NPASS Compound

Natural Product: NPC483854

Natural Product ID	NPC483854
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	OIYGAGDGUHYHMX-BZOAEYFQSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44567102
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000279] Alkaloids and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 121127 0 0 0 0 0 0 0 0999 V2000 6.5364 0.5599 -0.2838 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2638 0.2998 0.5514 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7560 1.6326 0.9429 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7000 2.4329 1.8084 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3928 1.6657 1.4709 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1174 2.1766 2.5805 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3938 1.1262 0.7284 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9990 1.0801 1.0552 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2641 1.6627 -0.0927 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3695 0.7092 -1.0488 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8672 -0.5579 -0.3819 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8794 0.0098 0.6330 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8677 0.6824 -0.1910 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9390 1.3315 0.4153 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9686 1.2830 1.6852 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9820 2.0362 -0.3681 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5784 -1.4689 -1.3149 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8648 -2.7255 -1.7360 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3634 -3.0391 -0.9869 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1045 -2.5892 0.4719 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3565 -1.1477 0.3000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6752 -0.3220 1.4807 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8449 -0.8193 2.3104 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3661 -0.3772 2.4575 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4387 -1.0318 -0.6050 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5597 -2.1734 -1.3244 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6583 -1.9611 -2.8406 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8352 -2.9256 -1.0057 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5147 -2.2667 0.0218 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6997 -2.6546 0.5917 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2296 -3.7236 0.1260 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3583 -1.9287 1.6709 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7389 -2.6987 2.7742 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3623 -2.1468 3.8607 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6205 -0.7985 3.8651 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2434 -0.0869 2.7911 N 0 0 0 0 0 0 0 0 0 0 0 0 5.6301 -0.5918 1.7070 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9065 -3.3310 1.3162 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2841 -4.1934 2.2397 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9641 -4.2469 2.2527 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0629 -5.0275 3.1840 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6789 -2.8081 -3.1339 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2603 -3.7311 -3.9741 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0255 -4.5802 -3.4708 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9564 -3.6835 -5.4501 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8473 -1.7745 -0.7537 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0722 -1.5447 -1.2940 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0691 -1.0028 -2.4286 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2806 -1.9107 -0.5840 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5231 -1.6792 -1.1211 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6856 -2.0157 -0.4605 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6312 -2.6041 0.7778 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4007 -2.8474 1.3384 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2243 -2.4987 0.6534 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4775 1.3192 -1.6750 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4810 1.4678 -3.0474 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4997 1.0612 -3.7503 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6100 2.1014 -3.7868 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6269 2.6812 0.2656 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4651 3.9753 -0.1453 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5299 4.2556 -0.8768 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4259 4.9959 0.2591 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5038 4.7257 1.0472 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3562 5.7759 1.3691 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1313 7.0570 0.9129 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9289 7.9806 1.2282 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0614 7.2806 0.1417 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.8231 8.6314 -0.3362 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2293 6.2790 -0.1785 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3448 0.7065 0.4615 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7593 -0.3013 -0.9381 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3961 1.5110 -0.8183 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5502 -0.2315 -0.0729 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7063 2.2361 -0.0283 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3882 3.5139 1.6969 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7291 2.3707 1.4632 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5220 2.1936 2.8624 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8768 1.7279 1.9420 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0386 2.1997 -0.7397 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3441 0.4504 -1.8721 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4161 -0.7569 1.1778 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4855 0.8590 1.2071 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6156 3.0382 -0.6178 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2009 1.4614 -1.3100 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8984 2.1241 0.2722 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7937 -0.9309 -2.2616 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5787 -3.5750 -1.4891 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5855 -4.1046 -1.0117 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9927 -2.7531 0.6514 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8096 -0.1294 3.2355 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8075 -0.5915 1.8765 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7305 -1.8029 2.7490 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2947 -1.1671 3.0211 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9791 -1.2476 -3.2572 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7077 -1.5708 -2.9970 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6541 -2.9624 -3.3092 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5186 -3.0075 -1.9046 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6233 -3.9940 -0.7586 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5093 -3.7783 2.7127 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6317 -2.7954 4.6838 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1176 -0.3326 4.7228 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1664 -4.5792 4.1715 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0305 -5.3043 2.7102 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4978 -5.9937 3.3395 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3924 -4.5529 -5.7835 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9470 -3.6507 -5.9484 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4687 -2.7163 -5.6756 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5508 -1.2075 -2.1140 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6414 -1.8228 -0.9030 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5389 -2.8837 1.3286 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3726 -3.3120 2.3150 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2978 -2.7225 1.1604 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3734 1.3500 -4.1023 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1755 2.6551 -4.6422 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0739 2.9005 -3.1397 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6659 3.7255 1.3975 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2046 5.5491 1.9919 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1161 9.3197 0.4847 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3552 8.8678 -1.2770 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7228 8.7586 -0.4957 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3704 6.4981 -0.8074 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 1 12 13 1 0 13 14 1 0 14 15 2 0 14 16 1 0 11 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 1 21 25 1 6 25 26 1 0 26 27 1 6 26 28 1 0 28 29 1 0 29 30 1 0 30 31 2 0 30 32 1 0 32 33 2 0 33 34 1 0 34 35 2 0 35 36 1 0 36 37 2 0 20 38 1 0 38 39 1 0 39 40 2 0 39 41 1 0 18 42 1 0 42 43 1 0 43 44 2 0 43 45 1 0 17 46 1 0 46 47 1 0 47 48 2 0 47 49 1 0 49 50 2 0 50 51 1 0 51 52 2 0 52 53 1 0 53 54 2 0 10 55 1 0 55 56 1 0 56 57 2 0 56 58 1 0 9 59 1 0 59 60 1 0 60 61 2 0 60 62 1 0 62 63 1 0 63 64 2 0 64 65 1 0 65 66 2 0 65 67 1 0 67 68 1 0 67 69 1 0 37 2 1 0 54 49 1 0 69 62 2 0 22 8 1 0 37 32 1 0 21 11 1 0 26 19 1 0 1 70 1 0 1 71 1 0 1 72 1 0 2 73 1 6 3 74 1 6 4 75 1 0 4 76 1 0 4 77 1 0 8 78 1 1 9 79 1 6 10 80 1 6 12 81 1 0 12 82 1 0 16 83 1 0 16 84 1 0 16 85 1 0 17 86 1 6 18 87 1 1 19 88 1 1 20 89 1 1 23 90 1 0 23 91 1 0 23 92 1 0 24 93 1 0 27 94 1 0 27 95 1 0 27 96 1 0 28 97 1 0 28 98 1 0 33 99 1 0 34100 1 0 35101 1 0 41102 1 0 41103 1 0 41104 1 0 45105 1 0 45106 1 0 45107 1 0 50108 1 0 51109 1 0 52110 1 0 53111 1 0 54112 1 0 58113 1 0 58114 1 0 58115 1 0 63116 1 0 64117 1 0 68118 1 0 68119 1 0 68120 1 0 69121 1 0 M END

Standard InCHIKey	OIYGAGDGUHYHMX-BZOAEYFQSA-N
Standard InCHI	InChI=1S/C48H52N2O19/c1-23-24(2)41(56)67-38-36(66-43(58)30-17-18-32(55)50(9)20-30)40(65-28(6)54)47(22-61-25(3)51)39(68-42(57)29-14-11-10-12-15-29)35(63-26(4)52)33-37(64-27(5)53)48(47,46(38,8)60)69-45(33,7)21-62-44(59)31-16-13-19-49-34(23)31/h10-20,23-24,33,35-40,60H,21-22H2,1-9H3/t23-,24+,33-,35+,36+,37-,38+,39-,40+,45+,46-,47-,48+/m1/s1
SMILES	C[C@@H]1[C@H](C)C(=O)O[C@H]2[C@@H]([C@@H]([C@@]3(COC(=O)C)[C@@H]([C@H]([C@@H]4[C@H]([C@@]3([C@]2(C)O)O[C@@]4(C)COC(=O)c2cccnc12)OC(=O)C)OC(=O)C)OC(=O)c1ccccc1)OC(=O)C)OC(=O)c1ccc(=O)n(C)c1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	960.32	Volume:	923.057 ? Van der Waals volume.
Dense:	1.04	LogP:	1.122 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.625 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.673 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	50.0
TPSA:	274.75 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	1.0	Rings:	7.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.238	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.803	Fsp³:	0.5
MCE-18:	245.778 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.659	Fluc inhibitor:	0.01 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.481 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.002	Promiscuous compounds:	0.014

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.43	MDCK Permeability:	-5.004
Pgp-inhibitor:	0.999	Pgp-substrate:	0.149
PAMPA:	0.937 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.082	30% Bioavailability (F30%):	0.37
50% Bioavailability (F50%):	0.978

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	71.627%	Volume Distribution (VD):	-0.326
Fu:	26.957% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.0
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.473	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.995
HLM stability:	0.567 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.288

Half-life (T1/2):

1.596

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.102
Human Hepatotoxicity (H-HT):	0.276	Drug-induced Liver Injury (DILI):	0.989
AMES Toxicity:	0.956	Rat Oral Acute Toxicity:	0.386
Maximum Recommended Daily Dose:	0.86	Skin Sensitization:	1.0
Carcinogencity:	0.569	Eye Corrosion:	0.0
Eye Irritation:	0.037	Respiratory Toxicity:	0.338
Drug-induced Neurotoxicity:	0.79	Ototoxicity:	0.63
Hematotoxicity:	0.895	Drug-induced Nephrotoxicity:	0.995
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.517
A549 Cytotoxicity:	0.106	Hek293 Cytotoxicity:	0.267
BCF:	0.559 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.46 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.797 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.464 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO19747	Maytenus emarginata	Species	Celastraceae	Eukaryota	n.a.	stem	n.a.	PMID[2380715]
NPO19747	Maytenus emarginata	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[2380715]
NPO19747	Maytenus emarginata	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8176403]
NPO19747	Maytenus emarginata	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO19747	Maytenus emarginata	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell line	KB	Homo sapiens	ED50	=	0.4	ug ml-1	PMID[2380715]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC483854 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24027
0.1-0.2	24720
0.2-0.3	881
0.3-0.4	143
0.4-0.5	27
0.5-0.6	22
0.6-0.7	22
0.7-0.8	0
0.8-0.85	4
0.85-0.9	1
0.9-0.95	2
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9714	High Similarity	NPC482915
0.9135	High Similarity	NPC483853
0.9135	High Similarity	NPC608314
0.8559	High Similarity	NPC483856
0.8462	Intermediate Similarity	NPC475600
0.8087	Intermediate Similarity	NPC483855
0.8037	Intermediate Similarity	NPC476110
0.8019	Intermediate Similarity	NPC475303
0.7928	Intermediate Similarity	NPC327769
0.7778	Intermediate Similarity	NPC87152
0.7778	Intermediate Similarity	NPC475631
0.7706	Intermediate Similarity	NPC475596
0.7358	Intermediate Similarity	NPC76565
0.7358	Intermediate Similarity	NPC601313
0.7273	Intermediate Similarity	NPC326930
0.7018	Intermediate Similarity	NPC475644
0.6903	Remote Similarity	NPC475301
0.6903	Remote Similarity	NPC122968
0.6903	Remote Similarity	NPC228377
0.678	Remote Similarity	NPC170751
0.6724	Remote Similarity	NPC30456
0.6724	Remote Similarity	NPC488904
0.6696	Remote Similarity	NPC471977
0.6555	Remote Similarity	NPC477787
0.6525	Remote Similarity	NPC473689
0.6525	Remote Similarity	NPC292416
0.65	Remote Similarity	NPC328928
0.6471	Remote Similarity	NPC475406
0.6325	Remote Similarity	NPC328186
0.6271	Remote Similarity	NPC470486
0.6271	Remote Similarity	NPC316841
0.6195	Remote Similarity	NPC35208
0.6174	Remote Similarity	NPC475498
0.6148	Remote Similarity	NPC319880
0.6148	Remote Similarity	NPC320324
0.6098	Remote Similarity	NPC327904
0.608	Remote Similarity	NPC475426
0.6066	Remote Similarity	NPC244839
0.5968	Remote Similarity	NPC38959
0.5913	Remote Similarity	NPC250807
0.5913	Remote Similarity	NPC57797
0.5882	Remote Similarity	NPC53255
0.5882	Remote Similarity	NPC85879
0.582	Remote Similarity	NPC471190
0.5806	Remote Similarity	NPC601643
0.5794	Remote Similarity	NPC471979
0.5738	Remote Similarity	NPC328154
0.5726	Remote Similarity	NPC475137
0.568	Remote Similarity	NPC253482
0.5583	Remote Similarity	NPC146824
0.5583	Remote Similarity	NPC473833
0.5565	Remote Similarity	NPC13603
0.5556	Remote Similarity	NPC475648
0.536	Remote Similarity	NPC477788
0.5312	Remote Similarity	NPC600583
0.5294	Remote Similarity	NPC470306
0.5285	Remote Similarity	NPC473506
0.5234	Remote Similarity	NPC600607
0.5078	Remote Similarity	NPC324619
0.5039	Remote Similarity	NPC475533

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC483854 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4707
0.1-0.2	4413
0.2-0.3	30
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data