NPASS Compound

Natural Product: NPC80005

Natural Product ID	NPC80005
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	VNUGYONVKHBAOG-LBSCCOFSSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	11968528
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 189197 0 0 0 0 0 0 0 0999 V2000 6.4745 -3.5999 5.8317 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3599 -3.0026 4.4094 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5469 -2.0062 4.3012 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0932 -1.1182 3.2315 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8120 -1.2934 1.9564 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4035 -0.4762 0.7822 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4701 0.9996 1.1199 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1917 -0.8010 0.0076 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1921 -2.1955 -0.6029 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7262 -2.5232 -0.7723 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0111 -1.7862 0.3577 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2472 -2.6944 1.5512 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8249 -0.5284 0.5019 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2703 0.6373 -0.2792 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7891 0.7496 -0.2738 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0610 -0.2793 0.5054 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4242 -0.0910 0.3913 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0177 -0.4270 1.7270 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7500 1.4077 0.1945 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2149 1.6346 -0.0546 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0867 0.4509 -0.0534 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5248 -0.7723 -0.7355 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1672 -1.9675 -0.1428 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0285 -0.7002 -2.1959 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0290 -0.7435 -0.8104 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4066 -1.9660 -1.3322 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1110 -1.8975 -1.2798 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5562 -1.6577 0.1504 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1151 -2.7486 0.9367 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3344 0.7297 -0.6609 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3583 0.7367 0.2069 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4003 1.7844 0.1687 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.0984 1.7223 1.5274 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.5613 0.3081 1.8285 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6290 -0.7538 1.3563 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.2252 -2.1050 1.5365 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3055 -2.3208 0.7187 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8390 -3.6042 0.8712 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.2079 -3.6037 1.4950 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.9850 -4.7779 0.9442 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.2179 -4.4492 -0.5389 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.8816 -4.0165 -1.1447 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.6847 -4.8038 -2.4184 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8350 -4.3435 -0.2797 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.0833 -3.3747 -0.6116 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1182 -5.8881 0.9686 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1407 -3.6632 2.8921 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1238 -0.4952 0.0791 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8330 0.1773 3.2125 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1010 2.6297 1.6918 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0225 3.0422 -0.2124 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6223 3.4650 -1.4001 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5894 4.5915 -1.2521 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8331 5.2081 -2.6421 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5268 5.8449 -3.0249 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3996 4.9001 -2.7998 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2872 5.5087 -1.9635 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5779 5.6127 -0.6292 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6993 3.6410 -2.3837 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5629 6.3767 -4.3151 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7421 6.2564 -2.4369 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8707 4.1557 -0.8328 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7149 0.5845 -1.6026 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4416 -0.7333 -0.1845 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6814 -0.3219 0.1445 C 0 0 1 0 0 0 0 0 0 0 0 0 8.7354 -1.4094 0.0446 C 0 0 1 0 0 0 0 0 0 0 0 0 8.8057 -1.9673 -1.3772 C 0 0 2 0 0 0 0 0 0 0 0 0 8.4014 -0.8989 -2.3754 C 0 0 1 0 0 0 0 0 0 0 0 0 8.8271 0.4038 -1.7657 C 0 0 1 0 0 0 0 0 0 0 0 0 8.7921 1.4707 -2.8284 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1820 2.7159 -2.3418 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4504 2.7762 -1.8658 C 0 0 1 0 0 0 0 0 0 0 0 0 11.2980 3.9148 -2.3814 C 0 0 1 0 0 0 0 0 0 0 0 0 12.7006 3.7690 -1.8260 C 0 0 2 0 0 0 0 0 0 0 0 0 12.7584 2.7892 -0.6866 C 0 0 1 0 0 0 0 0 0 0 0 0 11.5393 2.7839 0.1706 C 0 0 1 0 0 0 0 0 0 0 0 0 11.6594 3.8131 1.3061 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6423 5.1126 0.8189 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3531 3.0174 -0.4678 O 0 0 0 0 0 0 0 0 0 0 0 0 13.1747 1.5423 -1.1277 O 0 0 0 0 0 0 0 0 0 0 0 0 13.1473 5.0432 -1.4870 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3989 3.9454 -3.7654 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9690 0.7356 -0.7645 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9019 -1.1655 -3.6189 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0749 -3.1358 -1.5238 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9741 -0.9956 0.5163 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1852 -3.7010 3.4165 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7273 -3.1779 6.4954 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3895 -4.6940 5.6890 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4647 -3.2820 6.1830 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0337 -1.7369 5.2951 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2543 -0.0681 3.6542 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9858 -1.2245 3.2076 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9051 -1.1039 2.2171 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8051 -2.3860 1.7293 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4932 1.2326 1.6366 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6300 1.6046 0.2208 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2462 1.2547 1.8412 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3616 -0.1608 -0.9741 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7253 -2.8683 0.0906 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7370 -2.2574 -1.5615 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4190 -2.2380 -1.7663 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6387 -3.6250 -0.6994 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9065 -3.7374 1.3590 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3744 -2.8254 1.5791 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9913 -2.2756 2.5114 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8733 -0.2203 1.5403 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7025 1.5777 0.1102 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4941 1.7466 0.1771 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3982 0.7634 -1.3054 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3038 -0.0384 1.5934 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4144 0.4586 2.2912 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2008 -0.7776 2.4461 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7639 -1.1967 1.7784 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2592 1.7597 -0.7636 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3529 1.9106 1.0897 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4030 2.2046 -0.9912 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5418 2.3512 0.7610 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3758 0.2562 1.0001 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8111 -1.7781 0.7451 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4831 -2.7841 0.1524 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8912 -2.4880 -0.8471 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8567 0.3365 -2.5150 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5342 -1.4703 -2.8063 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1222 -0.8760 -2.1538 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8196 0.0075 -1.6564 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6128 -2.0401 -2.4520 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7147 -2.9351 -0.9767 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4472 -2.8854 -1.6688 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4290 -1.1458 -1.9922 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2152 -2.7334 0.9358 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1320 -3.7122 0.3947 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1853 -2.8812 1.9649 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9258 0.6731 1.2617 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1818 1.4170 -0.5773 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3121 1.9377 2.3115 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5373 0.1684 1.3238 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7154 -0.6932 2.0287 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4592 -2.2728 2.6125 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4287 -2.8571 1.3047 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1664 -4.1069 1.6272 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7795 -2.6886 1.2573 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9306 -4.9642 1.4640 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6192 -5.3056 -1.0891 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9068 -2.9611 -1.4061 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7431 -4.5364 -2.9336 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6886 -5.8994 -2.2406 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5047 -4.5937 -3.1536 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3842 -3.1865 -1.5323 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5574 -5.8970 1.8007 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9790 -3.3077 3.2830 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3646 0.8860 3.7057 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8233 3.5505 1.8583 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2635 2.5791 -1.7328 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3062 5.4074 -0.5985 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1936 4.4655 -3.3616 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4123 6.7346 -2.3369 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9118 4.7703 -3.8276 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3641 4.8906 -2.1270 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0172 6.5121 -2.3802 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1485 6.4298 -0.4997 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0737 5.7483 -4.9215 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5269 6.1268 -3.0246 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0195 3.2449 -1.2138 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3257 1.3429 -2.1023 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8212 0.1784 1.1235 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4313 -2.2766 0.6612 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8691 -2.2073 -1.5632 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2938 -0.9112 -2.4170 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8516 0.3612 -1.3411 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7636 1.6023 -3.2272 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4270 1.2375 -3.7109 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0385 1.8462 -1.9448 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8304 4.8641 -2.0593 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4213 3.3832 -2.6025 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6031 3.1543 -0.0258 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4722 1.7906 0.6971 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5986 3.6256 1.8893 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8246 3.7127 2.0264 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3786 5.6619 1.1593 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3981 0.9174 -0.4032 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9289 5.3211 -2.0248 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3215 3.0271 -4.1278 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5318 -1.9210 -3.6780 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7364 -3.2570 -2.4362 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9623 -0.9369 1.4861 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5368 -4.2960 2.7275 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8764 -4.4548 3.9093 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8333 -3.0626 2.8092 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 21 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 41 45 1 0 40 46 1 0 39 47 1 0 35 48 1 0 34 49 1 0 33 50 1 0 32 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 56 59 1 0 55 60 1 0 54 61 1 0 53 62 1 0 14 63 1 0 6 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 76 79 1 0 75 80 1 0 74 81 1 0 73 82 1 0 69 83 1 0 68 84 1 0 67 85 1 0 66 86 1 0 2 87 1 0 13 8 1 0 28 16 1 0 48 31 1 0 59 52 1 0 83 65 1 0 28 11 1 0 44 38 1 0 79 72 1 0 25 17 1 0 1 88 1 0 1 89 1 0 1 90 1 0 3 91 1 0 4 92 1 0 4 93 1 0 5 94 1 0 5 95 1 0 7 96 1 0 7 97 1 0 7 98 1 0 8 99 1 0 9100 1 0 9101 1 0 10102 1 0 10103 1 0 12104 1 0 12105 1 0 12106 1 0 13107 1 0 14108 1 0 15109 1 0 15110 1 0 16111 1 0 18112 1 0 18113 1 0 18114 1 0 19115 1 0 19116 1 0 20117 1 0 20118 1 0 21119 1 0 23120 1 0 23121 1 0 23122 1 0 24123 1 0 24124 1 0 24125 1 0 25126 1 0 26127 1 0 26128 1 0 27129 1 0 27130 1 0 29131 1 0 29132 1 0 29133 1 0 31134 1 1 32135 1 6 33136 1 1 34137 1 6 35138 1 1 36139 1 0 36140 1 0 38141 1 1 39142 1 1 40143 1 1 41144 1 6 42145 1 6 43146 1 0 43147 1 0 43148 1 0 45149 1 0 46150 1 0 47151 1 0 49152 1 0 50153 1 0 52154 1 6 53155 1 1 54156 1 6 55157 1 1 56158 1 6 57159 1 0 57160 1 0 58161 1 0 60162 1 0 61163 1 0 62164 1 0 63165 1 0 65166 1 1 66167 1 1 67168 1 6 68169 1 6 69170 1 1 70171 1 0 70172 1 0 72173 1 1 73174 1 1 74175 1 6 75176 1 1 76177 1 1 77178 1 0 77179 1 0 78180 1 0 80181 1 0 81182 1 0 82183 1 0 84184 1 0 85185 1 0 86186 1 0 87187 1 0 87188 1 0 87189 1 0 M END

Standard InCHIKey	VNUGYONVKHBAOG-LBSCCOFSSA-N
Standard InCHI	InChI=1S/C60H102O27/c1-24(2)11-10-15-60(9,87-54-49(77)44(72)39(67)30(83-54)22-79-52-47(75)42(70)37(65)28(20-61)81-52)26-12-17-59(8)35(26)27(63)19-33-57(6)16-14-34(56(4,5)32(57)13-18-58(33,59)7)85-55-50(86-53-48(76)43(71)38(66)29(21-62)82-53)45(73)40(68)31(84-55)23-78-51-46(74)41(69)36(64)25(3)80-51/h11,25-55,61-77H,10,12-23H2,1-9H3/t25-,26?,27?,28+,29+,30+,31+,32?,33?,34?,35?,36-,37+,38+,39+,40+,41+,42-,43-,44-,45-,46+,47+,48+,49+,50+,51+,52+,53-,54-,55-,57?,58?,59?,60?/m0/s1
SMILES	CC(=CCCC(C)(C1CCC2(C)C1C(CC1C3(C)CCC(C(C)(C)C3CCC21C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O1)O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1254.66	Volume:	1204.007 ? Van der Waals volume.
Dense:	1.042	LogP:	0.722 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.577 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.065 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	18.0	Rigid Bonds:	51.0
TPSA:	436.21 ? Topological Polar Surface Area.	H-Bond Acceptor:	27.0
H-Bond Donor:	17.0	Rings:	9.0
Heavy Atoms:	27.0

MedChem Properties

QED Drug-Likeness Score:	0.047	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.337	Fsp³:	0.967
MCE-18:	200.678 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.51	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.013 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.172 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.24	Promiscuous compounds:	0.036

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.465	MDCK Permeability:	-4.973
Pgp-inhibitor:	0.0	Pgp-substrate:	0.113
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.909
20% Bioavailability (F20%):	0.0	30% Bioavailability (F30%):	0.984
50% Bioavailability (F50%):	0.994

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.008	MRP1:	0.664
Plasma Protein Binding (PPB):	37.751%	Volume Distribution (VD):	-0.328
Fu:	30.015% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.07
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.982

Half-life (T1/2):

5.573

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.006
Human Hepatotoxicity (H-HT):	0.377	Drug-induced Liver Injury (DILI):	0.337
AMES Toxicity:	0.945	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.054	Drug-induced Nephrotoxicity:	0.829
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.282
A549 Cytotoxicity:	0.772	Hek293 Cytotoxicity:	0.26
BCF:	1.829 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.426 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.842 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.951 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	Stems	n.a.	n.a.	PMID[20104880]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22342101]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	aerial parts	n.a.	n.a.	PMID[25895106]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12216	Gynura elliptica	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO12216	Gynura elliptica	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO12216	Gynura elliptica	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC80005 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22702
0.1-0.2	22782
0.2-0.3	3036
0.3-0.4	970
0.4-0.5	288
0.5-0.6	39
0.6-0.7	21
0.7-0.8	0
0.8-0.85	5
0.85-0.9	2
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9091	High Similarity	NPC208650
0.8889	High Similarity	NPC220427
0.8506	High Similarity	NPC69737
0.8404	Intermediate Similarity	NPC14946
0.8404	Intermediate Similarity	NPC159005
0.8404	Intermediate Similarity	NPC63368
0.8333	Intermediate Similarity	NPC135369
0.8182	Intermediate Similarity	NPC208477
0.7843	Intermediate Similarity	NPC146868
0.7647	Intermediate Similarity	NPC241381
0.7596	Intermediate Similarity	NPC488294
0.7471	Intermediate Similarity	NPC31907
0.7339	Intermediate Similarity	NPC488291
0.7228	Intermediate Similarity	NPC246124
0.6979	Remote Similarity	NPC269627
0.6947	Remote Similarity	NPC181467
0.6832	Remote Similarity	NPC65167
0.6827	Remote Similarity	NPC472718
0.6783	Remote Similarity	NPC488293
0.6697	Remote Similarity	NPC488292
0.6542	Remote Similarity	NPC472716
0.6449	Remote Similarity	NPC180183
0.6408	Remote Similarity	NPC472988
0.6408	Remote Similarity	NPC38217
0.64	Remote Similarity	NPC152584
0.6316	Remote Similarity	NPC157659
0.6311	Remote Similarity	NPC208594
0.6289	Remote Similarity	NPC312553
0.625	Remote Similarity	NPC146652
0.6214	Remote Similarity	NPC234160
0.6196	Remote Similarity	NPC66654
0.6147	Remote Similarity	NPC6931
0.6122	Remote Similarity	NPC8039
0.6122	Remote Similarity	NPC120123
0.604	Remote Similarity	NPC213190
0.5922	Remote Similarity	NPC127801
0.5918	Remote Similarity	NPC159036
0.5833	Remote Similarity	NPC160816
0.5794	Remote Similarity	NPC476360
0.5794	Remote Similarity	NPC476361
0.5769	Remote Similarity	NPC194842
0.5702	Remote Similarity	NPC610948
0.5676	Remote Similarity	NPC173859
0.5625	Remote Similarity	NPC234287
0.5588	Remote Similarity	NPC472987
0.5545	Remote Similarity	NPC472897
0.5545	Remote Similarity	NPC472896
0.5524	Remote Similarity	NPC472719
0.55	Remote Similarity	NPC114874
0.5464	Remote Similarity	NPC88000
0.5464	Remote Similarity	NPC4831
0.5464	Remote Similarity	NPC472023
0.5455	Remote Similarity	NPC160734
0.5429	Remote Similarity	NPC207845
0.5429	Remote Similarity	NPC131479
0.5417	Remote Similarity	NPC606950
0.5398	Remote Similarity	NPC148603
0.5327	Remote Similarity	NPC472715
0.5315	Remote Similarity	NPC470512
0.5304	Remote Similarity	NPC470514
0.5294	Remote Similarity	NPC470915
0.5288	Remote Similarity	NPC16573
0.5278	Remote Similarity	NPC472717
0.5258	Remote Similarity	NPC280825
0.5258	Remote Similarity	NPC473198
0.5217	Remote Similarity	NPC607354
0.5169	Remote Similarity	NPC481079
0.5143	Remote Similarity	NPC165033
0.5143	Remote Similarity	NPC273879
0.513	Remote Similarity	NPC171741
0.5088	Remote Similarity	NPC305418
0.5047	Remote Similarity	NPC139271
0.5043	Remote Similarity	NPC123796
0.5043	Remote Similarity	NPC470513

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC80005 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7653
0.1-0.2	1434
0.2-0.3	53
0.3-0.4	10
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data