Drug Information| Drug ID:   | NPD1121 |
| Drug Name:   | Valacyclovir |
| Molecular Formula:   | C13H20N6O4 |
| Canonical SMILES:   | CC([C@@H](C(=O)OCCOCn1cnc2c1[nH]c(=N)nc2O)N)C |
| Standard InCHI:   | "InChI=1S/C13H20N6O4/c1-7(2)8(14)12(21)23-4-3-22-6-19-5-16-9-10(19)17-13(15)18-11(9)20/h5,7-8H,3-4,6,14H2,1-2H3,(H3,15,17,18,20)/t8-/m0/s1" |
| Standard InCHIKey:   | HDOVUKNUBWVHOX-QMMMGPOBSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD1121Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 324.15 |
| ALogP   | -1.2234 |
| MLogP   | 1.79 |
| XLogP   | -0.204 |
| HDA   | 10 |
| HBD   | 4 |
| Rotatable Bonds   | 12 |
| TPSA   | 147.84 |
| RO5 Violation   | 0 |