NPASS Compound

Natural Product: NPC591475

Natural Product ID	NPC591475
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(3~{S},5~{S},8~{R},9~{S},10~{S},13~{R},14~{S},17~{R})-3-[(2~{R},4~{S},5~{S},6~{S})-5-[(2~{S},3~{R},4~{R},5~{R},6~{S})-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2~{S},3~{R},4~{S},5~{R},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]oxy-4-methoxy-6-methyl-tetrahydropyran-2-yl]oxy-5,14-dihydroxy-13-methyl-17-(5-oxo-2~{H}-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1~{H}-cyclopenta[a]phenanthrene-10-carbaldehyde
IUPAC Name	(3~{S},5~{S},8~{R},9~{S},10~{S},13~{R},14~{S},17~{R})-3-[(2~{R},4~{S},5~{S},6~{S})-5-[(2~{S},3~{R},4~{R},5~{R},6~{S})-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2~{S},3~{R},4~{S},5~{R},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]oxy-4-methoxy-6-methyl-tetrahydropyran-2-yl]oxy-5,14-dihydroxy-13-methyl-17-(5-oxo-2~{H}-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1~{H}-cyclopenta[a]phenanthrene-10-carbaldehyde
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 125132 0 0 0 0 0 0 0 0999 V2000 -2.3505 1.0765 -2.4691 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3447 1.4642 -1.1398 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8649 0.5468 -0.2539 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6445 1.0352 0.5090 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0235 -0.2523 1.0146 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0130 -0.6655 0.1582 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3067 -0.7038 0.6399 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9238 -2.0477 0.6154 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3787 -1.9390 0.9761 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1187 -1.0834 -0.0541 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9127 -1.8281 -1.3539 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3823 -1.3542 -2.3184 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5873 -1.0787 0.2210 C 0 0 1 0 0 0 0 0 0 0 0 0 7.2735 -2.2299 -0.5103 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7334 -2.2153 -0.1538 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4309 -0.9426 -0.5699 C 0 0 2 0 0 0 0 0 0 0 0 0 9.5006 -0.9211 -2.0555 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7999 -0.8920 0.0867 C 0 0 1 0 0 0 0 0 0 0 0 0 11.5380 0.3639 -0.2674 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7766 1.3809 0.5562 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5277 2.4313 -0.1204 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9182 3.5428 0.3740 O 0 0 0 0 0 0 0 0 0 0 0 0 12.7429 2.0068 -1.4013 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1210 0.7583 -1.5673 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3842 -0.8219 1.5535 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0974 -0.0159 1.5426 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7480 0.2040 0.0853 C 0 0 1 0 0 0 0 0 0 0 0 0 9.1931 1.4355 -0.3660 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2412 0.1872 -0.1652 C 0 0 2 0 0 0 0 0 0 0 0 0 6.6465 1.3456 0.6048 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1971 1.1754 0.8883 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5368 0.2678 -0.1614 C 0 0 1 0 0 0 0 0 0 0 0 0 4.9665 0.8070 -1.3979 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0684 0.3945 -0.0055 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9095 -1.2042 1.3197 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0707 -0.6551 1.8470 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8875 0.1325 3.1066 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8710 0.1319 0.8159 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8587 -0.6221 0.2419 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1174 -0.0951 0.2254 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9237 -0.7469 1.1739 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1551 -0.1075 1.3501 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0169 1.2404 2.0419 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4435 1.0990 3.2999 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9274 0.0116 0.0799 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.1878 -0.5195 0.0994 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1577 0.3369 -0.3916 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.0633 0.6315 0.6245 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.2931 1.0267 0.0826 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.1071 1.6743 1.1625 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.4691 2.8108 1.6807 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.0503 -0.1708 -0.4496 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.5963 -0.8657 0.6022 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.0844 -1.0449 -1.2333 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.7598 -2.2120 -0.5598 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8371 -0.2679 -1.5996 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.0299 0.6767 -2.5770 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1608 -0.7032 -1.0661 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9819 -2.0338 -0.8040 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7653 -0.0485 -1.1220 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8815 1.2308 -1.6585 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2938 0.8596 -2.7431 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6139 1.9644 -3.1185 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0449 0.2704 -2.7185 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5627 -0.3683 -0.7946 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9110 1.7119 1.3368 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0137 1.5485 -0.2219 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5071 0.0196 1.9705 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2195 -0.4010 1.7308 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8473 -2.5653 -0.3652 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4601 -2.6825 1.4309 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4579 -1.5357 2.0003 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8169 -2.9710 0.9979 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2692 -2.8426 -1.3939 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6876 -1.3105 1.3166 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8292 -3.2031 -0.1953 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1603 -2.1131 -1.5951 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7729 -2.3183 0.9487 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2648 -3.1094 -0.5567 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5008 -1.1933 -2.4594 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8260 -1.7028 -2.5241 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1801 0.0202 -2.5372 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4266 -1.7586 -0.1396 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4887 1.5046 1.5967 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8582 0.0206 -1.9421 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3283 0.9601 -2.3557 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2926 -1.8099 2.0307 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1711 -0.3038 2.1686 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2082 0.9660 2.0898 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3704 -0.5849 2.1136 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8107 1.6635 -1.2290 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1417 0.3602 -1.2497 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1836 1.3998 1.5692 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8229 2.3066 0.0796 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6944 2.1783 0.7911 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9762 0.8285 1.9064 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5642 1.6851 -1.5565 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8611 1.3990 0.4876 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6587 0.5706 -1.0521 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7845 -1.5068 2.1307 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4396 1.1206 3.0473 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8463 0.3107 3.4089 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3921 -0.3697 3.9939 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1903 1.0741 1.2829 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0506 0.9573 0.6272 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7189 -0.7615 2.0498 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0851 1.5578 2.2416 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5843 2.0225 1.4213 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8464 1.9033 3.4326 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8932 1.0884 -0.2706 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6689 1.2811 -0.7151 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1135 1.7822 -0.7274 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1679 0.9571 2.0205 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.1527 1.8770 0.8479 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9049 3.1515 0.9402 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.8716 0.2000 -1.0940 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0227 -0.9798 1.3903 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5921 -1.3276 -2.1742 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1525 -2.0414 0.2068 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1160 -1.0369 -2.0077 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7993 0.5158 -3.1674 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6632 -0.4612 -2.0170 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9917 -2.5352 -1.6577 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1908 -0.6963 -1.8310 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2558 1.3158 -2.4128 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 6 11 12 2 0 10 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 6 16 18 1 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 2 0 21 23 1 0 23 24 1 0 18 25 1 0 25 26 1 0 26 27 1 0 27 28 1 6 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 6 32 34 1 0 5 35 1 0 35 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 49 52 1 0 52 53 1 0 52 54 1 0 54 55 1 0 54 56 1 0 56 57 1 0 45 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 38 3 1 0 60 40 1 0 34 7 1 0 56 47 1 0 32 10 1 0 29 13 1 0 27 16 1 0 24 19 1 0 1 62 1 0 1 63 1 0 1 64 1 0 3 65 1 6 4 66 1 0 4 67 1 0 5 68 1 1 7 69 1 1 8 70 1 0 8 71 1 0 9 72 1 0 9 73 1 0 11 74 1 0 13 75 1 1 14 76 1 0 14 77 1 0 15 78 1 0 15 79 1 0 17 80 1 0 17 81 1 0 17 82 1 0 18 83 1 1 20 84 1 0 24 85 1 0 24 86 1 0 25 87 1 0 25 88 1 0 26 89 1 0 26 90 1 0 28 91 1 0 29 92 1 6 30 93 1 0 30 94 1 0 31 95 1 0 31 96 1 0 33 97 1 0 34 98 1 0 34 99 1 0 36100 1 1 37101 1 0 37102 1 0 37103 1 0 38104 1 1 40105 1 1 42106 1 1 43107 1 0 43108 1 0 44109 1 0 45110 1 6 47111 1 6 49112 1 6 50113 1 0 50114 1 0 51115 1 0 52116 1 6 53117 1 0 54118 1 6 55119 1 0 56120 1 6 57121 1 0 58122 1 6 59123 1 0 60124 1 6 61125 1 0 M END

Standard InCHIKey	CTNPHHZPAJYPFO-RODZRPJJSA-N
Standard InCHI	InChI=1S/C42H64O19/c1-19-35(60-38-34(51)32(49)36(27(16-44)59-38)61-37-33(50)31(48)30(47)26(15-43)58-37)25(54-3)13-29(56-19)57-21-4-9-40(18-45)23-5-8-39(2)22(20-12-28(46)55-17-20)7-11-42(39,53)24(23)6-10-41(40,52)14-21/h12,18-19,21-27,29-38,43-44,47-53H,4-11,13-17H2,1-3H3/t19-,21-,22+,23-,24+,25-,26+,27-,29-,30-,31-,32+,33+,34+,35-,36-,37-,38-,39+,40-,41-,42-/m0/s1
SMILES	CO[C@H]1C[C@H](O[C@H]2CC[C@]3(C=O)[C@H]4CC[C@]5(C)[C@@H](C6=CC(=O)OC6)CC[C@]5(O)[C@@H]4CC[C@]3(O)C2)O[C@@H](C)[C@@H]1O[C@@H]1O[C@@H](CO)[C@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	872.4	Volume:	825.641 ? Van der Waals volume.
Dense:	1.057	LogP:	-1.45 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	-0.44 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-1.404 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	45.0
TPSA:	290.05 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	9.0	Rings:	8.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.062	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.262	Fsp³:	0.905
MCE-18:	158.2 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.695	Fluc inhibitor:	0.004 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.002 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.208	Promiscuous compounds:	0.28

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.636	MDCK Permeability:	-5.261
Pgp-inhibitor:	0.0	Pgp-substrate:	0.999
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.961
20% Bioavailability (F20%):	0.897	30% Bioavailability (F30%):	0.992
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.396
Plasma Protein Binding (PPB):	44.858%	Volume Distribution (VD):	-0.529
Fu:	55.628% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.001
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.035	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.995	CYP3A4-substrate:	0.006
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.186
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.528

Half-life (T1/2):

3.008

ADMET: Toxicity

hERG Blockers:	0.023	hERG Blockers (10um):	0.114
Human Hepatotoxicity (H-HT):	0.916	Drug-induced Liver Injury (DILI):	0.967
AMES Toxicity:	0.998	Rat Oral Acute Toxicity:	0.943
Maximum Recommended Daily Dose:	0.994	Skin Sensitization:	1.0
Carcinogencity:	0.936	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.836
Drug-induced Neurotoxicity:	0.002	Ototoxicity:	0.989
Hematotoxicity:	0.894	Drug-induced Nephrotoxicity:	0.996
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.943
A549 Cytotoxicity:	0.998	Hek293 Cytotoxicity:	0.998
BCF:	0.562 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.238 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.713 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.835 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO11771	Strophanthus kombe	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO11771	Strophanthus kombe	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO11771	Strophanthus kombe	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO11771	Strophanthus kombe	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO11771	Strophanthus kombe	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC591475 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	17325
0.1-0.2	28153
0.2-0.3	3683
0.3-0.4	499
0.4-0.5	69
0.5-0.6	70
0.6-0.7	37
0.7-0.8	0
0.8-0.85	0
0.85-0.9	2
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9213	High Similarity	NPC146857
0.8737	High Similarity	NPC329675
0.8542	High Similarity	NPC194716
0.7957	Intermediate Similarity	NPC32793
0.7957	Intermediate Similarity	NPC116075
0.7449	Intermediate Similarity	NPC329986
0.7449	Intermediate Similarity	NPC140092
0.7273	Intermediate Similarity	NPC247190
0.7157	Intermediate Similarity	NPC329636
0.7143	Intermediate Similarity	NPC475629
0.7041	Intermediate Similarity	NPC475556
0.7041	Intermediate Similarity	NPC311706
0.7	Intermediate Similarity	NPC469749
0.69	Remote Similarity	NPC59288
0.6809	Remote Similarity	NPC17896
0.6809	Remote Similarity	NPC469755
0.6809	Remote Similarity	NPC284406
0.6809	Remote Similarity	NPC197707
0.6809	Remote Similarity	NPC251866
0.6702	Remote Similarity	NPC84987
0.67	Remote Similarity	NPC608063
0.6698	Remote Similarity	NPC475419
0.6667	Remote Similarity	NPC180079
0.6606	Remote Similarity	NPC474423
0.6505	Remote Similarity	NPC232785
0.6505	Remote Similarity	NPC486139
0.6408	Remote Similarity	NPC125077
0.6389	Remote Similarity	NPC120390
0.6389	Remote Similarity	NPC74259
0.6373	Remote Similarity	NPC188234
0.6354	Remote Similarity	NPC219085
0.625	Remote Similarity	NPC486143
0.625	Remote Similarity	NPC486135
0.625	Remote Similarity	NPC486142
0.625	Remote Similarity	NPC486137
0.625	Remote Similarity	NPC486149
0.6226	Remote Similarity	NPC486138
0.6226	Remote Similarity	NPC276838
0.6182	Remote Similarity	NPC474908
0.6154	Remote Similarity	NPC264336
0.6126	Remote Similarity	NPC329784
0.6122	Remote Similarity	NPC6108
0.6122	Remote Similarity	NPC89514
0.6117	Remote Similarity	NPC236973
0.6117	Remote Similarity	NPC32177
0.6117	Remote Similarity	NPC469756
0.6117	Remote Similarity	NPC275901
0.6061	Remote Similarity	NPC10823
0.6061	Remote Similarity	NPC480914
0.6	Remote Similarity	NPC486127
0.5981	Remote Similarity	NPC486146
0.596	Remote Similarity	NPC157376
0.596	Remote Similarity	NPC142066
0.596	Remote Similarity	NPC603972
0.5918	Remote Similarity	NPC99728
0.5918	Remote Similarity	NPC87250
0.5918	Remote Similarity	NPC244402
0.5918	Remote Similarity	NPC50305
0.5909	Remote Similarity	NPC486144
0.5909	Remote Similarity	NPC486145
0.5909	Remote Similarity	NPC486147
0.5909	Remote Similarity	NPC486136
0.5909	Remote Similarity	NPC486148
0.5905	Remote Similarity	NPC486130
0.5841	Remote Similarity	NPC486150
0.58	Remote Similarity	NPC5311
0.58	Remote Similarity	NPC77299
0.58	Remote Similarity	NPC34390
0.58	Remote Similarity	NPC480906
0.5784	Remote Similarity	NPC9499
0.5784	Remote Similarity	NPC471360
0.5784	Remote Similarity	NPC469751
0.5784	Remote Similarity	NPC471361
0.5784	Remote Similarity	NPC86159
0.5784	Remote Similarity	NPC469752
0.5784	Remote Similarity	NPC469754
0.5784	Remote Similarity	NPC70542
0.5766	Remote Similarity	NPC475590
0.5676	Remote Similarity	NPC486128
0.5614	Remote Similarity	NPC117445
0.5614	Remote Similarity	NPC308262
0.5614	Remote Similarity	NPC486134
0.5614	Remote Similarity	NPC486141
0.5586	Remote Similarity	NPC486132
0.5586	Remote Similarity	NPC486131
0.5556	Remote Similarity	NPC610296
0.5524	Remote Similarity	NPC480907
0.55	Remote Similarity	NPC158344
0.55	Remote Similarity	NPC474418
0.5463	Remote Similarity	NPC480910
0.5463	Remote Similarity	NPC240070
0.5463	Remote Similarity	NPC480909
0.5437	Remote Similarity	NPC243196
0.5421	Remote Similarity	NPC30483
0.5421	Remote Similarity	NPC470897
0.5385	Remote Similarity	NPC146456
0.537	Remote Similarity	NPC292467
0.5364	Remote Similarity	NPC208193
0.5345	Remote Similarity	NPC486140
0.534	Remote Similarity	NPC469750
0.5299	Remote Similarity	NPC486133
0.5288	Remote Similarity	NPC76572
0.5288	Remote Similarity	NPC193382
0.5273	Remote Similarity	NPC231518
0.5273	Remote Similarity	NPC488944
0.5243	Remote Similarity	NPC309034
0.5238	Remote Similarity	NPC77319
0.5238	Remote Similarity	NPC484212
0.5238	Remote Similarity	NPC471351
0.5238	Remote Similarity	NPC471355
0.5189	Remote Similarity	NPC471359
0.5189	Remote Similarity	NPC483822
0.5146	Remote Similarity	NPC99620
0.514	Remote Similarity	NPC469753
0.514	Remote Similarity	NPC471354
0.514	Remote Similarity	NPC27507
0.513	Remote Similarity	NPC488943
0.513	Remote Similarity	NPC488942
0.5082	Remote Similarity	NPC486152
0.5043	Remote Similarity	NPC475219

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC591475 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6415
0.1-0.2	2637
0.2-0.3	81
0.3-0.4	4
0.4-0.5	11
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6809	Remote Similarity	NPD7319	Approved
0.5273	Remote Similarity	NPD8033	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data