NPASS Compound

Natural Product: NPC105859

Natural Product ID	NPC105859
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	BGBWTEGJEXNBFH-RJRTVKOJSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	102271938
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 186195 0 0 0 0 0 0 0 0999 V2000 9.0481 14.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5481 14.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1386 14.8454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9895 13.8812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2500 12.4040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6595 11.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8086 12.8552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9095 10.5920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6595 9.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2500 8.7799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7500 8.7799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2500 8.7799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 7.4809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2500 6.1818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 7.4809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9895 7.3027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1386 6.3385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5481 6.8515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8086 8.3287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5586 9.6278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0481 6.8515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8886 5.0395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1386 3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3886 2.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7981 1.9284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0586 0.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9095 -0.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2395 1.4772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 -2.5981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1595 1.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4895 2.7762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7500 -3.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -5.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7500 -6.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5000 -7.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2500 -6.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0000 -7.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2500 -9.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7500 -9.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3405 -9.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0105 -10.5705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2709 -12.0477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -7.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -7.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -6.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -5.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -5.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -3.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -3.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9895 -10.5705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1386 -11.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9895 -12.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2500 -13.9761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6595 -14.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8086 -13.5249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5481 -12.0477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8086 -15.4533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9895 -15.4533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5800 -13.0119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3195 -14.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9100 -13.9761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7609 -14.9402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0214 -16.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4309 -16.9305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5800 -17.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5800 -15.9663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7609 -17.8947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6486 -15.4533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7609 -13.0119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1595 -1.8121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8086 -0.8479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2981 1.9284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7500 12.4040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2395 15.1803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8886 16.1445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5481 14.3324 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0481 15.8324 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0481 12.8324 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8086 15.8096 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9895 15.8096 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5280 13.5439 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8553 11.1130 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9176 11.0741 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6785 9.9546 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8553 10.0709 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7500 10.2799 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7500 7.2799 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 7.4809 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 5.9809 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 8.9809 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8806 5.5216 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8086 5.3743 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2181 7.8157 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0586 9.6278 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7981 5.5525 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7578 4.3265 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8724 3.4290 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2395 3.4056 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0312 2.6907 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5202 0.7885 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0586 -1.4772 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2395 -1.4772 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6491 0.9642 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9183 -0.4882 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6715 2.7970 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1595 1.8121 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5691 2.3251 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8222 3.2736 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8406 0.4756 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2291 4.2535 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9240 3.2148 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0084 2.6978 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9888 -0.1828 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0861 -1.2173 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4095 -2.0850 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9215 -1.1001 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0982 -4.5546 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8991 -2.9329 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5000 -5.1962 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9134 -9.2361 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7053 -9.0664 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9991 -7.7420 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6595 -5.9822 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3547 -4.9989 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1491 -8.7584 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1491 -6.8300 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7116 -9.4307 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9309 -10.1193 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6778 -11.0679 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5016 -8.3628 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5760 -11.0091 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5068 -10.6752 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8526 -12.5359 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0972 -8.9922 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0905 -8.3073 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2137 -9.2666 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6683 -6.0070 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2730 -7.5922 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -5.1962 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5377 -6.5965 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7044 -3.8718 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4134 -1.1562 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4991 -2.6503 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7947 -1.3259 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1595 -4.4101 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0363 -5.3695 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9183 -2.1098 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6491 -3.5623 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0413 -10.3367 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7174 -11.7041 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7946 -14.3390 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0735 -15.8699 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2181 -13.0119 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7114 -14.7228 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2702 -15.1159 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0125 -16.5503 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7749 -14.8520 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4960 -12.5953 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1418 -13.7423 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4674 -16.6003 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8449 -18.3112 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7291 -18.8588 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7631 -19.1527 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5442 -16.7456 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6425 -19.1082 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0872 -16.8877 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7007 -13.3493 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9095 -3.1111 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3086 -0.8479 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2009 0.7304 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8472 13.6020 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7395 15.1803 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1386 17.4435 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 0 13 15 1 0 10 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 18 21 1 0 17 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 28 30 1 0 30 31 1 0 31 32 2 0 33 31 1 1 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 36 38 1 0 36 39 1 0 39 40 2 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 1 45 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 1 50 52 1 0 52 53 1 0 50 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 1 57 59 1 0 59 60 1 6 59 61 1 0 61 62 1 0 49 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 67 70 1 0 66 71 1 0 65 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 77 79 1 0 76 80 1 0 75 81 1 0 74 82 1 0 27 83 1 0 26 84 1 0 25 85 1 0 5 86 1 0 4 87 1 0 3 88 1 0 7 2 1 0 19 9 1 0 29 24 1 0 62 33 1 0 69 64 1 0 79 73 1 0 40 33 1 0 59 41 1 0 57 44 1 0 54 45 1 0 1 89 1 0 1 90 1 0 1 91 1 0 2 92 1 1 3 93 1 6 4 94 1 1 5 95 1 1 6 96 1 6 9 97 1 6 10 98 1 1 11 99 1 0 11100 1 0 15101 1 0 15102 1 0 15103 1 0 17104 1 1 18105 1 6 19106 1 1 20107 1 0 21108 1 0 23109 1 0 23110 1 0 24111 1 1 25112 1 6 26113 1 1 27114 1 6 28115 1 1 34116 1 0 34117 1 0 35118 1 0 35119 1 0 37120 1 0 37121 1 0 37122 1 0 38123 1 0 38124 1 0 38125 1 0 39126 1 0 41127 1 1 42128 1 0 42129 1 0 43130 1 0 43131 1 0 44132 1 6 46133 1 0 46134 1 0 46135 1 0 47136 1 0 47137 1 0 48138 1 0 48139 1 0 49140 1 6 51141 1 0 51142 1 0 51143 1 0 52144 1 0 52145 1 0 53146 1 0 54147 1 6 55148 1 0 55149 1 0 56150 1 0 56151 1 0 58152 1 0 58153 1 0 58154 1 0 60155 1 0 60156 1 0 60157 1 0 61158 1 0 61159 1 0 62160 1 0 62161 1 0 64162 1 6 65163 1 1 66164 1 6 67165 1 6 68166 1 0 68167 1 0 70168 1 0 71169 1 0 73170 1 6 74171 1 1 75172 1 1 76173 1 6 77174 1 1 78175 1 0 78176 1 0 78177 1 0 80178 1 0 81179 1 0 82180 1 0 83181 1 0 84182 1 0 85183 1 0 86184 1 0 87185 1 0 88186 1 0 M END

Standard InCHIKey	BGBWTEGJEXNBFH-RJRTVKOJSA-N
Standard InCHI	InChI=1S/C61H98O27/c1-25-36(65)40(69)44(73)51(81-25)86-48-32(23-78-27(3)63)84-50(47(76)43(48)72)80-22-31-39(68)42(71)46(75)53(83-31)88-55(77)61-18-16-56(4,5)20-29(61)28-10-11-34-57(6)14-13-35(58(7,24-62)33(57)12-15-60(34,9)59(28,8)17-19-61)85-54-49(38(67)30(64)21-79-54)87-52-45(74)41(70)37(66)26(2)82-52/h20,25-26,28,30-54,62,64-76H,10-19,21-24H2,1-9H3/t25-,26-,28+,30-,31+,32+,33+,34+,35-,36-,37-,38-,39+,40+,41+,42-,43+,44+,45+,46+,47+,48+,49+,50+,51-,52-,53-,54-,57-,58-,59+,60+,61-/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@@H](COC(=O)C)O[C@H]([C@@H]([C@H]1O)O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC(=O)[C@@]12CCC(C)(C)C=C2[C@H]2CC[C@@H]3[C@@]4(C)CC[C@@H]([C@@](C)(CO)[C@@H]4CC[C@@]3(C)[C@]2(C)CC1)O[C@H]1[C@@H]([C@H]([C@H](CO1)O)O)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](C)O1)O)O)O)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1262.63	Volume:	1207.474 ? Van der Waals volume.
Dense:	1.046	LogP:	0.809 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.569 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.804 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	58.0
TPSA:	418.89 ? Topological Polar Surface Area.	H-Bond Acceptor:	27.0
H-Bond Donor:	14.0	Rings:	10.0
Heavy Atoms:	27.0

MedChem Properties

QED Drug-Likeness Score:	0.051	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.392	Fsp³:	0.934
MCE-18:	218.254 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.914	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.005 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.298	Promiscuous compounds:	0.311

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.601	MDCK Permeability:	-5.034
Pgp-inhibitor:	0.0	Pgp-substrate:	0.921
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.242
20% Bioavailability (F20%):	0.748	30% Bioavailability (F30%):	0.981
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	0.006
Plasma Protein Binding (PPB):	57.98%	Volume Distribution (VD):	-0.347
Fu:	20.405% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.997	BCRP inhibitor:	0.002
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.032	CYP3A4-substrate:	0.152
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.929
HLM stability:	0.008 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.7

Half-life (T1/2):

3.916

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.016
Human Hepatotoxicity (H-HT):	0.374	Drug-induced Liver Injury (DILI):	0.858
AMES Toxicity:	0.9	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.003	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.394	Drug-induced Nephrotoxicity:	0.998
Genotoxicity:	0.016	RPMI-8226 Immunitoxicity:	0.397
A549 Cytotoxicity:	0.566	Hek293 Cytotoxicity:	0.109
BCF:	0.829 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.781 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.783 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.767 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO22109	Streptomyces clavuligerus	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	PMID[18450406]
NPO22109	Streptomyces clavuligerus	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	PMID[19941870]
NPO22554	Eunicea laciniata	Species	Plexauridae	Eukaryota	n.a.	Caribbean	n.a.	PMID[7769391]
NPO22554	Eunicea laciniata	Species	Plexauridae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO22494	Thalictrum rugosum	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO21909	Alkanna tinctoria	Species	Boraginaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO22109	Streptomyces clavuligerus	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	Database[COCONUT]
NPO22494	Thalictrum rugosum	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO22494	Thalictrum rugosum	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO21909	Alkanna tinctoria	Species	Boraginaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO22494	Thalictrum rugosum	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO5093	Centaurea hermannii	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO22750	Resseliella theobaldi	Species	Cecidomyiidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO22494	Thalictrum rugosum	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO22554	Eunicea laciniata	Species	Plexauridae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO20517	Seseli elatum	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO22367	Strychnos hirsuta	Species	Loganiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO231	Phanera vahlii	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO21909	Alkanna tinctoria	Species	Boraginaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO27908	Bathynella natans	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[UNPD]
NPO22109	Streptomyces clavuligerus	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC105859 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21388
0.1-0.2	24481
0.2-0.3	2883
0.3-0.4	942
0.4-0.5	136
0.5-0.6	25
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.6167	Remote Similarity	NPC76972
0.6167	Remote Similarity	NPC469782
0.6167	Remote Similarity	NPC204414
0.6016	Remote Similarity	NPC309907
0.568	Remote Similarity	NPC165204
0.5649	Remote Similarity	NPC202828
0.5649	Remote Similarity	NPC119592
0.5645	Remote Similarity	NPC60557
0.5645	Remote Similarity	NPC67857
0.5606	Remote Similarity	NPC298034
0.5606	Remote Similarity	NPC71065
0.5512	Remote Similarity	NPC135904
0.5391	Remote Similarity	NPC155410
0.5323	Remote Similarity	NPC241909
0.5271	Remote Similarity	NPC475209
0.5231	Remote Similarity	NPC100639
0.5224	Remote Similarity	NPC65105
0.5197	Remote Similarity	NPC114287
0.5188	Remote Similarity	NPC110633
0.5185	Remote Similarity	NPC236638
0.5185	Remote Similarity	NPC294453
0.5185	Remote Similarity	NPC305981
0.5182	Remote Similarity	NPC220160
0.5147	Remote Similarity	NPC261506
0.5147	Remote Similarity	NPC4328
0.5116	Remote Similarity	NPC192600
0.5111	Remote Similarity	NPC293330
0.5037	Remote Similarity	NPC41061
0.5037	Remote Similarity	NPC227551

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC105859 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7151
0.1-0.2	1950
0.2-0.3	45
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data