Drug Information| Drug ID:   | NPD1431 |
| Drug Name:   | Valganciclovir |
| Molecular Formula:   | C14H22N6O5 |
| Canonical SMILES:   | OCC(OCn1cnc2c1[nH]c(=N)nc2O)COC(=O)[C@H](C(C)C)N |
| Standard InCHI:   | "InChI=1S/C14H22N6O5/c1-7(2)9(15)13(23)24-4-8(3-21)25-6-20-5-17-10-11(20)18-14(16)19-12(10)22/h5,7-9,21H,3-4,6,15H2,1-2H3,(H3,16,18,19,22)/t8?,9-/m0/s1" |
| Standard InCHIKey:   | WPVFJKSGQUFQAP-GKAPJAKFSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD1431Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 354.17 |
| ALogP   | -1.7341 |
| MLogP   | 1.79 |
| XLogP   | -0.876 |
| HDA   | 11 |
| HBD   | 5 |
| Rotatable Bonds   | 14 |
| TPSA   | 168.07 |
| RO5 Violation   | 1 |