NPASS Compound

Natural Product: NPC246353

Natural Product ID	NPC246353
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	PWAOOJDMFUQOKB-ACACRENUSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44592919
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 148154 0 0 0 0 0 0 0 0999 V2000 -9.0354 2.3681 -0.2833 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2622 2.3533 -1.5611 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3120 1.4734 -1.7249 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9493 0.4444 -0.6576 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5378 0.7173 -0.3415 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8211 -0.0495 0.6777 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4915 0.0723 2.0691 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4711 0.6426 0.9938 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8957 -0.2967 2.0723 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4112 -0.4448 1.7741 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1907 0.6958 0.8607 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.3402 1.9606 1.6664 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4292 0.5579 -0.0434 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3758 1.4984 -1.1550 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.1768 2.3464 -1.3572 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0595 1.9989 -0.6547 C 0 0 2 0 0 0 0 0 0 0 0 0 1.3543 2.3081 -1.3800 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6289 1.4544 -2.5655 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2347 3.7161 -1.8711 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9864 4.7042 -0.9820 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4217 4.3187 -1.1717 C 0 0 1 0 0 0 0 0 0 0 0 0 3.6802 2.9551 -0.5680 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6576 2.2380 -1.4697 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3865 3.2488 0.7432 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4287 2.2058 -0.2911 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5619 0.8238 0.2143 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2306 0.5214 0.9678 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0612 0.6414 0.0319 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0523 -0.5322 -0.8696 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6108 0.6558 1.0698 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3367 -0.4805 0.9583 C 0 0 1 0 0 0 0 0 0 0 0 0 5.7979 -0.2371 0.7757 C 0 0 1 0 0 0 0 0 0 0 0 0 6.4820 -0.5935 2.1013 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7231 0.1105 3.1853 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3789 -0.6041 3.2827 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3472 0.3249 3.8234 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1515 -0.3393 4.0891 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0605 -1.2458 2.1092 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4473 -0.0184 4.3738 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8319 -0.2857 2.0780 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3553 -1.1507 -0.1511 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0628 -0.5469 -1.1578 C 0 0 1 0 0 0 0 0 0 0 0 0 8.4880 -1.0428 -1.2893 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5731 -2.5457 -1.3836 C 0 0 1 0 0 0 0 0 0 0 0 0 7.5860 -3.0422 -2.3957 C 0 0 2 0 0 0 0 0 0 0 0 0 6.2785 -2.3128 -2.2743 C 0 0 2 0 0 0 0 0 0 0 0 0 5.3301 -2.8585 -3.3152 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4311 -0.9286 -2.3672 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3262 -4.3924 -2.0708 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8794 -2.8897 -1.7110 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9592 -0.5492 -2.5270 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6894 4.3499 -2.5449 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5518 0.8028 -2.3870 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5568 -1.3597 0.5025 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5447 -2.2758 0.3931 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4313 -3.0869 -0.9130 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7275 -3.8340 -1.0604 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.0729 -4.6197 0.1825 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6655 -3.9440 1.4466 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6150 -4.9209 2.5974 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8077 -5.6270 2.7475 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4380 -3.2994 1.3816 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4700 -4.7586 0.1985 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6730 -4.7552 -2.1209 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1623 -2.3103 -2.0051 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5731 3.3285 -2.6291 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5348 1.3838 -0.1382 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8462 3.1233 -0.3572 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3192 2.5328 0.5228 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7182 1.4186 -2.6329 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0715 -0.5120 -1.2544 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6814 0.5719 0.1239 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0186 0.4996 -1.3290 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4515 1.8008 -0.0996 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5700 -0.0834 2.0073 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3343 1.0984 2.4739 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0727 -0.6330 2.7879 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7348 1.6223 1.3813 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3100 -1.3055 2.0284 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0912 0.1003 3.0806 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8030 -0.3245 2.6980 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1607 -1.4360 1.3825 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0408 1.7542 2.5331 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8100 2.7905 1.1375 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4245 2.3164 2.1454 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5109 -0.4993 -0.4402 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3085 2.1423 -1.1098 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9075 2.4444 -2.4561 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4888 3.4174 -1.1380 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1292 2.7116 0.2358 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0714 0.4819 -2.4024 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7180 1.4717 -3.2041 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3770 2.0252 -3.1984 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2256 4.0986 -1.9793 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7148 3.8472 -2.8887 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6368 4.7229 0.0437 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8013 5.7084 -1.4150 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0428 5.1255 -0.7312 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5746 2.6461 -2.4982 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7173 2.4906 -1.1660 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5671 1.1537 -1.4519 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4206 4.3668 0.9616 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4855 3.0068 0.6856 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8847 2.8409 1.6270 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9540 2.7800 0.5753 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6118 0.0006 -0.5059 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3009 -0.5527 1.2390 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1687 1.0873 1.8906 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0101 -1.1349 -0.8125 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1159 -0.3589 -1.9271 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6982 -1.3343 -0.5869 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0188 -1.1535 0.1224 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0966 0.7450 0.4279 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3655 -1.6894 2.2202 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6073 1.1747 2.8953 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5280 -1.4050 4.0570 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7159 0.6554 4.8416 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1785 1.2467 3.2731 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4865 0.3877 4.3123 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9412 -0.5771 5.0244 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2847 -0.9702 2.6671 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1090 0.5433 -1.1248 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1597 -0.6225 -0.5265 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3518 -3.0130 -0.3930 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0039 -3.0375 -3.4163 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8436 -2.6163 -1.2848 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8076 -2.8880 -4.3032 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3611 -2.3407 -3.3101 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1561 -3.9351 -3.0335 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0513 -4.4560 -1.1119 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3693 -2.1034 -2.0569 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5263 -1.0787 -3.2286 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2807 5.0707 -2.8120 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8593 1.4903 -3.0580 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5765 -1.9468 0.4642 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6332 -3.8643 -0.7684 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5298 -3.0860 -1.2280 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6524 -5.6416 0.1660 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4465 -3.1806 1.7087 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7585 -5.5940 2.4726 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4493 -4.3449 3.5361 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5490 -6.5562 3.0075 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8878 -3.8599 0.3866 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9334 -4.5361 -2.7439 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3731 -2.6529 -2.5087 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6431 3.3015 -2.9230 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3133 4.3327 -2.2549 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9091 3.1344 -3.4939 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 1 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 6 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 6 26 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 35 38 1 0 34 39 1 0 33 40 1 0 32 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 46 48 1 0 45 49 1 0 44 50 1 0 43 51 1 0 21 52 1 0 14 53 1 0 6 54 1 6 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 59 62 1 0 58 63 1 0 57 64 1 0 56 65 1 0 2 66 1 0 13 8 1 0 28 16 1 0 38 31 1 0 48 42 1 0 62 55 1 0 28 11 1 0 25 17 1 0 1 67 1 0 1 68 1 0 1 69 1 0 3 70 1 0 4 71 1 0 4 72 1 0 5 73 1 0 5 74 1 0 7 75 1 0 7 76 1 0 7 77 1 0 8 78 1 1 9 79 1 0 9 80 1 0 10 81 1 0 10 82 1 0 12 83 1 0 12 84 1 0 12 85 1 0 13 86 1 6 14 87 1 1 15 88 1 0 15 89 1 0 16 90 1 1 18 91 1 0 18 92 1 0 18 93 1 0 19 94 1 0 19 95 1 0 20 96 1 0 20 97 1 0 21 98 1 1 23 99 1 0 23100 1 0 23101 1 0 24102 1 0 24103 1 0 24104 1 0 25105 1 1 26106 1 6 27107 1 0 27108 1 0 29109 1 0 29110 1 0 29111 1 0 31112 1 6 32113 1 6 33114 1 1 34115 1 6 35116 1 1 36117 1 0 36118 1 0 37119 1 0 39120 1 0 40121 1 0 42122 1 1 43123 1 1 44124 1 1 45125 1 6 46126 1 1 47127 1 0 47128 1 0 47129 1 0 49130 1 0 50131 1 0 51132 1 0 52133 1 0 53134 1 0 55135 1 6 56136 1 1 57137 1 6 58138 1 6 59139 1 1 60140 1 0 60141 1 0 61142 1 0 63143 1 0 64144 1 0 65145 1 0 66146 1 0 66147 1 0 66148 1 0 M END

Standard InCHIKey	PWAOOJDMFUQOKB-ACACRENUSA-N
Standard InCHI	InChI=1S/C48H82O18/c1-21(2)11-10-14-48(9,66-42-38(60)35(57)32(54)26(19-49)63-42)23-12-16-46(7)30(23)24(51)17-28-45(6)15-13-29(52)44(4,5)40(45)25(18-47(28,46)8)62-43-39(36(58)33(55)27(20-50)64-43)65-41-37(59)34(56)31(53)22(3)61-41/h11,22-43,49-60H,10,12-20H2,1-9H3/t22-,23-,24+,25-,26+,27+,28+,29-,30-,31-,32+,33+,34+,35-,36-,37+,38+,39+,40-,41-,42-,43+,45+,46+,47+,48+/m0/s1
SMILES	CC(=CCC[C@](C)([C@H]1CC[C@]2(C)[C@@H]1[C@@H](C[C@@H]1[C@@]3(C)CC[C@@H](C(C)(C)[C@@H]3[C@H](C[C@@]21C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](C)O1)O)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	946.55	Volume:	934.456 ? Van der Waals volume.
Dense:	1.013	LogP:	1.887 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.581 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.079 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	39.0
TPSA:	298.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	12.0	Rings:	7.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.09	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.503	Fsp³:	0.958
MCE-18:	158.17 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.702	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.278	Promiscuous compounds:	0.244

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.448	MDCK Permeability:	-4.991
Pgp-inhibitor:	0.0	Pgp-substrate:	0.897
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.843
20% Bioavailability (F20%):	0.692	30% Bioavailability (F30%):	0.987
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.035	MRP1:	0.151
Plasma Protein Binding (PPB):	65.802%	Volume Distribution (VD):	-0.372
Fu:	21.26% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.003	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.007	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.025
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.195

Half-life (T1/2):

3.524

ADMET: Toxicity

hERG Blockers:	0.005	hERG Blockers (10um):	0.021
Human Hepatotoxicity (H-HT):	0.437	Drug-induced Liver Injury (DILI):	0.52
AMES Toxicity:	0.936	Rat Oral Acute Toxicity:	0.003
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.018	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.775	Drug-induced Nephrotoxicity:	0.975
Genotoxicity:	0.024	RPMI-8226 Immunitoxicity:	0.278
A549 Cytotoxicity:	0.962	Hek293 Cytotoxicity:	0.286
BCF:	1.312 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.451 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.86 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.019 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[ 12877918]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.jarmap.2018.11.004]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.jarmap.2018.11.004]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12350149]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Flower buds	n.a.	n.a.	PMID[12880307]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Stems	n.a.	n.a.	PMID[17663584]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Roots	n.a.	n.a.	PMID[18186611]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	leaf	n.a.	PMID[18409045]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	flower buds	n.a.	n.a.	PMID[19926279]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	root	n.a.	PMID[2092947]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	berry	n.a.	n.a.	PMID[21216145]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	leaves	n.a.	n.a.	PMID[24290061]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24968750]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25152999]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	leaves and stems	n.a.	n.a.	PMID[25442304]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Steamed Roots	n.a.	n.a.	PMID[26200131]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	stems-leaves	n.a.	n.a.	PMID[26420067]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	stem	n.a.	PMID[27914541]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	Roots	n.a.	n.a.	PMID[28006911]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28202328]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	Flower Buds	n.a.	n.a.	PMID[28345906]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32129622]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[MetaboLights]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC246353 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24550
0.1-0.2	21314
0.2-0.3	3387
0.3-0.4	506
0.4-0.5	31
0.5-0.6	34
0.6-0.7	20
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC208594
0.9512	High Similarity	NPC127801
0.8556	High Similarity	NPC160816
0.8415	Intermediate Similarity	NPC114874
0.7917	Intermediate Similarity	NPC6931
0.7778	Intermediate Similarity	NPC152584
0.7667	Intermediate Similarity	NPC307167
0.7647	Intermediate Similarity	NPC309425
0.75	Intermediate Similarity	NPC16520
0.75	Intermediate Similarity	NPC211879
0.75	Intermediate Similarity	NPC189852
0.75	Intermediate Similarity	NPC155010
0.75	Intermediate Similarity	NPC601606
0.7333	Intermediate Similarity	NPC229801
0.7283	Intermediate Similarity	NPC288694
0.7174	Intermediate Similarity	NPC472252
0.7174	Intermediate Similarity	NPC245280
0.6882	Remote Similarity	NPC181467
0.686	Remote Similarity	NPC66654
0.6813	Remote Similarity	NPC274833
0.6774	Remote Similarity	NPC208477
0.6667	Remote Similarity	NPC231340
0.6562	Remote Similarity	NPC269627
0.6556	Remote Similarity	NPC160734
0.6517	Remote Similarity	NPC131466
0.6444	Remote Similarity	NPC82955
0.6436	Remote Similarity	NPC237071
0.6436	Remote Similarity	NPC238796
0.6429	Remote Similarity	NPC210759
0.6311	Remote Similarity	NPC305418
0.63	Remote Similarity	NPC286969
0.6238	Remote Similarity	NPC208650
0.6196	Remote Similarity	NPC47566
0.6196	Remote Similarity	NPC129372
0.6196	Remote Similarity	NPC609286
0.6117	Remote Similarity	NPC220427
0.6038	Remote Similarity	NPC246124
0.5978	Remote Similarity	NPC7341
0.5943	Remote Similarity	NPC14946
0.5943	Remote Similarity	NPC63368
0.5914	Remote Similarity	NPC31907
0.581	Remote Similarity	NPC65167
0.5806	Remote Similarity	NPC136816
0.58	Remote Similarity	NPC213190
0.5794	Remote Similarity	NPC159005
0.578	Remote Similarity	NPC135369
0.5758	Remote Similarity	NPC473020
0.5729	Remote Similarity	NPC157659
0.5729	Remote Similarity	NPC472901
0.5575	Remote Similarity	NPC241381
0.5545	Remote Similarity	NPC472718
0.5545	Remote Similarity	NPC69737
0.5521	Remote Similarity	NPC472899
0.5521	Remote Similarity	NPC472898
0.5514	Remote Similarity	NPC203434
0.5478	Remote Similarity	NPC488292
0.5478	Remote Similarity	NPC146868
0.5426	Remote Similarity	NPC140446
0.5417	Remote Similarity	NPC472989
0.534	Remote Similarity	NPC131479
0.531	Remote Similarity	NPC472716
0.5299	Remote Similarity	NPC488294
0.5258	Remote Similarity	NPC43912
0.5253	Remote Similarity	NPC8431
0.5238	Remote Similarity	NPC472715
0.5164	Remote Similarity	NPC488291
0.5146	Remote Similarity	NPC473199
0.5088	Remote Similarity	NPC180183
0.5049	Remote Similarity	NPC16573
0.5049	Remote Similarity	NPC165033
0.5049	Remote Similarity	NPC273879

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC246353 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7963
0.1-0.2	1133
0.2-0.3	51
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data