Natural Product: NPC35410
| Natural Product ID | NPC35410 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| MKUXAQIIEYXACX-UHFFFAOYSA-N |
| IUPAC Name | n.a. |
| Synonyms | |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | n.a. |
| PubChem CID |
2022 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | MKUXAQIIEYXACX-UHFFFAOYSA-N |
| Standard InCHI | InChI=1S/C8H11N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15) |
| SMILES | C(COCn1cnc2c1[nH]c(=N)nc2O)O |
Calculated Properties
Physi-Chem Properties
| Molecular Weight: | 225.09 | Volume: | 200.62 Van der Waals volume.
|
| Dense: | 1.122 | LogP: | -1.73 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4: | -0.887 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS: | -1.434 The logarithm of aqueous solubility value.
|
| Rotatable Bonds: | 4.0 | Rigid Bonds: | 11.0 |
| TPSA: | 120.04 Topological Polar Surface Area.
|
H-Bond Acceptor: | 8.0 |
| H-Bond Donor: | 4.0 | Rings: | 2.0 |
| Heavy Atoms: | 8.0 |
MedChem Properties
| QED Drug-Likeness Score: | 0.493 | GASA: | 0.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score: | 3.353 | Fsp3: | 0.375 |
| MCE-18: | 11.0 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5: | Rejected |
| Pfizer Rule: | Rejected | GSK Rule: | Rejected |
| Golden Triangle Rule: | Rejected | BMS Rule: | 0 |
| Chelating Alert: | 0 | PAINS Alert: | 0 |
| Colloidal aggregators: | 0.145 | Fluc inhibitor: | 0.002 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence: | 0.149 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence: | 0.161 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds: | 0.028 | Promiscuous compounds: | 0.119 |
ADMET Properties (ADMETlab3.0)
ADMET: Absorption
| Caco-2 Permeability: | -6.11 | MDCK Permeability: | -5.234 |
| Pgp-inhibitor: | 0.0 | Pgp-substrate: | 0.675 |
| PAMPA: |
0.833 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA): | 0.95 |
| 20% Bioavailability (F20%): | 0.819 | 30% Bioavailability (F30%): | 0.999 |
| 50% Bioavailability (F50%): | 0.993 |
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.062 | MRP1: | 0.433 |
| Plasma Protein Binding (PPB): | 12.954% | Volume Distribution (VD): | -0.267 |
| Fu: |
93.306% The fraction unbound in plasms.
|
OATP1B1 inhibitor: | 0.094 |
| OATP1B3 inhibitor: | 0.294 | BCRP inhibitor: | 0.179 |
| BSEP inhibitor: | 0.028 |
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.009 | CYP1A2-substrate: | 0.0 |
| CYP2C19-inhibitor: | 0.0 | CYP2C19-substrate: | 0.0 |
| CYP2C9-inhibitor: | 0.021 | CYP2C9-substrate: | 0.0 |
| CYP2D6-inhibitor: | 0.039 | CYP2D6-substrate: | 0.0 |
| CYP3A4-inhibitor: | 0.003 | CYP3A4-substrate: | 0.0 |
| CYP2B6-substrate: | 0.0 | CYP2C8-inhibitor: | 0.0 |
| HLM stability: |
0.187 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
ADMET: Excretion
| Clearance (CL): | 5.396 | Half-life (T1/2): | 1.581 |
ADMET: Toxicity
| hERG Blockers: | 0.181 | hERG Blockers (10um): | 0.437 |
| Human Hepatotoxicity (H-HT): | 0.98 | Drug-induced Liver Injury (DILI): | 0.556 |
| AMES Toxicity: | 0.684 | Rat Oral Acute Toxicity: | 0.364 |
| Maximum Recommended Daily Dose: | 0.07 | Skin Sensitization: | 0.991 |
| Carcinogencity: | 0.97 | Eye Corrosion: | 0.0 |
| Eye Irritation: | 0.526 | Respiratory Toxicity: | 0.964 |
| Drug-induced Neurotoxicity: | 0.8 | Ototoxicity: | 0.686 |
| Hematotoxicity: | 0.481 | Drug-induced Nephrotoxicity: | 0.922 |
| Genotoxicity: | 0.996 | RPMI-8226 Immunitoxicity: | 0.032 |
| A549 Cytotoxicity: | 0.059 | Hek293 Cytotoxicity: | 0.679 |
| BCF: |
0.066 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50: |
1.927 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM: |
3.443 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM: |
2.369 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
Species Source
| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO1436 | Houttuynia cordata | Species | Saururaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.5897/AJB11.1524] |
| NPO15768 | Lyonia ovalifolia | Species | Ericaceae | Eukaryota | Twigs; Leaves | n.a. | n.a. |
PMID[27792321] |
| NPO24074 | Jatropha dioica | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28771358] |
| NPO1436 | Houttuynia cordata | Species | Saururaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[29099182] |
| NPO9925 | Rhododendron latoucheae | Species | Ericaceae | Eukaryota | Twigs; Leaves | n.a. | n.a. |
PMID[30106288] |
| NPO40504 | Epicoccum nigrum HDN17-88 | Strain | Didymellaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31975590] |
| NPO1436 | Houttuynia cordata | Species | Saururaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32456033] |
| NPO40504 | Epicoccum nigrum HDN17-88 | Strain | Didymellaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO15768 | Lyonia ovalifolia | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO24074 | Jatropha dioica | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO1436 | Houttuynia cordata | Species | Saururaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO9925 | Rhododendron latoucheae | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO15768 | Lyonia ovalifolia | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO1436 | Houttuynia cordata | Species | Saururaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO15768 | Lyonia ovalifolia | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO1436 | Houttuynia cordata | Species | Saururaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO15768 | Lyonia ovalifolia | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO1436 | Houttuynia cordata | Species | Saururaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO1436 | Houttuynia cordata | Species | Saururaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO24074 | Jatropha dioica | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO15768 | Lyonia ovalifolia | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9925 | Rhododendron latoucheae | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
NP Quantity Composition/Concentration
| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
Molecular-level activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT1755 | Individual protein | Thymidine kinase, cytosolic | Homo sapiens | Activity | = | 23.0 | % | PMID[3016263] |
| NPT1755 | Individual protein | Thymidine kinase, cytosolic | Homo sapiens | Inhibition | = | 69.0 | % | PMID[2991522] |
| NPT1291 | Individual protein | Purine nucleoside phosphorylase | Homo sapiens | Ki | = | 180000.0 | nM | PMID[8478902] |
| NPT2215 | Individual protein | DNA polymerase alpha subunit | Homo sapiens | Inhibition | = | 37.0 | % | PMID[3009816] |
| NPT1763 | Individual protein | Thymidine kinase | Macacine herpesvirus 1 | IC50 | = | 1000000.0 | nM | PMID[17438061] |
| NPT1463 | Individual protein | Cytochrome P450 2J2 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[23033255] |
| NPT2773 | Individual protein | Solute carrier family 22 member 7 | Homo sapiens | FC | = | 10.0 | n.a. | PMID[22190696] |
| NPT1249 | Individual protein | Canalicular multispecific organic anion transporter 2 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT1028 | Individual protein | Multidrug resistance-associated protein 4 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT1291 | Individual protein | Purine nucleoside phosphorylase | Homo sapiens | Ki | = | 91000.0 | nM | PMID[30627387] |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | FC | = | 1.0 | n.a. | PMID[27397500] |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | FC | = | 1.0 | n.a. | PMID[27397500] |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | FC | = | 1.0 | n.a. | PMID[27397500] |
| NPT2769 | Individual protein | Thromboxane A2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1464 | Individual protein | Phosphodiesterase 4D | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT2761 | Individual protein | Phosphodiesterase 4A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT267 | Individual protein | Neuropeptide Y receptor type 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2879 | Individual protein | Equilibrative nucleoside transporter 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT2856 | Individual protein | Sodium channel protein type V alpha subunit | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1788 | Individual protein | Alpha-1a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT239 | Individual protein | Cholecystokinin A receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1785 | Individual protein | Serotonin 7 (5-HT7) receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT2719 | Individual protein | Voltage-gated L-type calcium channel alpha-1C subunit | Rattus norvegicus | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT217 | Individual protein | Adenosine A2a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT272 | Individual protein | Kappa opioid receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1647 | Individual protein | Vasopressin V2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT230 | Individual protein | Bradykinin B2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT245 | Individual protein | Dopamine D4 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT243 | Individual protein | Dopamine D2 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT259 | Individual protein | Melanocortin receptor 4 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT294 | Individual protein | Serotonin 6 (5-HT6) receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT1478 | Individual protein | Vascular endothelial growth factor receptor 2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1407 | Individual protein | GABA-B receptor 1 | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1410 | Individual protein | GABA receptor alpha-1 subunit | Rattus norvegicus | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT252 | Individual protein | Histamine H2 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT247 | Individual protein | Endothelin receptor ET-A | Homo sapiens | AC50 | = | 8940.1 | nM | PMID[37468498] |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | AC50 | = | 3371.9 | nM | PMID[37468498] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1814 | Individual protein | Glucagon receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT1410 | Individual protein | GABA receptor alpha-1 subunit | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT227 | Individual protein | Beta-3 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT248 | Individual protein | Estrogen receptor beta | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT216 | Individual protein | Adenosine A1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT271 | Individual protein | Delta opioid receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT1788 | Individual protein | Alpha-1a adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT266 | Individual protein | Muscarinic acetylcholine receptor M5 | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT1163 | Individual protein | Glutamate (NMDA) receptor subunit zeta 1 | Rattus norvegicus | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT303 | Individual protein | Vasopressin V1a receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT297 | Individual protein | Neurokinin 1 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT251 | Individual protein | Histamine H1 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT19368 | Single protein | Thymidine kinase | Human herpesvirus 2 | IC50 | = | 200000.0 | nM | PMID[17438061] |
| NPT613 | Individual protein | Solute carrier family 22 member 1 | Homo sapiens | Inhibition | = | -3.9 | % | PMID[18788725] |
| NPT669 | Individual protein | Solute carrier family 22 member 8 | Homo sapiens | Activity | = | 64.3 | % | PMID[11861798] |
| NPT613 | Individual protein | Solute carrier family 22 member 1 | Homo sapiens | Activity | = | 88.4 | % | PMID[11861798] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | -2.0 | % | PMID[22541068] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | 105.48 | % | PMID[23571415] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | > | 1000000.0 | nM | PMID[21965623] |
| NPT669 | Individual protein | Solute carrier family 22 member 8 | Homo sapiens | FC | = | 1.7 | n.a. | PMID[22190696] |
| NPT669 | Individual protein | Solute carrier family 22 member 8 | Homo sapiens | Ratio | = | 1.0 | uL/min | PMID[22190696] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | > | 135000.0 | nM | PMID[20829430] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | > | 1000000.0 | nM | PMID[22961681] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT987 | Individual protein | Histamine H3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5318 | Individual protein | Corticotropin releasing factor receptor 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5301 | Individual protein | Motilin receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT30134 | Single protein | Gastric inhibitory polypeptide receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT317 | Nucleic acid | Nucleic Acid | n.a. | EC50 | = | 6750.0 | nM | PMID[12408726] |
| NPT665 | Individual protein | Solute carrier family 22 member 6 | Homo sapiens | Activity | = | 67.0 | % | PMID[11861798] |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Inhibition | = | 2.3 | % | PMID[22541068] |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Inhibition | = | 103.39 | % | PMID[23571415] |
| NPT665 | Individual protein | Solute carrier family 22 member 6 | Homo sapiens | FC | = | 1.7 | n.a. | PMID[22190696] |
| NPT6179 | Individual protein | POU domain, class 2, transcription factor 2 | Homo sapiens | Ratio | = | 6.0 | uL/min | PMID[22190696] |
| NPT665 | Individual protein | Solute carrier family 22 member 6 | Homo sapiens | Ratio | = | 0.5 | uL/min | PMID[22190696] |
| NPT612 | Individual protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 6.729 | % | DOI[10.6019/CHEMBL4495564] |
| NPT3735 | Individual protein | Neurotensin receptor 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT29430 | Single protein | Neuronal acetylcholine receptor protein alpha-4 subunit | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -1.46 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT4358 | Individual protein | Type-1 angiotensin II receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -24.99 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT98 | Individual protein | HERG | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT3952 | Individual protein | Endothelin receptor ET-B | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT4729 | Individual protein | Cholecystokinin B receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT4230 | Individual protein | Human herpesvirus 1 DNA polymerase | Herpes simplex virus (type 1 / strain 17) | Inhibition | = | 79.0 | % | PMID[2848125] |
| NPT667 | Individual protein | Solute carrier family 22 member 8 | Rattus norvegicus | Activity | = | 7.66 | % | PMID[12358729] |
| NPT622 | Individual protein | Solute carrier organic anion transporter family member 2B1 | Homo sapiens | Inhibition | = | -15.2 | % | PMID[22541068] |
| NPT712 | Individual protein | Bile salt export pump | Rattus norvegicus | IC50 | > | 1000000.0 | nM | PMID[21965623] |
| NPT92 | Individual protein | Serotonin 1a (5-HT1a) receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT92 | Individual protein | Serotonin 1a (5-HT1a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT29454 | Single protein | Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 | Homo sapiens | Inhibition | = | -10.19 | % | PMID[38318365] |
| NPT28448 | Single protein | Corticotropin releasing factor receptor 2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5104 | Individual protein | Phosphodiesterase 3A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT28814 | Single protein | Ghrelin receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5975 | Individual protein | Cyclooxygenase-1 | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT6127 | Individual protein | Bradykinin B1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT20859 | Single protein | Neuropeptide Y receptor type 2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT28787 | Single protein | Voltage-gated N-type calcium channel alpha-1B subunit | Rattus norvegicus | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT3788 | Individual protein | Thymidine kinase | Human herpesvirus 1 | IC50 | = | 122000.0 | nM | PMID[17438061] |
| NPT4896 | Individual protein | Purine nucleoside phosphorylase | Mycobacterium tuberculosis | Kd | = | 12589.25 | nM | PMID[20570524] |
| NPT425 | Individual protein | Serotonin 3a (5-HT3a) receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT670 | Individual protein | Thrombin | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30151 | Single protein | Melanocortin receptor 3 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
In vitro activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 24.0 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00149-2] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 26.0 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00149-2] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 0.077 | ug.mL-1 | PMID[11472207] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | > | 400.0 | ug.mL-1 | PMID[11472207] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 48.0 | ug.mL-1 | PMID[11472207] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 0.384 | ug.mL-1 | PMID[11472207] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | EC50 | = | 40.0 | ug.mL-1 | PMID[11677126] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | EC50 | = | 0.5 | ug.mL-1 | PMID[11677126] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 0.07 | ug.mL-1 | PMID[1315394] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 0.04 | ug.mL-1 | PMID[1315394] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 0.02 | ug.mL-1 | PMID[1315394] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 70.0 | ug.mL-1 | PMID[1315394] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 10.0 | ug.mL-1 | PMID[1315394] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 0.015 | ug.mL-1 | PMID[1315394] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 50.0 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00365-X] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | > | 50.0 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00365-X] |
| NPT1353 | Cell line | CCRF-HSB-2 | Homo sapiens | IC50 | > | 100.0 | ug.mL-1 | PMID[9216836] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 350.0 | ug.mL-1 | PMID[7932543] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | > | 200.0 | ug.mL-1 | PMID[7932543] |
| NPT80 | Cell line | Raji | Homo sapiens | ED50 | = | 3.8 | ug ml-1 | PMID[2329551] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | = | 4.0 | ug.mL-1 | PMID[8176708] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | = | 80.0 | ug.mL-1 | PMID[8176708] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | = | 50.0 | ug.mL-1 | PMID[8176708] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | = | 35.0 | ug.mL-1 | PMID[8176708] |
| NPT5206 | Cell line | ESM | n.a. | MIC | > | 400.0 | ug.mL-1 | PMID[8176708] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | > | 200.0 | ug.mL-1 | PMID[8176708] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | > | 200000.0 | nM | PMID[10579812] |
| NPT859 | Cell line | HFF | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[2840500] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | > | 200.0 | ug.mL-1 | PMID[8393114] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ED50 | = | 0.5 | uM | PMID[8289203] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CD50 | > | 50.0 | uM | PMID[8289203] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 0.04 | ug.mL-1 | PMID[9135038] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 0.07 | ug.mL-1 | PMID[9135038] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | > | 200.0 | ug.mL-1 | PMID[9135038] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 70.0 | ug.mL-1 | PMID[9135038] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 400.0 | ug.mL-1 | PMID[9135038] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | = | 0.1 | ug.mL-1 | PMID[9135038] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | = | 5.0 | ug.mL-1 | PMID[9135038] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | > | 200.0 | ug.mL-1 | PMID[9135038] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 3800.0 | nM | PMID[3040998] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 2500.0 | nM | PMID[3040998] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC90 | = | 4800.0 | nM | PMID[3040998] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC90 | = | 700.0 | nM | PMID[3040998] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC90 | = | 1400.0 | nM | PMID[3040998] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC90 | = | 900.0 | nM | PMID[3040998] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC90 | = | 1200.0 | nM | PMID[3040998] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC90 | = | 300.0 | nM | PMID[3040998] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 1900.0 | nM | PMID[7752206] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | > | 200000.0 | nM | PMID[7752206] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | MIC50 | = | 4.3 | ug.mL-1 | PMID[3033247] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | MIC | = | 1.3 | ug.mL-1 | PMID[7629793] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | > | 50000.0 | nM | PMID[10999490] |
| NPT859 | Cell line | HFF | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[2163453] |
| NPT859 | Cell line | HFF | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[2175356] |
| NPT137 | Cell line | L1210 | Mus musculus | MIC | = | 55.0 | ug.mL-1 | PMID[2455050] |
| NPT1759 | Cell line | FM3A | Mus musculus | MIC | = | 66.0 | ug.mL-1 | PMID[2455050] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ED50 | = | 0.04 | uM | PMID[1548681] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ED50 | > | 1300.0 | uM | PMID[1548681] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | EC50 | = | 0.32 | ug.mL-1 | DOI[10.1016/0960-894X(95)00395-A] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | EC50 | = | 0.39 | ug.mL-1 | DOI[10.1016/0960-894X(95)00395-A] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | EC50 | = | 6000.0 | nM | DOI[10.1016/0960-894X(95)00208-B] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | EC50 | = | 3000.0 | nM | DOI[10.1016/0960-894X(95)00208-B] |
| NPT171 | Cell line | MRC5 | Homo sapiens | EC50 | = | 18000.0 | nM | DOI[10.1016/0960-894X(95)00208-B] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 100.0 | nM | PMID[2991522] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | > | 150000.0 | nM | PMID[11495586] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 4530.0 | nM | PMID[11495586] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 4090.0 | nM | PMID[11495586] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 41000.0 | nM | PMID[11495586] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 63000.0 | nM | PMID[11495586] |
| NPT5206 | Cell line | ESM | n.a. | MIC | = | 0.02 | ug.mL-1 | PMID[1652016] |
| NPT5206 | Cell line | ESM | n.a. | MIC | = | 0.007 | ug.mL-1 | PMID[1652016] |
| NPT5206 | Cell line | ESM | n.a. | MIC | = | 0.01 | ug.mL-1 | PMID[1652016] |
| NPT5206 | Cell line | ESM | n.a. | MIC | = | 0.07 | ug.mL-1 | PMID[1652016] |
| NPT5206 | Cell line | ESM | n.a. | MIC | > | 200.0 | ug.mL-1 | PMID[1652016] |
| NPT5206 | Cell line | ESM | n.a. | MIC | = | 100.0 | ug.mL-1 | PMID[1652016] |
| NPT5206 | Cell line | ESM | n.a. | MIC | = | 40.0 | ug.mL-1 | PMID[1652016] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | = | 0.3 | ug.mL-1 | PMID[1652016] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | = | 0.2 | ug.mL-1 | PMID[1652016] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | = | 10.0 | ug.mL-1 | PMID[1652016] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | = | 5.0 | ug.mL-1 | PMID[1652016] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | = | 15.0 | ug.mL-1 | PMID[1652016] |
| NPT5206 | Cell line | ESM | n.a. | MIC | = | 400.0 | ug.mL-1 | PMID[1652016] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | = | 200.0 | ug.mL-1 | PMID[1652016] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 1200.0 | nM | PMID[1323678] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | > | 440000.0 | nM | PMID[11814776] |
| NPT6172 | Cell line | Human neoplasticcell line | n.a. | IC50 | > | 100000.0 | nM | PMID[2163454] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 0.1 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80693-4] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 0.5 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80693-4] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 0.08 | ug.mL-1 | PMID[11858989] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 48.0 | ug.mL-1 | PMID[11858989] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | = | 1.1 | ug.mL-1 | PMID[11858989] |
| NPT165 | Cell line | HeLa | Homo sapiens | MIC | = | 12.3 | ug.mL-1 | PMID[11858989] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | > | 400.0 | ug.mL-1 | PMID[11858989] |
| NPT859 | Cell line | HFF | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[2846837] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 7540.0 | nM | PMID[9685239] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 37800.0 | nM | PMID[9685239] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | > | 88800.0 | nM | PMID[9685239] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 138400.0 | nM | PMID[9685239] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 111000.0 | nM | PMID[9685239] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 130700.0 | nM | PMID[9685239] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 189800.0 | nM | PMID[9685239] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 444000.0 | nM | PMID[9685239] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 378800.0 | nM | PMID[9685239] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 6660.0 | nM | PMID[9685239] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | > | 44400.0 | nM | PMID[9685239] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 62800.0 | nM | PMID[9685239] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 1500.0 | nM | PMID[11549457] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 1100.0 | nM | PMID[11549457] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 40000.0 | nM | PMID[11549457] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 44000.0 | nM | PMID[11549457] |
| NPT171 | Cell line | MRC5 | Homo sapiens | EC50 | = | 50000.0 | nM | PMID[10762044] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | EC50 | = | 3000.0 | nM | PMID[10762044] |
| NPT171 | Cell line | MRC5 | Homo sapiens | EC50 | = | 5000.0 | nM | PMID[10762044] |
| NPT859 | Cell line | HFF | Homo sapiens | EC50 | = | 1100.0 | nM | PMID[14584954] |
| NPT859 | Cell line | HFF | Homo sapiens | EC50 | = | 1680.0 | nM | PMID[14584954] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | = | 0.001 | ug.mL-1 | PMID[1319491] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | = | 0.0007 | ug.mL-1 | PMID[1319491] |
| NPT2192 | Cell line | HEL | Homo sapiens | MIC | > | 10.0 | ug.mL-1 | PMID[1319491] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 0.1 | ug.mL-1 | PMID[7473592] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 0.23 | ug.mL-1 | PMID[7473592] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 20.0 | ug.mL-1 | PMID[7473592] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 250.0 | ug.mL-1 | PMID[7473592] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 110.0 | nM | PMID[11356110] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 190.0 | nM | PMID[11356110] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 8710.0 | nM | PMID[11356110] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 26430.0 | nM | PMID[11356110] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 253640.0 | nM | PMID[11356110] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 0.04 | ug.mL-1 | PMID[7877148] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 0.15 | ug.mL-1 | PMID[7877148] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 3.0 | ug.mL-1 | PMID[7877148] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 5.0 | ug.mL-1 | PMID[7877148] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 20.0 | ug.mL-1 | PMID[7877148] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 15.0 | ug.mL-1 | PMID[7877148] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 1.5 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80236-5] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 3.4 | ug.mL-1 | PMID[10649983] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC50 | = | 0.29 | ug.mL-1 | PMID[10649983] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC50 | = | 0.25 | ug.mL-1 | PMID[10649983] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC50 | = | 1.3 | ug.mL-1 | PMID[10649983] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 5.4 | ug.mL-1 | PMID[10649983] |
| NPT2846 | Cell line | BHK-21 | Cricetulus griseus | EC50 | = | 2000.0 | nM | PMID[8863795] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 0.81 | ug.mL-1 | PMID[9548818] |
| NPT859 | Cell line | HFF | Homo sapiens | IC50 | = | 2.7 | ug.mL-1 | PMID[9548818] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | MIC | = | 1.3 | ug.mL-1 | PMID[8388470] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | MIC | = | 0.29 | ug.mL-1 | PMID[8388470] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | MIC | = | 0.14 | ug.mL-1 | PMID[8388470] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | MIC | = | 43.0 | ug.mL-1 | PMID[8388470] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | MIC | = | 7.8 | ug.mL-1 | PMID[8388470] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | MIC | = | 11.0 | ug.mL-1 | PMID[8388470] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | MIC | = | 77.0 | ug.mL-1 | PMID[8388470] |
| NPT859 | Cell line | HFF | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[8784444] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[8784444] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 6700.0 | nM | PMID[2153202] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC50 | = | 2500.0 | nM | PMID[2153202] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC50 | = | 20000.0 | nM | PMID[2153202] |
| NPT80 | Cell line | Raji | Homo sapiens | EC50 | = | 2900.0 | nM | PMID[8394933] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[8071942] |
| NPT171 | Cell line | MRC5 | Homo sapiens | MIC50 | = | 1300.0 | nM | PMID[1654428] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | MIC50 | = | 1800.0 | nM | PMID[1654428] |
| NPT171 | Cell line | MRC5 | Homo sapiens | MIC50 | = | 14500.0 | nM | PMID[1654428] |
| NPT171 | Cell line | MRC5 | Homo sapiens | MIC50 | = | 100000.0 | nM | PMID[1654428] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[1310744] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 0.075 | ug.mL-1 | PMID[9784109] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 0.38 | ug.mL-1 | PMID[9784109] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 1.92 | ug.mL-1 | PMID[9784109] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | = | 0.1 | ug.mL-1 | PMID[9784109] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | EC50 | = | 6000.0 | nM | PMID[10987418] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 780.0 | nM | PMID[10411487] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 160.0 | nM | PMID[10411487] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 17000.0 | nM | PMID[10411487] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 12000.0 | nM | PMID[10411487] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[10411487] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[10411487] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 0.1 | ug.mL-1 | PMID[8246242] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 4.0 | ug.mL-1 | PMID[8246242] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 5.0 | ug.mL-1 | PMID[8246242] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 26.0 | ug.mL-1 | PMID[8246242] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 22.0 | ug.mL-1 | PMID[8246242] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | > | 200.0 | ug.mL-1 | PMID[8246242] |
| NPT25 | Cell line | MT4 | Homo sapiens | IC50 | > | 100.0 | ug.mL-1 | PMID[8246242] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | > | 200000.0 | nM | PMID[14643328] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 320.0 | nM | PMID[14643328] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 1300.0 | nM | PMID[14643328] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 88000.0 | nM | PMID[14643328] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 0.23 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80538-2] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 0.32 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80538-2] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 22.0 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80538-2] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 9.0 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80538-2] |
| NPT171 | Cell line | MRC5 | Homo sapiens | CD50 | = | 355.0 | uM | PMID[8496903] |
| NPT4951 | Cell line | E6SM | Homo sapiens | EC50 | = | 0.07 | ug.mL-1 | PMID[15481985] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | > | 200000.0 | nM | PMID[15481985] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | > | 400000.0 | nM | PMID[15481985] |
| NPT4951 | Cell line | E6SM | Homo sapiens | EC50 | = | 48.0 | ug.mL-1 | PMID[15481985] |
| NPT4951 | Cell line | E6SM | Homo sapiens | EC50 | = | 0.38 | ug.mL-1 | PMID[15481985] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 1300.0 | nM | PMID[15481985] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 900.0 | nM | PMID[15481985] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 24000.0 | nM | PMID[15481985] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 27000.0 | nM | PMID[15481985] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 17000.0 | nM | PMID[15801851] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 20000.0 | nM | PMID[15801851] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 7100.0 | nM | PMID[15801851] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 111000.0 | nM | PMID[15801851] |
| NPT859 | Cell line | HFF | Homo sapiens | IC50 | > | 20000.0 | nM | PMID[16134946] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | > | 10000.0 | nM | PMID[16134946] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 5400.0 | nM | PMID[16134946] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 2400.0 | nM | PMID[16134946] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 2800.0 | nM | PMID[16134946] |
| NPT859 | Cell line | HFF | Homo sapiens | IC50 | = | 8100.0 | nM | PMID[16134946] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 2100.0 | nM | PMID[16134946] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 3500.0 | nM | PMID[16134946] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 4400.0 | nM | PMID[16134946] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | > | 500000.0 | nM | PMID[17286431] |
| NPT2192 | Cell line | HEL | Homo sapiens | Activity | > | 100.0 | ug ml-1 | PMID[17298047] |
| NPT2192 | Cell line | HEL | Homo sapiens | Activity | = | 173.5 | ug ml-1 | PMID[17298047] |
| NPT4951 | Cell line | E6SM | Homo sapiens | MIC | > | 500000.0 | nM | PMID[17092728] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | = | 0.03 | ug.mL-1 | PMID[17948980] |
| NPT2192 | Cell line | HEL | Homo sapiens | EC50 | >= | 25.2 | ug.mL-1 | PMID[17948980] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC100 | > | 600.0 | ug ml-1 | PMID[11678658] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | > | 100.0 | ug.mL-1 | PMID[9214738] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC100 | > | 600.0 | ug ml-1 | PMID[11858754] |
| NPT165 | Cell line | HeLa | Homo sapiens | CC100 | > | 600.0 | ug ml-1 | PMID[19217699] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[19645484] |
| NPT25 | Cell line | MT4 | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[19645484] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC100 | > | 600.0 | ug ml-1 | PMID[19892441] |
| NPT859 | Cell line | HFF | Homo sapiens | IC50 | > | 444000.0 | nM | PMID[19770274] |
| NPT1306 | Cell line | WISH | Homo sapiens | Activity | = | 3414.0 | umol/L | PMID[25515560] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | > | 1700000.0 | nM | PMID[26638041] |
| NPT2192 | Cell line | HEL | Homo sapiens | MCC | > | 444030.0 | nM | PMID[35754374] |
| NPT81 | Cell line | A549 | Homo sapiens | CC20 | = | 196.08 | uM | PMID[34425312] |
| NPT2192 | Cell line | HEL | Homo sapiens | MCC | > | 250000.0 | nM | PMID[35933787] |
| NPT165 | Cell line | HeLa | Homo sapiens | CC50 | = | 200.0 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00149-2] |
| NPT4951 | Cell line | E6SM | Homo sapiens | CC50 | > | 400.0 | ug.mL-1 | PMID[8709116] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | = | 1100.0 | uM | PMID[2993615] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 400000.0 | nM | PMID[14584951] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 100.0 | ug.mL-1 | PMID[11677126] |
| NPT80 | Cell line | Raji | Homo sapiens | ID50 | > | 100.0 | ug ml-1 | PMID[2329551] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | = | 100.0 | ug ml-1 | PMID[2157012] |
| NPT165 | Cell line | HeLa | Homo sapiens | CC50 | > | 400000.0 | nM | PMID[15109620] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | = | 0.5 | uM | PMID[3016263] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | ID50 | > | 100.0 | n.a. | PMID[10891113] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | ID50 | > | 200.0 | n.a. | PMID[10891113] |
| NPT1374 | Cell line | WI-38 | Homo sapiens | ID50 | = | 4.0 | uM | PMID[1316966] |
| NPT1374 | Cell line | WI-38 | Homo sapiens | ID50 | = | 2.0 | uM | PMID[1316966] |
| NPT1374 | Cell line | WI-38 | Homo sapiens | ID50 | = | 220.0 | uM | PMID[1316966] |
| NPT1374 | Cell line | WI-38 | Homo sapiens | ID50 | = | 110.0 | uM | PMID[1316966] |
| NPT1374 | Cell line | WI-38 | Homo sapiens | ID50 | = | 0.2 | uM | PMID[1316966] |
| NPT1374 | Cell line | WI-38 | Homo sapiens | ID50 | = | 0.8 | uM | PMID[1316966] |
| NPT1374 | Cell line | WI-38 | Homo sapiens | ID50 | = | 40.0 | uM | PMID[1316966] |
| NPT1374 | Cell line | WI-38 | Homo sapiens | ID50 | > | 750.0 | uM | PMID[1316966] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | = | 0.9 | ug ml-1 | PMID[2157013] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | > | 300.0 | ug ml-1 | PMID[1848298] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 200000.0 | nM | PMID[10866384] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 100000.0 | nM | DOI[10.1016/0960-894X(95)00208-B] |
| NPT171 | Cell line | MRC5 | Homo sapiens | CC50 | >= | 100000.0 | nM | DOI[10.1016/0960-894X(95)00208-B] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | = | 0.2 | ug ml-1 | DOI[10.1016/S0960-894X(01)80719-8] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | = | 0.6 | ug ml-1 | DOI[10.1016/S0960-894X(01)80719-8] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | > | 300.0 | ug ml-1 | DOI[10.1016/S0960-894X(01)80719-8] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 200.0 | ug.mL-1 | PMID[10197958] |
| NPT137 | Cell line | L1210 | Mus musculus | ID50 | = | 13.0 | ug ml-1 | PMID[6092636] |
| NPT137 | Cell line | L1210 | Mus musculus | ID50 | = | 367.0 | ug ml-1 | PMID[6092636] |
| NPT137 | Cell line | L1210 | Mus musculus | ID50 | = | 50.0 | ug ml-1 | PMID[6092636] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 200000.0 | nM | PMID[11212118] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 10.0 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80693-4] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | = | 0.01 | ug ml-1 | PMID[2299637] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | = | 0.5 | ug ml-1 | PMID[1648622] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | = | 2.4 | ug ml-1 | PMID[1648622] |
| NPT171 | Cell line | MRC5 | Homo sapiens | ID50 | = | 38.4 | ug ml-1 | PMID[1648622] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | > | 100.0 | ug ml-1 | PMID[1648622] |
| NPT25 | Cell line | MT4 | Homo sapiens | CC50 | > | 76.6 | ug.mL-1 | PMID[12161143] |
| NPT25 | Cell line | MT4 | Homo sapiens | CC50 | > | 11.4 | ug.mL-1 | PMID[12161143] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 400000.0 | nM | PMID[11549457] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 5000.0 | nM | PMID[10762044] |
| NPT137 | Cell line | L1210 | Mus musculus | ID50 | = | 41.0 | ug ml-1 | PMID[2391680] |
| NPT1759 | Cell line | FM3A | Mus musculus | ID50 | = | 17.0 | ug ml-1 | PMID[2391680] |
| NPT1759 | Cell line | FM3A | Mus musculus | ID50 | = | 0.62 | ug ml-1 | PMID[2391680] |
| NPT1759 | Cell line | FM3A | Mus musculus | ID50 | = | 0.0009 | ug ml-1 | PMID[2391680] |
| NPT80 | Cell line | Raji | Homo sapiens | ID50 | > | 100.0 | ug ml-1 | PMID[2391680] |
| NPT5528 | Cell line | MOLT-4F | Homo sapiens | ID50 | > | 100.0 | ug ml-1 | PMID[2391680] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | = | 0.01 | ug ml-1 | PMID[2709380] |
| NPT1374 | Cell line | WI-38 | Homo sapiens | ID50 | > | 800.0 | uM | PMID[8387600] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 200.0 | ug.mL-1 | PMID[7877148] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | = | 820.0 | ug.mL-1 | PMID[10649983] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | = | 820.0 | ug.mL-1 | PMID[9548818] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | > | 500.0 | n.a. | PMID[1654428] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | CC50 | > | 200000.0 | nM | PMID[14643328] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 1700000.0 | nM | PMID[14643328] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 50.0 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80538-2] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 200.0 | ug.mL-1 | PMID[12217359] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | = | 0.5 | uM | PMID[3871860] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 400000.0 | nM | PMID[10966745] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 200.0 | ug.mL-1 | PMID[15658861] |
| NPT165 | Cell line | HeLa | Homo sapiens | CC50 | > | 400000.0 | nM | PMID[15993062] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 511000.0 | nM | PMID[15801851] |
| NPT859 | Cell line | HFF | Homo sapiens | CC50 | > | 444000.0 | nM | PMID[15634003] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 200000.0 | nM | PMID[15634003] |
| NPT464 | Cell line | Daudi | Homo sapiens | CC50 | > | 222000.0 | nM | PMID[15634003] |
| NPT859 | Cell line | HFF | Homo sapiens | CC50 | > | 100000.0 | nM | PMID[16134946] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 100000.0 | nM | PMID[16134946] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 889000.0 | nM | PMID[16392824] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 118.0 | ug.mL-1 | PMID[16480257] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | = | 960000.0 | nM | PMID[16321530] |
| NPT91 | Cell line | KB | Homo sapiens | CC50 | > | 100000.0 | nM | PMID[17004726] |
| NPT464 | Cell line | Daudi | Homo sapiens | CC50 | > | 100000.0 | nM | PMID[17004726] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 500000.0 | nM | PMID[17181162] |
| NPT859 | Cell line | HFF | Homo sapiens | CC50 | > | 444000.0 | nM | PMID[15615545] |
| NPT464 | Cell line | Daudi | Homo sapiens | CC50 | > | 222000.0 | nM | PMID[15615545] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 200000.0 | nM | PMID[17368024] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 649000.0 | nM | PMID[17539622] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 890000.0 | nM | PMID[17622128] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 545000.0 | nM | PMID[17672445] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 212.0 | ug.mL-1 | PMID[17948980] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 200000.0 | nM | PMID[18052321] |
| NPT859 | Cell line | HFF | Homo sapiens | CC50 | > | 100000.0 | nM | PMID[17434304] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 200.0 | ug.mL-1 | PMID[17869124] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | = | 126000.0 | nM | PMID[17937990] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 200000.0 | nM | PMID[18086523] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 100000.0 | nM | PMID[17981031] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 890000.0 | nM | PMID[17438061] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | = | 122000.0 | ug.mL-1 | PMID[11678658] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 200.0 | ug.mL-1 | PMID[17583388] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 137.0 | ug.mL-1 | PMID[18835175] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 10.0 | ug.mL-1 | PMID[12444692] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 500.0 | ug.mL-1 | PMID[16724853] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 1350000.0 | nM | PMID[18614365] |
| NPT859 | Cell line | HFF | Homo sapiens | CC50 | > | 100000.0 | nM | PMID[18595689] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 733000.0 | nM | PMID[19226140] |
| NPT859 | Cell line | HFF | Homo sapiens | CC50 | > | 300000.0 | nM | PMID[19410465] |
| NPT25 | Cell line | MT4 | Homo sapiens | CC50 | > | 250000.0 | nM | PMID[19645484] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 782000.0 | nM | PMID[19339082] |
| NPT25 | Cell line | MT4 | Homo sapiens | CC50 | > | 100000.0 | nM | PMID[19482481] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 100000.0 | nM | PMID[19482481] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 200000.0 | nM | PMID[19700316] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 1778000.0 | nM | PMID[20064723] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 100000.0 | nM | PMID[20359898] |
| NPT25 | Cell line | MT4 | Homo sapiens | CC50 | > | 100000.0 | nM | PMID[20359898] |
| NPT859 | Cell line | HFF | Homo sapiens | CC50 | > | 100000.0 | nM | PMID[20403696] |
| NPT859 | Cell line | HFF | Homo sapiens | CC50 | > | 444000.0 | nM | PMID[19770274] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 130000.0 | nM | PMID[21232828] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | = | 860000.0 | nM | PMID[21376603] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 200000.0 | nM | PMID[21334891] |
| NPT2454 | Cell line | RD | Homo sapiens | CC50 | > | 25000.0 | nM | PMID[21356589] |
| NPT859 | Cell line | HFF | Homo sapiens | CC50 | > | 100000.0 | nM | PMID[21376429] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 1338000.0 | nM | PMID[21745746] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 400000.0 | nM | PMID[21696963] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 1421000.0 | nM | PMID[21565516] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 100000.0 | nM | PMID[22047799] |
| NPT165 | Cell line | HeLa | Homo sapiens | CC50 | = | 541000.0 | nM | PMID[22459876] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 470000.0 | nM | PMID[22578783] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 100000.0 | nM | PMID[22513121] |
| NPT859 | Cell line | HFF | Homo sapiens | CC50 | > | 300000.0 | nM | PMID[22607883] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 918000.0 | nM | PMID[22858222] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | = | 130.0 | ug.mL-1 | PMID[22921079] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 2000000.0 | nM | PMID[22954898] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 134000.0 | nM | PMID[23047229] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 200000.0 | nM | PMID[22704890] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 200000.0 | nM | PMID[23141915] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | = | 1275.0 | ug.mL-1 | DOI[10.1007/s00044-011-9574-8] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | = | 960000.0 | nM | DOI[10.1007/s00044-007-9035-6] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 120.0 | ug.mL-1 | DOI[10.1007/s00044-011-9776-0] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 50000.0 | nM | PMID[23419738] |
| NPT25 | Cell line | MT4 | Homo sapiens | CC50 | > | 250000.0 | nM | PMID[24177359] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 440000.0 | nM | PMID[24690527] |
| NPT25 | Cell line | MT4 | Homo sapiens | CC50 | > | 100000.0 | nM | PMID[25082514] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 1000000.0 | nM | PMID[26048809] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 440000.0 | nM | PMID[26443550] |
| NPT25 | Cell line | MT4 | Homo sapiens | CC50 | > | 100000.0 | nM | PMID[26443549] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 440000.0 | nM | PMID[27750154] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | TC50 | > | 100.0 | umol/L | PMID[27792321] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 1000000.0 | nM | PMID[28129981] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 787000.0 | nM | PMID[28829913] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 444000.0 | nM | PMID[28682067] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 440000.0 | nM | PMID[28757102] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 200000.0 | nM | PMID[29099182] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 440000.0 | nM | PMID[29945100] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 440000.0 | nM | PMID[29407990] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | TC50 | > | 100.0 | uM | PMID[30106288] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 444000.0 | nM | PMID[29550734] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 444000.0 | nM | PMID[29268134] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 444000.0 | nM | PMID[29670705] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 2000000.0 | nM | PMID[30798081] |
| NPT71 | Cell line | HEK293 | Homo sapiens | CC50 | > | 20000.0 | nM | DOI[10.6019/CHEMBL4296181] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 444000.0 | nM | PMID[32676147] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | = | 1100000.0 | ug.mL-1 | PMID[32089391] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | = | 424000.0 | nM | PMID[33479570] |
| NPT859 | Cell line | HFF | Homo sapiens | CC50 | > | 300000.0 | nM | PMID[27933957] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 300000.0 | nM | PMID[33039724] |
| NPT81 | Cell line | A549 | Homo sapiens | CC50 | = | 1555600.0 | nM | PMID[34425312] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 300000.0 | nM | PMID[33894564] |
| NPT2192 | Cell line | HEL | Homo sapiens | CC50 | > | 444030.0 | nM | PMID[35754374] |
| NPT859 | Cell line | HFF | Homo sapiens | CC50 | > | 150000.0 | nM | PMID[35754374] |
| NPT859 | Cell line | HFF | Homo sapiens | CC50 | n.a. | n.a. | n.a. | PMID[35754374] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 15000.0 | nM | PMID[1846922] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 0.82 | ug.mL-1 | PMID[8709116] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 0.95 | ug.mL-1 | PMID[8709116] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 25.0 | ug.mL-1 | PMID[8709116] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 40.0 | ug.mL-1 | PMID[8709116] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 6.25 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00365-X] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | ED50 | = | 2.7 | ug ml-1 | PMID[9216836] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 0.38 | ug.mL-1 | PMID[7932543] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 0.18 | ug.mL-1 | PMID[7932543] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 4.7 | ug.mL-1 | PMID[7932543] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 13.7 | ug.mL-1 | PMID[7932543] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | > | 220.0 | ug.mL-1 | PMID[7932543] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | ED50 | = | 2.3 | ug ml-1 | PMID[2329551] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | ED50 | = | 3.7 | ug ml-1 | PMID[2329551] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 0.5 | ug.mL-1 | DOI[10.1016/S0960-894X(96)00244-2] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 1.1 | ug.mL-1 | PMID[11412988] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 13.0 | ug.mL-1 | PMID[11412988] |
| NPT3148 | Organism | Cytomegalovirus | Cytomegalovirus | EC50 | = | 16.0 | ug.mL-1 | PMID[11412988] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 2900.0 | nM | PMID[10579812] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1000.0 | nM | PMID[10579812] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 74000.0 | nM | PMID[10579812] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 125000.0 | nM | PMID[10579812] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1500.0 | nM | PMID[15109620] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1100.0 | nM | PMID[15109620] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 40000.0 | nM | PMID[15109620] |
| NPT3148 | Organism | Cytomegalovirus | Cytomegalovirus | IC50 | = | 63000.0 | nM | PMID[2840500] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 0.15 | ug.mL-1 | PMID[8393114] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 0.04 | ug.mL-1 | PMID[8393114] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 5.0 | ug.mL-1 | PMID[8393114] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 3.0 | ug.mL-1 | PMID[8393114] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 2000.0 | nM | PMID[10891113] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1000.0 | nM | PMID[10866384] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 2900.0 | nM | PMID[10866384] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 74000.0 | nM | PMID[10866384] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 125000.0 | nM | PMID[10866384] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | ED50 | = | 1.0 | ug ml-1 | PMID[2989523] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 0.3 | ug.mL-1 | PMID[2455050] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 0.6 | ug.mL-1 | PMID[2455050] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 25.0 | ug.mL-1 | PMID[2455050] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 10.0 | ug.mL-1 | PMID[2455050] |
| NPT3148 | Organism | Cytomegalovirus | Cytomegalovirus | MIC | = | 20.0 | ug.mL-1 | PMID[2455050] |
| NPT3148 | Organism | Cytomegalovirus | Cytomegalovirus | MIC | = | 25.0 | ug.mL-1 | PMID[2455050] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 0.73 | ug.mL-1 | PMID[10197958] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 0.78 | ug.mL-1 | PMID[10197958] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 24.0 | ug.mL-1 | PMID[10197958] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 26.0 | ug.mL-1 | PMID[10197958] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 0.6 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00082-6] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 8810.0 | nM | PMID[11814776] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 2900.0 | nM | PMID[11212118] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1000.0 | nM | PMID[11212118] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | > | 4000.0 | nM | PMID[11212118] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 125000.0 | nM | PMID[11212118] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 0.82 | ug.mL-1 | PMID[9836626] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 0.95 | ug.mL-1 | PMID[9836626] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | > | 25.0 | ug.mL-1 | PMID[9836626] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | > | 40.0 | ug.mL-1 | PMID[9836626] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 2900.0 | nM | PMID[11150169] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1000.0 | nM | PMID[11150169] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 74000.0 | nM | PMID[11150169] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 125000.0 | nM | PMID[11150169] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 2400.0 | nM | PMID[14584954] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 30000.0 | nM | PMID[14584954] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 19000.0 | nM | PMID[14584954] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 46800.0 | nM | PMID[8576922] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | ED50 | = | 2.0 | uM | DOI[10.1016/S0960-894X(00)80318-2] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 0.18 | ug.mL-1 | PMID[8831773] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 0.35 | ug.mL-1 | PMID[8831773] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 11.0 | ug.mL-1 | PMID[8831773] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 22.0 | ug.mL-1 | PMID[8831773] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 2000.0 | nM | DOI[10.1016/S0960-894X(00)80317-0] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 2600.0 | nM | PMID[11708924] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 2600.0 | nM | PMID[11585457] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 0.38 | ug.mL-1 | PMID[12217359] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 0.35 | ug.mL-1 | PMID[12217359] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 6.5 | ug.mL-1 | PMID[12217359] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 3.1 | ug.mL-1 | PMID[12217359] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 21000.0 | nM | PMID[8496903] |
| NPT3148 | Organism | Cytomegalovirus | Cytomegalovirus | IC50 | = | 93000.0 | nM | PMID[8496903] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 0.8 | ug.mL-1 | PMID[10691698] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 13.0 | ug.mL-1 | PMID[10691698] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | MIC | = | 28.0 | ug.mL-1 | PMID[10691698] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 4530.0 | nM | PMID[10966745] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 4090.0 | nM | PMID[10966745] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 41000.0 | nM | PMID[10966745] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 63000.0 | nM | PMID[10966745] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 9.4 | ug.mL-1 | PMID[15658861] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 0.6 | ug.mL-1 | PMID[15658861] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 36000.0 | nM | PMID[16392824] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1400.0 | nM | PMID[16392824] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 24000.0 | nM | PMID[16392824] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 0.22 | ug.mL-1 | PMID[16480257] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 14.0 | ug.mL-1 | PMID[16480257] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 30.0 | nM | PMID[17004726] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 480.0 | nM | PMID[17181162] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 12000.0 | nM | PMID[17181162] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | MIC | = | 480.0 | nM | PMID[17286431] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 0.015 | ug.mL-1 | PMID[17298047] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | > | 20.0 | ug.mL-1 | PMID[17298047] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 0.75 | ug.mL-1 | PMID[17298047] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | >= | 25.1 | ug.mL-1 | PMID[17298047] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1600.0 | nM | PMID[15615545] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | MIC | = | 480.0 | nM | PMID[17092728] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | MIC | = | 60000.0 | nM | PMID[17092728] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 0.02 | ug.mL-1 | PMID[17518459] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1000.0 | nM | PMID[17539622] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 32000.0 | nM | PMID[17539622] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1400.0 | nM | PMID[17622128] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 4000.0 | nM | PMID[17622128] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 36000.0 | nM | PMID[17622128] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 24000.0 | nM | PMID[17622128] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1000.0 | nM | PMID[17672445] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 32000.0 | nM | PMID[17672445] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | MIC | = | 400.0 | nM | PMID[17672445] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 8100.0 | nM | PMID[17513108] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 0.23 | ug.mL-1 | PMID[17948980] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 10.2 | ug.mL-1 | PMID[17948980] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 2900.0 | nM | PMID[18052321] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1000.0 | nM | PMID[18052321] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 74000.0 | nM | PMID[18052321] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 125000.0 | nM | PMID[18052321] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 8100.0 | nM | PMID[17434304] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 0.7 | ug.mL-1 | PMID[17869124] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 28.0 | ug.mL-1 | PMID[17869124] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 8500.0 | nM | PMID[17325220] |
| NPT1762 | Organism | Macacine herpesvirus 1 | Macacine herpesvirus 1 | EC50 | = | 112000.0 | nM | PMID[17438061] |
| NPT1762 | Organism | Macacine herpesvirus 1 | Macacine herpesvirus 1 | EC50 | = | 118000.0 | nM | PMID[17438061] |
| NPT1762 | Organism | Macacine herpesvirus 1 | Macacine herpesvirus 1 | EC50 | = | 47500.0 | nM | PMID[17438061] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 0.17 | ug.mL-1 | PMID[17583388] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 16.0 | ug.mL-1 | PMID[17583388] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 0.24 | ug.mL-1 | PMID[18835175] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 13.0 | ug.mL-1 | PMID[18835175] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 2500.0 | nM | PMID[18614365] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 2900.0 | nM | PMID[18614365] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 61000.0 | nM | PMID[18614365] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 43000.0 | nM | PMID[18614365] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 8100.0 | nM | PMID[18595689] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1100.0 | nM | PMID[19226140] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 72000.0 | nM | PMID[19226140] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 4400.0 | nM | PMID[19410465] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 2000.0 | nM | PMID[19339082] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1800.0 | nM | PMID[19339082] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 62200.0 | nM | PMID[19339082] |
| NPT70 | Organism | Respiratory syncytial virus | Respiratory syncytial virus | EC50 | > | 100000.0 | nM | PMID[19482481] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 840.0 | nM | PMID[20064723] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 26700.0 | nM | PMID[20064723] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 8100.0 | nM | PMID[20167488] |
| NPT70 | Organism | Respiratory syncytial virus | Respiratory syncytial virus | EC50 | > | 100000.0 | nM | PMID[20359898] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 8100.0 | nM | PMID[20403696] |
| NPT1762 | Organism | Macacine herpesvirus 1 | Macacine herpesvirus 1 | Activity | = | 33.0 | % | PMID[19858259] |
| NPT1762 | Organism | Macacine herpesvirus 1 | Macacine herpesvirus 1 | EC50 | = | 19300.0 | nM | PMID[19858259] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 160.0 | nM | PMID[20809641] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 125000.0 | nM | PMID[20809641] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 300.0 | nM | PMID[20809641] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 3300.0 | nM | PMID[21128666] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 62000.0 | nM | PMID[21128666] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 200.0 | nM | PMID[21232828] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 400.0 | nM | PMID[21232828] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 10000.0 | nM | PMID[21232828] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 16500.0 | nM | PMID[21232828] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 58700.0 | nM | PMID[21256035] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1100.0 | nM | PMID[21376429] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 3640.0 | nM | PMID[21745746] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 71600.0 | nM | PMID[21745746] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 76900.0 | nM | PMID[21745746] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 300.0 | nM | PMID[21745746] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 230.0 | nM | PMID[21745746] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 7300.0 | nM | PMID[21745746] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 111000.0 | nM | PMID[21696963] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 43000.0 | nM | PMID[21696963] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 4900.0 | nM | PMID[21696963] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 400.0 | nM | PMID[21696963] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 50000.0 | nM | PMID[21696963] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 400.0 | nM | PMID[21696963] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 270.0 | nM | PMID[21565516] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 27100.0 | nM | PMID[21565516] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 230.0 | nM | PMID[21565516] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 69300.0 | nM | PMID[21565516] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | IC50 | = | 600.0 | nM | PMID[21812420] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 3000.0 | nM | PMID[22047799] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 26600.0 | nM | PMID[22459876] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | > | 250000.0 | nM | PMID[22459876] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 400.0 | nM | PMID[22459876] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 200.0 | nM | PMID[22459876] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 2180.0 | nM | PMID[22578783] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 92000.0 | nM | PMID[22578783] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 3000.0 | nM | PMID[22513121] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 1900.0 | nM | PMID[22607883] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 2840.0 | nM | PMID[22858222] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 54000.0 | nM | PMID[22858222] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 37000.0 | nM | PMID[22858222] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 380.0 | nM | PMID[22858222] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 1.8 | ug.mL-1 | PMID[22921079] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 400.0 | nM | PMID[23047229] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 400.0 | nM | PMID[23047229] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 250000.0 | nM | PMID[23047229] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 15000.0 | nM | PMID[23047229] |
| NPT3574 | Organism | Herpes simplex virus (type 1 / strain F) | Herpes simplex virus (type 1 / strain F) | EC50 | = | 500.0 | nM | PMID[22944333] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 44000.0 | nM | PMID[23099097] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 140.0 | nM | PMID[23099097] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 140.0 | nM | PMID[23099097] |
| NPT3574 | Organism | Herpes simplex virus (type 1 / strain F) | Herpes simplex virus (type 1 / strain F) | IC50 | = | 0.2 | ug.mL-1 | PMID[23194476] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 23.0 | ug.mL-1 | DOI[10.1007/s00044-011-9776-0] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 0.44 | ug.mL-1 | DOI[10.1007/s00044-011-9776-0] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | MIC | = | 300.0 | ug.mL-1 | DOI[10.1007/s00044-012-0127-6] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | MIC | = | 20.0 | ug.mL-1 | DOI[10.1007/s00044-012-0127-6] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | MIC | = | 2.4 | ug.mL-1 | DOI[10.1007/s00044-012-0127-6] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | > | 250000.0 | nM | PMID[32214762] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 700.0 | nM | PMID[32214762] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 1000.0 | nM | PMID[32214762] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | IC50 | = | 13000.0 | nM | PMID[23219702] |
| NPT3574 | Organism | Herpes simplex virus (type 1 / strain F) | Herpes simplex virus (type 1 / strain F) | EC50 | = | 1700.0 | nM | PMID[23419738] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 80.0 | nM | PMID[23603046] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 29000.0 | nM | PMID[23603046] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 80.0 | nM | PMID[23603046] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 112000.0 | nM | PMID[23811093] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 200.0 | nM | PMID[23811093] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 400.0 | nM | PMID[23811093] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 143600.0 | nM | PMID[23811093] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 112000.0 | nM | PMID[23911856] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 26000.0 | nM | PMID[23911856] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 200.0 | nM | PMID[23911856] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 200.0 | nM | PMID[23911856] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 23000.0 | nM | PMID[24177359] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 200.0 | nM | PMID[24177359] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 230.0 | nM | PMID[24177359] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 18000.0 | nM | PMID[24185376] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 500.0 | nM | PMID[24185376] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 320.0 | nM | PMID[24185376] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 140000.0 | nM | PMID[24690527] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 200.0 | nM | PMID[24690527] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 100.0 | nM | PMID[24690527] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 3000.0 | nM | PMID[25014745] |
| NPT1539 | Organism | Human coxsackievirus B5 | Human coxsackievirus B5 | EC50 | > | 100000.0 | nM | PMID[25082514] |
| NPT70 | Organism | Respiratory syncytial virus | Respiratory syncytial virus | EC50 | > | 100000.0 | nM | PMID[25082514] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 2000.0 | nM | PMID[26001344] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 200.0 | nM | PMID[26001344] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 33000.0 | nM | PMID[26001344] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1500.0 | nM | PMID[26001344] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 80.0 | nM | PMID[26001344] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 3000.0 | nM | PMID[26119992] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 54500.0 | nM | PMID[26443550] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 6400.0 | nM | PMID[26460883] |
| NPT3574 | Organism | Herpes simplex virus (type 1 / strain F) | Herpes simplex virus (type 1 / strain F) | EC50 | = | 660.0 | nM | PMID[26460883] |
| NPT1539 | Organism | Human coxsackievirus B5 | Human coxsackievirus B5 | EC50 | > | 100000.0 | nM | PMID[26479028] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 3000.0 | nM | PMID[26479028] |
| NPT1539 | Organism | Human coxsackievirus B5 | Human coxsackievirus B5 | EC50 | > | 100000.0 | nM | PMID[26443549] |
| NPT6367 | Organism | Human respiratory syncytial virus | Human respiratory syncytial virus | EC50 | > | 100000.0 | nM | PMID[26443549] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | FC | = | 4.3 | n.a. | PMID[26819664] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | Activity | = | 33.3 | PFU/ml | PMID[26819664] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | FC | = | 8.5 | n.a. | PMID[26819664] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | FC | = | 2300.0 | n.a. | PMID[26819664] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 70.0 | nM | PMID[26819664] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | FC | = | 1.8 | n.a. | PMID[26819664] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 27000.0 | nM | PMID[27128178] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 250000.0 | nM | PMID[27750154] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 400.0 | nM | PMID[27750154] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 200.0 | nM | PMID[27750154] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 50300.0 | nM | PMID[27750154] |
| NPT3574 | Organism | Herpes simplex virus (type 1 / strain F) | Herpes simplex virus (type 1 / strain F) | IC50 | = | 410.0 | nM | PMID[27792321] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 200.0 | nM | PMID[26114811] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 10000.0 | nM | PMID[26114811] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 49300.0 | nM | PMID[26114811] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 400.0 | nM | PMID[28829913] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 400.0 | nM | PMID[28829913] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 60000.0 | nM | PMID[28829913] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 73000.0 | nM | PMID[28829913] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 20700.0 | nM | PMID[28682067] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 400.0 | nM | PMID[28757102] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 180.0 | nM | PMID[28757102] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 54000.0 | nM | PMID[28757102] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1500.0 | nM | PMID[28757102] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 38900.0 | nM | PMID[28757102] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 800.0 | nM | PMID[29880251] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 400.0 | nM | PMID[29880251] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 126000.0 | nM | PMID[29880251] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 3550.0 | nM | PMID[29880251] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 14870.0 | nM | PMID[29880251] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 1800.0 | nM | PMID[29028528] |
| NPT3574 | Organism | Herpes simplex virus (type 1 / strain F) | Herpes simplex virus (type 1 / strain F) | IC50 | = | 150.0 | nM | PMID[29099182] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 133300.0 | nM | PMID[29945100] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 54400.0 | nM | PMID[29407990] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 1200.0 | nM | PMID[29407990] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 94000.0 | nM | PMID[29407990] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 700.0 | nM | PMID[29407990] |
| NPT3574 | Organism | Herpes simplex virus (type 1 / strain F) | Herpes simplex virus (type 1 / strain F) | IC50 | = | 410.0 | nM | PMID[30106288] |
| NPT3574 | Organism | Herpes simplex virus (type 1 / strain F) | Herpes simplex virus (type 1 / strain F) | Activity | = | 0.1 | % | PMID[29602675] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 14120.0 | nM | PMID[29550734] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 300.0 | nM | PMID[29550734] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | > | 88000.0 | nM | PMID[29550734] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 290.0 | nM | PMID[29550734] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 53510.0 | nM | PMID[29268134] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 380.0 | nM | PMID[29268134] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 88810.0 | nM | PMID[29268134] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 290.0 | nM | PMID[29268134] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 470.0 | nM | PMID[29670705] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | > | 88800.0 | nM | PMID[29670705] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 340.0 | nM | PMID[29670705] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 54800.0 | nM | PMID[29670705] |
| NPT3574 | Organism | Herpes simplex virus (type 1 / strain F) | Herpes simplex virus (type 1 / strain F) | IC50 | = | 1290.0 | nM | PMID[30194008] |
| NPT3574 | Organism | Herpes simplex virus (type 1 / strain F) | Herpes simplex virus (type 1 / strain F) | EC50 | = | 600.0 | nM | PMID[30286952] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 600.0 | nM | PMID[30286952] |
| NPT3574 | Organism | Herpes simplex virus (type 1 / strain F) | Herpes simplex virus (type 1 / strain F) | EC50 | = | 2000.0 | nM | PMID[30286952] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 36740.0 | nM | PMID[30098481] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 10000.0 | nM | PMID[30098481] |
| NPT5012 | Organism | Human herpesvirus 2 strain G | Human herpesvirus 2 strain G | EC50 | = | 200.0 | nM | PMID[30098481] |
| NPT1766 | Organism | Human herpesvirus 1 strain KOS | Human herpesvirus 1 strain KOS | EC50 | = | 200.0 | nM | PMID[30098481] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 8.75 | % | DOI[10.21203/rs.3.rs-23951/v1] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 5000.0 | nM | PMID[30738653] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 59200.0 | nM | PMID[30738653] |
| NPT4194 | Organism | Human adenovirus type 2 | Human adenovirus 2 | EC50 | = | 5800.0 | nM | PMID[31586832] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 96000.0 | nM | PMID[31586832] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1560.0 | nM | PMID[31586832] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 0.04 | % | DOI[10.6019/CHEMBL4495565] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 7060.0 | nM | PMID[32676147] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 42700.0 | nM | PMID[32676147] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 20000.0 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 19952.62 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 22150.0 | nM | PMID[33479570] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 1600.0 | nM | PMID[33479570] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 4170.0 | nM | PMID[34124679] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC90 | = | 30.23 | uM | PMID[34124679] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 490.0 | nM | PMID[33039724] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | EC50 | = | 23220.0 | nM | PMID[33039724] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | = | 84630.0 | nM | PMID[36332548] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | = | 56000.0 | nM | PMID[33894564] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | = | 14650.0 | nM | PMID[36332548] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | = | 1220.0 | nM | PMID[36054994] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | = | 700.0 | nM | PMID[35933787] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | = | 14740.0 | nM | PMID[35933787] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | = | 12000.0 | nM | PMID[33894564] |
| NPT3148 | Organism | Cytomegalovirus | Cytomegalovirus | EC50 | = | 40.0 | ug.mL-1 | PMID[36054994] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | = | 7100.0 | nM | PMID[35754374] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | = | 700.0 | nM | PMID[35305462] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | = | 9.0 | nM | PMID[33894564] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | = | 3866.0 | nM | PMID[37140467] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | > | 20000.0 | nM | PMID[37140467] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | = | 4170.0 | nM | PMID[35754374] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | = | 370.0 | nM | PMID[37140467] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | = | 275830.0 | nM | PMID[35754374] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC90 | = | 30.23 | uM | PMID[35754374] |
| NPT29237 | Organism | Human adenovirus 2 | Human adenovirus 2 | EC50 | n.a. | n.a. | n.a. | PMID[35933787] |
| NPT28438 | Unchecked | Unchecked | n.a. | MCC | > | 444000.0 | nM | PMID[36332548] |
| NPT29374 | Organism | Human alphaherpesvirus 3 | Human alphaherpesvirus 3 | EC50 | = | 7750.0 | nM | PMID[37140467] |
| NPT26641 | Cell line | P3HR-1 | Homo sapiens | CC50 | = | 392000.0 | nM | PMID[12408726] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | ID50 | > | 100.0 | ug ml-1 | PMID[2329551] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | CC50 | > | 200000.0 | nM | PMID[11150169] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | CC50 | = | 488000.0 | nM | PMID[14584954] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | ID50 | = | 4.0 | uM | PMID[8387600] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | ID50 | = | 2.0 | uM | PMID[8387600] |
| NPT1749 | Organism | Human herpesvirus 3 | Human herpesvirus 3 | ID50 | = | 100.0 | uM | PMID[8387600] |
| NPT21954 | Cell line | Vero 76 | Chlorocebus sabaeus | CC50 | > | 100000.0 | nM | PMID[29028528] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | ED50 | = | 3.0 | ug ml-1 | PMID[2848125] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 4800.0 | nM | PMID[1846922] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | IC50 | = | 1200.0 | nM | PMID[1846922] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Inhibition | = | 100.0 | % | PMID[7932528] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Inhibition | = | 0.0 | % | PMID[7932528] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ED50 | = | 0.5 | uM | PMID[14584951] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ED50 | = | 2.5 | uM | PMID[14584951] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | > | 100.0 | ug.mL-1 | PMID[2838633] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 2.6 | ug.mL-1 | PMID[2838633] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 1.563 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00365-X] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ED50 | = | 0.14 | ug ml-1 | PMID[9216836] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ED50 | = | 0.23 | ug ml-1 | PMID[9216836] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ED50 | = | 0.02 | ug ml-1 | PMID[2213836] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | ED50 | > | 110.0 | ug ml-1 | PMID[2213836] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.02 | ug.mL-1 | PMID[7932543] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 0.004 | ug.mL-1 | PMID[7932543] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.07 | ug.mL-1 | PMID[7932543] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.09 | ug.mL-1 | PMID[7932543] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.01 | ug.mL-1 | PMID[7932543] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.009 | ug.mL-1 | PMID[7932543] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 5.0 | ug.mL-1 | PMID[7932543] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 70.0 | ug.mL-1 | PMID[7932543] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | MIC | > | 180.0 | ug.mL-1 | PMID[7932543] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ED50 | = | 0.08 | ug ml-1 | PMID[2329551] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ED50 | = | 0.09 | ug ml-1 | PMID[2329551] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ED50 | = | 0.1 | ug ml-1 | PMID[2329551] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ED50 | = | 0.07 | ug ml-1 | PMID[2329551] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ED50 | = | 0.06 | ug ml-1 | PMID[2329551] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ED50 | = | 189.9 | ug ml-1 | PMID[2329551] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 100.0 | ug.mL-1 | PMID[8176708] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | MIC | > | 400.0 | ug.mL-1 | PMID[8176708] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 0.004 | ug.mL-1 | DOI[10.1016/S0960-894X(96)00244-2] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 0.004 | ug.mL-1 | DOI[10.1016/S0960-894X(96)00244-2] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 0.01 | ug.mL-1 | PMID[11412988] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 9.6 | ug.mL-1 | PMID[11412988] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | IC50 | = | 0.02 | ug.mL-1 | PMID[11412988] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 2220.0 | nM | PMID[14584954] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1.054 | ug.mL-1 | PMID[9871553] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 5.12 | ug.mL-1 | PMID[9871553] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 250.0 | ug.mL-1 | PMID[9871553] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 2600.0 | nM | PMID[2840500] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 0.02 | ug.mL-1 | PMID[8393114] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 0.4 | ug.mL-1 | PMID[8393114] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 0.7 | ug.mL-1 | PMID[8393114] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 0.02 | ug.mL-1 | PMID[8393114] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 2.0 | ug.mL-1 | PMID[8393114] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 0.7 | ug.mL-1 | PMID[8393114] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 70.0 | ug.mL-1 | PMID[8393114] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | MIC | > | 400.0 | ug.mL-1 | PMID[8393114] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ED50 | = | 58.0 | mg.kg-1 | PMID[1848298] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ED50 | = | 58.0 | mg.kg-1 | PMID[1848298] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ED50 | ~ | 50.0 | mg.kg-1 | PMID[1848298] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Inhibition | = | 85.0 | % | PMID[2989523] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | Inhibition | = | 34.0 | % | PMID[2989523] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ED50 | = | 1.0 | ug ml-1 | PMID[2989523] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ED50 | = | 1.0 | ug ml-1 | PMID[2989523] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 23000.0 | nM | PMID[10999490] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 35000.0 | nM | PMID[10999490] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 3900.0 | nM | PMID[2163453] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 4000.0 | nM | PMID[2175356] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC90 | = | 7000.0 | nM | PMID[2175356] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 0.2 | ug.mL-1 | PMID[2455050] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 0.1 | ug.mL-1 | PMID[2455050] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 0.07 | ug.mL-1 | PMID[2455050] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 0.2 | ug.mL-1 | PMID[2455050] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | MIC | = | 150.0 | ug.mL-1 | PMID[2455050] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 20.0 | ug.mL-1 | PMID[2455050] |
| NPT18622 | Organism | Suid herpesvirus 1 | Suid herpesvirus 1 | MIC | = | 7.0 | ug.mL-1 | PMID[2455050] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 10.0 | nM | PMID[2842506] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 4400.0 | nM | PMID[2842506] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 1300.0 | nM | PMID[2842506] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 13200.0 | nM | PMID[2842506] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 44000.0 | nM | PMID[2842506] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 440000.0 | nM | PMID[2842506] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 132000.0 | nM | PMID[2842506] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 440000.0 | nM | PMID[2842506] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC50 | = | 3.0 | ug.mL-1 | PMID[3035178] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 0.06 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00082-6] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 0.3 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00082-6] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 0.2 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00082-6] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 1.1 | ug.mL-1 | DOI[10.1016/S0960-894X(97)00082-6] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 3080.0 | nM | PMID[11814776] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 6160.0 | nM | PMID[11814776] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 4000.0 | nM | PMID[2163454] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 7000.0 | nM | PMID[2163454] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 0.077 | ug.mL-1 | PMID[12459010] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 400.0 | ug.mL-1 | PMID[12459010] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 341.0 | nM | PMID[12408716] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 242.0 | nM | PMID[12408716] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 1000.0 | nM | PMID[12408716] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 249000.0 | nM | PMID[12408716] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 2600.0 | nM | PMID[2846837] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 0.13 | ug.mL-1 | PMID[12161143] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 0.88 | ug.mL-1 | PMID[12161143] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 10210.0 | nM | PMID[14584954] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 3900.0 | nM | PMID[2500527] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 1800.0 | nM | PMID[8576922] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ED50 | = | 12.3 | ug ml-1 | PMID[3027333] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ED50 | = | 4.8 | ug ml-1 | PMID[3027333] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ED50 | = | 0.2 | uM | DOI[10.1016/S0960-894X(00)80318-2] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ED50 | = | 0.4 | uM | DOI[10.1016/S0960-894X(00)80318-2] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 0.015 | ug.mL-1 | PMID[8831773] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 0.81 | ug.mL-1 | PMID[10649983] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 0.3 | ug.mL-1 | PMID[4067994] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 3.0 | ug.mL-1 | PMID[4067994] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 1.3 | ug.mL-1 | PMID[8388470] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 3400.0 | nM | PMID[8784444] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 400.0 | nM | DOI[10.1016/S0960-894X(00)80317-0] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | IC50 | = | 400.0 | nM | DOI[10.1016/S0960-894X(00)80317-0] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 0.13 | ug.mL-1 | PMID[11708929] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 0.08 | ug.mL-1 | PMID[11708929] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 0.19 | ug.mL-1 | PMID[11708929] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 0.07 | ug.mL-1 | PMID[11708929] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 0.28 | ug.mL-1 | PMID[11708929] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | MIC | > | 80.0 | ug.mL-1 | PMID[11708929] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 19.0 | ug.mL-1 | PMID[11708929] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 7.1 | ug.mL-1 | PMID[11708929] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | > | 400.0 | ug.mL-1 | DOI[10.1016/S0960-894X(96)00254-5] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 0.02 | ug.mL-1 | DOI[10.1016/S0960-894X(96)00254-5] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 0.03 | ug.mL-1 | DOI[10.1016/S0960-894X(96)00254-5] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 80.0 | ug.mL-1 | DOI[10.1016/S0960-894X(96)00254-5] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 4.0 | ug.mL-1 | DOI[10.1016/S0960-894X(96)00254-5] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 1700.0 | nM | PMID[8071942] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 3400.0 | nM | PMID[1310744] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 117600.0 | nM | PMID[11585457] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 2200.0 | nM | PMID[11585457] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 4400.0 | nM | PMID[11585457] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 6200.0 | nM | PMID[11585457] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Inhibition | = | 86.0 | % | PMID[3009816] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 160.0 | nM | PMID[10091689] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 360.0 | nM | PMID[10425099] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | > | 350000.0 | nM | PMID[10425099] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 1100.0 | nM | PMID[10425099] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | IC50 | > | 350000.0 | nM | PMID[10425099] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 200.0 | nM | DOI[10.1016/S0960-894X(97)00117-0] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | IC50 | = | 2100.0 | nM | DOI[10.1016/S0960-894X(97)00117-0] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 3900.0 | nM | PMID[8496903] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | IC50 | = | 4300.0 | nM | PMID[8496903] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 0.003 | ug.mL-1 | PMID[10691698] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 0.02 | ug.mL-1 | PMID[10691698] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.02 | ug.mL-1 | PMID[10691698] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 9.6 | ug.mL-1 | PMID[10691698] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.07 | ug.mL-1 | PMID[10691698] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 1.1 | ug.mL-1 | PMID[10691698] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 100.0 | nM | PMID[6273561] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 8000.0 | nM | PMID[15658867] |
| NPT610 | Others | Molecular identity unknown | n.a. | EC50 | = | 1500.0 | nM | PMID[15993062] |
| NPT610 | Others | Molecular identity unknown | n.a. | EC50 | = | 3100.0 | nM | PMID[15993062] |
| NPT610 | Others | Molecular identity unknown | n.a. | EC50 | = | 40000.0 | nM | PMID[15993062] |
| NPT610 | Others | Molecular identity unknown | n.a. | EC50 | = | 53000.0 | nM | PMID[15993062] |
| NPT610 | Others | Molecular identity unknown | n.a. | EC50 | = | 1600.0 | nM | PMID[15634003] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1500.0 | nM | PMID[15634003] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 900.0 | nM | PMID[15634003] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 13500.0 | nM | PMID[15634003] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 6700.0 | nM | PMID[15634003] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 32300.0 | nM | PMID[15634003] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 320.0 | nM | PMID[15658858] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1120.0 | nM | PMID[16392791] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 86600.0 | nM | PMID[16392791] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 1760.0 | nM | PMID[16392791] |
| NPT3795 | Organism | Human immunodeficiency virus 2 | Human immunodeficiency virus 2 | EC50 | > | 50000.0 | nM | PMID[16392791] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC50 | = | 0.384 | ug.mL-1 | PMID[16420056] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC50 | = | 0.384 | ug.mL-1 | PMID[16420056] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | MIC50 | > | 400.0 | ug.mL-1 | PMID[16420056] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC50 | = | 48.0 | ug.mL-1 | PMID[16420056] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Inhibition | = | 96.0 | % | PMID[16321530] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1090.0 | nM | PMID[16321530] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 3500.0 | nM | PMID[17004726] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 480.0 | nM | PMID[17181162] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | = | 300000.0 | nM | PMID[17181162] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | MIC | > | 500000.0 | nM | PMID[17286431] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 480.0 | nM | PMID[17286431] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 60000.0 | nM | PMID[17286431] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 0.018 | ug.mL-1 | PMID[17298047] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 0.048 | ug.mL-1 | PMID[17298047] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 10000.0 | nM | PMID[15615545] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 800.0 | nM | PMID[17092728] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | MIC | = | 300000.0 | nM | PMID[17092728] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 0.07 | ug.mL-1 | PMID[17518459] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 400.0 | ug.mL-1 | PMID[17518459] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 40.0 | ug.mL-1 | PMID[17518459] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 7.0 | ug.mL-1 | PMID[17518459] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 390.0 | nM | PMID[17368024] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 400.0 | nM | PMID[17672445] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | MIC | > | 250000.0 | nM | PMID[17672445] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 2100.0 | nM | PMID[17513108] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 0.02 | ug.mL-1 | PMID[17948980] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 0.05 | ug.mL-1 | PMID[17948980] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 2100.0 | nM | PMID[17434304] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 390.0 | nM | PMID[18086523] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 6000.0 | nM | PMID[17981031] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | > | 444000.0 | nM | PMID[17325220] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1300.0 | nM | PMID[17325220] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 3100.0 | nM | PMID[17325220] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | > | 444000.0 | nM | PMID[17325220] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1400.0 | nM | PMID[17438061] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | IC50 | = | 4.21 | ug.mL-1 | PMID[11678658] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | Activity | = | 6.0 | ug ml-1 | PMID[11678658] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | Ratio | = | 100000.0 | n.a. | PMID[11678658] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 2.0 | ug.mL-1 | PMID[11277765] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 0.8 | ug.mL-1 | PMID[12444692] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 2.4 | ug.mL-1 | PMID[12444692] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 10200.0 | nM | PMID[18363379] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 0.384 | ug.mL-1 | PMID[17583388] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC | = | 0.384 | ug.mL-1 | PMID[17583388] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | MIC | > | 400.0 | ug.mL-1 | PMID[17583388] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC | = | 48.0 | ug.mL-1 | PMID[17583388] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 2.3 | ug.mL-1 | PMID[8792629] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 1.5 | ug.mL-1 | PMID[9214738] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 0.1 | ug.mL-1 | PMID[16378363] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1100.0 | nM | PMID[15104498] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 1000.0 | nM | PMID[15104498] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 0.26 | ug.mL-1 | PMID[9599250] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 2.3 | ug.mL-1 | PMID[9599250] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 950.0 | nM | PMID[15497938] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 950.0 | nM | PMID[15497938] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | Activity | = | 6.0 | ug ml-1 | PMID[11858754] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 3.25 | n.a. | PMID[8064297] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 3.0 | n.a. | PMID[8064297] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 2.0 | n.a. | PMID[8064297] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 0.5 | ug.mL-1 | PMID[17067157] |
| NPT3119 | Organism | Human coxsackievirus B3 | Human coxsackievirus B3 | IC50 | = | 25.0 | ug.mL-1 | PMID[16724853] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 0.25 | ug.mL-1 | PMID[16724853] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 0.24 | ug.mL-1 | PMID[9584406] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 0.22 | ug.mL-1 | PMID[9584406] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 1.1 | ug.mL-1 | PMID[16441071] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 400.0 | nM | PMID[18614365] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 200.0 | nM | PMID[18614365] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 50000.0 | nM | PMID[18614365] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 6000.0 | nM | PMID[18614365] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | > | 100000.0 | nM | PMID[18614365] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 2100.0 | nM | PMID[18595689] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 3040.0 | nM | PMID[19010684] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 31200.0 | nM | PMID[19010684] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 580.0 | nM | PMID[19010684] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 75070.0 | nM | PMID[19010684] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 320.0 | nM | PMID[19010684] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 9510.0 | nM | PMID[19010684] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | IC50 | = | 384.0 | nM | PMID[19112024] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 0.18 | ug.mL-1 | PMID[19147352] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 0.36 | ug.mL-1 | PMID[19147352] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 10.0 | n.a. | PMID[19217699] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 6.0 | ug ml-1 | PMID[19217699] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 300.0 | nM | PMID[19410465] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1300.0 | nM | PMID[19410465] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 1200.0 | nM | PMID[19410465] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 4300.0 | nM | PMID[19422205] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 6.86 | ug.mL-1 | PMID[19456117] |
| NPT3795 | Organism | Human immunodeficiency virus 2 | Human immunodeficiency virus 2 | EC50 | > | 250000.0 | nM | PMID[19645484] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 50000.0 | nM | PMID[19645484] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 200.0 | nM | PMID[19645484] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 400.0 | nM | PMID[19645484] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 12.0 | % | PMID[19285757] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 28.0 | % | PMID[19285757] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC50 | = | 0.4 | ug.mL-1 | PMID[19324473] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | MIC50 | = | 0.4 | ug.mL-1 | PMID[19324473] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | MIC50 | > | 250.0 | ug.mL-1 | PMID[19324473] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | MIC50 | = | 50.0 | ug.mL-1 | PMID[19324473] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 3000.0 | nM | PMID[19482481] |
| NPT3573 | Organism | Bovine viral diarrhea virus | Bovine viral diarrhea virus 1 | EC50 | > | 100000.0 | nM | PMID[19482481] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | > | 100000.0 | nM | PMID[19482481] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 390.0 | nM | PMID[19700316] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 13000.0 | nM | PMID[20038128] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Ratio | = | 1000.0 | n.a. | PMID[19892441] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 6.0 | ug ml-1 | PMID[19892441] |
| NPT3573 | Organism | Bovine viral diarrhea virus | Bovine viral diarrhea virus 1 | EC50 | > | 100000.0 | nM | PMID[20359898] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 100000.0 | nM | PMID[20359898] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 3000.0 | nM | PMID[20359898] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 2100.0 | nM | PMID[20403696] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 19300.0 | nM | PMID[19858259] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 19300.0 | nM | PMID[19858259] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 4300.0 | nM | PMID[20092288] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 3000.0 | nM | PMID[19770274] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 80.0 | nM | PMID[19770274] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 12000.0 | nM | PMID[19770274] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 600.0 | nM | PMID[19770274] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 11.0 | nM | PMID[19770274] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 4400.0 | nM | PMID[19770274] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 4700.0 | nM | PMID[19770274] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 9600.0 | nM | PMID[19770274] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 4900.0 | nM | PMID[19770274] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 6600.0 | nM | PMID[19770274] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | > | 440000.0 | nM | PMID[19770274] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | Ratio EC50 | > | 100.0 | n.a. | PMID[19770274] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | > | 100000.0 | nM | PMID[19770274] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 1000.0 | nM | PMID[21232828] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[21232828] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | > | 50000.0 | nM | PMID[20733037] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 11000.0 | nM | PMID[20733037] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 35000.0 | nM | PMID[20733037] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 16000.0 | nM | PMID[20733037] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 26000.0 | nM | PMID[20733037] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 31000.0 | nM | PMID[20733037] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 10000.0 | nM | PMID[20733037] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 22000.0 | nM | PMID[20733037] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 43000.0 | nM | PMID[20733037] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 33000.0 | nM | PMID[20733037] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 24000.0 | nM | PMID[20733037] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 11000.0 | nM | PMID[20733037] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | > | 50000.0 | nM | PMID[20733037] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 18000.0 | nM | PMID[20733037] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 42000.0 | nM | PMID[20733037] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 5800.0 | nM | PMID[21256035] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Inhibition | = | 95.0 | % | PMID[21376603] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 990.0 | nM | PMID[21376603] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1160.0 | nM | PMID[21334891] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 1720.0 | nM | PMID[21334891] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 300.0 | nM | PMID[21356589] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | IC50 | = | 1270.0 | nM | PMID[21356589] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 17000.0 | nM | PMID[21473608] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 1560.0 | nM | PMID[21745746] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[21745746] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 1400.0 | nM | PMID[21696963] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[21696963] |
| NPT343 | Organism | Felid herpesvirus 1 | Felid herpesvirus 1 | EC50 | = | 1000.0 | nM | PMID[21696963] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 3000.0 | nM | PMID[21565516] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[21565516] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | Inhibition | = | 66.3 | % | PMID[22148431] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | Inhibition | = | 60.6 | % | PMID[22148431] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 490.0 | nM | PMID[22459876] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[22459876] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 2900.0 | nM | PMID[22607883] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | IC50 | = | 2800.0 | nM | PMID[22607883] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 1640.0 | nM | PMID[22858222] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 530.0 | nM | PMID[22858222] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | >= | 212000.0 | nM | PMID[22858222] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 1000000.0 | nM | PMID[22858222] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1.6 | ug.mL-1 | PMID[22921079] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Inhibition | = | 94.0 | % | PMID[22921079] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 2.1 | ug.mL-1 | PMID[22921079] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1700.0 | nM | PMID[22954898] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 530000.0 | nM | PMID[22954898] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[23047229] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 2700.0 | nM | PMID[23047229] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 1870.0 | nM | PMID[22704890] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1200.0 | nM | PMID[22704890] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | >= | 250000.0 | nM | PMID[23099097] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 22000.0 | nM | PMID[23141915] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 760.0 | nM | PMID[23141915] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 100.0 | % | DOI[10.1007/s00044-011-9960-2] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1.5 | ug.mL-1 | DOI[10.1007/s00044-011-9574-8] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | < | 0.012 | ug ml-1 | DOI[10.1007/s00044-010-9338-x] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 1.6 | ug ml-1 | DOI[10.1007/s00044-010-9338-x] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Inhibition | = | 96.0 | % | DOI[10.1007/s00044-007-9035-6] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1090.0 | nM | DOI[10.1007/s00044-007-9035-6] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 3000.0 | nM | DOI[10.1007/s00044-010-9513-0] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | MIC | > | 500.0 | ug.mL-1 | DOI[10.1007/s00044-012-0127-6] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[32214762] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 3000.0 | nM | DOI[10.1007/s00044-012-0342-1] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 58600.0 | nM | PMID[23419738] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[23603046] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[23811093] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 26.0 | nM | PMID[23811093] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 2100.0 | nM | PMID[23911856] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[23911856] |
| NPT343 | Organism | Felid herpesvirus 1 | Felid herpesvirus 1 | EC50 | > | 100000.0 | nM | PMID[24177359] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 9600.0 | nM | PMID[24486419] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 3300.0 | nM | PMID[24486419] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 50000.0 | nM | PMID[24690527] |
| NPT3573 | Organism | Bovine viral diarrhea virus | Bovine viral diarrhea virus 1 | EC50 | > | 100000.0 | nM | PMID[25082514] |
| NPT4691 | Organism | Human poliovirus 1 strain Sabin | Human poliovirus 1 strain Sabin | EC50 | > | 100000.0 | nM | PMID[25082514] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 100000.0 | nM | PMID[25082514] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1200.0 | nM | PMID[25082514] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 2800.0 | nM | PMID[25913116] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[26001344] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | > | 1000000.0 | nM | PMID[26048809] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | > | 100000.0 | nM | PMID[26048809] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 1020.0 | nM | PMID[26460883] |
| NPT3573 | Organism | Bovine viral diarrhea virus | Bovine viral diarrhea virus 1 | EC50 | > | 100000.0 | nM | PMID[26443549] |
| NPT4691 | Organism | Human poliovirus 1 strain Sabin | Human poliovirus 1 strain Sabin | EC50 | > | 100000.0 | nM | PMID[26443549] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1200.0 | nM | PMID[26443549] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 100000.0 | nM | PMID[26443549] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 2200.0 | nM | PMID[26638041] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 270.0 | nM | PMID[26638041] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | FC | = | 1000.0 | n.a. | PMID[26638041] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | FC | = | 10000.0 | n.a. | PMID[26638041] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | = | 1500.0 | nM | PMID[27161176] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 1900.0 | nM | PMID[27639368] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 26000.0 | nM | PMID[27639368] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 80.0 | nM | PMID[27639368] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 112000.0 | nM | PMID[27639368] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 200.0 | nM | PMID[27639368] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 100.0 | nM | PMID[26114811] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[26114811] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 3000.0 | nM | PMID[28129981] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 1730.0 | nM | PMID[28408228] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | > | 444000.0 | nM | PMID[28408228] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 27800.0 | nM | PMID[28408228] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 3500.0 | nM | PMID[28408228] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 17300.0 | nM | PMID[28408228] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC95 | = | 6900.0 | nM | PMID[28408228] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC95 | > | 444000.0 | nM | PMID[28408228] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC95 | = | 111000.0 | nM | PMID[28408228] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC95 | = | 13900.0 | nM | PMID[28408228] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC95 | = | 138800.0 | nM | PMID[28408228] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[28757102] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 89.6 | % | PMID[28943043] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 7.92 | % | PMID[28943043] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 1.36 | % | PMID[28943043] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 1.13 | % | PMID[28943043] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 92.6 | % | PMID[28943043] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 6.22 | % | PMID[28943043] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 0.44 | % | PMID[28943043] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 0.76 | % | PMID[28943043] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[29880251] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | IC50 | = | 0.00311 | nM | PMID[28771358] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 0.00475 | nM | PMID[28771358] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[29407990] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[30286952] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[30098481] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | Activity | = | 100.0 | % | PMID[30826188] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 900.0 | nM | PMID[30738653] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 900.0 | nM | PMID[30738653] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 100000.0 | nM | PMID[30738653] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 1380.0 | nM | PMID[30798081] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | IC50 | = | 3230.0 | nM | PMID[30798081] |
| NPT26476 | Organism | Hepatitis A virus | Hepatitis A virus | IC50 | = | 35.6 | ug.mL-1 | PMID[30844608] |
| NPT26476 | Organism | Hepatitis A virus | Hepatitis A virus | IC50 | = | 33.5 | ug.mL-1 | PMID[30844608] |
| NPT26476 | Organism | Hepatitis A virus | Hepatitis A virus | IC50 | = | 30.6 | ug.mL-1 | PMID[30844608] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[31586832] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 17000.0 | nM | PMID[31586832] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | EC50 | = | 2000.0 | nM | PMID[31586832] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 900.0 | nM | PMID[31586832] |
| NPT20 | Organism | Candida albicans | Candida albicans | Inhibition | = | 4.6 | % | DOI[10.6019/CHEMBL4296181] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Inhibition | = | 6.29 | % | DOI[10.6019/CHEMBL4296181] |
| NPT20 | Organism | Candida albicans | Candida albicans | MIC | > | 20000.0 | nM | DOI[10.6019/CHEMBL4296181] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 20000.0 | nM | DOI[10.6019/CHEMBL4296181] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | IC50 | = | 31000.0 | nM | PMID[31975590] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 1200.0 | ug.mL-1 | PMID[32089391] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | EC50 | = | 12800.0 | ug.mL-1 | PMID[32089391] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | IC50 | = | 27400.0 | nM | PMID[32961320] |
| NPT22368 | Organism | Zika virus | Zika virus | EC | n.a. | n.a. | n.a. | PMID[35969814] |
| NPT30073 | Organism | Human betaherpesvirus 5 | Human betaherpesvirus 5 | EC50 | n.a. | n.a. | n.a. | PMID[36332548] |
| NPT28519 | Organism | Enterovirus E | Enterovirus E | EC50 | = | 222.0 | n.a. | PMID[34425312] |
| NPT30073 | Organism | Human betaherpesvirus 5 | Human betaherpesvirus 5 | EC50 | n.a. | n.a. | n.a. | PMID[35754374] |
| NPT22224 | Cell line | Vero C1008 | Chlorocebus sabaeus | CC100 | n.a. | n.a. | n.a. | PMID[35969814] |
| NPT28711 | Organism | Human adenovirus 5 | Human adenovirus 5 | Activity | n.a. | n.a. | n.a. | PMID[34425312] |
| NPT30073 | Organism | Human betaherpesvirus 5 | Human betaherpesvirus 5 | EC50 | n.a. | n.a. | n.a. | PMID[35933787] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | > | 250000.0 | nM | PMID[35933787] |
| NPT28519 | Organism | Enterovirus E | Enterovirus E | Activity | n.a. | n.a. | n.a. | PMID[34425312] |
| NPT29392 | Protein complex | Gamma-aminobutyric acid receptor subunit alpha-1/alpha-2/beta-2/gamma-2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30073 | Organism | Human betaherpesvirus 5 | Human betaherpesvirus 5 | EC50 | = | 2270.0 | nM | PMID[35754374] |
| NPT30073 | Organism | Human betaherpesvirus 5 | Human betaherpesvirus 5 | EC50 | = | 2080.0 | nM | PMID[35754374] |
| NPT30073 | Organism | Human betaherpesvirus 5 | Human betaherpesvirus 5 | EC90 | n.a. | n.a. | n.a. | PMID[35754374] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ID50 | = | 0.4 | uM | PMID[2993615] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ID50 | = | 1.5 | uM | PMID[2993615] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ID50 | = | 0.48 | uM | PMID[2828623] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ID50 | = | 1.6 | uM | PMID[2828623] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ID50 | > | 100.0 | ug ml-1 | PMID[2329551] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ID50 | > | 100.0 | ug ml-1 | PMID[2329551] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | ID50 | > | 100.0 | ug ml-1 | PMID[2329551] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ID50 | = | 0.5 | ug ml-1 | PMID[2157012] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ID50 | = | 2.4 | ug ml-1 | PMID[2157012] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ID50 | = | 0.2 | ug ml-1 | PMID[1848298] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ID50 | = | 0.6 | ug ml-1 | PMID[1848298] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ID50 | = | 0.5 | ug ml-1 | PMID[2544723] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ID50 | = | 4.3 | ug ml-1 | PMID[2544723] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ID50 | = | 0.3 | ug ml-1 | PMID[2544723] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ID50 | = | 0.7 | ug ml-1 | PMID[3411597] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ID50 | = | 5.3 | ug ml-1 | PMID[3411597] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ID50 | = | 0.05 | ug ml-1 | PMID[6092636] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ID50 | = | 0.04 | ug ml-1 | PMID[6092636] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | ID50 | = | 50.0 | ug ml-1 | PMID[6092636] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ID50 | = | 1.3 | uM | PMID[2521518] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ID50 | = | 2.2 | uM | PMID[2521518] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ID50 | = | 0.9 | uM | PMID[8387600] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ID50 | > | 440.0 | uM | PMID[8387600] |
| NPT1141 | Organism | Human herpesvirus 2 | Human herpesvirus 2 | ID50 | > | 440.0 | uM | PMID[8387600] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | ID50 | > | 440.0 | uM | PMID[8387600] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | ID50 | = | 0.8 | ug ml-1 | PMID[6292425] |
| NPT190 | Organism | Human herpesvirus 1 | Human herpesvirus 1 | CC50 | > | 100000.0 | nM | PMID[10091689] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Ratio CC50/EC50 | > | 10.4 | n.a. | PMID[24486419] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Ratio CC50/EC50 | = | 30.3 | n.a. | PMID[24486419] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | CC50 | > | 100000.0 | nM | PMID[25082514] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | CC50 | = | 191000.0 | nM | PMID[27639368] |
| NPT419 | Organism | Oryctolagus cuniculus | Oryctolagus cuniculus | MIC | = | 0.08 | ug.mL-1 | PMID[6300403] |
| NPT419 | Organism | Oryctolagus cuniculus | Oryctolagus cuniculus | MIC | = | 0.1 | ug.mL-1 | PMID[6300403] |
| NPT419 | Organism | Oryctolagus cuniculus | Oryctolagus cuniculus | MIC | = | 0.09 | ug.mL-1 | PMID[6300403] |
| NPT419 | Organism | Oryctolagus cuniculus | Oryctolagus cuniculus | MIC | = | 0.04 | ug.mL-1 | PMID[6300403] |
| NPT419 | Organism | Oryctolagus cuniculus | Oryctolagus cuniculus | MIC | = | 0.06 | ug.mL-1 | PMID[6300403] |
| NPT419 | Organism | Oryctolagus cuniculus | Oryctolagus cuniculus | MIC | = | 80.0 | ug.mL-1 | PMID[6300403] |
| NPT419 | Organism | Oryctolagus cuniculus | Oryctolagus cuniculus | MIC | > | 400.0 | ug.mL-1 | PMID[6300403] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | ED50 | = | 6.9 | ug ml-1 | PMID[9216836] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | MIC | = | 13.2 | ug.mL-1 | PMID[7932543] |
| NPT963 | Organism | Hepatitis B virus | Hepatitis B virus | IC50 | > | 50.0 | ug.mL-1 | PMID[11412988] |
| NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | EC50 | = | 19700.0 | nM | PMID[10891113] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | ED50 | = | 20.0 | ug ml-1 | PMID[2989523] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | = | 63000.0 | nM | PMID[2163453] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | = | 63000.0 | nM | PMID[2175356] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC90 | = | 90000.0 | nM | PMID[2175356] |
| NPT19358 | Organism | Equid herpesvirus 1 | Equid herpesvirus 1 | MIC | = | 0.2 | ug.mL-1 | PMID[2455050] |
| NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | EC50 | = | 3960.0 | nM | PMID[11814776] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | = | 63000.0 | nM | PMID[2163454] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | = | 90000.0 | nM | PMID[2163454] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | = | 63000.0 | nM | PMID[2846837] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | = | 63000.0 | nM | PMID[2500527] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | > | 85000.0 | nM | PMID[8576922] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | ED50 | = | 20.0 | uM | DOI[10.1016/S0960-894X(00)80318-2] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | = | 63000.0 | nM | PMID[2913300] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | = | 13.0 | ug.mL-1 | PMID[8831773] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | > | 100000.0 | nM | PMID[8784444] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | = | 20000.0 | nM | DOI[10.1016/S0960-894X(00)80317-0] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | = | 86000.0 | nM | PMID[8071942] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC90 | = | 85000.0 | nM | PMID[8071942] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | > | 100000.0 | nM | PMID[8071942] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | = | 63000.0 | nM | PMID[1310744] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC90 | = | 90000.0 | nM | PMID[1310744] |
| NPT963 | Organism | Hepatitis B virus | Hepatitis B virus | EC50 | = | 20.0 | nM | PMID[15658867] |
| NPT419 | Organism | Oryctolagus cuniculus | Oryctolagus cuniculus | EC50 | = | 51000.0 | nM | PMID[15658867] |
| NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | EC50 | = | 1100.0 | nM | PMID[15634003] |
| NPT24 | Organism | Human immunodeficiency virus 1 | Human immunodeficiency virus 1 | EC50 | > | 50000.0 | nM | PMID[16392791] |
| NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | EC50 | = | 330.0 | nM | PMID[17004726] |
| NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | EC50 | = | 1100.0 | nM | PMID[15615545] |
| NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | EC50 | = | 5300.0 | nM | PMID[15615545] |
| NPT6174 | Organism | Human herpesvirus 8 | Human herpesvirus 8 | IC50 | > | 100000.0 | nM | PMID[17402726] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | > | 20000.0 | nM | PMID[17513108] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | > | 20000.0 | nM | PMID[17434304] |
| NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | IC50 | = | 6900.0 | nM | PMID[17434304] |
| NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | EC50 | = | 1700.0 | nM | PMID[18082410] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | EC50 | = | 12.0 | ug.mL-1 | PMID[18707089] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | EC50 | = | 7.9 | ug.mL-1 | PMID[18707089] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | EC50 | = | 173.0 | ug.mL-1 | PMID[18707089] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | EC50 | = | 130.0 | ug.mL-1 | PMID[18707089] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | EC50 | = | 4.8 | ug.mL-1 | PMID[18707089] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | EC50 | = | 91.0 | ug.mL-1 | PMID[18707089] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | EC50 | = | 7.7 | ug.mL-1 | PMID[18707089] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | EC50 | = | 22.0 | ug.mL-1 | PMID[18707089] |
| NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | EC50 | = | 3300.0 | nM | PMID[19397271] |
| NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | IC50 | = | 6900.0 | nM | PMID[18595689] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | > | 20000.0 | nM | PMID[18595689] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | EC50 | = | 7500.0 | nM | PMID[19226140] |
| NPT2262 | Organism | Human herpesvirus 5 strain AD169 | Human herpesvirus 5 strain AD169 | EC50 | = | 15000.0 | nM | PMID[19226140] |
| NPT2262 | Organism | Human herpesvirus 5 strain AD169 | Human herpesvirus 5 strain AD169 | EC50 | = | 4300.0 | nM | PMID[19226140] |
| NPT2262 | Organism | Human herpesvirus 5 strain AD169 | Human herpesvirus 5 strain AD169 | EC50 | = | 176000.0 | nM | PMID[19226140] |
| NPT2262 | Organism | Human herpesvirus 5 strain AD169 | Human herpesvirus 5 strain AD169 | EC50 | = | 7600.0 | nM | PMID[19226140] |
| NPT2262 | Organism | Human herpesvirus 5 strain AD169 | Human herpesvirus 5 strain AD169 | EC50 | = | 125000.0 | nM | PMID[19226140] |
| NPT2262 | Organism | Human herpesvirus 5 strain AD169 | Human herpesvirus 5 strain AD169 | EC50 | = | 1000.0 | nM | PMID[19226140] |
| NPT2262 | Organism | Human herpesvirus 5 strain AD169 | Human herpesvirus 5 strain AD169 | EC50 | = | 200000.0 | nM | PMID[19226140] |
| NPT19358 | Organism | Equid herpesvirus 1 | Equid herpesvirus 1 | EC50 | = | 1.7 | ug.mL-1 | PMID[17846132] |
| NPT24 | Organism | Human immunodeficiency virus 1 | Human immunodeficiency virus 1 | EC50 | > | 250000.0 | nM | PMID[19645484] |
| NPT2262 | Organism | Human herpesvirus 5 strain AD169 | Human herpesvirus 5 strain AD169 | EC50 | = | 178000.0 | nM | PMID[19339082] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | EC50 | = | 45000.0 | nM | PMID[19339082] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | = | 20000.0 | nM | PMID[20167488] |
| NPT1106 | Organism | Human poliovirus 1 | Human poliovirus 1 | EC50 | > | 100000.0 | nM | PMID[20359898] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | EC50 | = | 3690.0 | nM | PMID[20809641] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | EC50 | = | 60400.0 | nM | PMID[20809641] |
| NPT963 | Organism | Hepatitis B virus | Hepatitis B virus | IC50 | > | 1000000.0 | nM | PMID[23369536] |
| NPT24 | Organism | Human immunodeficiency virus 1 | Human immunodeficiency virus 1 | EC50 | > | 250000.0 | nM | PMID[24177359] |
| NPT337 | Organism | Reovirus sp. | Reovirus sp. | EC50 | > | 100000.0 | nM | PMID[25082514] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | EC50 | = | 18900.0 | nM | PMID[26460883] |
| NPT2262 | Organism | Human herpesvirus 5 strain AD169 | Human herpesvirus 5 strain AD169 | EC50 | = | 1240.0 | nM | PMID[26114811] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | EC50 | = | 510.0 | nM | PMID[26114811] |
| NPT85 | Organism | Filobasidiella neoformans | Cryptococcus neoformans | Inhibition | = | -1.27 | % | DOI[10.6019/CHEMBL4296181] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Inhibition | = | 4.79 | % | DOI[10.6019/CHEMBL4296181] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | Inhibition | = | 9.14 | % | DOI[10.6019/CHEMBL4296181] |
| NPT2922 | Organism | Staphylococcus aureus subsp. aureus | Staphylococcus aureus subsp. aureus | Inhibition | = | -22.02 | % | DOI[10.6019/CHEMBL4296181] |
| NPT85 | Organism | Filobasidiella neoformans | Cryptococcus neoformans | MIC | > | 20000.0 | nM | DOI[10.6019/CHEMBL4296181] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 20000.0 | nM | DOI[10.6019/CHEMBL4296181] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | > | 20000.0 | nM | DOI[10.6019/CHEMBL4296181] |
| NPT2922 | Organism | Staphylococcus aureus subsp. aureus | Staphylococcus aureus subsp. aureus | MIC | > | 20000.0 | nM | DOI[10.6019/CHEMBL4296181] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | EC50 | = | 3600.0 | nM | PMID[34766503] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | EC50 | = | 200.0 | nM | PMID[36054994] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | ED50 | > | 500.0 | mg/kg.day | PMID[36054994] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | log(activity) | = | 2.42 | n.a. | PMID[35635945] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | log(activity) | = | 3.36 | n.a. | PMID[35635945] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | FC | = | 100.0 | n.a. | PMID[35969814] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | EC50 | = | 0.32 | ug.mL-1 | PMID[36054994] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | IC50 | = | 3500.0 | nM | PMID[32937282] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | EC50 | = | 0.41 | ug.mL-1 | PMID[36054994] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | EC50 | = | 160.0 | nM | PMID[35635945] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | ED50 | = | 0.5 | mg.kg-1 | PMID[36202389] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | Activity | n.a. | n.a. | n.a. | PMID[34425312] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | EC50 | = | 3000.0 | nM | PMID[32937282] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | EC | = | 1.5 | ug ml-1 | PMID[35969814] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | EC50 | = | 111100.0 | nM | PMID[34425312] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | EC50 | = | 800.0 | nM | PMID[35933787] |
| NPT28897 | Organism | Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | EC50 | = | 126000.0 | nM | PMID[35933787] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | ID50 | = | 100.0 | uM | PMID[2993615] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | ID50 | = | 38.4 | ug ml-1 | PMID[2157012] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | ID50 | = | 40.0 | uM | PMID[8387600] |
| NPT30043 | Cell line | Vero | Chlorocebus sabaeus | CC50 | > | 100000.0 | nM | PMID[34766503] |
| NPT30043 | Cell line | Vero | Chlorocebus sabaeus | CC50 | > | 100000.0 | nM | PMID[35635945] |
| NPT21798 | Cell line | ARPE-19 | Homo sapiens | CC50 | > | 100000.0 | nM | PMID[37140467] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 40.0 | % | PMID[2848125] |
| NPT1748 | Organism | African swine fever virus | African swine fever virus | ED50 | = | 40.0 | ug ml-1 | PMID[2213836] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | ED50 | > | 40.0 | ug ml-1 | PMID[2213836] |
| NPT27 | Others | Unspecified | n.a. | MIC | = | 0.07 | ug.mL-1 | PMID[8176708] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | MIC | > | 400.0 | ug.mL-1 | PMID[8176708] |
| NPT27 | Others | Unspecified | n.a. | IC50 | > | 100000.0 | nM | PMID[2840500] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | MIC | > | 400.0 | ug.mL-1 | PMID[8393114] |
| NPT27 | Others | Unspecified | n.a. | EC50 | = | 13600.0 | nM | PMID[10891113] |
| NPT27 | Others | Unspecified | n.a. | IC50 | > | 100000.0 | nM | PMID[2163453] |
| NPT27 | Others | Unspecified | n.a. | IC50 | > | 100000.0 | nM | PMID[2175356] |
| NPT19357 | Organism | Bovine herpesvirus 1 | Bovine herpesvirus 1 | MIC | = | 7.0 | ug.mL-1 | PMID[2455050] |
| NPT27 | Others | Unspecified | n.a. | MIC | = | 8.0 | ug.mL-1 | PMID[2455050] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 0.33 | n.a. | PMID[3035178] |
| NPT27 | Others | Unspecified | n.a. | IC50 | > | 100000.0 | nM | PMID[2163454] |
| NPT27 | Others | Unspecified | n.a. | EC50 | = | 0.077 | ug.mL-1 | PMID[12459010] |
| NPT27 | Others | Unspecified | n.a. | EC50 | = | 0.384 | ug.mL-1 | PMID[12459010] |
| NPT2 | Others | Unspecified | n.a. | EC50 | = | 0.384 | ug.mL-1 | PMID[12459010] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | EC50 | > | 400.0 | ug.mL-1 | PMID[12459010] |
| NPT27 | Others | Unspecified | n.a. | EC50 | = | 48.0 | ug.mL-1 | PMID[12459010] |
| NPT27 | Others | Unspecified | n.a. | IC50 | > | 100000.0 | nM | PMID[2846837] |
| NPT27 | Others | Unspecified | n.a. | Inhibition | > | 100.0 | % | PMID[2846837] |
| NPT27 | Others | Unspecified | n.a. | MIC | = | 0.2 | ug.mL-1 | PMID[2391680] |
| NPT27 | Others | Unspecified | n.a. | MIC | = | 0.1 | ug.mL-1 | PMID[2391680] |
| NPT27 | Others | Unspecified | n.a. | MIC | = | 0.02 | ug.mL-1 | PMID[2391680] |
| NPT27 | Others | Unspecified | n.a. | MIC | = | 0.07 | ug.mL-1 | PMID[2391680] |
| NPT27 | Others | Unspecified | n.a. | MIC | = | 150.0 | ug.mL-1 | PMID[2391680] |
| NPT27 | Others | Unspecified | n.a. | MIC | > | 400.0 | ug.mL-1 | PMID[2391680] |
| NPT27 | Others | Unspecified | n.a. | MIC | = | 20.0 | ug.mL-1 | PMID[2391680] |
| NPT27 | Others | Unspecified | n.a. | MIC | = | 10.0 | ug.mL-1 | PMID[2391680] |
| NPT27 | Others | Unspecified | n.a. | IC50 | > | 100000.0 | nM | PMID[2500527] |
| NPT27 | Others | Unspecified | n.a. | IC50 | = | 1700.0 | nM | PMID[8576922] |
| NPT27 | Others | Unspecified | n.a. | IC50 | = | 2600.0 | nM | PMID[2913300] |
| NPT27 | Others | Unspecified | n.a. | IC50 | > | 100000.0 | nM | PMID[2913300] |
| NPT19362 | Cell line | NC-37 | Homo sapiens | EC50 | = | 0.17 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80146-3] |
| NPT27 | Others | Unspecified | n.a. | IC50 | = | 0.02 | ug.mL-1 | PMID[8831773] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | MIC | > | 80.0 | ug.mL-1 | PMID[11708929] |
| NPT27 | Others | Unspecified | n.a. | IC50 | > | 100000.0 | nM | PMID[1310744] |
| NPT27 | Others | Unspecified | n.a. | MIC | = | 0.01 | ug.mL-1 | PMID[10691698] |
| NPT27 | Others | Unspecified | n.a. | MIC | = | 0.005 | ug.mL-1 | PMID[10691698] |
| NPT27 | Others | Unspecified | n.a. | MIC | = | 0.02 | ug.mL-1 | PMID[10691698] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | MIC50 | > | 400.0 | ug.mL-1 | PMID[16420056] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | EC50 | > | 500000.0 | nM | PMID[17181162] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | MIC | > | 500000.0 | nM | PMID[17286431] |
| NPT27 | Others | Unspecified | n.a. | IC50 | = | 57730.0 | nM | PMID[17341060] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | MIC | > | 500000.0 | nM | PMID[17092728] |
| NPT27 | Others | Unspecified | n.a. | IC50 | > | 100000.0 | nM | PMID[17402726] |
| NPT2 | Others | Unspecified | n.a. | IC50 | > | 100000.0 | nM | PMID[18052321] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | MIC | > | 400.0 | ug.mL-1 | PMID[17583388] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50/EC50 | > | 60.0 | n.a. | PMID[9214738] |
| NPT27 | Others | Unspecified | n.a. | IC50 | > | 67.0 | ug.mL-1 | PMID[9599250] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50/EC50 | > | 250.0 | n.a. | PMID[9599250] |
| NPT27 | Others | Unspecified | n.a. | IC50 | > | 10.0 | ug.mL-1 | PMID[9599250] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50/EC50 | > | 4.3 | n.a. | PMID[9599250] |
| NPT742 | Organism | Influenza A virus | Influenza A virus | IC50 | = | 15.7 | ug.mL-1 | PMID[16724853] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/IC50 | > | 2000.0 | n.a. | PMID[16724853] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | MIC50 | > | 250.0 | ug.mL-1 | PMID[19324473] |
| NPT4327 | Organism | Yellow fever virus | Yellow fever virus | EC50 | > | 100000.0 | nM | PMID[19482481] |
| NPT3878 | Organism | Mammalian orthoreovirus 1 | Mammalian orthoreovirus 1 | EC50 | > | 100000.0 | nM | PMID[19482481] |
| NPT6258 | Organism | Human coxsackievirus B2 | Human coxsackievirus B2 | EC50 | > | 100000.0 | nM | PMID[19482481] |
| NPT6258 | Organism | Human coxsackievirus B2 | Human coxsackievirus B2 | EC50 | > | 100000.0 | nM | PMID[20359898] |
| NPT4327 | Organism | Yellow fever virus | Yellow fever virus | EC50 | > | 100000.0 | nM | PMID[20359898] |
| NPT2 | Others | Unspecified | n.a. | IC50 | > | 20000.0 | nM | PMID[20403696] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/IC50 | = | 869.0 | n.a. | PMID[21376603] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | EC50 | > | 250000.0 | nM | PMID[22459876] |
| NPT24742 | Organism | Human herpesvirus 3 strain Oka vaccine | Human herpesvirus 3 strain Oka vaccine | EC50 | = | 2500.0 | nM | PMID[22578783] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | EC50 | > | 250000.0 | nM | PMID[23099097] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | MIC | > | 500.0 | ug.mL-1 | DOI[10.1007/s00044-012-0127-6] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | EC50 | > | 250000.0 | nM | PMID[32214762] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | EC50 | > | 250000.0 | nM | PMID[23811093] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | EC50 | > | 250000.0 | nM | PMID[23911856] |
| NPT24742 | Organism | Human herpesvirus 3 strain Oka vaccine | Human herpesvirus 3 strain Oka vaccine | EC50 | = | 2600.0 | nM | PMID[24690527] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | ED50 | = | 1411.0 | umol/L | PMID[25515560] |
| NPT4327 | Organism | Yellow fever virus | Yellow fever virus | EC50 | > | 100000.0 | nM | PMID[25082514] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | EC50 | > | 100000.0 | nM | PMID[25082514] |
| NPT24742 | Organism | Human herpesvirus 3 strain Oka vaccine | Human herpesvirus 3 strain Oka vaccine | EC50 | = | 1820.0 | nM | PMID[26443550] |
| NPT4327 | Organism | Yellow fever virus | Yellow fever virus | EC50 | > | 100000.0 | nM | PMID[26443549] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | EC50 | > | 100000.0 | nM | PMID[26443549] |
| NPT24742 | Organism | Human herpesvirus 3 strain Oka vaccine | Human herpesvirus 3 strain Oka vaccine | EC50 | = | 800.0 | nM | PMID[27750154] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | EC50 | > | 250000.0 | nM | PMID[26114811] |
| NPT24742 | Organism | Human herpesvirus 3 strain Oka vaccine | Human herpesvirus 3 strain Oka vaccine | EC50 | = | 1690.0 | nM | PMID[26114811] |
| NPT24742 | Organism | Human herpesvirus 3 strain Oka vaccine | Human herpesvirus 3 strain Oka vaccine | EC50 | = | 1880.0 | nM | PMID[28829913] |
| NPT24742 | Organism | Human herpesvirus 3 strain Oka vaccine | Human herpesvirus 3 strain Oka vaccine | EC50 | = | 3020.0 | nM | PMID[28682067] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/IC50 | > | 1333.0 | n.a. | PMID[29099182] |
| NPT24742 | Organism | Human herpesvirus 3 strain Oka vaccine | Human herpesvirus 3 strain Oka vaccine | EC50 | = | 2350.0 | nM | PMID[29945100] |
| NPT24742 | Organism | Human herpesvirus 3 strain Oka vaccine | Human herpesvirus 3 strain Oka vaccine | EC50 | = | 2930.0 | nM | PMID[29407990] |
| NPT24742 | Organism | Human herpesvirus 3 strain Oka vaccine | Human herpesvirus 3 strain Oka vaccine | EC50 | = | 3370.0 | nM | PMID[29550734] |
| NPT24742 | Organism | Human herpesvirus 3 strain Oka vaccine | Human herpesvirus 3 strain Oka vaccine | EC50 | = | 5310.0 | nM | PMID[29268134] |
| NPT24742 | Organism | Human herpesvirus 3 strain Oka vaccine | Human herpesvirus 3 strain Oka vaccine | EC50 | = | 2840.0 | nM | PMID[29670705] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/IC50 | > | 1500.0 | n.a. | PMID[30194008] |
| NPT24742 | Organism | Human herpesvirus 3 strain Oka vaccine | Human herpesvirus 3 strain Oka vaccine | EC50 | = | 1260.0 | nM | PMID[30098481] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/IC50 | > | 1449.0 | n.a. | PMID[30798081] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/IC50 | > | 619.0 | n.a. | PMID[30798081] |
| NPT27 | Others | Unspecified | n.a. | Ratio CC50/IC50 | = | 80.0 | n.a. | PMID[30844608] |
| NPT27 | Others | Unspecified | n.a. | Ratio CC50/IC50 | = | 85.0 | n.a. | PMID[30844608] |
| NPT27 | Others | Unspecified | n.a. | Ratio CC50/IC50 | = | 93.0 | n.a. | PMID[30844608] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | Inhibition | = | 6.13 | % | DOI[10.6019/CHEMBL4296181] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | > | 20000.0 | nM | DOI[10.6019/CHEMBL4296181] |
| NPT2 | Others | Unspecified | n.a. | EC50 | = | 990.0 | nM | PMID[27933957] |
| NPT30145 | Organism | Human alphaherpesvirus 2 | Human alphaherpesvirus 2 | EC50 | = | 4600.0 | nM | PMID[34766503] |
| NPT29320 | Cell line | BHK-21 | Mesocricetus auratus | CC100 | n.a. | n.a. | n.a. | PMID[35969814] |
| NPT30145 | Organism | Human alphaherpesvirus 2 | Human alphaherpesvirus 2 | ED50 | = | 0.5 | mg.kg-1 | PMID[36202389] |
| NPT30145 | Organism | Human alphaherpesvirus 2 | Human alphaherpesvirus 2 | IC50 | = | 12000.0 | nM | PMID[36054994] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | Activity | n.a. | n.a. | n.a. | PMID[34425312] |
| NPT30145 | Organism | Human alphaherpesvirus 2 | Human alphaherpesvirus 2 | EC50 | = | 0.39 | ug.mL-1 | PMID[36054994] |
| NPT28359 | Organism | dengue virus type 2 | dengue virus type 2 | EC | n.a. | n.a. | n.a. | PMID[35969814] |
| NPT20632 | Organism | Chikungunya virus | Chikungunya virus | FC | n.a. | n.a. | n.a. | PMID[35969814] |
| NPT20632 | Organism | Chikungunya virus | Chikungunya virus | EC | n.a. | n.a. | n.a. | PMID[35969814] |
| NPT30145 | Organism | Human alphaherpesvirus 2 | Human alphaherpesvirus 2 | log(activity) | = | 2.9 | n.a. | PMID[35635945] |
| NPT30145 | Organism | Human alphaherpesvirus 2 | Human alphaherpesvirus 2 | EC50 | = | 400.0 | nM | PMID[35933787] |
| NPT30145 | Organism | Human alphaherpesvirus 2 | Human alphaherpesvirus 2 | EC50 | = | 0.18 | ug.mL-1 | PMID[36054994] |
| NPT30145 | Organism | Human alphaherpesvirus 2 | Human alphaherpesvirus 2 | log(activity) | = | 1.79 | n.a. | PMID[35635945] |
| NPT30145 | Organism | Human alphaherpesvirus 2 | Human alphaherpesvirus 2 | EC50 | = | 1440.0 | nM | PMID[35635945] |
| NPT27 | Others | Unspecified | n.a. | ID50 | = | 360.0 | uM | PMID[2828623] |
| NPT195 | Organism | Vesicular stomatitis virus | Vesicular stomatitis virus | ID50 | > | 400.0 | ug ml-1 | PMID[6092636] |
| NPT27 | Others | Unspecified | n.a. | ID50 | = | 12.0 | ug ml-1 | PMID[6092636] |
| NPT27 | Others | Unspecified | n.a. | ID50 | = | 13.0 | ug ml-1 | PMID[6092636] |
| NPT27 | Others | Unspecified | n.a. | ID50 | = | 2.0 | uM | PMID[8387600] |
| NPT27 | Others | Unspecified | n.a. | ID50 | = | 0.9 | uM | PMID[8387600] |
| NPT19361 | Organism | Cercopithecine herpesvirus 9 | Cercopithecine herpesvirus 9 | ID50 | = | 100.0 | uM | PMID[8387600] |
| NPT19362 | Cell line | NC-37 | Homo sapiens | CC50 | > | 100.0 | ug.mL-1 | DOI[10.1016/S0960-894X(01)80146-3] |
| NPT27 | Others | Unspecified | n.a. | CC50 | > | 100000.0 | nM | PMID[15634003] |
| NPT27 | Others | Unspecified | n.a. | CC50 | > | 10000.0 | nM | PMID[15615545] |
| NPT27 | Others | Unspecified | n.a. | CC50 | > | 100000.0 | nM | PMID[19397271] |
| NPT27 | Others | Unspecified | n.a. | CC50 | > | 100000.0 | nM | PMID[19482481] |
| NPT27 | Others | Unspecified | n.a. | CC50 | > | 100000.0 | nM | PMID[20359898] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | > | 150.0 | n.a. | PMID[19770274] |
| NPT27 | Others | Unspecified | n.a. | CC50 | > | 1778000.0 | nM | PMID[21256035] |
| NPT27 | Others | Unspecified | n.a. | CC50 | > | 100000.0 | nM | PMID[21696963] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | = | 61.9 | n.a. | PMID[22921079] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | = | 81.3 | n.a. | PMID[22921079] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | = | 72.2 | n.a. | PMID[22921079] |
| NPT27 | Others | Unspecified | n.a. | Ratio CC50/EC50 | > | 1176.0 | n.a. | PMID[22954898] |
| NPT27 | Others | Unspecified | n.a. | Ratio CC50/EC50 | > | 3.8 | n.a. | PMID[22954898] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | > | 106.95 | n.a. | PMID[22704890] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | > | 166.67 | n.a. | PMID[22704890] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | = | 850.0 | n.a. | DOI[10.1007/s00044-011-9574-8] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | = | 880.0 | n.a. | DOI[10.1007/s00044-007-9035-6] |
| NPT27 | Others | Unspecified | n.a. | CC50 | = | 630000.0 | nM | PMID[23369536] |
| NPT27 | Others | Unspecified | n.a. | CC50 | > | 100000.0 | nM | PMID[25014745] |
| NPT27 | Others | Unspecified | n.a. | CC50 | > | 100000.0 | nM | PMID[25082514] |
| NPT27 | Others | Unspecified | n.a. | CC50 | > | 100000.0 | nM | PMID[25913116] |
| NPT27 | Others | Unspecified | n.a. | CC50 | > | 100000.0 | nM | PMID[26048809] |
| NPT27 | Others | Unspecified | n.a. | CC50 | > | 1000000.0 | nM | PMID[26048809] |
| NPT27 | Others | Unspecified | n.a. | CC50 | = | 13000.0 | nM | PMID[26119992] |
| NPT27 | Others | Unspecified | n.a. | CC50 | > | 100000.0 | nM | PMID[26460883] |
| NPT27 | Others | Unspecified | n.a. | CC50 | > | 100000.0 | nM | PMID[26443549] |
| NPT27 | Others | Unspecified | n.a. | CC50 | > | 100000.0 | nM | PMID[27161176] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | > | 150.0 | n.a. | PMID[29407990] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | > | 8.0 | n.a. | PMID[29407990] |
| NPT2 | Others | Unspecified | n.a. | CC50 | > | 440000.0 | nM | PMID[30098481] |
| NPT2 | Others | Unspecified | n.a. | CC50 | > | 1000.0 | ug.mL-1 | PMID[30844608] |
| NPT2 | Others | Unspecified | n.a. | CC50 | > | 440000.0 | nM | PMID[31586832] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | = | 916.0 | n.a. | PMID[32089391] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | = | 86.0 | n.a. | PMID[32089391] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | = | 19.0 | n.a. | PMID[33479570] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | = | 265.0 | n.a. | PMID[33479570] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | > | 300.0 | n.a. | PMID[27933957] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | > | 36.0 | n.a. | PMID[34124679] |
In vivo activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT32 | Organism | Mus musculus | Mus musculus | Survival | = | 75.0 | % | PMID[2544723] |
| NPT32 | Organism | Mus musculus | Mus musculus | Survival | = | 70.0 | % | PMID[2544723] |
| NPT32 | Organism | Mus musculus | Mus musculus | Survival | = | 50.0 | % | PMID[2544723] |
| NPT32 | Organism | Mus musculus | Mus musculus | Survival | = | 2.0 | % | PMID[2544723] |
| NPT32 | Organism | Mus musculus | Mus musculus | Survival | = | 78.0 | % | PMID[2544723] |
| NPT32 | Organism | Mus musculus | Mus musculus | Survival | = | 86.0 | % | PMID[1648622] |
| NPT32 | Organism | Mus musculus | Mus musculus | Survival | = | 70.0 | % | PMID[1648622] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 17.2 | n.a. | PMID[2391680] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 40.8 | n.a. | PMID[2391680] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 10.0 | n.a. | PMID[15916444] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 7.0 | n.a. | PMID[15916444] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 13.0 | n.a. | PMID[15916444] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 6.0 | n.a. | PMID[15916444] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 17.2 | n.a. | PMID[15916444] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 1.0 | n.a. | PMID[15916444] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 0.0 | n.a. | PMID[15916444] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 14.2 | n.a. | PMID[15916444] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 3.0 | n.a. | PMID[15916444] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 11.0 | n.a. | PMID[15916444] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 2.0 | n.a. | PMID[15916444] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 15.0 | n.a. | PMID[15916444] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 31.2 | % | PMID[23369536] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 18.7 | % | PMID[23369536] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 15.1 | % | PMID[23369536] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 1.2 | % | PMID[23369536] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | ID50 | = | 165.0 | ug ml-1 | PMID[2329551] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | EC50 | = | 10210.0 | nM | PMID[14584954] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | EC50 | = | 1100.0 | nM | PMID[14584954] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | EC50 | = | 1680.0 | nM | PMID[14584954] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[2500527] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | > | 440000.0 | nM | PMID[8394933] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | EC50 | = | 40.0 | nM | PMID[8394933] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | EC50 | = | 90.0 | nM | PMID[8394933] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | EC50 | = | 7100.0 | nM | PMID[8394933] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Activity | = | 0.23 | % | PMID[20022146] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Ratio | = | 0.19 | n.a. | PMID[20038622] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Ratio | = | 0.2 | n.a. | PMID[20038622] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| Macaca mulatta | n.a. | T1/2 | = | 1.3 | hr | PMID[36202389] |
| Rattus norvegicus | n.a. | T1/2 | = | 1.0 | hr | PMID[36202389] |
| Homo sapiens | n.a. | F | = | 54.0 | % | PMID[36202389] |
| Canis lupus familiaris | n.a. | F | = | 83.0 | % | PMID[36202389] |
| Rattus norvegicus | n.a. | F | = | 65.0 | % | PMID[36202389] |
| Homo sapiens | n.a. | T1/2 | = | 2.7 | hr | PMID[36202389] |
| Macaca mulatta | n.a. | F | = | 63.0 | % | PMID[36202389] |
Experimental Toxicity
Quantitative toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|---|---|---|---|---|---|
| - | Human herpesvirus 1 | Therapeutic index | > | 38.0 | n.a. | PMID[2838633] |
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
Categorical toxicity labels
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
Chemically structural similarity
Similar Active Natural Products in NPASS
Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
● The left chart: Distribution of similarity level between NPC35410 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).
Similar Clinical/Approved Drugs
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
● The left chart: Distribution of similarity level between NPC35410 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| 1.0 | High Similarity | NPD9374 | Phase 4 |
| 0.7308 | Intermediate Similarity | NPD9607 | Phase 4 |
| 0.661 | Remote Similarity | NPD1121 | Phase 4 |
| 0.65 | Remote Similarity | NPD1120 | Approved |
| 0.6182 | Remote Similarity | NPD9373 | Approved |
| 0.5909 | Remote Similarity | NPD1431 | Phase 4 |
| 0.5821 | Remote Similarity | NPD1430 | Approved |
| 0.5345 | Remote Similarity | NPD307 | Phase 4 |
| 0.5333 | Remote Similarity | NPD9409 | Discontinued |
| 0.5323 | Remote Similarity | NPD252 | Clinical (unspecified phase) |
| 0.5082 | Remote Similarity | NPD515 | Phase 2 |
| 0.5082 | Remote Similarity | NPD545 | Clinical (unspecified phase) |
| 0.5082 | Remote Similarity | NPD547 | Phase 2 |
| 0.5077 | Remote Similarity | NPD194 | Clinical (unspecified phase) |
Bioactivity similarity
Bioactivity similarity
Similar Natural Products in NPASS
Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
A: chemistry similarity
B: biological targets similarity
C: networks similarity
D: cell-based bioactivity similarity
E: similarity based on clinical data
