NPASS drugs

Drug Information

Drug ID:	NPD252
Drug Name:
Molecular Formula:	C10H13N5O5
Canonical SMILES:	OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1[nH]c(=N)nc2O
Standard InCHI:	"InChI=1S/C10H13N5O5/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,19)/t3-,5-,6-,9-/m1/s1"
Standard InCHIKey:	NYHBQMYGNKIUIF-UUOKFMHZSA-N
Max Developmental Stage:	Clinical (unspecified phase)
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD252

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	152368
0.1-0.2	58347
0.2-0.3	807
0.3-0.4	162
0.4-0.5	29
0.5-0.6	14
0.6-0.7	9
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC61198
High Similarity	1.0	NPC105915
Intermediate Similarity	0.7119	NPC262926
Intermediate Similarity	0.7031	NPC211820
Remote Similarity	0.6719	NPC11920
Remote Similarity	0.6667	NPC319221
Remote Similarity	0.6618	NPC14590
Remote Similarity	0.6522	NPC177169
Remote Similarity	0.625	NPC64705
Remote Similarity	0.6081	NPC484201
Remote Similarity	0.6081	NPC484198
Remote Similarity	0.6029	NPC11271
Remote Similarity	0.6	NPC187707
Remote Similarity	0.5833	NPC327579
Remote Similarity	0.5775	NPC89147
Remote Similarity	0.5775	NPC297033
Remote Similarity	0.5775	NPC274384
Remote Similarity	0.5775	NPC28366
Remote Similarity	0.5526	NPC232408
Remote Similarity	0.5493	NPC186619
Remote Similarity	0.5484	NPC567521
Remote Similarity	0.5422	NPC103057
Remote Similarity	0.5385	NPC487897
Remote Similarity	0.5323	NPC35410
Remote Similarity	0.5132	NPC318590
Remote Similarity	0.5075	NPC324009
Remote Similarity	0.5075	NPC594325

Drug Structure

NPD252 OpenBabel08201723122D 26 28 0 0 1 0 0 0 0 0999 V2000 5.5237 0.0909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0685 -2.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8546 -0.6522 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0625 -1.6303 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.1965 -2.1303 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4533 -1.4612 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.0739 -2.4781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.4752 -1.6691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.5019 -0.1170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9761 -2.0371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0920 -3.1249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8601 -0.5477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 2.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1710 0.6262 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7851 -1.4493 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1784 -3.5316 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 16 1 0 0 0 0 2 12 2 0 0 0 0 2 15 1 0 0 0 0 3 1 1 6 0 0 0 3 5 1 0 0 0 0 3 20 1 0 0 0 0 4 7 2 0 0 0 0 4 8 1 0 0 0 0 4 12 1 0 0 0 0 5 6 1 0 0 0 0 5 17 1 1 0 0 0 6 9 1 0 0 0 0 6 18 1 1 0 0 0 7 13 1 0 0 0 0 7 15 1 0 0 0 0 8 14 2 0 0 0 0 8 19 1 0 0 0 0 9 15 1 6 0 0 0 9 20 1 0 0 0 0 10 11 2 0 0 0 0 10 13 1 0 0 0 0 10 14 1 0 0 0 0 11 21 1 0 0 0 0 13 22 1 0 0 0 0 16 23 1 0 0 0 0 17 24 1 0 0 0 0 18 25 1 0 0 0 0 19 26 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNC002557
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	6802
ChEBI
CAS Number

Drug Properties

Molecular Weight	283.09
ALogP	-2.2152
MLogP	1.46
XLogP	-1.643
HDA	10
HBD	6
Rotatable Bonds	6
TPSA	156.21
RO5 Violation	1