Drug Information| Drug ID:   | NPD9409 |
| Drug Name:   | GS-438 |
| Molecular Formula:   | C8H12N5O5P |
| Canonical SMILES:   | N=c1nc(O)c2c([nH]1)n(CCOCP(=O)(O)O)cn2 |
| Standard InCHI:   | "InChI=1S/C8H12N5O5P/c9-8-11-6-5(7(14)12-8)10-3-13(6)1-2-18-4-19(15,16)17/h3H,1-2,4H2,(H2,15,16,17)(H3,9,11,12,14)" |
| Standard InCHIKey:   | NZVORGQIEFTOQZ-UHFFFAOYSA-N |
| Max Developmental Stage:   | Discontinued |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD9409Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 289.06 |
| ALogP   | -1.31 |
| MLogP   | 1.13 |
| XLogP   | -2.334 |
| HDA   | 10 |
| HBD   | 5 |
| Rotatable Bonds   | 8 |
| TPSA   | 162.86 |
| RO5 Violation   | 0 |