NPASS Compound

Natural Product: NPC65619

Natural Product ID	NPC65619
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	NSBBZPLOZQNGDH-IDABPYBGSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	102165751
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 168175 0 0 0 0 0 0 0 0999 V2000 -4.7603 5.1105 4.5932 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1769 4.1662 3.5245 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2868 3.4897 2.8361 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6208 2.5123 1.7363 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9366 2.9985 0.5188 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1191 2.0448 -0.7065 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3612 2.8370 -1.7733 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4490 0.7076 -0.4741 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6694 -0.0458 -1.7727 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3057 -0.4787 -2.2989 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4581 -0.4934 -1.1094 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6017 -1.8531 -0.5215 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9981 0.6456 -0.2650 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.4432 0.4592 1.1021 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0802 0.4363 1.0179 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6369 -0.4376 -0.0373 C 0 0 2 0 0 0 0 0 0 0 0 0 2.1419 -0.4955 -0.0094 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7647 0.8677 0.1263 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5323 -1.2890 1.2139 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3864 -2.4785 0.9931 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5461 -2.2281 0.0260 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0776 -1.6017 -1.2288 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9632 -0.5113 -1.6759 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1706 -2.7006 -2.3161 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5976 -1.2746 -1.1898 C 0 0 2 0 0 0 0 0 0 0 0 0 2.0990 -0.8340 -2.5157 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5880 -0.9502 -2.5041 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0094 -0.1498 -1.3725 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1365 1.2967 -1.8049 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4025 -1.4277 0.7735 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5479 -2.0635 1.1755 C 0 0 1 0 0 0 0 0 0 0 0 0 7.8298 -1.3410 1.1596 C 0 0 1 0 0 0 0 0 0 0 0 0 8.9263 -2.4120 1.2998 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7369 -3.0316 2.6675 C 0 0 1 0 0 0 0 0 0 0 0 0 7.3010 -3.4937 2.7381 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9940 -4.1158 4.0939 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1151 -3.1859 5.1133 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3848 -2.4607 2.5582 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5555 -4.1397 2.7439 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1831 -1.9493 1.0562 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1685 -0.5692 0.0853 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4827 0.7436 0.4185 C 0 0 1 0 0 0 0 0 0 0 0 0 9.8955 1.1498 0.1730 C 0 0 1 0 0 0 0 0 0 0 0 0 10.2634 1.0027 -1.2874 C 0 0 2 0 0 0 0 0 0 0 0 0 9.1075 1.4279 -2.1628 C 0 0 1 0 0 0 0 0 0 0 0 0 8.0725 2.1983 -1.3723 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9571 2.5147 -2.3778 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5365 3.1633 -3.4950 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6302 1.5880 -0.2448 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5980 2.2710 -3.1532 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5739 -0.3276 -1.6007 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9871 2.5289 0.4711 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6558 1.5177 1.9977 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4074 1.9261 -0.8320 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3714 1.3644 -1.4489 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3475 0.6743 -0.4763 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.7355 0.8623 -1.0450 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.0540 2.3356 -0.8638 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.9849 3.0767 -1.6825 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4220 4.2302 -0.9179 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6570 5.0664 -1.7287 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1243 2.2410 -2.2919 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3304 2.5511 -1.3716 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6878 0.0194 -0.5565 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1179 -0.6987 -0.4777 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8007 -1.2397 0.7401 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8933 -2.1747 1.2698 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.0580 -3.3672 0.3896 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8385 -3.6074 -0.4381 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5716 -3.1441 0.1930 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1688 -4.1614 1.2614 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5950 -1.8968 0.7545 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9699 -3.0571 -1.7341 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2912 -4.5078 1.1665 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4997 -2.5950 2.5461 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6183 3.9877 3.2434 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9823 4.6744 5.2534 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6019 5.5400 5.1377 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2473 5.9636 4.0626 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2212 3.6598 3.0899 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3204 1.5183 2.0943 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7228 2.5607 1.5334 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9274 3.3774 0.5928 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5190 3.9101 0.1660 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4768 3.2726 -1.3134 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2097 2.3302 -2.7113 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0425 3.7134 -1.9983 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0254 0.2499 0.3792 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3479 -0.8672 -1.5863 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1450 0.5962 -2.5640 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4825 -1.5081 -2.7322 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9767 0.1272 -3.1491 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8632 -2.5623 -0.9707 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5816 -2.3437 -0.8255 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5589 -1.9840 0.5418 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5819 1.5987 -0.6385 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8501 -0.3911 1.6839 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4209 1.4939 0.9585 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3988 0.0791 2.0210 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3422 -1.4930 0.2243 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4132 1.3070 1.0831 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6518 1.5251 -0.7279 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8544 0.7329 0.2666 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5799 -1.6578 1.7015 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0793 -0.6615 1.9583 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7851 -2.8713 1.9499 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7631 -3.2849 0.5720 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0261 -3.2178 -0.1121 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6182 -0.7913 -2.5591 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4461 0.4023 -2.0311 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6925 -0.1788 -0.9119 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3695 -2.2197 -3.3054 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2506 -3.2754 -2.3850 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9948 -3.4062 -2.0891 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1179 -2.2999 -1.0492 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4281 -1.6230 -3.2561 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4779 0.1003 -2.9102 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3304 -1.9978 -2.5185 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2309 -0.4949 -3.4507 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3368 2.0056 -1.0059 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0074 1.4331 -2.5202 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7309 1.5936 -2.4695 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6263 -3.0560 0.6878 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8976 -0.7692 2.1266 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6269 -3.1950 0.5538 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8881 -2.2821 3.4481 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0770 -4.2355 1.9255 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7685 -4.8918 4.2793 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0031 -4.5825 4.0464 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2528 -2.6738 5.1959 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5738 -4.5951 1.8721 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6492 -2.4682 0.3516 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3257 0.9106 1.5310 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6503 0.6912 0.8397 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1513 1.6056 -1.5543 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6122 0.5774 -2.6771 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5040 3.1995 -1.1253 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2184 3.2104 -1.9620 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5689 1.5723 -2.7625 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2801 4.1210 -3.5153 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5032 2.6422 -2.9177 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4535 -0.4173 -2.0475 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6072 2.7529 1.3405 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0801 2.2864 1.8406 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1942 0.5256 -2.2069 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2397 1.0614 0.5346 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6401 0.6577 -2.1516 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9224 2.6471 0.1804 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5860 3.5595 -2.5224 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8458 3.9642 -0.0416 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3074 4.8149 -0.5317 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7054 4.6870 -2.6606 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9670 2.0998 -0.7896 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4297 -0.0443 -1.2114 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7524 -0.4150 1.5078 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8398 -1.6312 1.3790 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9101 -3.2362 -0.3182 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7697 -4.7131 -0.6241 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7661 -3.2360 -0.5874 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5712 -3.6828 2.0695 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0261 -4.7191 1.6685 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4966 -4.9546 0.8252 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7915 -3.4893 -2.1161 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2175 -4.5113 1.5392 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8928 -3.4769 2.7642 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8783 2.9125 3.1781 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9384 4.4802 2.2930 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2621 4.4380 4.0297 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 1 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 1 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 6 21 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 35 38 1 0 34 39 1 0 33 40 1 0 32 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 45 50 1 0 44 51 1 0 43 52 1 0 14 53 1 0 6 54 1 6 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 59 62 1 0 58 63 1 0 57 64 1 0 56 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 70 72 1 0 69 73 1 0 68 74 1 0 67 75 1 0 2 76 1 0 13 8 1 0 28 16 1 0 38 31 1 0 49 42 1 0 62 55 1 0 72 66 1 0 28 11 1 0 25 17 1 0 1 77 1 0 1 78 1 0 1 79 1 0 3 80 1 0 4 81 1 0 4 82 1 0 5 83 1 0 5 84 1 0 7 85 1 0 7 86 1 0 7 87 1 0 8 88 1 1 9 89 1 0 9 90 1 0 10 91 1 0 10 92 1 0 12 93 1 0 12 94 1 0 12 95 1 0 13 96 1 6 14 97 1 1 15 98 1 0 15 99 1 0 16100 1 1 18101 1 0 18102 1 0 18103 1 0 19104 1 0 19105 1 0 20106 1 0 20107 1 0 21108 1 6 23109 1 0 23110 1 0 23111 1 0 24112 1 0 24113 1 0 24114 1 0 25115 1 1 26116 1 0 26117 1 0 27118 1 0 27119 1 0 29120 1 0 29121 1 0 29122 1 0 31123 1 6 32124 1 1 33125 1 6 34126 1 1 35127 1 6 36128 1 0 36129 1 0 37130 1 0 39131 1 0 40132 1 0 42133 1 1 43134 1 1 44135 1 6 45136 1 6 46137 1 1 47138 1 0 47139 1 0 48140 1 0 50141 1 0 51142 1 0 52143 1 0 53144 1 0 55145 1 6 56146 1 1 57147 1 6 58148 1 1 59149 1 6 60150 1 0 60151 1 0 61152 1 0 63153 1 0 64154 1 0 66155 1 1 67156 1 1 68157 1 6 69158 1 6 70159 1 6 71160 1 0 71161 1 0 71162 1 0 73163 1 0 74164 1 0 75165 1 0 76166 1 0 76167 1 0 76168 1 0 M END

Standard InCHIKey	NSBBZPLOZQNGDH-IDABPYBGSA-N
Standard InCHI	InChI=1S/C54H92O22/c1-23(2)11-10-15-54(9,76-49-45(41(66)37(62)29(22-57)72-49)75-46-42(67)38(63)34(59)24(3)69-46)25-12-17-53(8)33(25)26(58)19-31-51(6)16-14-32(50(4,5)30(51)13-18-52(31,53)7)73-48-44(40(65)36(61)28(21-56)71-48)74-47-43(68)39(64)35(60)27(20-55)70-47/h11,24-49,55-68H,10,12-22H2,1-9H3/t24-,25-,26+,27+,28+,29+,30-,31+,32-,33-,34-,35+,36+,37+,38+,39-,40-,41-,42+,43+,44+,45+,46-,47-,48-,49-,51-,52+,53+,54-/m0/s1
SMILES	CC(=CCC[C@@](C)([C@H]1CC[C@]2(C)[C@@H]1[C@@H](C[C@@H]1[C@@]3(C)CC[C@@H](C(C)(C)[C@@H]3CC[C@@]21C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](C)O1)O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1092.61	Volume:	1064.837 ? Van der Waals volume.
Dense:	1.026	LogP:	1.202 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.198 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.379 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	45.0
TPSA:	357.06 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	14.0	Rings:	8.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.068	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.854	Fsp³:	0.963
MCE-18:	178.075 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.777	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.377	Promiscuous compounds:	0.204

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.688	MDCK Permeability:	-4.909
Pgp-inhibitor:	0.0	Pgp-substrate:	0.652
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.972
20% Bioavailability (F20%):	0.308	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.131
Plasma Protein Binding (PPB):	65.09%	Volume Distribution (VD):	-0.389
Fu:	20.78% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.053	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.005	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.335
HLM stability:	0.005 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.343

Half-life (T1/2):

3.446

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.005
Human Hepatotoxicity (H-HT):	0.657	Drug-induced Liver Injury (DILI):	0.712
AMES Toxicity:	0.967	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.009	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.713	Drug-induced Nephrotoxicity:	0.996
Genotoxicity:	0.019	RPMI-8226 Immunitoxicity:	0.281
A549 Cytotoxicity:	0.917	Hek293 Cytotoxicity:	0.266
BCF:	1.38 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.472 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.725 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.893 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	Stems	n.a.	n.a.	PMID[20104880]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22342101]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	aerial parts	n.a.	n.a.	PMID[25895106]
NPO16506	Synotis alata	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO4305	Pertusaria wulfenii	Species	Pertusariaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO918	Dahlia pinnata	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO11990	Coleostephus myconis	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO11990	Coleostephus myconis	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO918	Dahlia pinnata	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO11990	Coleostephus myconis	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO918	Dahlia pinnata	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO11990	Coleostephus myconis	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO4305	Pertusaria wulfenii	Species	Pertusariaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO11990	Coleostephus myconis	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO918	Dahlia pinnata	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO16506	Synotis alata	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC65619 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23532
0.1-0.2	22091
0.2-0.3	2977
0.3-0.4	939
0.4-0.5	241
0.5-0.6	42
0.6-0.7	17
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9	High Similarity	NPC208477
0.8182	Intermediate Similarity	NPC208650
0.8	Intermediate Similarity	NPC220427
0.7778	Intermediate Similarity	NPC31907
0.7742	Intermediate Similarity	NPC14946
0.7742	Intermediate Similarity	NPC63368
0.7614	Intermediate Similarity	NPC269627
0.7586	Intermediate Similarity	NPC181467
0.7553	Intermediate Similarity	NPC159005
0.75	Intermediate Similarity	NPC135369
0.72	Intermediate Similarity	NPC241381
0.7191	Intermediate Similarity	NPC69737
0.7059	Intermediate Similarity	NPC488292
0.7059	Intermediate Similarity	NPC146868
0.7053	Intermediate Similarity	NPC65167
0.7045	Intermediate Similarity	NPC312553
0.7045	Intermediate Similarity	NPC8039
0.7045	Intermediate Similarity	NPC120123
0.6842	Remote Similarity	NPC208594
0.6827	Remote Similarity	NPC488294
0.6818	Remote Similarity	NPC159036
0.6606	Remote Similarity	NPC488291
0.66	Remote Similarity	NPC246124
0.6517	Remote Similarity	NPC157659
0.6421	Remote Similarity	NPC127801
0.6413	Remote Similarity	NPC472987
0.6395	Remote Similarity	NPC66654
0.6374	Remote Similarity	NPC472897
0.6374	Remote Similarity	NPC472896
0.6263	Remote Similarity	NPC472988
0.6263	Remote Similarity	NPC38217
0.6228	Remote Similarity	NPC488293
0.6082	Remote Similarity	NPC194842
0.6061	Remote Similarity	NPC234160
0.6058	Remote Similarity	NPC472718
0.5955	Remote Similarity	NPC234287
0.5955	Remote Similarity	NPC88000
0.5955	Remote Similarity	NPC4831
0.5955	Remote Similarity	NPC472023
0.5895	Remote Similarity	NPC16573
0.5895	Remote Similarity	NPC165033
0.5895	Remote Similarity	NPC273879
0.5825	Remote Similarity	NPC160816
0.5794	Remote Similarity	NPC472716
0.5758	Remote Similarity	NPC472715
0.573	Remote Similarity	NPC280825
0.573	Remote Similarity	NPC473198
0.5638	Remote Similarity	NPC114874
0.5612	Remote Similarity	NPC139271
0.5591	Remote Similarity	NPC160734
0.5579	Remote Similarity	NPC611039
0.5556	Remote Similarity	NPC180183
0.5556	Remote Similarity	NPC488574
0.5521	Remote Similarity	NPC252253
0.55	Remote Similarity	NPC307167
0.5464	Remote Similarity	NPC45959
0.5446	Remote Similarity	NPC276758
0.5413	Remote Similarity	NPC6931
0.54	Remote Similarity	NPC488575
0.5385	Remote Similarity	NPC76486
0.5368	Remote Similarity	NPC309425
0.5326	Remote Similarity	NPC91497
0.53	Remote Similarity	NPC488576
0.5294	Remote Similarity	NPC152584
0.5243	Remote Similarity	NPC16520
0.5243	Remote Similarity	NPC211879
0.5243	Remote Similarity	NPC189852
0.5243	Remote Similarity	NPC155010
0.5243	Remote Similarity	NPC601606
0.5238	Remote Similarity	NPC25605
0.52	Remote Similarity	NPC229801
0.5146	Remote Similarity	NPC236753
0.5146	Remote Similarity	NPC304011
0.513	Remote Similarity	NPC146652
0.5096	Remote Similarity	NPC488577
0.5049	Remote Similarity	NPC288694
0.5047	Remote Similarity	NPC14630

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC65619 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7818
0.1-0.2	1277
0.2-0.3	48
0.3-0.4	6
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data