NPASS Compound

Natural Product: NPC483855

Natural Product ID	NPC483855
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	RQZCESDGZDJIIK-QPSPWVOASA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44575688
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000279] Alkaloids and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 116122 0 0 0 0 0 0 0 0999 V2000 -3.5031 1.7766 2.4648 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9493 2.1483 1.0640 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3243 3.4636 0.7187 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7543 3.9417 -0.6663 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8371 3.1570 0.5588 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9563 3.7607 1.2002 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4356 2.1873 -0.3159 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1543 1.7391 -0.6360 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7126 1.3049 0.4913 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5255 -0.1218 0.7950 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6899 -1.0736 -0.3890 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0734 -0.9034 -0.9501 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3598 -1.7346 -2.0563 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5665 -1.7135 -2.6871 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4420 -0.9085 -2.2416 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8770 -2.5888 -3.8563 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5275 -2.4907 0.0096 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3968 -3.3497 -0.8108 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5100 -2.6362 -1.4802 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6869 -1.6291 -2.3450 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4415 -0.6466 -1.3128 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.2211 0.7633 -1.8061 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4062 1.2596 -2.6044 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8749 0.8755 -2.6313 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5409 -0.6403 -0.4311 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3475 -1.7270 -0.6557 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7609 -2.4417 0.6071 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6248 -1.3400 -1.3598 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4463 -0.4348 -0.8231 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2905 -0.2858 0.1846 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4881 -1.2367 0.9273 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0103 0.9318 0.4885 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3720 0.8468 0.3447 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1414 1.9539 0.6096 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5573 3.1366 1.0154 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2213 3.1516 1.1371 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.4260 2.1024 0.8919 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3930 -1.2780 -3.4916 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9247 -1.6106 -4.7357 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1552 -2.2420 -4.8631 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6773 -1.2361 -5.9711 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6388 -4.5320 -0.1849 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8114 -3.1387 -0.1288 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4443 -3.7659 0.9023 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9256 -3.8136 2.0243 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7781 -4.3805 0.5992 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1967 -0.6114 1.9122 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6315 -1.0323 3.0750 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6111 -0.9813 3.1280 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4567 -1.5038 4.1696 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8801 -1.9589 5.3623 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6830 -2.3949 6.3929 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0568 -2.4081 6.3123 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5954 -1.9508 5.1171 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8258 -1.5117 4.0762 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0193 1.7541 0.2694 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6710 2.7002 1.0436 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0237 3.1736 2.0088 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0170 3.1615 0.8106 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5436 4.1081 1.6530 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8341 4.6059 1.4935 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5862 4.1170 0.4495 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7514 4.5793 0.3208 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0848 3.1874 -0.3870 N 0 0 0 0 0 0 0 0 0 0 0 0 6.9275 2.7182 -1.4585 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8166 2.7093 -0.2166 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9878 0.8609 2.8160 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4089 1.5797 2.4060 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6452 2.6408 3.1455 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5140 1.3175 0.4219 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3881 4.2438 1.4671 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6819 4.5487 -0.6194 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8936 3.0085 -1.2669 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9298 4.4877 -1.1311 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3569 2.6393 -1.1122 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3588 1.8682 1.4000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5562 -0.2064 1.0803 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7479 -1.3511 -0.1443 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3980 0.0914 -1.1957 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4680 -3.6229 -3.6854 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3560 -2.1464 -4.7249 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9612 -2.6028 -4.0012 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3013 -2.5559 1.0887 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2507 -3.6877 -1.7073 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0697 -3.3114 -2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2296 -2.1586 -2.7083 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3754 1.1069 -2.1156 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3689 1.0136 -3.6804 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2925 2.3968 -2.6098 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8429 1.6071 -3.2704 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9803 -3.1985 0.9345 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6356 -3.1044 0.4935 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9686 -1.7463 1.4423 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4542 -1.0593 -2.4347 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1884 -2.3232 -1.4636 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8226 -0.1267 0.0285 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2315 1.8745 0.4905 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1817 3.9853 1.2153 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3644 -0.1871 -6.1978 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3235 -1.8516 -6.8217 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7677 -1.3156 -5.8220 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6634 -5.3321 -0.7471 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6102 -3.6942 0.8869 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8818 -5.3673 1.0990 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8934 -4.5652 -0.4885 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1963 -1.9585 5.4514 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2545 -2.7540 7.3311 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6926 -2.7498 7.1173 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6730 -1.9343 4.9858 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2615 -1.1515 3.1343 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9879 4.5323 2.5011 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2243 5.3537 2.1746 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5542 3.2008 -2.4021 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9595 3.0723 -1.3100 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8744 1.6116 -1.5403 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4350 1.9593 -0.9041 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 6 12 13 1 0 13 14 1 0 14 15 2 0 14 16 1 0 11 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 6 21 25 1 1 25 26 1 0 26 27 1 1 26 28 1 0 28 29 1 0 29 30 1 0 30 31 2 0 30 32 1 0 32 33 2 0 33 34 1 0 34 35 2 0 35 36 1 0 36 37 2 0 20 38 1 0 38 39 1 0 39 40 2 0 39 41 1 0 18 42 1 0 17 43 1 0 43 44 1 0 44 45 2 0 44 46 1 0 10 47 1 0 47 48 1 0 48 49 2 0 48 50 1 0 50 51 2 0 51 52 1 0 52 53 2 0 53 54 1 0 54 55 2 0 9 56 1 0 56 57 1 0 57 58 2 0 57 59 1 0 59 60 1 0 60 61 2 0 61 62 1 0 62 63 2 0 62 64 1 0 64 65 1 0 64 66 1 0 37 2 1 0 55 50 1 0 66 59 2 0 22 8 1 0 37 32 1 0 21 11 1 0 26 19 1 0 1 67 1 0 1 68 1 0 1 69 1 0 2 70 1 6 3 71 1 1 4 72 1 0 4 73 1 0 4 74 1 0 8 75 1 6 9 76 1 1 10 77 1 1 12 78 1 0 12 79 1 0 16 80 1 0 16 81 1 0 16 82 1 0 17 83 1 1 18 84 1 6 19 85 1 6 20 86 1 6 23 87 1 0 23 88 1 0 23 89 1 0 24 90 1 0 27 91 1 0 27 92 1 0 27 93 1 0 28 94 1 0 28 95 1 0 33 96 1 0 34 97 1 0 35 98 1 0 41 99 1 0 41100 1 0 41101 1 0 42102 1 0 46103 1 0 46104 1 0 46105 1 0 51106 1 0 52107 1 0 53108 1 0 54109 1 0 55110 1 0 60111 1 0 61112 1 0 65113 1 0 65114 1 0 65115 1 0 66116 1 0 M END

Standard InCHIKey	RQZCESDGZDJIIK-QPSPWVOASA-N
Standard InCHI	InChI=1S/C46H50N2O18/c1-22-23(2)39(54)64-37-34(63-41(56)28-16-17-30(52)48(8)19-28)38(65-40(55)27-13-10-9-11-14-27)45(21-59-24(3)49)36(62-26(5)51)33(53)31-35(61-25(4)50)46(45,44(37,7)58)66-43(31,6)20-60-42(57)29-15-12-18-47-32(22)29/h9-19,22-23,31,33-38,53,58H,20-21H2,1-8H3/t22-,23+,31-,33+,34+,35-,36-,37+,38+,43+,44-,45-,46+/m1/s1
SMILES	C[C@@H]1[C@H](C)C(=O)O[C@H]2[C@@H]([C@@H]([C@@]3(COC(=O)C)[C@@H]([C@H]([C@@H]4[C@H]([C@@]3([C@]2(C)O)O[C@@]4(C)COC(=O)c2cccnc12)OC(=O)C)O)OC(=O)C)OC(=O)c1ccccc1)OC(=O)c1ccc(=O)n(C)c1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	918.31	Volume:	882.311 ? Van der Waals volume.
Dense:	1.041	LogP:	1.082 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.485 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.21 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	49.0
TPSA:	268.68 ? Topological Polar Surface Area.	H-Bond Acceptor:	20.0
H-Bond Donor:	2.0	Rings:	7.0
Heavy Atoms:	20.0

MedChem Properties

QED Drug-Likeness Score:	0.241	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.747	Fsp³:	0.5
MCE-18:	242.319 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.723	Fluc inhibitor:	0.013 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.484 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.002	Promiscuous compounds:	0.007

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.514	MDCK Permeability:	-5.067
Pgp-inhibitor:	0.917	Pgp-substrate:	0.099
PAMPA:	0.981 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.024	30% Bioavailability (F30%):	0.053
50% Bioavailability (F50%):	0.815

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.004	MRP1:	1.0
Plasma Protein Binding (PPB):	72.92%	Volume Distribution (VD):	-0.117
Fu:	26.748% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.0
BSEP inhibitor:	0.998

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.22	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.965
HLM stability:	0.357 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.441

Half-life (T1/2):

1.828

ADMET: Toxicity

hERG Blockers:	0.005	hERG Blockers (10um):	0.105
Human Hepatotoxicity (H-HT):	0.29	Drug-induced Liver Injury (DILI):	0.987
AMES Toxicity:	0.931	Rat Oral Acute Toxicity:	0.222
Maximum Recommended Daily Dose:	0.789	Skin Sensitization:	1.0
Carcinogencity:	0.55	Eye Corrosion:	0.0
Eye Irritation:	0.07	Respiratory Toxicity:	0.364
Drug-induced Neurotoxicity:	0.732	Ototoxicity:	0.758
Hematotoxicity:	0.9	Drug-induced Nephrotoxicity:	0.997
Genotoxicity:	0.997	RPMI-8226 Immunitoxicity:	0.508
A549 Cytotoxicity:	0.079	Hek293 Cytotoxicity:	0.257
BCF:	0.572 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.431 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.748 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.353 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO19747	Maytenus emarginata	Species	Celastraceae	Eukaryota	n.a.	stem	n.a.	PMID[2380715]
NPO19747	Maytenus emarginata	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[2380715]
NPO19747	Maytenus emarginata	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8176403]
NPO19747	Maytenus emarginata	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO19747	Maytenus emarginata	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	6

Activity Type	# Activity
Cell line	6

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell line	KB	Homo sapiens	ED50	=	0.51	ug ml-1	PMID[8176403]
NPT81	Cell line	A549	Homo sapiens	ED50	=	5.5	ug ml-1	PMID[8176403]
NPT180	Cell line	HCT-8	Homo sapiens	ED50	=	1.29	ug ml-1	PMID[8176403]
NPT168	Cell line	P388	Mus musculus	ED50	=	0.69	ug ml-1	PMID[8176403]
NPT672	Cell line	TE-671	Homo sapiens	ED50	=	0.21	ug ml-1	PMID[8176403]
NPT1091	Cell line	RPMI-7951	Homo sapiens	ED50	<	0.1	ug ml-1	PMID[8176403]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC483855 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23319
0.1-0.2	25427
0.2-0.3	904
0.3-0.4	141
0.4-0.5	27
0.5-0.6	22
0.6-0.7	14
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8174	Intermediate Similarity	NPC482915
0.8087	Intermediate Similarity	NPC483854
0.7328	Intermediate Similarity	NPC483853
0.7328	Intermediate Similarity	NPC608314
0.6911	Remote Similarity	NPC483856
0.6783	Remote Similarity	NPC475303
0.6724	Remote Similarity	NPC475600
0.6667	Remote Similarity	NPC476110
0.6525	Remote Similarity	NPC475596
0.6475	Remote Similarity	NPC327769
0.6441	Remote Similarity	NPC87152
0.6441	Remote Similarity	NPC471977
0.6393	Remote Similarity	NPC170751
0.6303	Remote Similarity	NPC475631
0.6198	Remote Similarity	NPC475644
0.6167	Remote Similarity	NPC470486
0.6066	Remote Similarity	NPC30456
0.6066	Remote Similarity	NPC488904
0.5854	Remote Similarity	NPC471190
0.5812	Remote Similarity	NPC35208
0.5763	Remote Similarity	NPC76565
0.5763	Remote Similarity	NPC601313
0.5738	Remote Similarity	NPC326930
0.5591	Remote Similarity	NPC475648
0.5565	Remote Similarity	NPC475301
0.5537	Remote Similarity	NPC475498
0.5504	Remote Similarity	NPC328928
0.55	Remote Similarity	NPC475137
0.5469	Remote Similarity	NPC601643
0.544	Remote Similarity	NPC122968
0.544	Remote Similarity	NPC228377
0.5426	Remote Similarity	NPC477787
0.5349	Remote Similarity	NPC475406
0.5349	Remote Similarity	NPC253482
0.5276	Remote Similarity	NPC316841
0.5242	Remote Similarity	NPC473833
0.5154	Remote Similarity	NPC473689
0.5154	Remote Similarity	NPC292416
0.5152	Remote Similarity	NPC327904
0.5078	Remote Similarity	NPC328186

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC483855 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4704
0.1-0.2	4413
0.2-0.3	33
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data