NPASS Compound

Natural Product: NPC327904

Natural Product ID	NPC327904
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	UASPCJAJXBQHDM-RDZAULFISA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1813070
PubChem CID	56673181
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001283] Terpene lactones

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 124130 0 0 0 0 0 0 0 0999 V2000 -5.0076 -3.9374 0.7133 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3842 -2.7347 1.2764 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7328 -2.3061 2.4087 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3894 -2.0362 0.5710 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8546 -0.8717 1.2325 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8070 -0.3257 0.2487 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5008 0.0143 -0.9958 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0616 1.2642 -1.7222 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3603 2.2635 -0.8640 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8363 2.0471 0.5467 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0482 0.8539 0.8655 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6258 0.6532 2.2568 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3114 -0.5508 2.2826 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1273 -1.7089 1.5051 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7334 -1.3933 0.1595 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0711 -2.5240 -0.5724 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5001 -2.9493 -1.7283 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4093 -2.2830 -2.2123 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9488 -4.1583 -2.3757 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3865 -4.5733 -3.5579 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7978 -5.7360 -4.1885 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8052 -6.5280 -3.6363 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3673 -6.1128 -2.4544 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9424 -4.9560 -1.8481 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9981 -2.5331 1.2081 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1128 -3.8450 1.6533 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1557 -4.2818 2.3470 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2731 -4.7181 1.3556 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6098 -0.1565 1.9552 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8027 -0.6388 2.3732 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8403 -1.5947 3.1642 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0480 -0.0086 1.8778 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9686 0.1416 0.3419 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1618 0.8708 -0.1534 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2977 1.0590 -1.6082 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4800 1.6528 -2.4750 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8287 1.7725 -3.8429 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0107 1.2759 -4.2916 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8537 0.6623 -3.4031 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4785 0.5792 -2.1347 N 0 0 0 0 0 0 0 0 0 0 0 0 3.1432 2.2638 -2.2747 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0992 3.5113 -2.2194 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0544 1.5576 -2.1741 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7255 1.5609 -2.0218 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1393 1.9878 -0.7202 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1552 0.9240 0.1320 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8481 3.1992 -0.2686 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0675 1.4192 2.4515 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2142 -0.6149 2.3121 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5691 -1.9319 2.0686 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7594 -2.6251 1.3971 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8477 -2.4309 2.6002 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6006 0.7209 3.3559 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2731 1.7425 2.5044 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7228 3.1329 1.3862 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7972 3.7912 1.9536 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9632 3.4012 1.7100 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6252 4.9435 2.8410 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3260 5.3688 3.1060 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0720 6.4430 3.9280 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1546 7.0816 4.4788 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4580 6.6867 4.2375 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6777 5.5977 3.4024 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1806 1.9828 -2.2622 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3495 2.2894 -3.5784 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4319 1.8994 -4.3766 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5385 3.0445 -4.0987 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7083 -1.0747 -1.8283 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9072 -1.5758 -2.2721 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8900 -0.9404 -1.8454 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1040 -2.7304 -3.1578 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1090 -3.8103 0.7512 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6761 -4.1559 -0.3013 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7017 -4.7967 1.3600 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7421 -0.1973 1.2811 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4712 -1.2420 2.1585 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5760 0.3092 -0.7357 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4430 1.0563 -2.5999 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4864 3.2999 -1.1722 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9485 1.8417 0.4454 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3507 -0.8418 3.3753 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7794 -2.3458 2.1346 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1021 -0.9063 -0.3896 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3891 -3.9947 -4.0143 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3539 -6.0530 -5.1112 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1005 -7.4221 -4.1498 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1451 -6.7133 -2.0179 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4009 -4.6465 -0.9140 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0600 -4.6506 2.1451 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9022 -5.7651 1.3695 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6918 -4.5441 0.3508 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0168 0.6482 0.1817 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0106 -0.9025 -0.0307 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1022 0.4313 0.2848 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1093 1.8911 0.3172 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1031 2.2958 -4.4924 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3101 1.3477 -5.3271 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8148 0.2566 -3.7628 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4311 0.4645 -2.2515 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2030 2.1632 -2.8727 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3696 3.7168 0.6036 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8095 3.9594 -1.0665 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8748 2.9390 0.0049 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7172 1.3912 3.5212 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4107 2.0888 1.8755 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0882 1.8284 2.4626 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6768 -1.6905 2.4897 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7965 -2.6793 3.6800 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2014 -3.3479 2.0864 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5816 -0.1659 4.0603 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6339 0.9708 3.0240 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3949 1.5621 4.0985 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7120 1.6323 3.3736 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4923 4.8456 2.6576 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0549 6.7607 4.1237 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9520 7.9291 5.1273 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2626 7.2153 4.6890 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6753 5.2449 3.1785 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4839 2.6432 -3.6581 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5915 2.8247 -5.1848 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4319 4.1307 -3.9472 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1801 -2.9418 -3.7509 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9197 -2.5081 -3.8891 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4060 -3.6410 -2.6172 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 17 19 1 0 19 20 2 0 20 21 1 0 21 22 2 0 22 23 1 0 23 24 2 0 14 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 13 29 1 0 29 30 1 0 30 31 2 0 30 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 2 0 36 37 1 0 37 38 2 0 38 39 1 0 39 40 2 0 36 41 1 0 41 42 2 0 41 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 45 47 1 0 32 48 1 0 32 49 1 0 49 50 1 0 50 51 2 0 50 52 1 0 12 53 1 0 12 54 1 0 10 55 1 0 55 56 1 0 56 57 2 0 56 58 1 0 58 59 2 0 59 60 1 0 60 61 2 0 61 62 1 0 62 63 2 0 8 64 1 0 64 65 1 0 65 66 2 0 65 67 1 0 7 68 1 0 68 69 1 0 69 70 2 0 69 71 1 0 11 6 1 0 15 6 1 0 45 9 1 0 46 11 1 0 24 19 1 0 40 35 1 0 63 58 1 0 1 72 1 0 1 73 1 0 1 74 1 0 5 75 1 0 5 76 1 0 7 77 1 0 8 78 1 0 9 79 1 0 10 80 1 0 13 81 1 0 14 82 1 0 15 83 1 0 20 84 1 0 21 85 1 0 22 86 1 0 23 87 1 0 24 88 1 0 28 89 1 0 28 90 1 0 28 91 1 0 33 92 1 0 33 93 1 0 34 94 1 0 34 95 1 0 37 96 1 0 38 97 1 0 39 98 1 0 44 99 1 0 44100 1 0 47101 1 0 47102 1 0 47103 1 0 48104 1 0 48105 1 0 48106 1 0 52107 1 0 52108 1 0 52109 1 0 53110 1 0 53111 1 0 53112 1 0 54113 1 0 59114 1 0 60115 1 0 61116 1 0 62117 1 0 63118 1 0 67119 1 0 67120 1 0 67121 1 0 71122 1 0 71123 1 0 71124 1 0 M END

Standard InCHIKey	UASPCJAJXBQHDM-RDZAULFISA-N
Standard InCHI	InChI=1S/C50H53NO20/c1-26(52)62-25-49-40(66-29(4)55)36(64-27(2)53)35-38(67-42(57)31-16-11-9-12-17-31)50(49)48(8,61)39(37(65-28(3)54)41(49)68-43(58)32-18-13-10-14-19-32)69-45(60)46(6,70-30(5)56)22-21-34-33(20-15-23-51-34)44(59)63-24-47(35,7)71-50/h9-20,23,35-41,61H,21-22,24-25H2,1-8H3/t35-,36-,37+,38-,39+,40-,41+,46+,47+,48+,49+,50+/m1/s1
SMILES	CC(=O)OCC12C(C(C3C(C14C(C(C(C2OC(=O)C5=CC=CC=C5)OC(=O)C)OC(=O)C(CCC6=C(C=CC=N6)C(=O)OCC3(O4)C)(C)OC(=O)C)(C)O)OC(=O)C7=CC=CC=C7)OC(=O)C)OC(=O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	987.32	Volume:	952.806 ? Van der Waals volume.
Dense:	1.036	LogP:	1.936 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.181 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.795 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	17.0	Rigid Bonds:	51.0
TPSA:	279.05 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	1.0	Rings:	7.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.226	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.769	Fsp³:	0.48
MCE-18:	246.703 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.4	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.288 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.01	Promiscuous compounds:	0.005

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.207	MDCK Permeability:	-4.543
Pgp-inhibitor:	0.994	Pgp-substrate:	0.684
PAMPA:	0.995 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.001	30% Bioavailability (F30%):	0.409
50% Bioavailability (F50%):	0.913

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	1.0
Plasma Protein Binding (PPB):	77.679%	Volume Distribution (VD):	-0.394
Fu:	21.932% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.631
OATP1B3 inhibitor:	0.963	BCRP inhibitor:	0.0
BSEP inhibitor:	0.993

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.004
CYP3A4-inhibitor:	0.548	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.936 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.173

Half-life (T1/2):

1.646

ADMET: Toxicity

hERG Blockers:	0.015	hERG Blockers (10um):	0.246
Human Hepatotoxicity (H-HT):	0.123	Drug-induced Liver Injury (DILI):	0.986
AMES Toxicity:	0.616	Rat Oral Acute Toxicity:	0.041
Maximum Recommended Daily Dose:	0.281	Skin Sensitization:	0.996
Carcinogencity:	0.645	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.577	Ototoxicity:	0.868
Hematotoxicity:	0.024	Drug-induced Nephrotoxicity:	0.929
Genotoxicity:	0.967	RPMI-8226 Immunitoxicity:	0.122
A549 Cytotoxicity:	0.005	Hek293 Cytotoxicity:	0.295
BCF:	0.733 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.755 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.788 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.264 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO30152	Maytenus mekongensis	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[21634414]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Organism	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT485	Organism	Plasmodium falciparum (isolate K1 / Thailand)	Plasmodium falciparum K1	IC50	=	3500.0	nM	PMID[21634414]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC327904 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	18513
0.1-0.2	29972
0.2-0.3	1058
0.3-0.4	217
0.4-0.5	28
0.5-0.6	29
0.6-0.7	19
0.7-0.8	0
0.8-0.85	2
0.85-0.9	1
0.9-0.95	1
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
0.9688	High Similarity	NPC319880
0.9688	High Similarity	NPC320324
0.9	High Similarity	NPC38959
0.8586	High Similarity	NPC316841
0.8431	Intermediate Similarity	NPC244839
0.83	Intermediate Similarity	NPC328186
0.7788	Intermediate Similarity	NPC475596
0.7736	Intermediate Similarity	NPC600583
0.7596	Intermediate Similarity	NPC122968
0.7596	Intermediate Similarity	NPC228377
0.757	Intermediate Similarity	NPC475406
0.757	Intermediate Similarity	NPC601643
0.7524	Intermediate Similarity	NPC475631
0.7453	Intermediate Similarity	NPC476110
0.7315	Intermediate Similarity	NPC473689
0.7315	Intermediate Similarity	NPC292416
0.7264	Intermediate Similarity	NPC475303
0.7182	Intermediate Similarity	NPC477787
0.7157	Intermediate Similarity	NPC250807
0.7157	Intermediate Similarity	NPC57797
0.7054	Intermediate Similarity	NPC471979
0.7037	Intermediate Similarity	NPC87152
0.6937	Remote Similarity	NPC237702
0.6903	Remote Similarity	NPC327769
0.6887	Remote Similarity	NPC146824
0.6881	Remote Similarity	NPC475600
0.6606	Remote Similarity	NPC53255
0.6606	Remote Similarity	NPC85879
0.6549	Remote Similarity	NPC600607
0.6549	Remote Similarity	NPC611166
0.6491	Remote Similarity	NPC475648
0.646	Remote Similarity	NPC30456
0.646	Remote Similarity	NPC488904
0.6449	Remote Similarity	NPC76565
0.6449	Remote Similarity	NPC601313
0.6372	Remote Similarity	NPC13603
0.6348	Remote Similarity	NPC253482
0.6339	Remote Similarity	NPC475301
0.6311	Remote Similarity	NPC482915
0.6174	Remote Similarity	NPC475644
0.6098	Remote Similarity	NPC483854
0.5966	Remote Similarity	NPC328928
0.5965	Remote Similarity	NPC326930
0.5932	Remote Similarity	NPC600546
0.5877	Remote Similarity	NPC475362
0.5862	Remote Similarity	NPC470486
0.5862	Remote Similarity	NPC477788
0.5847	Remote Similarity	NPC483893
0.5812	Remote Similarity	NPC600224
0.5766	Remote Similarity	NPC473850
0.5726	Remote Similarity	NPC328154
0.5714	Remote Similarity	NPC483894
0.5678	Remote Similarity	NPC604935
0.5593	Remote Similarity	NPC471977
0.5528	Remote Similarity	NPC483853
0.5528	Remote Similarity	NPC608314
0.5487	Remote Similarity	NPC35208
0.544	Remote Similarity	NPC475426
0.5439	Remote Similarity	NPC471016
0.5398	Remote Similarity	NPC470306
0.5345	Remote Similarity	NPC475498
0.5289	Remote Similarity	NPC471190
0.525	Remote Similarity	NPC475533
0.525	Remote Similarity	NPC607403
0.5231	Remote Similarity	NPC483856
0.5172	Remote Similarity	NPC475137
0.5164	Remote Similarity	NPC324619
0.5152	Remote Similarity	NPC483855
0.5082	Remote Similarity	NPC475315
0.5042	Remote Similarity	NPC483892

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC327904 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3715
0.1-0.2	5386
0.2-0.3	48
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data