15 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
7 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC91492
Formula: C16H12O4
Ingredient ID: NPC91492
| Common Name | Dalbergin |
| IUPAC Name | 6-hydroxy-7-methoxy-4-phenylchromen-2-one |
| Canonical SMILES | COc1cc2oc(=O)cc(c2cc1O)c1ccccc1 |
| Standard InCHI | InChI=1S/C16H12O4/c1-19-15-9-14-12(7-13(15)17)11(8-16(18)20-14)10-5-3-2-4-6-10/h2-9,17H,1H3 |
| Standard InCHIKey | AZELSOYQOIUPBZ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 442768 ZINC ID: ZINC000000899783 ChEMBL ID: CHEMBL1829658 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC91492] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pterocarpus santalinus | Pterocarpus | Fabaceae |
  |
| Dalbergia odorifera | Dalbergia | Fabaceae |
 |
| Dalbergia sissoo | Dalbergia | Fabaceae |
|
| Arnica longifolia | Arnica | Asteraceae | |
| Kaempferia galanga | Kaempferia | Zingiberaceae |
|
| Rubus rigidus | Rubus | Rosaceae |
|
Ingredient ID: NPC7439
Formula: C17H14O6
Ingredient ID: NPC7439
| Common Name | n.a. |
| IUPAC Name | 6-hydroxy-4-(3-hydroxy-4-methoxyphenyl)-7-methoxychromen-2-one |
| Canonical SMILES | COc1ccc(cc1O)c1cc(=O)oc2c1cc(O)c(c2)OC |
| Standard InCHI | InChI=1S/C17H14O6/c1-21-14-4-3-9(5-12(14)18)10-7-17(20)23-15-8-16(22-2)13(19)6-11(10)15/h3-8,18-19H,1-2H3 |
| Standard InCHIKey | XZOXEPMJIGHPMG-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 15560441 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD29874] Database: NPASS [NPC7439] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pterocarpus santalinus | Pterocarpus | Fabaceae |
|
| Arnica longifolia | Arnica | Asteraceae | |
| Kaempferia galanga | Kaempferia | Zingiberaceae |
|
| Rubus rigidus | Rubus | Rosaceae |
|
Ingredient ID: NPC34245
Formula: C16H12O6
Ingredient ID: NPC34245
| Common Name | 3'-Hydroxymelanettin |
| IUPAC Name | 4-(3,4-dihydroxyphenyl)-6-hydroxy-7-methoxychromen-2-one |
| Canonical SMILES | COc1cc2oc(=O)cc(c2cc1O)c1ccc(c(c1)O)O |
| Standard InCHI | InChI=1S/C16H12O6/c1-21-15-7-14-10(5-13(15)19)9(6-16(20)22-14)8-2-3-11(17)12(18)4-8/h2-7,17-19H,1H3 |
| Standard InCHIKey | IGHVYQBBZBLNDW-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5318262 ZINC ID: ZINC000013340180 ChEMBL ID: CHEMBL2397756 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC34245] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Dalbergia odorifera | Dalbergia | Fabaceae |
|
| Sophora flavescens | Sophora | Fabaceae |
|
| Arnica longifolia | Arnica | Asteraceae | |
| Kaempferia galanga | Kaempferia | Zingiberaceae |
|
| Rubus rigidus | Rubus | Rosaceae |
|
Ingredient ID: NPC303967
Formula: C16H14O3
Ingredient ID: NPC303967
| Common Name | (R)-4' '-Methoxydalbergione |
| IUPAC Name | 2-methoxy-5-[(1R)-1-phenylprop-2-enyl]cyclohexa-2,5-diene-1,4-dione |
| Canonical SMILES | COC1=CC(=O)C(=CC1=O)[C@@H](c1ccccc1)C=C |
| Standard InCHI | InChI=1S/C16H14O3/c1-3-12(11-7-5-4-6-8-11)13-9-15(18)16(19-2)10-14(13)17/h3-10,12H,1H2,2H3/t12-/m1/s1 |
| Standard InCHIKey | RGSUZUQISVAJJF-GFCCVEGCSA-N |
| Ingredient External Links |
PubChem CID: 442809 ZINC ID: ZINC000000899887 ChEMBL ID: CHEMBL466581 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC303967] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Dalbergia odorifera | Dalbergia | Fabaceae |
|
| Arnica longifolia | Arnica | Asteraceae | |
| Kaempferia galanga | Kaempferia | Zingiberaceae |
|
| Rubus rigidus | Rubus | Rosaceae |
|
| Dalbergia louvelii | Dalbergia | Fabaceae |
Ingredient ID: NPC28951
Formula: C16H14O4
Ingredient ID: NPC28951
| Common Name | S-4'-Hydroxy-4-Methoxydalbergione |
| IUPAC Name | 2-[(1S)-1-(4-hydroxyphenyl)prop-2-enyl]-5-methoxycyclohexa-2,5-diene-1,4-dione |
| Canonical SMILES | COC1=CC(=O)C(=CC1=O)[C@H](c1ccc(cc1)O)C=C |
| Standard InCHI | InChI=1S/C16H14O4/c1-3-12(10-4-6-11(17)7-5-10)13-8-15(19)16(20-2)9-14(13)18/h3-9,12,17H,1H2,2H3/t12-/m0/s1 |
| Standard InCHIKey | DLCVFIMWFKVRTM-LBPRGKRZSA-N |
| Ingredient External Links |
PubChem CID: 44257558 ChEMBL ID: CHEMBL255296 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD79965] Database: NPASS [NPC28951] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Dalbergia odorifera | Dalbergia | Fabaceae |
|
| Arnica longifolia | Arnica | Asteraceae | |
| Kaempferia galanga | Kaempferia | Zingiberaceae |
|
| Rubus rigidus | Rubus | Rosaceae |
|
Ingredient ID: NPC280254
Formula: C6H6O3
Ingredient ID: NPC280254
| Common Name | Pyrogallol |
| IUPAC Name | benzene-1,2,3-triol |
| Canonical SMILES | Oc1c(O)cccc1O |
| Standard InCHI | InChI=1S/C6H6O3/c7-4-2-1-3-5(8)6(4)9/h1-3,7-9H |
| Standard InCHIKey | WQGWDDDVZFFDIG-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 1057 ChEMBL ID: CHEMBL307145 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC280254] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Rhododendron mucronatum | Rhododendron | Ericaceae |
|
| Amomum tsao-ko | Amomum | Zingiberaceae |
|
| Rumex chalepensis | Rumex | Polygonaceae | |
| Eucommia ulmoides | Eucommia | Eucommiaceae |
|
| Erica arborea | Erica | Ericaceae |
 |
| Saxifraga stolonifera | Saxifraga | Saxifragaceae |
|
| Rhodiola crenulata | Rhodiola | Crassulaceae |
|
| Bistorta officinalis | Bistorta | Polygonaceae |
|
| Rubus rigidus | Rubus | Rosaceae |
|
| Orostachys japonicus | Orostachys | Crassulaceae | |
| Rumex japonicus | Rumex | Polygonaceae |
|
| Euphorbia hirta | Euphorbia | Euphorbiaceae |
|
| Bistorta manshuriensis | Bistorta | Polygonaceae | |
| Rubia cordifolia | Rubia | Rubiaceae |
|
| Terminalia chebula | Terminalia | Combretaceae |
|
| Orostachys fimbriata | Orostachys | Crassulaceae | |
| Fallopia multiflora | Fallopia | Polygonaceae |
|
| Rheum maximowiczii | Rheum | Polygonaceae |
|
| Isodon lihsienensis | Isodon | Lamiaceae |
|
| Davallia mariesii | Davallia | Davalliaceae |
|
| Phoebe clemensii | Phoebe | Lauraceae | |
| Brassica oleracea var. sabauda | Brassica | Brassicaceae |
|
| Crocus sativus | Crocus | Iridaceae |
|
| Acacia confusa | Acacia | Fabaceae |
|
Ingredient ID: NPC256555
Formula: C16H12O5
Ingredient ID: NPC256555
| Common Name | n.a. |
| IUPAC Name | 6-hydroxy-4-(4-hydroxyphenyl)-7-methoxychromen-2-one |
| Canonical SMILES | COc1cc2oc(=O)cc(c2cc1O)c1ccc(cc1)O |
| Standard InCHI | InChI=1S/C16H12O5/c1-20-15-8-14-12(6-13(15)18)11(7-16(19)21-14)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| Standard InCHIKey | HUGUGFBIYQBLCS-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 442808 ZINC ID: ZINC000000899886 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC256555] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Dalbergia odorifera | Dalbergia | Fabaceae |
|
| Arnica longifolia | Arnica | Asteraceae | |
| Kaempferia galanga | Kaempferia | Zingiberaceae |
|
| Rubus rigidus | Rubus | Rosaceae |
|
Ingredient ID: NPC235467
Formula: C17H16O4
Ingredient ID: NPC235467
| Common Name | n.a. |
| IUPAC Name | 2-methoxy-5-[(1R)-1-(4-methoxyphenyl)prop-2-enyl]cyclohexa-2,5-diene-1,4-dione |
| Canonical SMILES | COc1ccc(cc1)[C@H](C1=CC(=O)C(=CC1=O)OC)C=C |
| Standard InCHI | InChI=1S/C17H16O4/c1-4-13(11-5-7-12(20-2)8-6-11)14-9-16(19)17(21-3)10-15(14)18/h4-10,13H,1H2,2-3H3/t13-/m1/s1 |
| Standard InCHIKey | FSNITHOUQGJHTR-CYBMUJFWSA-N |
| Ingredient External Links |
PubChem CID: 51432402 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD135202] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Arnica longifolia | Arnica | Asteraceae | |
| Kaempferia galanga | Kaempferia | Zingiberaceae |
|
| Rubus rigidus | Rubus | Rosaceae |
|
Ingredient ID: NPC199040
Formula: C19H18O8
Ingredient ID: NPC199040
| Common Name | n.a. |
| IUPAC Name | 5,7-dihydroxy-6-methoxy-3-(2,4,5-trimethoxyphenyl)chromen-4-one |
| Canonical SMILES | COc1cc(OC)c(cc1c1coc2c(c1=O)c(O)c(c(c2)O)OC)OC |
| Standard InCHI | InChI=1S/C19H18O8/c1-23-12-7-14(25-3)13(24-2)5-9(12)10-8-27-15-6-11(20)19(26-4)18(22)16(15)17(10)21/h5-8,20,22H,1-4H3 |
| Standard InCHIKey | SHONUJDWRZAHCQ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 6708635 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD164104] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Dalbergia sissoo | Dalbergia | Fabaceae |
|
| Arnica longifolia | Arnica | Asteraceae | |
| Kaempferia galanga | Kaempferia | Zingiberaceae |
|
| Rubus rigidus | Rubus | Rosaceae |
|
Ingredient ID: NPC182087
Formula: C17H14O5
Ingredient ID: NPC182087
| Common Name | n.a. |
| IUPAC Name | 6-hydroxy-7-methoxy-4-(4-methoxyphenyl)chromen-2-one |
| Canonical SMILES | COc1ccc(cc1)c1cc(=O)oc2c1cc(O)c(c2)OC |
| Standard InCHI | InChI=1S/C17H14O5/c1-20-11-5-3-10(4-6-11)12-8-17(19)22-15-9-16(21-2)14(18)7-13(12)15/h3-9,18H,1-2H3 |
| Standard InCHIKey | VGFANVFKVOTCIW-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 91279357 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD198749] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Arnica longifolia | Arnica | Asteraceae | |
| Kaempferia galanga | Kaempferia | Zingiberaceae |
|
| Rubus rigidus | Rubus | Rosaceae |
|
Ingredient ID: NPC168508
Formula: C18H27N3O4S
Ingredient ID: NPC168508
| Common Name | n.a. |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolane-2-carboxylate |
| Canonical SMILES | CC1CCC(C(C1)OC(=O)C1SCC(O1)n1ccc(=N)nc1O)C(C)C |
| Standard InCHI | InChI=1S/C18H27N3O4S/c1-10(2)12-5-4-11(3)8-13(12)24-16(22)17-25-15(9-26-17)21-7-6-14(19)20-18(21)23/h6-7,10-13,15,17H,4-5,8-9H2,1-3H3,(H2,19,20,23) |
| Standard InCHIKey | QMYKWNYBSBURDT-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 20712955 |
| Plant-Ingredient Association Reference |
Database: TCMID [18248] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Zea mays | Zea | Poaceae |
|
| Rubus rigidus | Rubus | Rosaceae |
|
| Aglaia odorata | Aglaia | Meliaceae |
|
Ingredient ID: NPC159869
Formula: C17H16O4
Ingredient ID: NPC159869
| Common Name | n.a. |
| IUPAC Name | 2-methoxy-5-[(1S)-1-(4-methoxyphenyl)prop-2-enyl]cyclohexa-2,5-diene-1,4-dione |
| Canonical SMILES | COc1ccc(cc1)[C@@H](C1=CC(=O)C(=CC1=O)OC)C=C |
| Standard InCHI | InChI=1S/C17H16O4/c1-4-13(11-5-7-12(20-2)8-6-11)14-9-16(19)17(21-3)10-15(14)18/h4-10,13H,1H2,2-3H3/t13-/m0/s1 |
| Standard InCHIKey | FSNITHOUQGJHTR-ZDUSSCGKSA-N |
| Ingredient External Links |
PubChem CID: 174861 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD192188] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Arnica longifolia | Arnica | Asteraceae | |
| Kaempferia galanga | Kaempferia | Zingiberaceae |
|
| Rubus rigidus | Rubus | Rosaceae |
|
Ingredient ID: NPC145052
Formula: C17H16O4
Ingredient ID: NPC145052
| Common Name | 3,4-Dimethoxydalbergione |
| IUPAC Name | 2,3-dimethoxy-5-[(1R)-1-phenylprop-2-enyl]cyclohexa-2,5-diene-1,4-dione |
| Canonical SMILES | C=C[C@@H](C1=CC(=O)C(=C(C1=O)OC)OC)c1ccccc1 |
| Standard InCHI | InChI=1S/C17H16O4/c1-4-12(11-8-6-5-7-9-11)13-10-14(18)16(20-2)17(21-3)15(13)19/h4-10,12H,1H2,2-3H3/t12-/m1/s1 |
| Standard InCHIKey | LJEJBLOFFDLRIH-GFCCVEGCSA-N |
| Ingredient External Links |
PubChem CID: 115019 ChEMBL ID: CHEMBL1591258 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD38117] Database: NPASS [NPC145052] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Arnica longifolia | Arnica | Asteraceae | |
| Kaempferia galanga | Kaempferia | Zingiberaceae |
|
| Rubus rigidus | Rubus | Rosaceae |
|
Ingredient ID: NPC135107
Formula: C28H32O15
Ingredient ID: NPC135107
| Common Name | n.a. |
| IUPAC Name | 3-[4-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-5-hydroxy-6,7-dimethoxychromen-4-one |
| Canonical SMILES | OC[C@@]1(O)CO[C@H]([C@@H]1O)OC[C@H]1O[C@@H](Oc2ccc(cc2)c2coc3c(c2=O)c(O)c(c(c3)OC)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C28H32O15/c1-37-16-7-15-18(21(32)24(16)38-2)19(30)14(8-39-15)12-3-5-13(6-4-12)42-26-23(34)22(33)20(31)17(43-26)9-40-27-25(35)28(36,10-29)11-41-27/h3-8,17,20,22-23,25-27,29,31-36H,9-11H2,1-2H3/t17-,20-,22+,23-,25+,26-,27-,28-/m1/s1 |
| Standard InCHIKey | PMQDVDNUZOVYCU-ASMIUSRBSA-N |
| Ingredient External Links |
PubChem CID: 24094147 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD152125] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Arnica longifolia | Arnica | Asteraceae | |
| Kaempferia galanga | Kaempferia | Zingiberaceae |
|
| Rubus rigidus | Rubus | Rosaceae |
|
Ingredient ID: NPC110067
Formula: C17H14O5
Ingredient ID: NPC110067
| Common Name | Kuhlmannin |
| IUPAC Name | 6-hydroxy-7,8-dimethoxy-4-phenylchromen-2-one |
| Canonical SMILES | COc1c(OC)c(O)cc2c1oc(=O)cc2c1ccccc1 |
| Standard InCHI | InChI=1S/C17H14O5/c1-20-16-13(18)8-12-11(10-6-4-3-5-7-10)9-14(19)22-15(12)17(16)21-2/h3-9,18H,1-2H3 |
| Standard InCHIKey | ABUBCBFUQXIEAU-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 4412068 ChEMBL ID: CHEMBL1568181 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD111804] Database: NPASS [NPC110067] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Arnica longifolia | Arnica | Asteraceae | |
| Kaempferia galanga | Kaempferia | Zingiberaceae |
|
| Rubus rigidus | Rubus | Rosaceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC110067 | C17H14O5 | Kuhlmannin | 298.08 | -0.4895 | 2.78 | 3.874 | 1 | 1 | 64.99 | 6 | 3 | 22 | 0 |
| NPC135107 | C28H32O15 | 3-[4-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-5-hydroxy-6,7-dimethoxychromen-4-one | 608.1741203 | -4.8465 | 2.89 | -0.858 | 10 | 7 | 223.29 | 9 | 5 | 43 | 1 |
| NPC145052 | C17H16O4 | 3,4-Dimethoxydalbergione | 284.1 | -0.1855 | 2.89 | 4.621 | 4 | 0 | 52.6 | 7 | 2 | 21 | 0 |
| NPC159869 | C17H16O4 | 2-methoxy-5-[(1S)-1-(4-methoxyphenyl)prop-2-enyl]cyclohexa-2,5-diene-1,4-dione | 284.104859 | 0.1546 | 2.89 | 2.882 | 3 | 0 | 52.6 | 5 | 2 | 21 | 0 |
| NPC168508 | C18H27N3O4S | (5-methyl-2-propan-2-ylcyclohexyl) 5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolane-2-carboxylate | 381.1722273 | 0.8975 | 2.56 | 4.681 | 7 | 2 | 120.51 | 5 | 3 | 26 | 0 |
| NPC182087 | C17H14O5 | 6-hydroxy-7-methoxy-4-(4-methoxyphenyl)chromen-2-one | 298.0841235 | -0.4895 | 2.78 | 2.819 | 1 | 1 | 64.99 | 3 | 3 | 22 | 0 |
| NPC199040 | C19H18O8 | 5,7-dihydroxy-6-methoxy-3-(2,4,5-trimethoxyphenyl)chromen-4-one | 374.1001675 | -1.7945 | 2.67 | 0.699 | 1 | 2 | 103.68 | 5 | 3 | 27 | 0 |
| NPC235467 | C17H16O4 | 2-methoxy-5-[(1R)-1-(4-methoxyphenyl)prop-2-enyl]cyclohexa-2,5-diene-1,4-dione | 284.104859 | 0.1546 | 2.89 | 2.882 | 3 | 0 | 52.6 | 5 | 2 | 21 | 0 |
| NPC256555 | C16H12O5 | 284.0684735 | -0.898 | 2.67 | 2.3 | 1 | 2 | 75.99 | 5 | 3 | 21 | 0 | |
| NPC280254 | C6H6O3 | Pyrogallol | 126.03 | -1.3809 | 1.79 | 0.765 | 0 | 3 | 60.69 | 3 | 1 | 9 | 0 |
| NPC28951 | C16H14O4 | S-4'-Hydroxy-4-Methoxydalbergione | 270.09 | -0.2539 | 2.78 | 2.363 | 3 | 1 | 63.6 | 6 | 2 | 20 | 0 |
| NPC303967 | C16H14O3 | (R)-4' '-Methoxydalbergione | 254.09 | 0.2064 | 2.89 | 4.381 | 3 | 0 | 43.37 | 5 | 2 | 19 | 0 |
| NPC34245 | C16H12O6 | 3'-Hydroxymelanettin | 300.06 | -1.3583 | 2.56 | 1.555 | 1 | 3 | 96.22 | 6 | 3 | 22 | 0 |
| NPC7439 | C17H14O6 | 314.0790382 | -0.9498 | 2.67 | 1.645 | 1 | 2 | 85.22 | 7 | 3 | 23 | 0 | |
| NPC91492 | C16H12O4 | Dalbergin | 268.07 | -0.4377 | 2.78 | 4.318 | 1 | 1 | 55.76 | 4 | 3 | 20 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
