NPASS Compound

Natural Product: NPC475644

Natural Product ID	NPC475644
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Ebenifoline E I
IUPAC Name	n.a.
Synonyms	Ebenifoline E I
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL510159
PubChem CID	44566645
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000279] Alkaloids and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 106111 0 0 0 0 0 0 0 0999 V2000 -5.4407 1.7307 -0.6283 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5374 0.6580 -1.0430 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0341 -0.3954 -1.5451 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1442 0.7352 -0.9115 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4197 -0.3599 -1.3422 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9414 -0.3416 -1.2117 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4557 0.8124 -2.0397 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3730 1.9005 -1.7977 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1219 2.4391 -2.8233 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9825 1.9534 -3.9551 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0333 3.5378 -2.5522 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8313 4.0683 -3.5816 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6925 5.1155 -3.3325 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8080 5.6798 -2.0904 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0472 5.1878 -1.0693 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1933 4.1418 -1.3331 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8950 1.3314 -1.6893 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9967 2.5973 -2.3225 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1226 1.5443 -0.2284 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1606 0.8711 0.7014 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3122 -0.4133 0.1498 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8990 -1.1501 -0.0206 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8756 -2.3064 0.6932 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6285 -2.6100 0.5554 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8397 -2.8401 -0.9143 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5631 -1.6991 -1.8350 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3349 -1.8895 -3.0058 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7746 -1.9058 -4.2584 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4675 -1.7503 -4.4245 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6889 -2.1151 -5.4342 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1015 -3.4407 -1.0925 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3048 -4.7028 -1.6279 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2665 -5.3282 -1.9672 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6693 -5.2807 -1.7897 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1985 -1.2720 0.9518 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3400 -1.0054 2.2940 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5056 -0.8327 3.0008 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5804 -0.9260 2.3548 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4351 -0.5540 4.4473 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5606 -3.4898 0.0562 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3069 -2.2866 2.1074 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4804 -1.9269 2.5305 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7493 -2.0278 2.7310 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3450 -3.0119 2.3925 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5737 -0.9832 3.3786 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1909 0.0700 2.8039 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3279 0.3860 1.3643 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8111 1.6388 0.8423 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4168 1.9634 0.7208 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9731 2.9662 1.3335 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4819 1.2813 -0.0227 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5293 2.7761 1.6052 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1239 -0.8099 0.4536 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8461 0.8975 3.6899 N 0 0 0 0 0 0 0 0 0 0 0 0 5.9256 0.7591 4.9942 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3008 -0.3142 5.5684 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6310 -1.1782 4.7689 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8576 1.8429 1.2248 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9292 0.5689 1.8556 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0874 2.1868 0.3222 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4343 1.2653 -0.3600 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5555 2.4423 -1.4530 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5457 -0.2771 -2.4969 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9287 -1.3342 -1.2002 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5137 0.5603 -3.1421 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7623 3.6461 -4.5576 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3330 5.5617 -4.1089 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4762 6.5057 -1.8665 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0857 5.5807 -0.0687 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5984 3.7589 -0.5152 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7175 0.7461 -2.1739 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1253 3.3213 -1.6633 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0175 2.6594 -0.0234 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9640 -3.4546 1.1191 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1235 -3.6426 -1.3000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4701 -1.5814 -2.1500 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3181 -2.9909 -5.2131 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1043 -2.2831 -6.3690 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3202 -1.2180 -5.5060 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1367 -4.7855 -2.6590 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2263 -4.9953 -0.8543 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5599 -6.3660 -1.9221 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2653 -1.3026 0.5760 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5748 -1.1075 4.8721 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2396 0.5212 4.6387 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3812 -0.7977 4.9752 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5049 -3.7712 0.5902 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9373 -4.4220 0.2313 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8541 -3.3498 -0.9771 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1978 -3.4192 2.4217 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5437 -1.8995 2.8519 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4811 0.5190 1.2265 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2505 1.7726 -0.2130 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8512 3.0381 2.4353 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6771 3.6535 0.9403 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4758 2.3875 1.9956 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1316 -1.2135 0.4125 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8581 -1.5775 0.7488 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4976 -0.4630 -0.5596 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4548 1.4384 5.6493 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3259 -0.5032 6.6592 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1077 -2.0782 5.0791 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8724 1.4569 1.3419 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6007 2.1868 2.2785 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7932 2.8336 0.6865 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8585 0.4841 1.6206 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 6 5 1 1 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 9 11 1 0 11 12 2 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 2 0 7 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 6 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 28 30 1 0 25 31 1 0 31 32 1 0 32 33 2 0 32 34 1 0 24 35 1 0 35 36 1 0 36 37 1 0 37 38 2 0 37 39 1 0 23 40 1 6 23 41 1 0 41 42 1 0 42 43 1 0 43 44 2 0 43 45 1 0 45 46 2 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 2 0 49 51 1 0 48 52 1 0 47 53 1 0 46 54 1 0 54 55 2 0 55 56 1 0 56 57 2 0 20 58 1 0 20 59 1 1 26 6 1 0 57 45 1 0 21 6 1 0 16 11 1 0 51 19 1 0 35 21 1 0 1 60 1 0 1 61 1 0 1 62 1 0 5 63 1 0 5 64 1 0 7 65 1 6 12 66 1 0 13 67 1 0 14 68 1 0 15 69 1 0 16 70 1 0 17 71 1 6 18 72 1 0 19 73 1 6 24 74 1 1 25 75 1 6 26 76 1 6 30 77 1 0 30 78 1 0 30 79 1 0 34 80 1 0 34 81 1 0 34 82 1 0 35 83 1 6 39 84 1 0 39 85 1 0 39 86 1 0 40 87 1 0 40 88 1 0 40 89 1 0 41 90 1 0 41 91 1 0 47 92 1 0 48 93 1 0 52 94 1 0 52 95 1 0 52 96 1 0 53 97 1 0 53 98 1 0 53 99 1 0 55100 1 0 56101 1 0 57102 1 0 58103 1 0 58104 1 0 58105 1 0 59106 1 0 M END

Standard InCHIKey	SACNWJXZRCLNCY-KDVPORLVSA-N
Standard InCHI	InChI=1S/C41H47NO17/c1-19-20(2)35(48)57-32-29(47)33(58-36(49)25-13-10-9-11-14-25)40(18-52-21(3)43)34(56-24(6)46)30(54-22(4)44)27-31(55-23(5)45)41(40,39(32,8)51)59-38(27,7)17-53-37(50)26-15-12-16-42-28(19)26/h9-16,19-20,27,29-34,47,51H,17-18H2,1-8H3/t19?,20?,27-,29+,30-,31-,32+,33+,34-,38+,39+,40+,41+/m1/s1
SMILES	CC(=O)OC[C@]12[C@@H](OC(=O)c3ccccc3)[C@@H](O)[C@H]3[C@]([C@@]42O[C@@]([C@H]([C@H]([C@H]1OC(=O)C)OC(=O)C)[C@H]4OC(=O)C)(C)COC(=O)c1c(C(C(C(=O)O3)C)C)nccc1)(C)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1333	Maytenus chiapensis	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12713421]
NPO1333	Maytenus chiapensis	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[14738378]
NPO1333	Maytenus chiapensis	Species	Celastraceae	Eukaryota	n.a.	leaf	n.a.	PMID[14738378]
NPO1333	Maytenus chiapensis	Species	Celastraceae	Eukaryota	root bark;leaves	Huayllabamba-Urquillos, Province of Urabamba, Cusco (Peru); Parque Nacional El Imposible, El Salvador	n.a.	PMID[16038541]
NPO1333	Maytenus chiapensis	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1333	Maytenus chiapensis	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
EC50	1
Activity	2

Activity Type	# Activity
Organism	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT776	Organism	Spodoptera littoralis	Spodoptera littoralis	EC50	=	0.72	microg/cm2	PMID[24920381]
NPT776	Organism	Spodoptera littoralis	Spodoptera littoralis	Activity	=	81.0	%	PMID[22413887]
NPT776	Organism	Spodoptera littoralis	Spodoptera littoralis	Activity	=	83.0	%	Open TG-GATES in vivo data: Biochemistry

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC475644 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21146
0.1-0.2	27329
0.2-0.3	1089
0.3-0.4	204
0.4-0.5	27
0.5-0.6	19
0.6-0.7	27
0.7-0.8	0
0.8-0.85	5
0.85-0.9	1
0.9-0.95	0
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
0.957	High Similarity	NPC30456
0.957	High Similarity	NPC488904
0.871	High Similarity	NPC475498
0.8283	Intermediate Similarity	NPC476110
0.8182	Intermediate Similarity	NPC475600
0.8081	Intermediate Similarity	NPC475303
0.8	Intermediate Similarity	NPC87152
0.8	Intermediate Similarity	NPC475631
0.7921	Intermediate Similarity	NPC471190
0.7921	Intermediate Similarity	NPC475596
0.7551	Intermediate Similarity	NPC76565
0.7551	Intermediate Similarity	NPC601313
0.7315	Intermediate Similarity	NPC327769
0.7115	Intermediate Similarity	NPC326930
0.7105	Intermediate Similarity	NPC482915
0.7018	Intermediate Similarity	NPC483854
0.6887	Remote Similarity	NPC475301
0.6822	Remote Similarity	NPC470486
0.6822	Remote Similarity	NPC471977
0.6667	Remote Similarity	NPC477787
0.6604	Remote Similarity	NPC473506
0.6574	Remote Similarity	NPC122968
0.6574	Remote Similarity	NPC228377
0.6549	Remote Similarity	NPC483853
0.6549	Remote Similarity	NPC608314
0.6542	Remote Similarity	NPC475362
0.6422	Remote Similarity	NPC328186
0.6364	Remote Similarity	NPC316841
0.6286	Remote Similarity	NPC35208
0.6228	Remote Similarity	NPC319880
0.6228	Remote Similarity	NPC320324
0.6226	Remote Similarity	NPC471014
0.6226	Remote Similarity	NPC475137
0.6198	Remote Similarity	NPC483855
0.6195	Remote Similarity	NPC473689
0.6195	Remote Similarity	NPC292416
0.6174	Remote Similarity	NPC327904
0.6174	Remote Similarity	NPC328928
0.6167	Remote Similarity	NPC483856
0.6154	Remote Similarity	NPC475426
0.614	Remote Similarity	NPC475406
0.614	Remote Similarity	NPC244839
0.6034	Remote Similarity	NPC38959
0.5981	Remote Similarity	NPC250807
0.5981	Remote Similarity	NPC57797
0.5789	Remote Similarity	NPC477788
0.5664	Remote Similarity	NPC53255
0.5664	Remote Similarity	NPC85879
0.5625	Remote Similarity	NPC146824
0.5625	Remote Similarity	NPC473833
0.5462	Remote Similarity	NPC601643
0.5385	Remote Similarity	NPC328154
0.5372	Remote Similarity	NPC170751
0.5339	Remote Similarity	NPC13603
0.5333	Remote Similarity	NPC253482
0.5333	Remote Similarity	NPC600583
0.5315	Remote Similarity	NPC470306
0.5299	Remote Similarity	NPC607403
0.5207	Remote Similarity	NPC475648
0.5203	Remote Similarity	NPC471979
0.5082	Remote Similarity	NPC237702
0.5042	Remote Similarity	NPC475533

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC475644 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4424
0.1-0.2	4691
0.2-0.3	34
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data