NPASS Compound

Natural Product: NPC38959

Natural Product ID	NPC38959
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Wilfornine C
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL509162
PubChem CID	44584749
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001283] Terpene lactones

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 124130 0 0 0 0 0 0 0 0999 V2000 -4.1128 -0.7760 -5.7407 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6598 0.0246 -4.5725 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8100 1.2728 -4.6440 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0970 -0.5985 -3.4584 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7050 0.2955 -2.4043 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1198 -0.5328 -1.2733 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9295 -1.2356 -1.8863 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0562 -1.4678 -3.2574 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1829 -2.6429 -3.9207 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1877 -3.6678 -3.2471 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3102 -2.6999 -5.3912 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4384 -0.7915 -1.4418 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2706 -1.0814 -2.6076 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2409 -2.0558 -2.6105 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4379 -2.7386 -1.5754 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0761 -2.3355 -3.8052 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6695 0.5878 -1.0510 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6004 1.2962 -0.4934 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5972 0.2926 -0.1245 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9539 -0.6494 0.6793 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6140 -0.8652 1.8577 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9966 -0.4328 1.5193 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6287 -1.4584 0.6071 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2386 -1.4425 -0.8260 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3512 -1.4560 -1.7029 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7962 -2.4698 -2.4813 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1358 -3.5092 -2.4009 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9852 -2.3507 -3.3665 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0474 -1.2734 0.7942 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8709 -2.1553 1.4335 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3425 -3.2214 1.8981 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3296 -1.9552 1.6212 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7426 0.8121 0.6685 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.4985 1.9522 1.4325 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2476 3.0957 1.4300 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2605 3.1446 0.6714 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9000 4.2472 2.2793 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8085 4.2257 3.1145 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4775 5.3029 3.9132 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2543 6.4651 3.8958 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3436 6.4689 3.0533 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6704 5.3850 2.2546 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5421 -2.3449 2.1846 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0025 -0.1699 3.0221 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1130 -0.7962 3.6158 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1463 -1.3296 2.9565 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2327 -1.3755 1.7994 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3107 -1.9333 3.5983 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9078 -2.8007 4.5757 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8627 -3.4672 5.2705 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2020 -3.2754 4.9979 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5200 -2.4067 4.0185 N 0 0 0 0 0 0 0 0 0 0 0 0 3.6116 -1.7313 3.3090 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9329 -0.8622 2.1565 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5971 0.5646 2.2612 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8883 1.2666 0.9814 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0385 0.8404 -0.1800 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6000 0.4395 -1.2359 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7124 0.8570 -0.1981 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5468 2.7495 1.2011 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2647 1.1257 0.7008 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9322 1.6550 -0.3650 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3286 2.3455 -1.2065 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3607 1.4162 -0.5283 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0564 0.6438 0.4014 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3967 0.4308 0.2295 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1238 0.9424 -0.8294 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4429 1.7052 -1.7496 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0885 1.9278 -1.5870 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9863 2.4934 -1.2813 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1459 1.8434 0.7411 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1248 -0.4136 -6.0142 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1198 -1.8598 -5.5291 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4193 -0.6432 -6.6098 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9555 0.9264 -2.9194 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5410 0.9223 -2.1448 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9974 -2.2762 -1.4858 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3547 -1.6669 -5.7924 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2068 -3.2937 -5.7056 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4013 -3.1916 -5.8459 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8810 -1.4961 -0.7173 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9150 -3.3563 -4.1955 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1413 -2.1749 -3.5424 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8645 -1.6227 -4.6319 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8871 1.2647 -1.9654 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6345 -0.2190 2.3770 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4715 -2.4290 1.0967 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8399 -2.4713 -1.0211 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1743 -1.2910 -3.6504 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8544 -2.9460 -4.2808 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8692 -2.7511 -2.8111 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5792 -0.9004 1.8371 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9259 -2.3911 0.7923 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6289 -2.5137 2.5576 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6523 1.0171 0.0658 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1966 3.3285 3.1380 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6215 5.3047 4.5771 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9785 7.2894 4.5248 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9586 7.3643 3.0269 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5352 5.4277 1.6056 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4994 -2.6870 2.6810 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8174 -2.5505 2.9988 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2489 -2.9735 1.3432 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8019 -0.3427 3.8423 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8938 0.8880 3.0426 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8033 -2.9133 4.6971 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5352 -4.1696 6.0509 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9115 -3.8339 5.5871 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0478 -0.9036 1.9257 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4966 -1.3585 1.2324 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3167 1.0115 3.0196 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6040 0.8087 2.6880 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5119 3.2972 1.2893 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9219 2.8940 2.0971 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0304 3.1834 0.3228 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4700 0.2518 1.2238 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9372 -0.1685 0.9513 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1890 0.7567 -0.9403 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9178 2.1495 -2.6109 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5280 2.5285 -2.3029 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3785 2.5035 -2.2319 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6095 3.4691 -0.8144 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0440 2.6948 -1.4032 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3874 2.7673 0.8736 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 6 5 1 6 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 9 11 1 0 7 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 14 16 1 0 12 17 1 0 17 18 1 0 18 19 1 0 19 20 1 1 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 23 29 1 0 29 30 1 0 30 31 2 0 30 32 1 0 22 33 1 0 33 34 1 0 34 35 1 0 35 36 2 0 35 37 1 0 37 38 2 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 2 0 21 43 1 1 21 44 1 0 44 45 1 0 45 46 1 0 46 47 2 0 46 48 1 0 48 49 2 0 49 50 1 0 50 51 2 0 51 52 1 0 52 53 2 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 2 0 57 59 1 0 56 60 1 0 56 61 1 6 61 62 1 0 62 63 2 0 62 64 1 0 64 65 2 0 65 66 1 0 66 67 2 0 67 68 1 0 68 69 2 0 18 70 1 0 18 71 1 1 24 6 1 0 42 37 1 0 53 48 1 0 69 64 1 0 19 6 1 0 59 17 1 0 33 19 1 0 1 72 1 0 1 73 1 0 1 74 1 0 5 75 1 0 5 76 1 0 7 77 1 1 11 78 1 0 11 79 1 0 11 80 1 0 12 81 1 1 16 82 1 0 16 83 1 0 16 84 1 0 17 85 1 6 22 86 1 1 23 87 1 1 24 88 1 6 28 89 1 0 28 90 1 0 28 91 1 0 32 92 1 0 32 93 1 0 32 94 1 0 33 95 1 6 38 96 1 0 39 97 1 0 40 98 1 0 41 99 1 0 42100 1 0 43101 1 0 43102 1 0 43103 1 0 44104 1 0 44105 1 0 49106 1 0 50107 1 0 51108 1 0 54109 1 0 54110 1 0 55111 1 0 55112 1 0 60113 1 0 60114 1 0 60115 1 0 65116 1 0 66117 1 0 67118 1 0 68119 1 0 69120 1 0 70121 1 0 70122 1 0 70123 1 0 71124 1 0 M END

Standard InCHIKey	WTRGNKRBOZTZCU-PYMTWWKESA-N
Standard InCHI	InChI=1S/C50H53NO20/c1-26(52)62-25-49-40(66-29(4)55)36(64-27(2)53)35-38(68-42(57)31-16-11-9-12-17-31)50(49)48(8,61)39(37(65-28(3)54)41(49)67-30(5)56)69-45(60)46(6,70-43(58)32-18-13-10-14-19-32)22-21-34-33(20-15-23-51-34)44(59)63-24-47(35,7)71-50/h9-20,23,35-41,61H,21-22,24-25H2,1-8H3/t35-,36-,37+,38-,39+,40-,41+,46-,47+,48+,49-,50+/m1/s1
SMILES	CC(=O)OC[C@]12[C@@H](OC(=O)C)[C@@H](OC(=O)C)[C@H]3[C@]([C@@]42O[C@@]([C@H]([C@H]([C@H]1OC(=O)C)OC(=O)C)[C@H]4OC(=O)c1ccccc1)(C)COC(=O)c1cccnc1CC[C@@](C(=O)O3)(C)OC(=O)c1ccccc1)(C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	987.32	Volume:	952.806 ? Van der Waals volume.
Dense:	1.036	LogP:	2.084 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.335 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.554 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	17.0	Rigid Bonds:	51.0
TPSA:	279.05 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	1.0	Rings:	7.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.226	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.779	Fsp³:	0.48
MCE-18:	246.703 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.679	Fluc inhibitor:	0.007 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.25 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.011	Promiscuous compounds:	0.021

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.404	MDCK Permeability:	-4.741
Pgp-inhibitor:	0.903	Pgp-substrate:	0.818
PAMPA:	0.991 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.0	30% Bioavailability (F30%):	0.001
50% Bioavailability (F50%):	0.405

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.663	MRP1:	1.0
Plasma Protein Binding (PPB):	73.631%	Volume Distribution (VD):	-0.205
Fu:	25.407% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.519	BCRP inhibitor:	0.0
BSEP inhibitor:	0.971

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.002
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.048	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.626 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.277

Half-life (T1/2):

1.492

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.064
Human Hepatotoxicity (H-HT):	0.079	Drug-induced Liver Injury (DILI):	0.984
AMES Toxicity:	0.978	Rat Oral Acute Toxicity:	0.161
Maximum Recommended Daily Dose:	0.658	Skin Sensitization:	1.0
Carcinogencity:	0.884	Eye Corrosion:	0.0
Eye Irritation:	0.062	Respiratory Toxicity:	0.006
Drug-induced Neurotoxicity:	0.255	Ototoxicity:	0.272
Hematotoxicity:	0.538	Drug-induced Nephrotoxicity:	0.995
Genotoxicity:	0.972	RPMI-8226 Immunitoxicity:	0.382
A549 Cytotoxicity:	0.505	Hek293 Cytotoxicity:	0.316
BCF:	0.549 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.517 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.833 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.517 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/0031-9422(90)85349-K]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	DOI[10.1186/1471-2202-6-1]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10579865]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	leaf	n.a.	PMID[10716597]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10757718]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11374948]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11561442]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12579877]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[1375626]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[1375626]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[1602302]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[1602302]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[16864458]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	roots	n.a.	n.a.	PMID[16989518]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[17250858]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[17265278]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[1823717]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	leaf	n.a.	PMID[1823717]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[18554602]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	bark	n.a.	PMID[18996177]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	root	n.a.	n.a.	PMID[21486005]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[21486005]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21514608]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	dried roots	purchased from Sichuan Neautus Traditional Chinese Medicine Co. Ltd. (Chengdu, P.R. China)	n.a.	PMID[22148431]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	leaves	n.a.	n.a.	PMID[23268606]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[23852638]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24549173]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24963543]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25237706]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	bark	n.a.	PMID[2534610]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[2816380]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	Leaves	n.a.	n.a.	PMID[29355322]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	Leaves	n.a.	n.a.	PMID[31556299]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[7102323]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[7304185]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8699928]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8722541]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[Article]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	Database[Article]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	6

Activity Type	# Activity
Cell line	6

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT927	Cell line	PBMC	Homo sapiens	Inhibition	=	-11.0	%	PMID[11374948]
NPT927	Cell line	PBMC	Homo sapiens	Inhibition	=	-6.0	%	PMID[11374948]
NPT927	Cell line	PBMC	Homo sapiens	Inhibition	=	-8.0	%	PMID[11374948]
NPT927	Cell line	PBMC	Homo sapiens	Inhibition	=	51.0	%	PMID[11374948]
NPT927	Cell line	PBMC	Homo sapiens	Inhibition	=	39.0	%	PMID[11374948]
NPT927	Cell line	PBMC	Homo sapiens	Inhibition	=	32.0	%	PMID[11374948]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC38959 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	18956
0.1-0.2	29561
0.2-0.3	1053
0.3-0.4	195
0.4-0.5	22
0.5-0.6	32
0.6-0.7	19
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	4
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9381	High Similarity	NPC244839
0.9286	High Similarity	NPC319880
0.9286	High Similarity	NPC320324
0.9	High Similarity	NPC327904
0.8485	Intermediate Similarity	NPC328186
0.8218	Intermediate Similarity	NPC316841
0.7767	Intermediate Similarity	NPC122968
0.7767	Intermediate Similarity	NPC228377
0.7736	Intermediate Similarity	NPC237702
0.7685	Intermediate Similarity	NPC471979
0.7524	Intermediate Similarity	NPC475631
0.7477	Intermediate Similarity	NPC473689
0.7477	Intermediate Similarity	NPC292416
0.7407	Intermediate Similarity	NPC600583
0.7327	Intermediate Similarity	NPC250807
0.7327	Intermediate Similarity	NPC57797
0.729	Intermediate Similarity	NPC475596
0.7248	Intermediate Similarity	NPC475406
0.7248	Intermediate Similarity	NPC601643
0.7048	Intermediate Similarity	NPC146824
0.6972	Remote Similarity	NPC476110
0.6903	Remote Similarity	NPC327769
0.6881	Remote Similarity	NPC87152
0.6881	Remote Similarity	NPC475600
0.6789	Remote Similarity	NPC475303
0.6759	Remote Similarity	NPC53255
0.6759	Remote Similarity	NPC85879
0.6726	Remote Similarity	NPC477787
0.6518	Remote Similarity	NPC13603
0.6491	Remote Similarity	NPC253482
0.6449	Remote Similarity	NPC76565
0.6449	Remote Similarity	NPC601313
0.6339	Remote Similarity	NPC475301
0.6316	Remote Similarity	NPC30456
0.6316	Remote Similarity	NPC488904
0.6261	Remote Similarity	NPC600607
0.6261	Remote Similarity	NPC611166
0.6207	Remote Similarity	NPC475648
0.6034	Remote Similarity	NPC475644
0.5968	Remote Similarity	NPC483854
0.5965	Remote Similarity	NPC326930
0.592	Remote Similarity	NPC482915
0.5909	Remote Similarity	NPC473850
0.5877	Remote Similarity	NPC475362
0.5862	Remote Similarity	NPC328154
0.5833	Remote Similarity	NPC328928
0.5726	Remote Similarity	NPC470486
0.5667	Remote Similarity	NPC600546
0.5593	Remote Similarity	NPC471977
0.5583	Remote Similarity	NPC483893
0.5575	Remote Similarity	NPC471016
0.5546	Remote Similarity	NPC600224
0.5536	Remote Similarity	NPC470306
0.5528	Remote Similarity	NPC483853
0.5528	Remote Similarity	NPC608314
0.5487	Remote Similarity	NPC35208
0.5462	Remote Similarity	NPC477788
0.5455	Remote Similarity	NPC483894
0.544	Remote Similarity	NPC475426
0.5417	Remote Similarity	NPC604935
0.5378	Remote Similarity	NPC475533
0.5289	Remote Similarity	NPC324619
0.525	Remote Similarity	NPC607403
0.5231	Remote Similarity	NPC483856
0.5214	Remote Similarity	NPC475498
0.5207	Remote Similarity	NPC475315
0.5172	Remote Similarity	NPC475137
0.5169	Remote Similarity	NPC483892
0.5164	Remote Similarity	NPC471190
0.5164	Remote Similarity	NPC471978
0.5041	Remote Similarity	NPC483895

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC38959 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3609
0.1-0.2	5484
0.2-0.3	56
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data