9313 0.7574 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0656 1.5107 -2.2048 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7134 3.7205 -1.2003 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6325 3.3427 -2.5470 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0657 4.0703 0.0557 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0992 2.8985 1.3847 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4607 3.7854 -1.0774 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7339 4.1563 1.6962 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0755 3.0471 -0.7807 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6427 0.9381 1.0071 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6512 1.1747 -0.4397 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.6008 2.4220 0.7838 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1923 5.9962 0.7925 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0656 5.7490 -0.0736 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6817 -0.5992 1.1127 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0392 -2.1335 2.1586 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2977 -3.0161 1.8560 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4876 -4.0638 -0.1251 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5682 -6.0362 -0.4527 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5432 -4.4334 -0.6771 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6127 -6.6585 0.3938 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1478 -5.9426 1.9234 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5078 -5.5042 1.1722 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6641 -4.5382 -1.8704 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2272 -5.7527 1.9968 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2262 -4.1923 3.1619 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3351 1.3391 -2.5725 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1441 1.0857 -2.4502 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9093 0.4235 -0.4985 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4615 3.2759 0.3327 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4355 2.9737 1.9230 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3259 0.7462 3.1568 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3573 -0.7777 0.8655 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1332 -0.2857 3.6240 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7172 -1.6441 2.5305 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2307 -1.8454 2.5432 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0277 0.0278 0.5608 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1067 3.3324 2.4498 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3439 3.4785 -0.7402 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 39 44 1 0 38 45 1 0 30 46 1 0 29 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 52 54 1 0 51 55 1 0 50 56 1 0 49 57 1 0 9 58 1 0 2 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 65 68 1 0 64 69 1 0 63 70 1 0 62 71 1 0 58 5 1 0 68 61 1 0 25 8 1 0 35 28 1 0 42 37 1 0 54 48 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 72 1 0 1 73 1 0 1 74 1 0 2 75 1 1 3 76 1 0 3 77 1 0 4 78 1 0 4 79 1 0 7 80 1 0 7 81 1 0 7 82 1 0 8 83 1 1 9 84 1 1 10 85 1 0 10 86 1 0 11 87 1 1 12 88 1 1 13 89 1 0 13 90 1 0 14 91 1 0 16 92 1 0 16 93 1 0 17 94 1 6 18 95 1 0 18 96 1 0 19 97 1 0 19 98 1 0 21 99 1 0 21100 1 0 21101 1 0 22102 1 1 23103 1 0 23104 1 0 24105 1 0 24106 1 0 26107 1 0 26108 1 0 26109 1 0 28110 1 6 29111 1 1 30112 1 6 31113 1 1 32114 1 6 33115 1 0 33116 1 0 34117 1 0 37118 1 1 38119 1 6 39120 1 1 40121 1 6 41122 1 0 41123 1 0 43124 1 0 44125 1 0 45126 1 0 46127 1 0 48128 1 1 49129 1 1 50130 1 6 51131 1 6 52132 1 6 53133 1 0 53134 1 0 53135 1 0 55136 1 0 56137 1 0 57138 1 0 59139 1 0 59140 1 0 61141 1 6 62142 1 1 63143 1 1 64144 1 1 65145 1 6 66146 1 0 66147 1 0 67148 1 0 69149 1 0 70150 1 0 71151 1 0 M END

Standard InCHIKey	GTNPYMJJYMUXBT-XTZLTXSXSA-N
Standard InCHI	InChI=1S/C50H80O21/c1-20(18-63-45-40(60)38(58)36(56)31(16-51)68-45)6-9-29-21(2)33-30(67-29)15-27-25-8-7-23-14-24(10-12-49(23,4)26(25)11-13-50(27,33)5)66-48-44(71-47-41(61)37(57)34(54)22(3)65-47)42(62)43(32(17-52)69-48)70-46-39(59)35(55)28(53)19-64-46/h7,20,22,24-28,30-48,51-62H,6,8-19H2,1-5H3/t20-,22+,24+,25-,26+,27+,28-,30+,31-,32-,33+,34+,35+,36-,37-,38+,39-,40-,41-,42+,43-,44-,45-,46+,47+,48-,49+,50+/m1/s1
SMILES	C[C@H](CCC1=C(C)[C@H]2[C@H](C[C@H]3[C@@H]4CC=C5C[C@H](CC[C@]5(C)[C@H]4CC[C@]23C)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)O)O[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)O1)CO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1016.52	Volume:	975.669 ? Van der Waals volume.
Dense:	1.042	LogP:	1.193 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.985 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.155 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	14.0	Rigid Bonds:	48.0
TPSA:	325.83 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	12.0	Rings:	9.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.089	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.68	Fsp³:	0.92
MCE-18:	169.208 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.716	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.236	Promiscuous compounds:	0.114

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.72	MDCK Permeability:	-5.031
Pgp-inhibitor:	0.0	Pgp-substrate:	0.889
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.042
20% Bioavailability (F20%):	0.059	30% Bioavailability (F30%):	0.997
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.005
Plasma Protein Binding (PPB):	57.823%	Volume Distribution (VD):	-0.345
Fu:	29.177% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.049
BSEP inhibitor:	0.003

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.999	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.975
HLM stability:	0.308 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.183

Half-life (T1/2):

3.112

ADMET: Toxicity

hERG Blockers:	0.008	hERG Blockers (10um):	0.026
Human Hepatotoxicity (H-HT):	0.513	Drug-induced Liver Injury (DILI):	0.897
AMES Toxicity:	0.896	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.009	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.294	Drug-induced Nephrotoxicity:	0.874
Genotoxicity:	0.002	RPMI-8226 Immunitoxicity:	0.208
A549 Cytotoxicity:	0.751	Hek293 Cytotoxicity:	0.33
BCF:	1.719 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.644 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.071 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.288 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1158	Isochrysis galbana	Species	Isochrysidaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1158	Isochrysis galbana	Species	Isochrysidaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC16598 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24133
0.1-0.2	22204
0.2-0.3	2585
0.3-0.4	745
0.4-0.5	115
0.5-0.6	36
0.6-0.7	25
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8942	High Similarity	NPC308140
0.7798	Intermediate Similarity	NPC249265
0.7522	Intermediate Similarity	NPC232054
0.7407	Intermediate Similarity	NPC475182
0.7339	Intermediate Similarity	NPC73243
0.7339	Intermediate Similarity	NPC244086
0.7339	Intermediate Similarity	NPC84956
0.7207	Intermediate Similarity	NPC247037
0.7143	Intermediate Similarity	NPC475333
0.7143	Intermediate Similarity	NPC224098
0.7143	Intermediate Similarity	NPC208383
0.708	Intermediate Similarity	NPC194207
0.708	Intermediate Similarity	NPC22779
0.6957	Remote Similarity	NPC23808
0.6957	Remote Similarity	NPC87998
0.6822	Remote Similarity	NPC94272
0.6786	Remote Similarity	NPC480555
0.6786	Remote Similarity	NPC150372
0.675	Remote Similarity	NPC480556
0.6609	Remote Similarity	NPC486386
0.6581	Remote Similarity	NPC218571
0.6581	Remote Similarity	NPC487615
0.6532	Remote Similarity	NPC208832
0.6518	Remote Similarity	NPC470433
0.6518	Remote Similarity	NPC46190
0.6518	Remote Similarity	NPC171073
0.6496	Remote Similarity	NPC254255
0.6333	Remote Similarity	NPC480553
0.6296	Remote Similarity	NPC128123
0.6283	Remote Similarity	NPC98696
0.6186	Remote Similarity	NPC269297
0.6186	Remote Similarity	NPC222202
0.6174	Remote Similarity	NPC248746
0.6167	Remote Similarity	NPC480554
0.6154	Remote Similarity	NPC102016
0.6154	Remote Similarity	NPC95051
0.6098	Remote Similarity	NPC475357
0.6034	Remote Similarity	NPC122819
0.5983	Remote Similarity	NPC42171
0.5906	Remote Similarity	NPC224314
0.5888	Remote Similarity	NPC165439
0.5868	Remote Similarity	NPC309278
0.5766	Remote Similarity	NPC486118
0.576	Remote Similarity	NPC287885
0.5738	Remote Similarity	NPC13193
0.5726	Remote Similarity	NPC486388
0.5714	Remote Similarity	NPC124677
0.569	Remote Similarity	NPC113044
0.569	Remote Similarity	NPC283829
0.569	Remote Similarity	NPC161676
0.5652	Remote Similarity	NPC306991
0.5593	Remote Similarity	NPC485596
0.5583	Remote Similarity	NPC300557
0.5583	Remote Similarity	NPC6806
0.5574	Remote Similarity	NPC148965
0.5546	Remote Similarity	NPC265275
0.5424	Remote Similarity	NPC305423
0.5417	Remote Similarity	NPC602423
0.5385	Remote Similarity	NPC470432
0.5385	Remote Similarity	NPC230507
0.5379	Remote Similarity	NPC477808
0.5372	Remote Similarity	NPC477809
0.536	Remote Similarity	NPC32361
0.5254	Remote Similarity	NPC6295
0.5161	Remote Similarity	NPC150057
0.5161	Remote Similarity	NPC147753
0.5156	Remote Similarity	NPC92710
0.5133	Remote Similarity	NPC181845
0.5113	Remote Similarity	NPC248202
0.5088	Remote Similarity	NPC272015
0.5081	Remote Similarity	NPC471464
0.5041	Remote Similarity	NPC470748
0.5041	Remote Similarity	NPC14704
0.5038	Remote Similarity	NPC31896

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC16598 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7580
0.1-0.2	1484
0.2-0.3	80
0.3-0.4	4
0.4-0.5	0
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6034	Remote Similarity	NPD8449	Approved
0.5161	Remote Similarity	NPD8450	Suspended

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data