NPASS Compound

Natural Product: NPC146824

Natural Product ID	NPC146824
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Alatusinine
IUPAC Name	n.a.
Synonyms	Alatusinine
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL508998
PubChem CID	44566643
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001283] Terpene lactones

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 105109 0 0 0 0 0 0 0 0999 V2000 -5.4441 2.8771 0.2323 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4100 2.2693 1.1165 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3559 2.4286 2.3428 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4538 1.4765 0.5106 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4072 0.8407 1.2788 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5985 0.0950 0.3012 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0248 1.0366 -0.7222 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.0844 1.7585 -1.3315 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3222 1.5728 -2.6820 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6092 0.7774 -3.3550 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4069 2.2781 -3.4208 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0365 1.9986 -0.1874 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6994 3.2514 0.0610 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4595 4.3587 -0.7111 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3582 4.2789 -1.6580 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1677 5.6428 -0.4219 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8296 1.6288 0.9359 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4809 0.3720 1.6888 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3235 -0.5684 0.8765 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4187 -0.9092 -0.2477 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5704 -2.2827 -0.3458 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7230 -2.7363 0.2971 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8148 -2.2623 -0.6349 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4620 -0.9697 -0.3070 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6398 -1.2496 0.4253 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9237 -1.0185 -0.0371 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0471 -0.5293 -1.1870 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1266 -1.3384 0.7991 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8001 -3.2872 -0.6594 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1612 -3.9930 -1.7744 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5954 -3.7350 -2.8677 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1913 -5.0615 -1.7903 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7860 -1.8003 1.5213 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1084 -2.2910 2.6103 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6930 -2.6839 3.7829 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9524 -2.5898 3.8756 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0821 -3.2112 4.9405 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6694 -2.7607 -1.7809 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7496 -2.8033 0.3639 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0148 -2.6310 -0.1803 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3567 -1.5376 -0.8724 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4960 -0.6872 -1.1114 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6517 -1.1230 -1.4349 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8553 -1.5321 -2.7149 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0192 -1.1771 -3.3365 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9316 -0.4171 -2.6308 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6765 -0.0386 -1.3664 N 0 0 0 0 0 0 0 0 0 0 0 0 5.5274 -0.3756 -0.7190 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2568 0.0789 0.6716 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4155 1.5050 0.9551 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5280 2.5372 0.3960 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1285 2.5862 0.8425 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7188 3.5784 1.5704 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2034 1.6629 0.5499 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6273 2.5331 -1.1296 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1048 3.8238 0.7367 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0620 0.6571 3.0756 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7189 -0.2360 1.9247 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9585 3.7870 -0.2261 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3656 3.1356 0.7721 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6465 2.1770 -0.6067 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9804 0.1873 1.9829 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9083 1.6934 1.7685 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5088 0.3794 -1.4816 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8867 1.5609 -4.1216 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9603 3.1454 -3.9641 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1558 2.5930 -2.6849 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6170 2.2520 -1.0836 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6320 6.4550 -0.9209 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2236 5.5250 -0.7365 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1573 5.7690 0.6816 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7702 2.4555 1.7108 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7627 -3.7840 0.5623 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4407 -2.1942 -1.6951 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8518 -0.5175 -1.2749 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9195 -2.1969 1.4752 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4617 -0.4854 1.3972 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9235 -1.6215 0.0855 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7047 -6.0558 -1.8574 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7811 -4.9419 -2.7370 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9136 -4.9818 -0.9696 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8801 -1.7873 1.8148 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0765 -4.3282 4.9606 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4117 -2.8481 5.8512 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1344 -2.8937 4.9313 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6877 -3.1492 -2.0284 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0059 -3.6513 -1.9492 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4725 -1.9514 -2.5067 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6121 -3.9653 0.2184 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8023 -2.7690 1.4440 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0374 -2.1162 -3.2091 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2002 -1.4969 -4.3618 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8669 -0.1220 -3.1043 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9970 -0.4890 1.3144 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2594 -0.3229 0.9516 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4233 1.6973 2.0909 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4833 1.8340 0.6706 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6840 2.5449 -1.4528 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1293 3.4367 -1.5532 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0821 1.6770 -1.5628 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8534 3.7086 1.3433 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0972 1.7614 3.3003 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0082 0.1340 3.3036 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6264 0.2874 3.8970 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2306 0.4054 2.4956 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 6 5 1 1 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 9 11 1 0 7 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 14 16 1 0 12 17 1 0 17 18 1 0 18 19 1 0 19 20 1 6 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 23 29 1 0 29 30 1 0 30 31 2 0 30 32 1 0 22 33 1 0 33 34 1 0 34 35 1 0 35 36 2 0 35 37 1 0 21 38 1 6 21 39 1 0 39 40 1 0 40 41 1 0 41 42 2 0 41 43 1 0 43 44 2 0 44 45 1 0 45 46 2 0 46 47 1 0 47 48 2 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 2 0 52 54 1 0 51 55 1 0 51 56 1 0 18 57 1 0 18 58 1 1 24 6 1 0 48 43 1 0 19 6 1 0 54 17 1 0 33 19 1 0 1 59 1 0 1 60 1 0 1 61 1 0 5 62 1 0 5 63 1 0 7 64 1 6 11 65 1 0 11 66 1 0 11 67 1 0 12 68 1 6 16 69 1 0 16 70 1 0 16 71 1 0 17 72 1 1 22 73 1 1 23 74 1 6 24 75 1 6 28 76 1 0 28 77 1 0 28 78 1 0 32 79 1 0 32 80 1 0 32 81 1 0 33 82 1 1 37 83 1 0 37 84 1 0 37 85 1 0 38 86 1 0 38 87 1 0 38 88 1 0 39 89 1 0 39 90 1 0 44 91 1 0 45 92 1 0 46 93 1 0 49 94 1 0 49 95 1 0 50 96 1 0 50 97 1 0 55 98 1 0 55 99 1 0 55100 1 0 56101 1 0 57102 1 0 57103 1 0 57104 1 0 58105 1 0 M END

Standard InCHIKey	PDOVVPMFGOLGNT-GFPSWGCNSA-N
Standard InCHI	InChI=1S/C38H47NO19/c1-17(40)50-16-37-30(55-21(5)44)26(52-18(2)41)25-28(54-20(4)43)38(37)36(9,49)29(27(53-19(3)42)31(37)56-22(6)45)57-33(47)34(7,48)13-12-24-23(11-10-14-39-24)32(46)51-15-35(25,8)58-38/h10-11,14,25-31,48-49H,12-13,15-16H2,1-9H3/t25-,26-,27+,28-,29+,30-,31+,34?,35+,36+,37-,38+/m1/s1
SMILES	CC(=O)OC[C@]12[C@@H](OC(=O)C)[C@@H](OC(=O)C)[C@H]3[C@]([C@@]42O[C@@]([C@H]([C@H]([C@H]1OC(=O)C)OC(=O)C)[C@H]4OC(=O)C)(C)COC(=O)c1cccnc1CCC(C(=O)O3)(C)O)(C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	821.27	Volume:	772.032 ? Van der Waals volume.
Dense:	1.064	LogP:	-0.164 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.54 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.376 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	38.0
TPSA:	272.98 ? Topological Polar Surface Area.	H-Bond Acceptor:	20.0
H-Bond Donor:	2.0	Rings:	5.0
Heavy Atoms:	20.0

MedChem Properties

QED Drug-Likeness Score:	0.27	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.622	Fsp³:	0.658
MCE-18:	210.381 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.476	Fluc inhibitor:	0.002 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.061 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.013	Promiscuous compounds:	0.346

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.352	MDCK Permeability:	-4.794
Pgp-inhibitor:	0.01	Pgp-substrate:	0.832
PAMPA:	0.997 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.011	30% Bioavailability (F30%):	0.137
50% Bioavailability (F50%):	0.962

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.015	MRP1:	1.0
Plasma Protein Binding (PPB):	14.781%	Volume Distribution (VD):	-0.476
Fu:	83.189% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.961	BCRP inhibitor:	0.0
BSEP inhibitor:	0.178

ADMET: Metabolism

CYP1A2-inhibitor:	0.002	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.002	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.503	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.416
HLM stability:	0.006 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.795

Half-life (T1/2):

1.62

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.015
Human Hepatotoxicity (H-HT):	0.526	Drug-induced Liver Injury (DILI):	0.858
AMES Toxicity:	0.995	Rat Oral Acute Toxicity:	0.588
Maximum Recommended Daily Dose:	0.637	Skin Sensitization:	1.0
Carcinogencity:	0.691	Eye Corrosion:	0.0
Eye Irritation:	0.048	Respiratory Toxicity:	0.088
Drug-induced Neurotoxicity:	0.085	Ototoxicity:	0.679
Hematotoxicity:	0.966	Drug-induced Nephrotoxicity:	0.993
Genotoxicity:	0.997	RPMI-8226 Immunitoxicity:	0.492
A549 Cytotoxicity:	0.342	Hek293 Cytotoxicity:	0.082
BCF:	0.454 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	2.913 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.215 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.043 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/0031-9422(90)85349-K]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	DOI[10.1186/1471-2202-6-1]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10579865]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	leaf	n.a.	PMID[10716597]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10757718]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11374948]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11561442]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12579877]
NPO1333	Maytenus chiapensis	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12713421]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[1375626]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[1375626]
NPO1333	Maytenus chiapensis	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[14738378]
NPO1333	Maytenus chiapensis	Species	Celastraceae	Eukaryota	n.a.	leaf	n.a.	PMID[14738378]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[1602302]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[1602302]
NPO1333	Maytenus chiapensis	Species	Celastraceae	Eukaryota	root bark;leaves	Huayllabamba-Urquillos, Province of Urabamba, Cusco (Peru); Parque Nacional El Imposible, El Salvador	n.a.	PMID[16038541]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[16864458]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	roots	n.a.	n.a.	PMID[16989518]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[17250858]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[17265278]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	leaf	n.a.	PMID[1823717]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[1823717]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[18554602]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	bark	n.a.	PMID[18996177]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	root	n.a.	n.a.	PMID[21486005]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[21486005]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21514608]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	dried roots	purchased from Sichuan Neautus Traditional Chinese Medicine Co. Ltd. (Chengdu, P.R. China)	n.a.	PMID[22148431]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	leaves	n.a.	n.a.	PMID[23268606]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[23852638]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24549173]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24963543]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25237706]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	bark	n.a.	PMID[2534610]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[2816380]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	Leaves	n.a.	n.a.	PMID[29355322]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	Leaves	n.a.	n.a.	PMID[31556299]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[7102323]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[7304185]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8699928]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8722541]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[Article]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	Database[Article]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1333	Maytenus chiapensis	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO1333	Maytenus chiapensis	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
EC50	1
Activity	2
IC50	2

Activity Type	# Activity
Cell line	2
Organism	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT927	Cell line	PBMC	Homo sapiens	IC50	=	45910.0	nM	PMID[17261619]
NPT927	Cell line	PBMC	Homo sapiens	IC50	=	75680.0	nM	Open TG-GATES in vivo data: Pathology
NPT776	Organism	Spodoptera littoralis	Spodoptera littoralis	EC50	=	1.6	10'-4 ug/cm2	PMID[25625705]
NPT776	Organism	Spodoptera littoralis	Spodoptera littoralis	Activity	=	125.0	%	PMID[22686608]
NPT776	Organism	Spodoptera littoralis	Spodoptera littoralis	Activity	=	111.0	%	PMID[17908946]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC146824 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19014
0.1-0.2	29886
0.2-0.3	793
0.3-0.4	84
0.4-0.5	11
0.5-0.6	29
0.6-0.7	20
0.7-0.8	0
0.8-0.85	2
0.85-0.9	5
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8913	High Similarity	NPC13603
0.8723	High Similarity	NPC473689
0.8723	High Similarity	NPC292416
0.8636	High Similarity	NPC250807
0.8636	High Similarity	NPC57797
0.8438	Intermediate Similarity	NPC475406
0.8085	Intermediate Similarity	NPC475362
0.7708	Intermediate Similarity	NPC53255
0.7708	Intermediate Similarity	NPC85879
0.7551	Intermediate Similarity	NPC122968
0.7551	Intermediate Similarity	NPC328186
0.7551	Intermediate Similarity	NPC228377
0.7525	Intermediate Similarity	NPC244839
0.7368	Intermediate Similarity	NPC76565
0.7368	Intermediate Similarity	NPC601313
0.7353	Intermediate Similarity	NPC600583
0.73	Intermediate Similarity	NPC316841
0.7115	Intermediate Similarity	NPC319880
0.7115	Intermediate Similarity	NPC320324
0.7048	Intermediate Similarity	NPC38959
0.7019	Intermediate Similarity	NPC253482
0.6981	Remote Similarity	NPC471979
0.6887	Remote Similarity	NPC327904
0.6698	Remote Similarity	NPC475648
0.6634	Remote Similarity	NPC483892
0.6602	Remote Similarity	NPC326930
0.6571	Remote Similarity	NPC476110
0.6566	Remote Similarity	NPC473850
0.6538	Remote Similarity	NPC475301
0.6476	Remote Similarity	NPC87152
0.6476	Remote Similarity	NPC475600
0.6476	Remote Similarity	NPC475631
0.6381	Remote Similarity	NPC475303
0.6337	Remote Similarity	NPC471016
0.633	Remote Similarity	NPC477787
0.6262	Remote Similarity	NPC475596
0.625	Remote Similarity	NPC475426
0.6139	Remote Similarity	NPC470306
0.6071	Remote Similarity	NPC483853
0.6071	Remote Similarity	NPC608314
0.6	Remote Similarity	NPC611166
0.5963	Remote Similarity	NPC324619
0.5922	Remote Similarity	NPC35208
0.5905	Remote Similarity	NPC475498
0.5872	Remote Similarity	NPC475315
0.5856	Remote Similarity	NPC483893
0.5856	Remote Similarity	NPC600607
0.5841	Remote Similarity	NPC328928
0.5804	Remote Similarity	NPC237702
0.5804	Remote Similarity	NPC601643
0.5794	Remote Similarity	NPC475601
0.5789	Remote Similarity	NPC327769
0.578	Remote Similarity	NPC475533
0.578	Remote Similarity	NPC607403
0.5714	Remote Similarity	NPC483856
0.5714	Remote Similarity	NPC483894
0.5676	Remote Similarity	NPC600224
0.5625	Remote Similarity	NPC475644
0.5586	Remote Similarity	NPC328154
0.5583	Remote Similarity	NPC483854
0.5566	Remote Similarity	NPC475137
0.5537	Remote Similarity	NPC482915
0.5536	Remote Similarity	NPC604935
0.5351	Remote Similarity	NPC30456
0.5351	Remote Similarity	NPC488904
0.5273	Remote Similarity	NPC473833
0.5259	Remote Similarity	NPC600546
0.513	Remote Similarity	NPC483895
0.5082	Remote Similarity	NPC469748
0.5043	Remote Similarity	NPC470486

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC146824 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4290
0.1-0.2	4835
0.2-0.3	25
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data