Drug Information| Drug ID:   | NPD515 |
| Drug Name:   | Cyclopropavir |
| Molecular Formula:   | C11H13N5O3 |
| Canonical SMILES:   | OCC1(CO)C/C/1=C/n1cnc2c1[nH]c(=N)nc2O |
| Standard InCHI:   | "InChI=1S/C11H13N5O3/c12-10-14-8-7(9(19)15-10)13-5-16(8)2-6-1-11(6,3-17)4-18/h2,5,17-18H,1,3-4H2,(H3,12,14,15,19)/b6-2-" |
| Standard InCHIKey:   | KMUNHOKTIVSFRA-KXFIGUGUSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD515Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5156 | NPC61198 |
| Remote Similarity | 0.5156 | NPC105915 |
| Remote Similarity | 0.5082 | NPC35410 |
| Remote Similarity | 0.5082 | NPC327579 |
| Remote Similarity | 0.5077 | NPC262926 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 263.1 |
| ALogP   | -1.7326 |
| MLogP   | 1.79 |
| XLogP   | -1.24 |
| HDA   | 8 |
| HBD   | 5 |
| Rotatable Bonds   | 6 |
| TPSA   | 126.75 |
| RO5 Violation   | 0 |