Drug Information| Drug ID:   | NPD8468 |
| Drug Name:   | Tesetaxel |
| Molecular Formula:   | C46H60FN3O13 |
| Canonical SMILES:   | CN(C[C@@H]1O[C@H]2[C@@H](O1)[C@]1(C)CC[C@@H]3[C@]([C@H]1[C@@H]([C@]1(C(C2=C(C)[C@@H](OC(=O)[C@@H]([C@H](c2ncccc2F)N=C(OC(C)(C)C)O)O)C1)(C)C)O)OC(=O)c1ccccc1)(CO3)OC(=O)C)C |
| Standard InCHI:   | "InChI=1S/C46H60FN3O13/c1-24-28(58-40(54)34(52)33(32-27(47)17-14-20-48-32)49-41(55)63-42(3,4)5)21-46(56)38(61-39(53)26-15-12-11-13-16-26)36-44(8,19-18-29-45(36,23-57-29)62-25(2)51)37-35(31(24)43(46,6)7)59-30(60-37)22-50(9)10/h11-17,20,28-30,33-38,52,56H,18-19,21-23H2,1-10H3,(H,49,55)/t28-,29+,30+,33-,34+,35+,36-,37+,38-,44+,45-,46+/m0/s1" |
| Standard InCHIKey:   | MODVSQKJJIBWPZ-VLLPJHQWSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD8468Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DNCL002591 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 6918574 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 881.41 |
| ALogP   | 1.4687 |
| MLogP   | 4.65 |
| XLogP   | 5.466 |
| HDA   | 16 |
| HBD   | 3 |
| Rotatable Bonds   | 29 |
| TPSA   | 205 |
| RO5 Violation   | 3 |