NPASS Compound

Natural Product: NPC87374

Natural Product ID	NPC87374
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	AOZDZAAVWCWXHI-XKVHHITMSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	5315313
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001283] Terpene lactones

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 110115 0 0 0 0 0 0 0 0999 V2000 1.1704 5.0776 -0.8732 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8631 4.8539 0.4592 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2978 4.5110 0.3146 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6528 3.2216 -0.3025 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0832 2.9575 -0.6359 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6209 1.6902 -0.6800 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9800 1.6333 -1.0494 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7242 2.7398 -1.3439 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1430 3.9765 -1.2841 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8547 4.0194 -0.9336 N 0 0 0 0 0 0 0 0 0 0 0 0 5.0074 0.4147 -0.3780 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6518 -0.3494 0.4520 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8515 -0.1508 -0.8117 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3995 -1.4455 -0.3974 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0467 -1.8297 -0.8377 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2118 -2.4330 -2.2462 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4219 -2.8533 0.0957 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0651 -3.3156 -0.4194 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0349 -2.3567 -0.5730 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9157 -1.1273 0.2892 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8394 -1.2503 1.4375 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1748 -1.3379 0.8776 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2677 -1.4441 1.7549 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9829 -1.4577 2.9848 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6614 -1.5339 1.3017 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4353 0.0716 -0.4910 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2661 1.4187 0.1890 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.1381 1.6359 1.0803 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9225 0.5459 0.8351 C 0 0 1 0 0 0 0 0 0 0 0 0 1.9070 0.6793 1.9644 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5194 -0.8254 0.5297 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1645 -1.9114 1.2737 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3943 -2.5700 2.2554 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8339 -2.8755 3.5259 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0319 -2.5198 3.7956 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0024 -3.5701 4.5424 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0470 -0.9362 -0.8401 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5355 1.1041 -0.3267 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6173 2.7909 0.6490 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0306 3.8845 1.2648 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7292 4.0694 2.4558 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5249 1.8284 0.6566 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2749 2.8132 0.1104 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7600 3.3565 -0.8696 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5743 3.2514 0.5732 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2223 2.6948 1.6555 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4579 3.2118 1.9876 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0619 4.2440 1.2948 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4009 4.7626 0.2449 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.2084 4.2769 -0.0902 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9511 0.0402 -1.7867 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8151 -0.0562 -2.8611 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0701 -0.1120 -2.7280 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3139 -0.1014 -4.2738 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2204 -3.0769 -0.1585 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2564 -3.3959 -0.9721 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2593 -3.0827 -2.1729 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4224 -4.1373 -0.4356 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3606 -4.1442 -1.5000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3059 -5.4855 -1.5638 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0527 -6.0717 -0.5339 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6485 -6.2299 -2.7786 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7645 4.1611 -1.3063 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9504 5.4524 -1.5758 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4076 5.8837 -0.8034 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8030 5.8190 1.0047 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7518 5.3290 -0.3093 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7891 4.6562 1.3216 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4058 2.3701 0.4042 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0971 3.0420 -1.2321 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4119 0.6139 -1.0865 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7638 2.6701 -1.6249 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6959 4.8997 -1.5111 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1985 -2.1101 -0.9091 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6559 -1.6079 0.6598 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5390 -3.5012 -2.1603 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0436 -1.9190 -2.7731 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3195 -2.3067 -2.8563 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0383 -3.7046 0.3291 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2344 -4.0564 0.3957 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2511 -2.0878 -1.6328 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7942 -2.1929 2.0206 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8790 -0.4269 2.1386 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3608 -0.8650 1.8370 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7241 -1.4338 0.2047 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0339 -2.5780 1.5216 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5542 -0.1005 -0.5591 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0985 2.1001 -0.7100 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2556 1.7327 2.1383 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9552 0.4230 1.6983 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0217 1.7536 2.2496 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5738 0.0984 2.8646 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1219 -1.7179 1.7345 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6750 -4.2089 5.1610 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7506 -4.2366 4.0773 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5137 -2.8899 5.2282 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9049 1.6547 -0.8070 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7359 1.8908 2.1835 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9957 2.8050 2.8257 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0180 4.6594 1.5351 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7189 4.7374 -0.9521 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7494 0.7740 -4.8236 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7056 -0.9951 -4.8127 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2237 0.0077 -4.3233 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3844 -3.6892 -0.7799 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3944 -5.1492 -0.9371 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3880 -4.3069 0.6427 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0089 -5.5127 -3.5736 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5299 -6.9205 -2.6194 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1967 -6.8046 -3.2005 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 6 7 1 0 7 8 2 0 8 9 1 0 9 10 2 0 6 11 1 0 11 12 2 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 2 0 23 25 1 0 20 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 2 0 34 36 1 0 31 37 1 0 29 38 1 6 28 39 1 0 39 40 1 0 40 41 2 0 27 42 1 0 42 43 1 0 43 44 2 0 43 45 1 0 45 46 2 0 46 47 1 0 47 48 2 0 48 49 1 0 49 50 2 0 26 51 1 0 51 52 1 0 52 53 2 0 52 54 1 0 19 55 1 0 55 56 1 0 56 57 2 0 56 58 1 0 18 59 1 0 59 60 1 0 60 61 2 0 60 62 1 0 40 2 1 0 50 45 1 0 10 5 1 0 37 15 1 0 32 17 1 0 31 20 1 0 1 63 1 0 1 64 1 0 1 65 1 0 2 66 1 0 3 67 1 0 3 68 1 0 4 69 1 0 4 70 1 0 7 71 1 0 8 72 1 0 9 73 1 0 14 74 1 0 14 75 1 0 16 76 1 0 16 77 1 0 16 78 1 0 17 79 1 0 18 80 1 0 19 81 1 0 21 82 1 0 21 83 1 0 25 84 1 0 25 85 1 0 25 86 1 0 26 87 1 0 27 88 1 6 28 89 1 0 30 90 1 0 30 91 1 0 30 92 1 0 32 93 1 0 36 94 1 0 36 95 1 0 36 96 1 0 38 97 1 0 46 98 1 0 47 99 1 0 48100 1 0 50101 1 0 54102 1 0 54103 1 0 54104 1 0 58105 1 0 58106 1 0 58107 1 0 62108 1 0 62109 1 0 62110 1 0 M END

Standard InCHIKey	AOZDZAAVWCWXHI-XKVHHITMSA-N
Standard InCHI	InChI=1S/C42H48N2O18/c1-20-13-14-28-27(12-10-16-44-28)38(52)55-18-39(7)29-30(56-22(3)46)34(58-24(5)48)41(19-54-21(2)45)35(59-25(6)49)31(60-37(51)26-11-9-15-43-17-26)33(61-36(20)50)40(8,53)42(41,62-39)32(29)57-23(4)47/h9-12,15-17,20,29-35,53H,13-14,18-19H2,1-8H3/t20?,29?,30?,31-,32?,33?,34?,35?,39?,40-,41?,42?/m0/s1
SMILES	CC1CCc2c(cccn2)C(=O)OCC2(C)C3C(C(C4(COC(=O)C)C([C@H](C([C@@](C)(C4(C3OC(=O)C)O2)O)OC1=O)OC(=O)c1cccnc1)OC(=O)C)OC(=O)C)OC(=O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	868.29	Volume:	826.956 ? Van der Waals volume.
Dense:	1.05	LogP:	0.622 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.033 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.081 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	14.0	Rigid Bonds:	44.0
TPSA:	265.64 ? Topological Polar Surface Area.	H-Bond Acceptor:	20.0
H-Bond Donor:	1.0	Rings:	6.0
Heavy Atoms:	20.0

MedChem Properties

QED Drug-Likeness Score:	0.291	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.605	Fsp³:	0.571
MCE-18:	218.273 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.056	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.095 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.008	Promiscuous compounds:	0.004

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.339	MDCK Permeability:	-4.89
Pgp-inhibitor:	0.509	Pgp-substrate:	0.454
PAMPA:	0.983 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.002	30% Bioavailability (F30%):	0.065
50% Bioavailability (F50%):	0.365

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.004	MRP1:	1.0
Plasma Protein Binding (PPB):	36.44%	Volume Distribution (VD):	-0.441
Fu:	58.719% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.37
OATP1B3 inhibitor:	0.65	BCRP inhibitor:	0.0
BSEP inhibitor:	0.989

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.002	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.161
CYP3A4-inhibitor:	0.006	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.983 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.482

Half-life (T1/2):

1.431

ADMET: Toxicity

hERG Blockers:	0.009	hERG Blockers (10um):	0.114
Human Hepatotoxicity (H-HT):	0.412	Drug-induced Liver Injury (DILI):	0.991
AMES Toxicity:	0.825	Rat Oral Acute Toxicity:	0.269
Maximum Recommended Daily Dose:	0.509	Skin Sensitization:	0.999
Carcinogencity:	0.806	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.727	Ototoxicity:	0.801
Hematotoxicity:	0.192	Drug-induced Nephrotoxicity:	0.939
Genotoxicity:	0.988	RPMI-8226 Immunitoxicity:	0.154
A549 Cytotoxicity:	0.019	Hek293 Cytotoxicity:	0.121
BCF:	0.551 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.156 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.074 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.532 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/0031-9422(90)85349-K]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	DOI[10.1186/1471-2202-6-1]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10579865]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	leaf	n.a.	PMID[10716597]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10757718]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11374948]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11561442]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12579877]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[1375626]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[1375626]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[1602302]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[1602302]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[16864458]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	roots	n.a.	n.a.	PMID[16989518]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[17250858]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[17265278]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[1823717]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	leaf	n.a.	PMID[1823717]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[18554602]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	bark	n.a.	PMID[18996177]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	root	n.a.	n.a.	PMID[21486005]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[21486005]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21514608]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	dried roots	purchased from Sichuan Neautus Traditional Chinese Medicine Co. Ltd. (Chengdu, P.R. China)	n.a.	PMID[22148431]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	leaves	n.a.	n.a.	PMID[23268606]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[23852638]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24549173]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24963543]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25237706]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	bark	n.a.	PMID[2534610]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[2816380]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	Leaves	n.a.	n.a.	PMID[29355322]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	Leaves	n.a.	n.a.	PMID[31556299]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[7102323]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[7304185]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8699928]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8722541]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[Article]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	Database[Article]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC87374 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19881
0.1-0.2	28855
0.2-0.3	868
0.3-0.4	151
0.4-0.5	37
0.5-0.6	19
0.6-0.7	30
0.7-0.8	0
0.8-0.85	1
0.85-0.9	6
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8667	High Similarity	NPC250807
0.8667	High Similarity	NPC57797
0.8526	High Similarity	NPC122968
0.8526	High Similarity	NPC228377
0.8511	High Similarity	NPC53255
0.8511	High Similarity	NPC85879
0.8039	Intermediate Similarity	NPC471979
0.7778	Intermediate Similarity	NPC328186
0.7551	Intermediate Similarity	NPC146824
0.7525	Intermediate Similarity	NPC316841
0.7476	Intermediate Similarity	NPC473689
0.7476	Intermediate Similarity	NPC292416
0.7451	Intermediate Similarity	NPC13603
0.7308	Intermediate Similarity	NPC600607
0.7238	Intermediate Similarity	NPC475406
0.7196	Intermediate Similarity	NPC327769
0.7075	Intermediate Similarity	NPC244839
0.6916	Remote Similarity	NPC600583
0.69	Remote Similarity	NPC76565
0.69	Remote Similarity	NPC601313
0.6857	Remote Similarity	NPC475600
0.6852	Remote Similarity	NPC319880
0.6852	Remote Similarity	NPC320324
0.6827	Remote Similarity	NPC326930
0.6789	Remote Similarity	NPC38959
0.6733	Remote Similarity	NPC471016
0.6727	Remote Similarity	NPC483853
0.6727	Remote Similarity	NPC608314
0.6636	Remote Similarity	NPC327904
0.6636	Remote Similarity	NPC328928
0.6634	Remote Similarity	NPC473850
0.6415	Remote Similarity	NPC475362
0.633	Remote Similarity	NPC476110
0.6325	Remote Similarity	NPC483856
0.6306	Remote Similarity	NPC601643
0.6296	Remote Similarity	NPC475301
0.6239	Remote Similarity	NPC87152
0.6239	Remote Similarity	NPC475631
0.6186	Remote Similarity	NPC483854
0.6161	Remote Similarity	NPC253482
0.6147	Remote Similarity	NPC475303
0.6134	Remote Similarity	NPC482915
0.6106	Remote Similarity	NPC477787
0.6058	Remote Similarity	NPC470306
0.6036	Remote Similarity	NPC475596
0.6036	Remote Similarity	NPC324619
0.6	Remote Similarity	NPC607403
0.5929	Remote Similarity	NPC611166
0.5897	Remote Similarity	NPC475426
0.5877	Remote Similarity	NPC475648
0.5804	Remote Similarity	NPC328154
0.5714	Remote Similarity	NPC475533
0.5688	Remote Similarity	NPC475498
0.5614	Remote Similarity	NPC600224
0.5614	Remote Similarity	NPC604935
0.5565	Remote Similarity	NPC475644
0.5556	Remote Similarity	NPC35208
0.547	Remote Similarity	NPC237702
0.5391	Remote Similarity	NPC475315
0.5357	Remote Similarity	NPC483892
0.5299	Remote Similarity	NPC30456
0.5299	Remote Similarity	NPC488904
0.5259	Remote Similarity	NPC471977
0.5225	Remote Similarity	NPC475137
0.521	Remote Similarity	NPC600546
0.504	Remote Similarity	NPC469748

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC87374 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4419
0.1-0.2	4695
0.2-0.3	35
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data