NPASS Compound

Natural Product: NPC147914

Natural Product ID	NPC147914
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	ZIYNQFMJNVWBKQ-UVXQDIGRSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 136143 0 0 0 0 0 0 0 0999 V2000 7.7223 3.1335 -0.1838 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5026 1.8088 -0.1698 C 0 0 2 0 0 0 0 0 0 0 0 0 7.5367 0.6497 -0.2777 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5518 0.6312 0.8645 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5813 -0.4946 0.7887 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7453 -0.4410 -0.5010 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8772 -1.7489 -1.2738 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3942 -0.3519 0.0531 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7419 0.4976 1.3001 C 0 0 1 0 0 0 0 0 0 0 0 0 2.3617 0.5877 1.8552 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6891 1.1495 0.5766 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2336 1.1013 0.6539 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.1756 0.4422 1.9463 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6543 0.5758 2.0730 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4535 0.4773 1.0377 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9233 0.6088 1.1771 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6477 -0.4532 0.3865 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6820 -1.5618 0.0777 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4427 -1.1720 -0.6655 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9189 0.2105 -0.3200 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.6285 1.1932 -1.2758 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4666 0.4175 -0.4901 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3232 -0.7985 -0.8791 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5864 -0.2668 -1.5355 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3771 0.5272 -0.5764 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1110 1.5800 -1.4326 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2363 -0.0429 -0.7703 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5928 -0.2592 -0.8517 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2646 1.0685 -0.8803 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4768 1.0078 -1.7616 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.1797 -0.2918 -1.5113 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3145 -1.4673 -1.8134 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6110 -2.0766 -3.1716 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9464 -2.4241 -3.3007 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9576 -1.1627 -1.8115 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8464 -0.2479 -0.3339 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2105 -0.3076 -0.3691 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.8339 -1.3807 0.4854 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.0187 -0.9537 1.9271 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.0570 0.1891 2.2572 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.1295 1.2839 1.2472 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.9896 2.4360 1.7873 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7166 0.8990 0.0663 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7830 -0.3486 2.4137 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.3287 -0.6139 2.1935 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.0895 -1.7443 -0.0310 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0081 0.9588 -3.0817 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5185 1.5441 0.4048 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6545 -0.3185 1.8502 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2019 -1.7091 0.9379 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3111 1.8117 1.0829 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0993 0.7071 1.2933 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0463 0.4790 0.3359 C 0 0 1 0 0 0 0 0 0 0 0 0 12.4627 0.5124 0.8545 C 0 0 1 0 0 0 0 0 0 0 0 0 13.3249 -0.1513 -0.2071 C 0 0 1 0 0 0 0 0 0 0 0 0 13.0570 -1.6407 -0.0904 C 0 0 2 0 0 0 0 0 0 0 0 0 11.5868 -1.7818 0.2893 C 0 0 2 0 0 0 0 0 0 0 0 0 11.0670 -3.1187 -0.1921 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8364 -0.7576 -0.2605 O 0 0 0 0 0 0 0 0 0 0 0 0 13.8769 -2.2091 0.8864 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8815 0.2646 -1.4781 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9297 1.8336 0.9607 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3571 3.9750 -0.4814 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3706 3.2809 0.8659 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7995 3.0398 -0.7935 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1295 1.7937 -1.0841 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1397 -0.2744 -0.3170 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0311 0.7434 -1.2589 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1679 0.4439 1.7911 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1435 1.6309 0.9756 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0248 0.4029 -1.1347 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7592 -1.5630 -2.3638 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8312 -2.2587 -1.0760 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0286 -2.4398 -0.9951 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0367 -1.3242 0.3875 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1233 1.4862 1.0210 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0244 -0.4239 2.0826 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3219 1.3104 2.6678 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0120 2.2361 0.6023 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2285 2.1354 0.6948 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3015 0.9221 2.8278 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0174 -0.6522 1.9401 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1150 0.7653 3.0646 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2113 1.6315 0.9851 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1607 0.4147 2.2691 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4447 -0.9168 1.0409 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4653 -2.1914 0.9724 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2570 -2.2707 -0.5961 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6448 -1.2449 -1.7501 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6918 -1.9615 -0.4285 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3076 1.8782 -0.7456 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0400 0.6904 -2.1586 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8462 1.8938 -1.7151 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3074 1.1536 -1.3553 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2228 -1.4632 -1.5938 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6353 -1.3169 0.0469 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1998 -1.0834 -1.9613 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2293 0.3953 -2.3607 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4186 1.1017 -2.3614 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8692 2.1265 -0.8849 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2967 2.3142 -1.7017 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8785 -0.7484 0.1295 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5762 1.8526 -1.3330 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1462 1.8864 -1.6124 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0053 -0.3374 -2.2980 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4357 -2.2804 -1.0687 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3879 -1.3468 -4.0017 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0149 -2.9614 -3.3821 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4532 -1.7661 -3.8586 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6000 -0.3815 -1.4388 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2399 -2.3121 0.5097 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7399 -1.7727 2.6435 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3939 0.5844 3.2441 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1232 1.7070 1.0858 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9224 2.0694 2.2143 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2325 3.0832 0.9202 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3587 2.9584 2.5462 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8590 -1.2240 2.8328 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3694 -0.2567 3.1193 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.5963 -2.2903 0.6203 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1284 1.8515 -3.4780 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6684 1.8838 0.7847 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1424 -1.7397 0.7005 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8748 2.7682 1.1044 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6000 1.8838 1.9458 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9946 1.2564 -0.4604 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6068 -0.0623 1.7833 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3997 0.0615 -0.0550 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2679 -2.1416 -1.0401 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4376 -1.7532 1.3896 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6152 -3.4720 -1.0988 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2859 -3.8682 0.5969 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9868 -3.0794 -0.3333 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1701 -1.5425 1.5405 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3852 -0.2016 -2.1807 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4690 2.3637 0.2438 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 41 43 1 0 40 44 1 0 39 45 1 0 38 46 1 0 30 47 1 0 29 48 1 0 9 49 1 0 5 50 1 1 2 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 57 59 1 0 56 60 1 0 55 61 1 0 54 62 1 0 49 5 1 0 59 53 1 0 25 8 1 0 35 28 1 0 43 37 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 63 1 0 1 64 1 0 1 65 1 0 2 66 1 6 3 67 1 0 3 68 1 0 4 69 1 0 4 70 1 0 6 71 1 6 7 72 1 0 7 73 1 0 7 74 1 0 8 75 1 1 9 76 1 6 10 77 1 0 10 78 1 0 11 79 1 6 12 80 1 1 13 81 1 0 13 82 1 0 14 83 1 0 16 84 1 0 16 85 1 0 17 86 1 1 18 87 1 0 18 88 1 0 19 89 1 0 19 90 1 0 21 91 1 0 21 92 1 0 21 93 1 0 22 94 1 6 23 95 1 0 23 96 1 0 24 97 1 0 24 98 1 0 26 99 1 0 26100 1 0 26101 1 0 28102 1 1 29103 1 6 30104 1 6 31105 1 6 32106 1 1 33107 1 0 33108 1 0 34109 1 0 37110 1 6 38111 1 1 39112 1 1 40113 1 1 41114 1 6 42115 1 0 42116 1 0 42117 1 0 44118 1 0 45119 1 0 46120 1 0 47121 1 0 48122 1 0 50123 1 0 51124 1 0 51125 1 0 53126 1 6 54127 1 1 55128 1 1 56129 1 6 57130 1 1 58131 1 0 58132 1 0 58133 1 0 60134 1 0 61135 1 0 62136 1 0 M END

Standard InCHIKey	ZIYNQFMJNVWBKQ-UVXQDIGRSA-N
Standard InCHI	InChI=1S/C45H74O17/c1-19(18-56-40-36(52)33(49)31(47)21(3)57-40)9-14-45(55)20(2)30-28(62-45)16-27-25-8-7-23-15-24(10-12-43(23,5)26(25)11-13-44(27,30)6)59-42-38(54)35(51)39(29(17-46)60-42)61-41-37(53)34(50)32(48)22(4)58-41/h7,19-22,24-42,46-55H,8-18H2,1-6H3/t19-,20+,21+,22+,24+,25-,26-,27-,28-,29-,30+,31+,32+,33-,34-,35-,36-,37-,38-,39-,40-,41+,42-,43+,44+,45-/m1/s1
SMILES	C[C@H](CC[C@@]1([C@@H](C)[C@H]2[C@@H](C[C@@H]3[C@@H]4CC=C5C[C@H](CC[C@]5(C)[C@@H]4CC[C@]23C)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)O)O)O1)O)CO[C@H]1[C@@H]([C@@H]([C@H]([C@H](C)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	886.49	Volume:	865.222 ? Van der Waals volume.
Dense:	1.025	LogP:	0.781 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.493 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.139 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	42.0
TPSA:	266.91 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	10.0	Rings:	8.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.124	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.31	Fsp³:	0.956
MCE-18:	155.455 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.699	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.228	Promiscuous compounds:	0.032

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.364	MDCK Permeability:	-5.084
Pgp-inhibitor:	0.0	Pgp-substrate:	0.999
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.655	30% Bioavailability (F30%):	0.555
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	0.482
Plasma Protein Binding (PPB):	65.502%	Volume Distribution (VD):	-0.344
Fu:	23.798% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.995
OATP1B3 inhibitor:	0.26	BCRP inhibitor:	0.019
BSEP inhibitor:	0.22

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.001	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.999
HLM stability:	0.119 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.235

Half-life (T1/2):

3.222

ADMET: Toxicity

hERG Blockers:	0.023	hERG Blockers (10um):	0.142
Human Hepatotoxicity (H-HT):	0.213	Drug-induced Liver Injury (DILI):	0.747
AMES Toxicity:	0.852	Rat Oral Acute Toxicity:	0.005
Maximum Recommended Daily Dose:	0.005	Skin Sensitization:	1.0
Carcinogencity:	0.006	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.492	Drug-induced Nephrotoxicity:	0.863
Genotoxicity:	0.055	RPMI-8226 Immunitoxicity:	0.359
A549 Cytotoxicity:	0.903	Hek293 Cytotoxicity:	0.782
BCF:	1.471 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.236 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.241 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.634 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO9170	Pulsatilla pratensis	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC147914 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22698
0.1-0.2	23318
0.2-0.3	3127
0.3-0.4	524
0.4-0.5	99
0.5-0.6	45
0.6-0.7	30
0.7-0.8	0
0.8-0.85	6
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8247	Intermediate Similarity	NPC247037
0.8229	Intermediate Similarity	NPC73243
0.8229	Intermediate Similarity	NPC244086
0.8229	Intermediate Similarity	NPC84956
0.81	Intermediate Similarity	NPC23808
0.81	Intermediate Similarity	NPC87998
0.7895	Intermediate Similarity	NPC98696
0.7857	Intermediate Similarity	NPC102016
0.7857	Intermediate Similarity	NPC95051
0.7822	Intermediate Similarity	NPC249265
0.7476	Intermediate Similarity	NPC218571
0.7476	Intermediate Similarity	NPC487615
0.7113	Intermediate Similarity	NPC470432
0.7113	Intermediate Similarity	NPC230507
0.6961	Remote Similarity	NPC6806
0.6768	Remote Similarity	NPC15249
0.6768	Remote Similarity	NPC25455
0.6633	Remote Similarity	NPC476538
0.6633	Remote Similarity	NPC476539
0.6458	Remote Similarity	NPC485602
0.6415	Remote Similarity	NPC475182
0.6316	Remote Similarity	NPC486114
0.6273	Remote Similarity	NPC194207
0.6273	Remote Similarity	NPC22779
0.6204	Remote Similarity	NPC98018
0.6204	Remote Similarity	NPC284104
0.6204	Remote Similarity	NPC103616
0.62	Remote Similarity	NPC476540
0.62	Remote Similarity	NPC476541
0.6195	Remote Similarity	NPC308140
0.6132	Remote Similarity	NPC470433
0.6132	Remote Similarity	NPC46190
0.6132	Remote Similarity	NPC171073
0.6126	Remote Similarity	NPC254255
0.6091	Remote Similarity	NPC470863
0.6091	Remote Similarity	NPC486386
0.6091	Remote Similarity	NPC269297
0.6091	Remote Similarity	NPC222202
0.6075	Remote Similarity	NPC477809
0.6042	Remote Similarity	NPC485600
0.6036	Remote Similarity	NPC475333
0.6036	Remote Similarity	NPC224098
0.6036	Remote Similarity	NPC208383
0.6	Remote Similarity	NPC232054
0.5963	Remote Similarity	NPC480555
0.5963	Remote Similarity	NPC150372
0.5926	Remote Similarity	NPC122819
0.5893	Remote Similarity	NPC309278
0.5865	Remote Similarity	NPC485601
0.5826	Remote Similarity	NPC84111
0.5826	Remote Similarity	NPC287483
0.5826	Remote Similarity	NPC470865
0.581	Remote Similarity	NPC94272
0.578	Remote Similarity	NPC248746
0.5743	Remote Similarity	NPC291203
0.5743	Remote Similarity	NPC217205
0.5701	Remote Similarity	NPC113044
0.5701	Remote Similarity	NPC283829
0.5701	Remote Similarity	NPC14704
0.5701	Remote Similarity	NPC161676
0.57	Remote Similarity	NPC181845
0.5688	Remote Similarity	NPC602423
0.5667	Remote Similarity	NPC224314
0.5652	Remote Similarity	NPC480554
0.5641	Remote Similarity	NPC287885
0.5586	Remote Similarity	NPC249553
0.5586	Remote Similarity	NPC42171
0.5586	Remote Similarity	NPC300557
0.5583	Remote Similarity	NPC480556
0.5575	Remote Similarity	NPC51520
0.5575	Remote Similarity	NPC303069
0.5556	Remote Similarity	NPC480553
0.5556	Remote Similarity	NPC477811
0.5526	Remote Similarity	NPC475550
0.5478	Remote Similarity	NPC470861
0.5455	Remote Similarity	NPC486388
0.5424	Remote Similarity	NPC92297
0.5413	Remote Similarity	NPC305423
0.5398	Remote Similarity	NPC150057
0.5398	Remote Similarity	NPC147753
0.537	Remote Similarity	NPC306991
0.5345	Remote Similarity	NPC32361
0.5294	Remote Similarity	NPC165439
0.5175	Remote Similarity	NPC124677
0.5138	Remote Similarity	NPC295980
0.5133	Remote Similarity	NPC265275
0.512	Remote Similarity	NPC273002
0.5098	Remote Similarity	NPC242748
0.5043	Remote Similarity	NPC182900

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC147914 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7459
0.1-0.2	1597
0.2-0.3	82
0.3-0.4	8
0.4-0.5	2
0.5-0.6	2
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5926	Remote Similarity	NPD8449	Approved
0.5398	Remote Similarity	NPD8450	Suspended

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data